...
\n * ```\n *\n * ### Using an inline function\n * The `transition` animation method also supports reading an inline function which can decide\n * if its associated animation should be run.\n *\n * ```typescript\n * // this method is run each time the `myAnimationTrigger` trigger value changes.\n * function myInlineMatcherFn(fromState: string, toState: string, element: any, params: {[key:\n string]: any}): boolean {\n * // notice that `element` and `params` are also available here\n * return toState == 'yes-please-animate';\n * }\n *\n * @Component({\n * selector: 'my-component',\n * templateUrl: 'my-component-tpl.html',\n * animations: [\n * trigger('myAnimationTrigger', [\n * transition(myInlineMatcherFn, [\n * // the animation sequence code\n * ]),\n * ])\n * ]\n * })\n * class MyComponent {\n * myStatusExp = \"yes-please-animate\";\n * }\n * ```\n *\n * ### Disabling Animations\n * When true, the special animation control binding `@.disabled` binding prevents\n * all animations from rendering.\n * Place the `@.disabled` binding on an element to disable\n * animations on the element itself, as well as any inner animation triggers\n * within the element.\n *\n * The following example shows how to use this feature:\n *\n * ```typescript\n * @Component({\n * selector: 'my-component',\n * template: `\n * \n *\n * Be careful about entering end leaving elements as their transitions present a common\n * pitfall for developers.\n *\n * Note that when an element with a trigger enters the DOM its `:enter` transition always\n * gets executed, but its `:leave` transition will not be executed if the element is removed\n * alongside its parent (as it will be removed \"without warning\" before its transition has\n * a chance to be executed, the only way that such transition can occur is if the element\n * is exiting the DOM on its own).\n *\n *\n *
\n *\n * ### Animating to a Final State\n *\n * If the final step in a transition is a call to `animate()` that uses a timing value\n * with no `style` data, that step is automatically considered the final animation arc,\n * for the element to reach the final state, in such case Angular automatically adds or removes\n * CSS styles to ensure that the element is in the correct final state.\n *\n *\n * ### Usage Examples\n *\n * - Transition animations applied based on\n * the trigger's expression value\n *\n * ```html\n * \n *\n * Note that elements will be successfully queried via `:enter`/`:leave` even if their\n * insertion/removal is not done manually via `ViewContainerRef`or caused by their structural\n * directive (e.g. they enter/exit alongside their parent).\n *\n *
\n *\n * \n *\n * There is an exception to what previously mentioned, besides elements entering/leaving based on\n * their own logic, elements with an animation trigger can always be queried via `:leave` when\n * their parent is also leaving.\n *\n *
\n *\n * ### Usage Example\n *\n * The following example queries for inner elements and animates them\n * individually using `animate()`.\n *\n * ```typescript\n * @Component({\n * selector: 'inner',\n * template: `\n * `\n // and attach a portal programmatically in the parent component. When Angular does the first CD\n // round, it will fire the setter with empty string, causing the user's content to be cleared.\n if (this.hasAttached() && !portal && !this._isInitialized) {\n return;\n }\n if (this.hasAttached()) {\n super.detach();\n }\n if (portal) {\n super.attach(portal);\n }\n this._attachedPortal = portal || null;\n }\n /** Component or view reference that is attached to the portal. */\n get attachedRef() {\n return this._attachedRef;\n }\n ngOnInit() {\n this._isInitialized = true;\n }\n ngOnDestroy() {\n super.dispose();\n this._attachedRef = this._attachedPortal = null;\n }\n /**\n * Attach the given ComponentPortal to this PortalOutlet using the ComponentFactoryResolver.\n *\n * @param portal Portal to be attached to the portal outlet.\n * @returns Reference to the created component.\n */\n attachComponentPortal(portal) {\n portal.setAttachedHost(this);\n // If the portal specifies an origin, use that as the logical location of the component\n // in the application tree. Otherwise use the location of this PortalOutlet.\n const viewContainerRef = portal.viewContainerRef != null ? portal.viewContainerRef : this._viewContainerRef;\n const resolver = portal.componentFactoryResolver || this._componentFactoryResolver;\n const componentFactory = resolver.resolveComponentFactory(portal.component);\n const ref = viewContainerRef.createComponent(componentFactory, viewContainerRef.length, portal.injector || viewContainerRef.injector, portal.projectableNodes || undefined);\n // If we're using a view container that's different from the injected one (e.g. when the portal\n // specifies its own) we need to move the component into the outlet, otherwise it'll be rendered\n // inside of the alternate view container.\n if (viewContainerRef !== this._viewContainerRef) {\n this._getRootNode().appendChild(ref.hostView.rootNodes[0]);\n }\n super.setDisposeFn(() => ref.destroy());\n this._attachedPortal = portal;\n this._attachedRef = ref;\n this.attached.emit(ref);\n return ref;\n }\n /**\n * Attach the given TemplatePortal to this PortalHost as an embedded View.\n * @param portal Portal to be attached.\n * @returns Reference to the created embedded view.\n */\n attachTemplatePortal(portal) {\n portal.setAttachedHost(this);\n const viewRef = this._viewContainerRef.createEmbeddedView(portal.templateRef, portal.context, {\n injector: portal.injector,\n });\n super.setDisposeFn(() => this._viewContainerRef.clear());\n this._attachedPortal = portal;\n this._attachedRef = viewRef;\n this.attached.emit(viewRef);\n return viewRef;\n }\n /** Gets the root node of the portal outlet. */\n _getRootNode() {\n const nativeElement = this._viewContainerRef.element.nativeElement;\n // The directive could be set on a template which will result in a comment\n // node being the root. Use the comment's parent node if that is the case.\n return (nativeElement.nodeType === nativeElement.ELEMENT_NODE\n ? nativeElement\n : nativeElement.parentNode);\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkPortalOutlet, deps: [{ token: i0.ComponentFactoryResolver }, { token: i0.ViewContainerRef }, { token: DOCUMENT }], target: i0.ɵɵFactoryTarget.Directive }); }\n static { this.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"18.2.0-next.2\", type: CdkPortalOutlet, isStandalone: true, selector: \"[cdkPortalOutlet]\", inputs: { portal: [\"cdkPortalOutlet\", \"portal\"] }, outputs: { attached: \"attached\" }, exportAs: [\"cdkPortalOutlet\"], usesInheritance: true, ngImport: i0 }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkPortalOutlet, decorators: [{\n type: Directive,\n args: [{\n selector: '[cdkPortalOutlet]',\n exportAs: 'cdkPortalOutlet',\n standalone: true,\n }]\n }], ctorParameters: () => [{ type: i0.ComponentFactoryResolver }, { type: i0.ViewContainerRef }, { type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }], propDecorators: { portal: [{\n type: Input,\n args: ['cdkPortalOutlet']\n }], attached: [{\n type: Output\n }] } });\n/**\n * @deprecated Use `CdkPortalOutlet` instead.\n * @breaking-change 9.0.0\n */\nclass PortalHostDirective extends CdkPortalOutlet {\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: PortalHostDirective, deps: null, target: i0.ɵɵFactoryTarget.Directive }); }\n static { this.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"18.2.0-next.2\", type: PortalHostDirective, isStandalone: true, selector: \"[cdkPortalHost], [portalHost]\", inputs: { portal: [\"cdkPortalHost\", \"portal\"] }, providers: [\n {\n provide: CdkPortalOutlet,\n useExisting: PortalHostDirective,\n },\n ], exportAs: [\"cdkPortalHost\"], usesInheritance: true, ngImport: i0 }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: PortalHostDirective, decorators: [{\n type: Directive,\n args: [{\n selector: '[cdkPortalHost], [portalHost]',\n exportAs: 'cdkPortalHost',\n inputs: [{ name: 'portal', alias: 'cdkPortalHost' }],\n providers: [\n {\n provide: CdkPortalOutlet,\n useExisting: PortalHostDirective,\n },\n ],\n standalone: true,\n }]\n }] });\nclass PortalModule {\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: PortalModule, deps: [], target: i0.ɵɵFactoryTarget.NgModule }); }\n static { this.ɵmod = i0.ɵɵngDeclareNgModule({ minVersion: \"14.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: PortalModule, imports: [CdkPortal, CdkPortalOutlet, TemplatePortalDirective, PortalHostDirective], exports: [CdkPortal, CdkPortalOutlet, TemplatePortalDirective, PortalHostDirective] }); }\n static { this.ɵinj = i0.ɵɵngDeclareInjector({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: PortalModule }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: PortalModule, decorators: [{\n type: NgModule,\n args: [{\n imports: [CdkPortal, CdkPortalOutlet, TemplatePortalDirective, PortalHostDirective],\n exports: [CdkPortal, CdkPortalOutlet, TemplatePortalDirective, PortalHostDirective],\n }]\n }] });\n\n/**\n * Custom injector to be used when providing custom\n * injection tokens to components inside a portal.\n * @docs-private\n * @deprecated Use `Injector.create` instead.\n * @breaking-change 11.0.0\n */\nclass PortalInjector {\n constructor(_parentInjector, _customTokens) {\n this._parentInjector = _parentInjector;\n this._customTokens = _customTokens;\n }\n get(token, notFoundValue) {\n const value = this._customTokens.get(token);\n if (typeof value !== 'undefined') {\n return value;\n }\n return this._parentInjector.get(token, notFoundValue);\n }\n}\n\n/**\n * Generated bundle index. Do not edit.\n */\n\nexport { BasePortalHost, BasePortalOutlet, CdkPortal, CdkPortalOutlet, ComponentPortal, DomPortal, DomPortalHost, DomPortalOutlet, Portal, PortalHostDirective, PortalInjector, PortalModule, TemplatePortal, TemplatePortalDirective };\n","import { coerceNumberProperty, coerceElement } from '@angular/cdk/coercion';\nimport * as i0 from '@angular/core';\nimport { InjectionToken, forwardRef, Directive, Input, Injectable, Optional, Inject, inject, Injector, afterNextRender, booleanAttribute, Component, ViewEncapsulation, ChangeDetectionStrategy, Output, ViewChild, SkipSelf, ElementRef, NgModule } from '@angular/core';\nimport { Subject, of, Observable, fromEvent, animationFrameScheduler, asapScheduler, Subscription, isObservable } from 'rxjs';\nimport { distinctUntilChanged, auditTime, filter, takeUntil, startWith, pairwise, switchMap, shareReplay } from 'rxjs/operators';\nimport * as i1 from '@angular/cdk/platform';\nimport { getRtlScrollAxisType, RtlScrollAxisType, supportsScrollBehavior, Platform } from '@angular/cdk/platform';\nimport { DOCUMENT } from '@angular/common';\nimport * as i2 from '@angular/cdk/bidi';\nimport { BidiModule } from '@angular/cdk/bidi';\nimport * as i2$1 from '@angular/cdk/collections';\nimport { isDataSource, ArrayDataSource, _VIEW_REPEATER_STRATEGY, _RecycleViewRepeaterStrategy } from '@angular/cdk/collections';\n\n/** The injection token used to specify the virtual scrolling strategy. */\nconst VIRTUAL_SCROLL_STRATEGY = new InjectionToken('VIRTUAL_SCROLL_STRATEGY');\n\n/** Virtual scrolling strategy for lists with items of known fixed size. */\nclass FixedSizeVirtualScrollStrategy {\n /**\n * @param itemSize The size of the items in the virtually scrolling list.\n * @param minBufferPx The minimum amount of buffer (in pixels) before needing to render more\n * @param maxBufferPx The amount of buffer (in pixels) to render when rendering more.\n */\n constructor(itemSize, minBufferPx, maxBufferPx) {\n this._scrolledIndexChange = new Subject();\n /** @docs-private Implemented as part of VirtualScrollStrategy. */\n this.scrolledIndexChange = this._scrolledIndexChange.pipe(distinctUntilChanged());\n /** The attached viewport. */\n this._viewport = null;\n this._itemSize = itemSize;\n this._minBufferPx = minBufferPx;\n this._maxBufferPx = maxBufferPx;\n }\n /**\n * Attaches this scroll strategy to a viewport.\n * @param viewport The viewport to attach this strategy to.\n */\n attach(viewport) {\n this._viewport = viewport;\n this._updateTotalContentSize();\n this._updateRenderedRange();\n }\n /** Detaches this scroll strategy from the currently attached viewport. */\n detach() {\n this._scrolledIndexChange.complete();\n this._viewport = null;\n }\n /**\n * Update the item size and buffer size.\n * @param itemSize The size of the items in the virtually scrolling list.\n * @param minBufferPx The minimum amount of buffer (in pixels) before needing to render more\n * @param maxBufferPx The amount of buffer (in pixels) to render when rendering more.\n */\n updateItemAndBufferSize(itemSize, minBufferPx, maxBufferPx) {\n if (maxBufferPx < minBufferPx && (typeof ngDevMode === 'undefined' || ngDevMode)) {\n throw Error('CDK virtual scroll: maxBufferPx must be greater than or equal to minBufferPx');\n }\n this._itemSize = itemSize;\n this._minBufferPx = minBufferPx;\n this._maxBufferPx = maxBufferPx;\n this._updateTotalContentSize();\n this._updateRenderedRange();\n }\n /** @docs-private Implemented as part of VirtualScrollStrategy. */\n onContentScrolled() {\n this._updateRenderedRange();\n }\n /** @docs-private Implemented as part of VirtualScrollStrategy. */\n onDataLengthChanged() {\n this._updateTotalContentSize();\n this._updateRenderedRange();\n }\n /** @docs-private Implemented as part of VirtualScrollStrategy. */\n onContentRendered() {\n /* no-op */\n }\n /** @docs-private Implemented as part of VirtualScrollStrategy. */\n onRenderedOffsetChanged() {\n /* no-op */\n }\n /**\n * Scroll to the offset for the given index.\n * @param index The index of the element to scroll to.\n * @param behavior The ScrollBehavior to use when scrolling.\n */\n scrollToIndex(index, behavior) {\n if (this._viewport) {\n this._viewport.scrollToOffset(index * this._itemSize, behavior);\n }\n }\n /** Update the viewport's total content size. */\n _updateTotalContentSize() {\n if (!this._viewport) {\n return;\n }\n this._viewport.setTotalContentSize(this._viewport.getDataLength() * this._itemSize);\n }\n /** Update the viewport's rendered range. */\n _updateRenderedRange() {\n if (!this._viewport) {\n return;\n }\n const renderedRange = this._viewport.getRenderedRange();\n const newRange = { start: renderedRange.start, end: renderedRange.end };\n const viewportSize = this._viewport.getViewportSize();\n const dataLength = this._viewport.getDataLength();\n let scrollOffset = this._viewport.measureScrollOffset();\n // Prevent NaN as result when dividing by zero.\n let firstVisibleIndex = this._itemSize > 0 ? scrollOffset / this._itemSize : 0;\n // If user scrolls to the bottom of the list and data changes to a smaller list\n if (newRange.end > dataLength) {\n // We have to recalculate the first visible index based on new data length and viewport size.\n const maxVisibleItems = Math.ceil(viewportSize / this._itemSize);\n const newVisibleIndex = Math.max(0, Math.min(firstVisibleIndex, dataLength - maxVisibleItems));\n // If first visible index changed we must update scroll offset to handle start/end buffers\n // Current range must also be adjusted to cover the new position (bottom of new list).\n if (firstVisibleIndex != newVisibleIndex) {\n firstVisibleIndex = newVisibleIndex;\n scrollOffset = newVisibleIndex * this._itemSize;\n newRange.start = Math.floor(firstVisibleIndex);\n }\n newRange.end = Math.max(0, Math.min(dataLength, newRange.start + maxVisibleItems));\n }\n const startBuffer = scrollOffset - newRange.start * this._itemSize;\n if (startBuffer < this._minBufferPx && newRange.start != 0) {\n const expandStart = Math.ceil((this._maxBufferPx - startBuffer) / this._itemSize);\n newRange.start = Math.max(0, newRange.start - expandStart);\n newRange.end = Math.min(dataLength, Math.ceil(firstVisibleIndex + (viewportSize + this._minBufferPx) / this._itemSize));\n }\n else {\n const endBuffer = newRange.end * this._itemSize - (scrollOffset + viewportSize);\n if (endBuffer < this._minBufferPx && newRange.end != dataLength) {\n const expandEnd = Math.ceil((this._maxBufferPx - endBuffer) / this._itemSize);\n if (expandEnd > 0) {\n newRange.end = Math.min(dataLength, newRange.end + expandEnd);\n newRange.start = Math.max(0, Math.floor(firstVisibleIndex - this._minBufferPx / this._itemSize));\n }\n }\n }\n this._viewport.setRenderedRange(newRange);\n this._viewport.setRenderedContentOffset(this._itemSize * newRange.start);\n this._scrolledIndexChange.next(Math.floor(firstVisibleIndex));\n }\n}\n/**\n * Provider factory for `FixedSizeVirtualScrollStrategy` that simply extracts the already created\n * `FixedSizeVirtualScrollStrategy` from the given directive.\n * @param fixedSizeDir The instance of `CdkFixedSizeVirtualScroll` to extract the\n * `FixedSizeVirtualScrollStrategy` from.\n */\nfunction _fixedSizeVirtualScrollStrategyFactory(fixedSizeDir) {\n return fixedSizeDir._scrollStrategy;\n}\n/** A virtual scroll strategy that supports fixed-size items. */\nclass CdkFixedSizeVirtualScroll {\n constructor() {\n this._itemSize = 20;\n this._minBufferPx = 100;\n this._maxBufferPx = 200;\n /** The scroll strategy used by this directive. */\n this._scrollStrategy = new FixedSizeVirtualScrollStrategy(this.itemSize, this.minBufferPx, this.maxBufferPx);\n }\n /** The size of the items in the list (in pixels). */\n get itemSize() {\n return this._itemSize;\n }\n set itemSize(value) {\n this._itemSize = coerceNumberProperty(value);\n }\n /**\n * The minimum amount of buffer rendered beyond the viewport (in pixels).\n * If the amount of buffer dips below this number, more items will be rendered. Defaults to 100px.\n */\n get minBufferPx() {\n return this._minBufferPx;\n }\n set minBufferPx(value) {\n this._minBufferPx = coerceNumberProperty(value);\n }\n /**\n * The number of pixels worth of buffer to render for when rendering new items. Defaults to 200px.\n */\n get maxBufferPx() {\n return this._maxBufferPx;\n }\n set maxBufferPx(value) {\n this._maxBufferPx = coerceNumberProperty(value);\n }\n ngOnChanges() {\n this._scrollStrategy.updateItemAndBufferSize(this.itemSize, this.minBufferPx, this.maxBufferPx);\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkFixedSizeVirtualScroll, deps: [], target: i0.ɵɵFactoryTarget.Directive }); }\n static { this.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"18.2.0-next.2\", type: CdkFixedSizeVirtualScroll, isStandalone: true, selector: \"cdk-virtual-scroll-viewport[itemSize]\", inputs: { itemSize: \"itemSize\", minBufferPx: \"minBufferPx\", maxBufferPx: \"maxBufferPx\" }, providers: [\n {\n provide: VIRTUAL_SCROLL_STRATEGY,\n useFactory: _fixedSizeVirtualScrollStrategyFactory,\n deps: [forwardRef(() => CdkFixedSizeVirtualScroll)],\n },\n ], usesOnChanges: true, ngImport: i0 }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkFixedSizeVirtualScroll, decorators: [{\n type: Directive,\n args: [{\n selector: 'cdk-virtual-scroll-viewport[itemSize]',\n standalone: true,\n providers: [\n {\n provide: VIRTUAL_SCROLL_STRATEGY,\n useFactory: _fixedSizeVirtualScrollStrategyFactory,\n deps: [forwardRef(() => CdkFixedSizeVirtualScroll)],\n },\n ],\n }]\n }], propDecorators: { itemSize: [{\n type: Input\n }], minBufferPx: [{\n type: Input\n }], maxBufferPx: [{\n type: Input\n }] } });\n\n/** Time in ms to throttle the scrolling events by default. */\nconst DEFAULT_SCROLL_TIME = 20;\n/**\n * Service contained all registered Scrollable references and emits an event when any one of the\n * Scrollable references emit a scrolled event.\n */\nclass ScrollDispatcher {\n constructor(_ngZone, _platform, document) {\n this._ngZone = _ngZone;\n this._platform = _platform;\n /** Subject for notifying that a registered scrollable reference element has been scrolled. */\n this._scrolled = new Subject();\n /** Keeps track of the global `scroll` and `resize` subscriptions. */\n this._globalSubscription = null;\n /** Keeps track of the amount of subscriptions to `scrolled`. Used for cleaning up afterwards. */\n this._scrolledCount = 0;\n /**\n * Map of all the scrollable references that are registered with the service and their\n * scroll event subscriptions.\n */\n this.scrollContainers = new Map();\n this._document = document;\n }\n /**\n * Registers a scrollable instance with the service and listens for its scrolled events. When the\n * scrollable is scrolled, the service emits the event to its scrolled observable.\n * @param scrollable Scrollable instance to be registered.\n */\n register(scrollable) {\n if (!this.scrollContainers.has(scrollable)) {\n this.scrollContainers.set(scrollable, scrollable.elementScrolled().subscribe(() => this._scrolled.next(scrollable)));\n }\n }\n /**\n * De-registers a Scrollable reference and unsubscribes from its scroll event observable.\n * @param scrollable Scrollable instance to be deregistered.\n */\n deregister(scrollable) {\n const scrollableReference = this.scrollContainers.get(scrollable);\n if (scrollableReference) {\n scrollableReference.unsubscribe();\n this.scrollContainers.delete(scrollable);\n }\n }\n /**\n * Returns an observable that emits an event whenever any of the registered Scrollable\n * references (or window, document, or body) fire a scrolled event. Can provide a time in ms\n * to override the default \"throttle\" time.\n *\n * **Note:** in order to avoid hitting change detection for every scroll event,\n * all of the events emitted from this stream will be run outside the Angular zone.\n * If you need to update any data bindings as a result of a scroll event, you have\n * to run the callback using `NgZone.run`.\n */\n scrolled(auditTimeInMs = DEFAULT_SCROLL_TIME) {\n if (!this._platform.isBrowser) {\n return of();\n }\n return new Observable((observer) => {\n if (!this._globalSubscription) {\n this._addGlobalListener();\n }\n // In the case of a 0ms delay, use an observable without auditTime\n // since it does add a perceptible delay in processing overhead.\n const subscription = auditTimeInMs > 0\n ? this._scrolled.pipe(auditTime(auditTimeInMs)).subscribe(observer)\n : this._scrolled.subscribe(observer);\n this._scrolledCount++;\n return () => {\n subscription.unsubscribe();\n this._scrolledCount--;\n if (!this._scrolledCount) {\n this._removeGlobalListener();\n }\n };\n });\n }\n ngOnDestroy() {\n this._removeGlobalListener();\n this.scrollContainers.forEach((_, container) => this.deregister(container));\n this._scrolled.complete();\n }\n /**\n * Returns an observable that emits whenever any of the\n * scrollable ancestors of an element are scrolled.\n * @param elementOrElementRef Element whose ancestors to listen for.\n * @param auditTimeInMs Time to throttle the scroll events.\n */\n ancestorScrolled(elementOrElementRef, auditTimeInMs) {\n const ancestors = this.getAncestorScrollContainers(elementOrElementRef);\n return this.scrolled(auditTimeInMs).pipe(filter(target => {\n return !target || ancestors.indexOf(target) > -1;\n }));\n }\n /** Returns all registered Scrollables that contain the provided element. */\n getAncestorScrollContainers(elementOrElementRef) {\n const scrollingContainers = [];\n this.scrollContainers.forEach((_subscription, scrollable) => {\n if (this._scrollableContainsElement(scrollable, elementOrElementRef)) {\n scrollingContainers.push(scrollable);\n }\n });\n return scrollingContainers;\n }\n /** Use defaultView of injected document if available or fallback to global window reference */\n _getWindow() {\n return this._document.defaultView || window;\n }\n /** Returns true if the element is contained within the provided Scrollable. */\n _scrollableContainsElement(scrollable, elementOrElementRef) {\n let element = coerceElement(elementOrElementRef);\n let scrollableElement = scrollable.getElementRef().nativeElement;\n // Traverse through the element parents until we reach null, checking if any of the elements\n // are the scrollable's element.\n do {\n if (element == scrollableElement) {\n return true;\n }\n } while ((element = element.parentElement));\n return false;\n }\n /** Sets up the global scroll listeners. */\n _addGlobalListener() {\n this._globalSubscription = this._ngZone.runOutsideAngular(() => {\n const window = this._getWindow();\n return fromEvent(window.document, 'scroll').subscribe(() => this._scrolled.next());\n });\n }\n /** Cleans up the global scroll listener. */\n _removeGlobalListener() {\n if (this._globalSubscription) {\n this._globalSubscription.unsubscribe();\n this._globalSubscription = null;\n }\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: ScrollDispatcher, deps: [{ token: i0.NgZone }, { token: i1.Platform }, { token: DOCUMENT, optional: true }], target: i0.ɵɵFactoryTarget.Injectable }); }\n static { this.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: ScrollDispatcher, providedIn: 'root' }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: ScrollDispatcher, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: () => [{ type: i0.NgZone }, { type: i1.Platform }, { type: undefined, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [DOCUMENT]\n }] }] });\n\n/**\n * Sends an event when the directive's element is scrolled. Registers itself with the\n * ScrollDispatcher service to include itself as part of its collection of scrolling events that it\n * can be listened to through the service.\n */\nclass CdkScrollable {\n constructor(elementRef, scrollDispatcher, ngZone, dir) {\n this.elementRef = elementRef;\n this.scrollDispatcher = scrollDispatcher;\n this.ngZone = ngZone;\n this.dir = dir;\n this._destroyed = new Subject();\n this._elementScrolled = new Observable((observer) => this.ngZone.runOutsideAngular(() => fromEvent(this.elementRef.nativeElement, 'scroll')\n .pipe(takeUntil(this._destroyed))\n .subscribe(observer)));\n }\n ngOnInit() {\n this.scrollDispatcher.register(this);\n }\n ngOnDestroy() {\n this.scrollDispatcher.deregister(this);\n this._destroyed.next();\n this._destroyed.complete();\n }\n /** Returns observable that emits when a scroll event is fired on the host element. */\n elementScrolled() {\n return this._elementScrolled;\n }\n /** Gets the ElementRef for the viewport. */\n getElementRef() {\n return this.elementRef;\n }\n /**\n * Scrolls to the specified offsets. This is a normalized version of the browser's native scrollTo\n * method, since browsers are not consistent about what scrollLeft means in RTL. For this method\n * left and right always refer to the left and right side of the scrolling container irrespective\n * of the layout direction. start and end refer to left and right in an LTR context and vice-versa\n * in an RTL context.\n * @param options specified the offsets to scroll to.\n */\n scrollTo(options) {\n const el = this.elementRef.nativeElement;\n const isRtl = this.dir && this.dir.value == 'rtl';\n // Rewrite start & end offsets as right or left offsets.\n if (options.left == null) {\n options.left = isRtl ? options.end : options.start;\n }\n if (options.right == null) {\n options.right = isRtl ? options.start : options.end;\n }\n // Rewrite the bottom offset as a top offset.\n if (options.bottom != null) {\n options.top =\n el.scrollHeight - el.clientHeight - options.bottom;\n }\n // Rewrite the right offset as a left offset.\n if (isRtl && getRtlScrollAxisType() != RtlScrollAxisType.NORMAL) {\n if (options.left != null) {\n options.right =\n el.scrollWidth - el.clientWidth - options.left;\n }\n if (getRtlScrollAxisType() == RtlScrollAxisType.INVERTED) {\n options.left = options.right;\n }\n else if (getRtlScrollAxisType() == RtlScrollAxisType.NEGATED) {\n options.left = options.right ? -options.right : options.right;\n }\n }\n else {\n if (options.right != null) {\n options.left =\n el.scrollWidth - el.clientWidth - options.right;\n }\n }\n this._applyScrollToOptions(options);\n }\n _applyScrollToOptions(options) {\n const el = this.elementRef.nativeElement;\n if (supportsScrollBehavior()) {\n el.scrollTo(options);\n }\n else {\n if (options.top != null) {\n el.scrollTop = options.top;\n }\n if (options.left != null) {\n el.scrollLeft = options.left;\n }\n }\n }\n /**\n * Measures the scroll offset relative to the specified edge of the viewport. This method can be\n * used instead of directly checking scrollLeft or scrollTop, since browsers are not consistent\n * about what scrollLeft means in RTL. The values returned by this method are normalized such that\n * left and right always refer to the left and right side of the scrolling container irrespective\n * of the layout direction. start and end refer to left and right in an LTR context and vice-versa\n * in an RTL context.\n * @param from The edge to measure from.\n */\n measureScrollOffset(from) {\n const LEFT = 'left';\n const RIGHT = 'right';\n const el = this.elementRef.nativeElement;\n if (from == 'top') {\n return el.scrollTop;\n }\n if (from == 'bottom') {\n return el.scrollHeight - el.clientHeight - el.scrollTop;\n }\n // Rewrite start & end as left or right offsets.\n const isRtl = this.dir && this.dir.value == 'rtl';\n if (from == 'start') {\n from = isRtl ? RIGHT : LEFT;\n }\n else if (from == 'end') {\n from = isRtl ? LEFT : RIGHT;\n }\n if (isRtl && getRtlScrollAxisType() == RtlScrollAxisType.INVERTED) {\n // For INVERTED, scrollLeft is (scrollWidth - clientWidth) when scrolled all the way left and\n // 0 when scrolled all the way right.\n if (from == LEFT) {\n return el.scrollWidth - el.clientWidth - el.scrollLeft;\n }\n else {\n return el.scrollLeft;\n }\n }\n else if (isRtl && getRtlScrollAxisType() == RtlScrollAxisType.NEGATED) {\n // For NEGATED, scrollLeft is -(scrollWidth - clientWidth) when scrolled all the way left and\n // 0 when scrolled all the way right.\n if (from == LEFT) {\n return el.scrollLeft + el.scrollWidth - el.clientWidth;\n }\n else {\n return -el.scrollLeft;\n }\n }\n else {\n // For NORMAL, as well as non-RTL contexts, scrollLeft is 0 when scrolled all the way left and\n // (scrollWidth - clientWidth) when scrolled all the way right.\n if (from == LEFT) {\n return el.scrollLeft;\n }\n else {\n return el.scrollWidth - el.clientWidth - el.scrollLeft;\n }\n }\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkScrollable, deps: [{ token: i0.ElementRef }, { token: ScrollDispatcher }, { token: i0.NgZone }, { token: i2.Directionality, optional: true }], target: i0.ɵɵFactoryTarget.Directive }); }\n static { this.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"18.2.0-next.2\", type: CdkScrollable, isStandalone: true, selector: \"[cdk-scrollable], [cdkScrollable]\", ngImport: i0 }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkScrollable, decorators: [{\n type: Directive,\n args: [{\n selector: '[cdk-scrollable], [cdkScrollable]',\n standalone: true,\n }]\n }], ctorParameters: () => [{ type: i0.ElementRef }, { type: ScrollDispatcher }, { type: i0.NgZone }, { type: i2.Directionality, decorators: [{\n type: Optional\n }] }] });\n\n/** Time in ms to throttle the resize events by default. */\nconst DEFAULT_RESIZE_TIME = 20;\n/**\n * Simple utility for getting the bounds of the browser viewport.\n * @docs-private\n */\nclass ViewportRuler {\n constructor(_platform, ngZone, document) {\n this._platform = _platform;\n /** Stream of viewport change events. */\n this._change = new Subject();\n /** Event listener that will be used to handle the viewport change events. */\n this._changeListener = (event) => {\n this._change.next(event);\n };\n this._document = document;\n ngZone.runOutsideAngular(() => {\n if (_platform.isBrowser) {\n const window = this._getWindow();\n // Note that bind the events ourselves, rather than going through something like RxJS's\n // `fromEvent` so that we can ensure that they're bound outside of the NgZone.\n window.addEventListener('resize', this._changeListener);\n window.addEventListener('orientationchange', this._changeListener);\n }\n // Clear the cached position so that the viewport is re-measured next time it is required.\n // We don't need to keep track of the subscription, because it is completed on destroy.\n this.change().subscribe(() => (this._viewportSize = null));\n });\n }\n ngOnDestroy() {\n if (this._platform.isBrowser) {\n const window = this._getWindow();\n window.removeEventListener('resize', this._changeListener);\n window.removeEventListener('orientationchange', this._changeListener);\n }\n this._change.complete();\n }\n /** Returns the viewport's width and height. */\n getViewportSize() {\n if (!this._viewportSize) {\n this._updateViewportSize();\n }\n const output = { width: this._viewportSize.width, height: this._viewportSize.height };\n // If we're not on a browser, don't cache the size since it'll be mocked out anyway.\n if (!this._platform.isBrowser) {\n this._viewportSize = null;\n }\n return output;\n }\n /** Gets a DOMRect for the viewport's bounds. */\n getViewportRect() {\n // Use the document element's bounding rect rather than the window scroll properties\n // (e.g. pageYOffset, scrollY) due to in issue in Chrome and IE where window scroll\n // properties and client coordinates (boundingClientRect, clientX/Y, etc.) are in different\n // conceptual viewports. Under most circumstances these viewports are equivalent, but they\n // can disagree when the page is pinch-zoomed (on devices that support touch).\n // See https://bugs.chromium.org/p/chromium/issues/detail?id=489206#c4\n // We use the documentElement instead of the body because, by default (without a css reset)\n // browsers typically give the document body an 8px margin, which is not included in\n // getBoundingClientRect().\n const scrollPosition = this.getViewportScrollPosition();\n const { width, height } = this.getViewportSize();\n return {\n top: scrollPosition.top,\n left: scrollPosition.left,\n bottom: scrollPosition.top + height,\n right: scrollPosition.left + width,\n height,\n width,\n };\n }\n /** Gets the (top, left) scroll position of the viewport. */\n getViewportScrollPosition() {\n // While we can get a reference to the fake document\n // during SSR, it doesn't have getBoundingClientRect.\n if (!this._platform.isBrowser) {\n return { top: 0, left: 0 };\n }\n // The top-left-corner of the viewport is determined by the scroll position of the document\n // body, normally just (scrollLeft, scrollTop). However, Chrome and Firefox disagree about\n // whether `document.body` or `document.documentElement` is the scrolled element, so reading\n // `scrollTop` and `scrollLeft` is inconsistent. However, using the bounding rect of\n // `document.documentElement` works consistently, where the `top` and `left` values will\n // equal negative the scroll position.\n const document = this._document;\n const window = this._getWindow();\n const documentElement = document.documentElement;\n const documentRect = documentElement.getBoundingClientRect();\n const top = -documentRect.top ||\n document.body.scrollTop ||\n window.scrollY ||\n documentElement.scrollTop ||\n 0;\n const left = -documentRect.left ||\n document.body.scrollLeft ||\n window.scrollX ||\n documentElement.scrollLeft ||\n 0;\n return { top, left };\n }\n /**\n * Returns a stream that emits whenever the size of the viewport changes.\n * This stream emits outside of the Angular zone.\n * @param throttleTime Time in milliseconds to throttle the stream.\n */\n change(throttleTime = DEFAULT_RESIZE_TIME) {\n return throttleTime > 0 ? this._change.pipe(auditTime(throttleTime)) : this._change;\n }\n /** Use defaultView of injected document if available or fallback to global window reference */\n _getWindow() {\n return this._document.defaultView || window;\n }\n /** Updates the cached viewport size. */\n _updateViewportSize() {\n const window = this._getWindow();\n this._viewportSize = this._platform.isBrowser\n ? { width: window.innerWidth, height: window.innerHeight }\n : { width: 0, height: 0 };\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: ViewportRuler, deps: [{ token: i1.Platform }, { token: i0.NgZone }, { token: DOCUMENT, optional: true }], target: i0.ɵɵFactoryTarget.Injectable }); }\n static { this.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: ViewportRuler, providedIn: 'root' }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: ViewportRuler, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: () => [{ type: i1.Platform }, { type: i0.NgZone }, { type: undefined, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [DOCUMENT]\n }] }] });\n\nconst VIRTUAL_SCROLLABLE = new InjectionToken('VIRTUAL_SCROLLABLE');\n/**\n * Extending the {@link CdkScrollable} to be used as scrolling container for virtual scrolling.\n */\nclass CdkVirtualScrollable extends CdkScrollable {\n constructor(elementRef, scrollDispatcher, ngZone, dir) {\n super(elementRef, scrollDispatcher, ngZone, dir);\n }\n /**\n * Measure the viewport size for the provided orientation.\n *\n * @param orientation The orientation to measure the size from.\n */\n measureViewportSize(orientation) {\n const viewportEl = this.elementRef.nativeElement;\n return orientation === 'horizontal' ? viewportEl.clientWidth : viewportEl.clientHeight;\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkVirtualScrollable, deps: [{ token: i0.ElementRef }, { token: ScrollDispatcher }, { token: i0.NgZone }, { token: i2.Directionality, optional: true }], target: i0.ɵɵFactoryTarget.Directive }); }\n static { this.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"18.2.0-next.2\", type: CdkVirtualScrollable, usesInheritance: true, ngImport: i0 }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkVirtualScrollable, decorators: [{\n type: Directive\n }], ctorParameters: () => [{ type: i0.ElementRef }, { type: ScrollDispatcher }, { type: i0.NgZone }, { type: i2.Directionality, decorators: [{\n type: Optional\n }] }] });\n\n/** Checks if the given ranges are equal. */\nfunction rangesEqual(r1, r2) {\n return r1.start == r2.start && r1.end == r2.end;\n}\n/**\n * Scheduler to be used for scroll events. Needs to fall back to\n * something that doesn't rely on requestAnimationFrame on environments\n * that don't support it (e.g. server-side rendering).\n */\nconst SCROLL_SCHEDULER = typeof requestAnimationFrame !== 'undefined' ? animationFrameScheduler : asapScheduler;\n/** A viewport that virtualizes its scrolling with the help of `CdkVirtualForOf`. */\nclass CdkVirtualScrollViewport extends CdkVirtualScrollable {\n /** The direction the viewport scrolls. */\n get orientation() {\n return this._orientation;\n }\n set orientation(orientation) {\n if (this._orientation !== orientation) {\n this._orientation = orientation;\n this._calculateSpacerSize();\n }\n }\n constructor(elementRef, _changeDetectorRef, ngZone, _scrollStrategy, dir, scrollDispatcher, viewportRuler, scrollable) {\n super(elementRef, scrollDispatcher, ngZone, dir);\n this.elementRef = elementRef;\n this._changeDetectorRef = _changeDetectorRef;\n this._scrollStrategy = _scrollStrategy;\n this.scrollable = scrollable;\n this._platform = inject(Platform);\n /** Emits when the viewport is detached from a CdkVirtualForOf. */\n this._detachedSubject = new Subject();\n /** Emits when the rendered range changes. */\n this._renderedRangeSubject = new Subject();\n this._orientation = 'vertical';\n /**\n * Whether rendered items should persist in the DOM after scrolling out of view. By default, items\n * will be removed.\n */\n this.appendOnly = false;\n // Note: we don't use the typical EventEmitter here because we need to subscribe to the scroll\n // strategy lazily (i.e. only if the user is actually listening to the events). We do this because\n // depending on how the strategy calculates the scrolled index, it may come at a cost to\n // performance.\n /** Emits when the index of the first element visible in the viewport changes. */\n this.scrolledIndexChange = new Observable((observer) => this._scrollStrategy.scrolledIndexChange.subscribe(index => Promise.resolve().then(() => this.ngZone.run(() => observer.next(index)))));\n /** A stream that emits whenever the rendered range changes. */\n this.renderedRangeStream = this._renderedRangeSubject;\n /**\n * The total size of all content (in pixels), including content that is not currently rendered.\n */\n this._totalContentSize = 0;\n /** A string representing the `style.width` property value to be used for the spacer element. */\n this._totalContentWidth = '';\n /** A string representing the `style.height` property value to be used for the spacer element. */\n this._totalContentHeight = '';\n /** The currently rendered range of indices. */\n this._renderedRange = { start: 0, end: 0 };\n /** The length of the data bound to this viewport (in number of items). */\n this._dataLength = 0;\n /** The size of the viewport (in pixels). */\n this._viewportSize = 0;\n /** The last rendered content offset that was set. */\n this._renderedContentOffset = 0;\n /**\n * Whether the last rendered content offset was to the end of the content (and therefore needs to\n * be rewritten as an offset to the start of the content).\n */\n this._renderedContentOffsetNeedsRewrite = false;\n /** Whether there is a pending change detection cycle. */\n this._isChangeDetectionPending = false;\n /** A list of functions to run after the next change detection cycle. */\n this._runAfterChangeDetection = [];\n /** Subscription to changes in the viewport size. */\n this._viewportChanges = Subscription.EMPTY;\n this._injector = inject(Injector);\n this._isDestroyed = false;\n if (!_scrollStrategy && (typeof ngDevMode === 'undefined' || ngDevMode)) {\n throw Error('Error: cdk-virtual-scroll-viewport requires the \"itemSize\" property to be set.');\n }\n this._viewportChanges = viewportRuler.change().subscribe(() => {\n this.checkViewportSize();\n });\n if (!this.scrollable) {\n // No scrollable is provided, so the virtual-scroll-viewport needs to become a scrollable\n this.elementRef.nativeElement.classList.add('cdk-virtual-scrollable');\n this.scrollable = this;\n }\n }\n ngOnInit() {\n // Scrolling depends on the element dimensions which we can't get during SSR.\n if (!this._platform.isBrowser) {\n return;\n }\n if (this.scrollable === this) {\n super.ngOnInit();\n }\n // It's still too early to measure the viewport at this point. Deferring with a promise allows\n // the Viewport to be rendered with the correct size before we measure. We run this outside the\n // zone to avoid causing more change detection cycles. We handle the change detection loop\n // ourselves instead.\n this.ngZone.runOutsideAngular(() => Promise.resolve().then(() => {\n this._measureViewportSize();\n this._scrollStrategy.attach(this);\n this.scrollable\n .elementScrolled()\n .pipe(\n // Start off with a fake scroll event so we properly detect our initial position.\n startWith(null), \n // Collect multiple events into one until the next animation frame. This way if\n // there are multiple scroll events in the same frame we only need to recheck\n // our layout once.\n auditTime(0, SCROLL_SCHEDULER), \n // Usually `elementScrolled` is completed when the scrollable is destroyed, but\n // that may not be the case if a `CdkVirtualScrollableElement` is used so we have\n // to unsubscribe here just in case.\n takeUntil(this._destroyed))\n .subscribe(() => this._scrollStrategy.onContentScrolled());\n this._markChangeDetectionNeeded();\n }));\n }\n ngOnDestroy() {\n this.detach();\n this._scrollStrategy.detach();\n // Complete all subjects\n this._renderedRangeSubject.complete();\n this._detachedSubject.complete();\n this._viewportChanges.unsubscribe();\n this._isDestroyed = true;\n super.ngOnDestroy();\n }\n /** Attaches a `CdkVirtualScrollRepeater` to this viewport. */\n attach(forOf) {\n if (this._forOf && (typeof ngDevMode === 'undefined' || ngDevMode)) {\n throw Error('CdkVirtualScrollViewport is already attached.');\n }\n // Subscribe to the data stream of the CdkVirtualForOf to keep track of when the data length\n // changes. Run outside the zone to avoid triggering change detection, since we're managing the\n // change detection loop ourselves.\n this.ngZone.runOutsideAngular(() => {\n this._forOf = forOf;\n this._forOf.dataStream.pipe(takeUntil(this._detachedSubject)).subscribe(data => {\n const newLength = data.length;\n if (newLength !== this._dataLength) {\n this._dataLength = newLength;\n this._scrollStrategy.onDataLengthChanged();\n }\n this._doChangeDetection();\n });\n });\n }\n /** Detaches the current `CdkVirtualForOf`. */\n detach() {\n this._forOf = null;\n this._detachedSubject.next();\n }\n /** Gets the length of the data bound to this viewport (in number of items). */\n getDataLength() {\n return this._dataLength;\n }\n /** Gets the size of the viewport (in pixels). */\n getViewportSize() {\n return this._viewportSize;\n }\n // TODO(mmalerba): This is technically out of sync with what's really rendered until a render\n // cycle happens. I'm being careful to only call it after the render cycle is complete and before\n // setting it to something else, but its error prone and should probably be split into\n // `pendingRange` and `renderedRange`, the latter reflecting whats actually in the DOM.\n /** Get the current rendered range of items. */\n getRenderedRange() {\n return this._renderedRange;\n }\n measureBoundingClientRectWithScrollOffset(from) {\n return this.getElementRef().nativeElement.getBoundingClientRect()[from];\n }\n /**\n * Sets the total size of all content (in pixels), including content that is not currently\n * rendered.\n */\n setTotalContentSize(size) {\n if (this._totalContentSize !== size) {\n this._totalContentSize = size;\n this._calculateSpacerSize();\n this._markChangeDetectionNeeded();\n }\n }\n /** Sets the currently rendered range of indices. */\n setRenderedRange(range) {\n if (!rangesEqual(this._renderedRange, range)) {\n if (this.appendOnly) {\n range = { start: 0, end: Math.max(this._renderedRange.end, range.end) };\n }\n this._renderedRangeSubject.next((this._renderedRange = range));\n this._markChangeDetectionNeeded(() => this._scrollStrategy.onContentRendered());\n }\n }\n /**\n * Gets the offset from the start of the viewport to the start of the rendered data (in pixels).\n */\n getOffsetToRenderedContentStart() {\n return this._renderedContentOffsetNeedsRewrite ? null : this._renderedContentOffset;\n }\n /**\n * Sets the offset from the start of the viewport to either the start or end of the rendered data\n * (in pixels).\n */\n setRenderedContentOffset(offset, to = 'to-start') {\n // In appendOnly, we always start from the top\n offset = this.appendOnly && to === 'to-start' ? 0 : offset;\n // For a horizontal viewport in a right-to-left language we need to translate along the x-axis\n // in the negative direction.\n const isRtl = this.dir && this.dir.value == 'rtl';\n const isHorizontal = this.orientation == 'horizontal';\n const axis = isHorizontal ? 'X' : 'Y';\n const axisDirection = isHorizontal && isRtl ? -1 : 1;\n let transform = `translate${axis}(${Number(axisDirection * offset)}px)`;\n this._renderedContentOffset = offset;\n if (to === 'to-end') {\n transform += ` translate${axis}(-100%)`;\n // The viewport should rewrite this as a `to-start` offset on the next render cycle. Otherwise\n // elements will appear to expand in the wrong direction (e.g. `mat-expansion-panel` would\n // expand upward).\n this._renderedContentOffsetNeedsRewrite = true;\n }\n if (this._renderedContentTransform != transform) {\n // We know this value is safe because we parse `offset` with `Number()` before passing it\n // into the string.\n this._renderedContentTransform = transform;\n this._markChangeDetectionNeeded(() => {\n if (this._renderedContentOffsetNeedsRewrite) {\n this._renderedContentOffset -= this.measureRenderedContentSize();\n this._renderedContentOffsetNeedsRewrite = false;\n this.setRenderedContentOffset(this._renderedContentOffset);\n }\n else {\n this._scrollStrategy.onRenderedOffsetChanged();\n }\n });\n }\n }\n /**\n * Scrolls to the given offset from the start of the viewport. Please note that this is not always\n * the same as setting `scrollTop` or `scrollLeft`. In a horizontal viewport with right-to-left\n * direction, this would be the equivalent of setting a fictional `scrollRight` property.\n * @param offset The offset to scroll to.\n * @param behavior The ScrollBehavior to use when scrolling. Default is behavior is `auto`.\n */\n scrollToOffset(offset, behavior = 'auto') {\n const options = { behavior };\n if (this.orientation === 'horizontal') {\n options.start = offset;\n }\n else {\n options.top = offset;\n }\n this.scrollable.scrollTo(options);\n }\n /**\n * Scrolls to the offset for the given index.\n * @param index The index of the element to scroll to.\n * @param behavior The ScrollBehavior to use when scrolling. Default is behavior is `auto`.\n */\n scrollToIndex(index, behavior = 'auto') {\n this._scrollStrategy.scrollToIndex(index, behavior);\n }\n /**\n * Gets the current scroll offset from the start of the scrollable (in pixels).\n * @param from The edge to measure the offset from. Defaults to 'top' in vertical mode and 'start'\n * in horizontal mode.\n */\n measureScrollOffset(from) {\n // This is to break the call cycle\n let measureScrollOffset;\n if (this.scrollable == this) {\n measureScrollOffset = (_from) => super.measureScrollOffset(_from);\n }\n else {\n measureScrollOffset = (_from) => this.scrollable.measureScrollOffset(_from);\n }\n return Math.max(0, measureScrollOffset(from ?? (this.orientation === 'horizontal' ? 'start' : 'top')) -\n this.measureViewportOffset());\n }\n /**\n * Measures the offset of the viewport from the scrolling container\n * @param from The edge to measure from.\n */\n measureViewportOffset(from) {\n let fromRect;\n const LEFT = 'left';\n const RIGHT = 'right';\n const isRtl = this.dir?.value == 'rtl';\n if (from == 'start') {\n fromRect = isRtl ? RIGHT : LEFT;\n }\n else if (from == 'end') {\n fromRect = isRtl ? LEFT : RIGHT;\n }\n else if (from) {\n fromRect = from;\n }\n else {\n fromRect = this.orientation === 'horizontal' ? 'left' : 'top';\n }\n const scrollerClientRect = this.scrollable.measureBoundingClientRectWithScrollOffset(fromRect);\n const viewportClientRect = this.elementRef.nativeElement.getBoundingClientRect()[fromRect];\n return viewportClientRect - scrollerClientRect;\n }\n /** Measure the combined size of all of the rendered items. */\n measureRenderedContentSize() {\n const contentEl = this._contentWrapper.nativeElement;\n return this.orientation === 'horizontal' ? contentEl.offsetWidth : contentEl.offsetHeight;\n }\n /**\n * Measure the total combined size of the given range. Throws if the range includes items that are\n * not rendered.\n */\n measureRangeSize(range) {\n if (!this._forOf) {\n return 0;\n }\n return this._forOf.measureRangeSize(range, this.orientation);\n }\n /** Update the viewport dimensions and re-render. */\n checkViewportSize() {\n // TODO: Cleanup later when add logic for handling content resize\n this._measureViewportSize();\n this._scrollStrategy.onDataLengthChanged();\n }\n /** Measure the viewport size. */\n _measureViewportSize() {\n this._viewportSize = this.scrollable.measureViewportSize(this.orientation);\n }\n /** Queue up change detection to run. */\n _markChangeDetectionNeeded(runAfter) {\n if (runAfter) {\n this._runAfterChangeDetection.push(runAfter);\n }\n // Use a Promise to batch together calls to `_doChangeDetection`. This way if we set a bunch of\n // properties sequentially we only have to run `_doChangeDetection` once at the end.\n if (!this._isChangeDetectionPending) {\n this._isChangeDetectionPending = true;\n this.ngZone.runOutsideAngular(() => Promise.resolve().then(() => {\n this._doChangeDetection();\n }));\n }\n }\n /** Run change detection. */\n _doChangeDetection() {\n if (this._isDestroyed) {\n return;\n }\n this.ngZone.run(() => {\n // Apply changes to Angular bindings. Note: We must call `markForCheck` to run change detection\n // from the root, since the repeated items are content projected in. Calling `detectChanges`\n // instead does not properly check the projected content.\n this._changeDetectorRef.markForCheck();\n // Apply the content transform. The transform can't be set via an Angular binding because\n // bypassSecurityTrustStyle is banned in Google. However the value is safe, it's composed of\n // string literals, a variable that can only be 'X' or 'Y', and user input that is run through\n // the `Number` function first to coerce it to a numeric value.\n this._contentWrapper.nativeElement.style.transform = this._renderedContentTransform;\n afterNextRender(() => {\n this._isChangeDetectionPending = false;\n const runAfterChangeDetection = this._runAfterChangeDetection;\n this._runAfterChangeDetection = [];\n for (const fn of runAfterChangeDetection) {\n fn();\n }\n }, { injector: this._injector });\n });\n }\n /** Calculates the `style.width` and `style.height` for the spacer element. */\n _calculateSpacerSize() {\n this._totalContentHeight =\n this.orientation === 'horizontal' ? '' : `${this._totalContentSize}px`;\n this._totalContentWidth =\n this.orientation === 'horizontal' ? `${this._totalContentSize}px` : '';\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkVirtualScrollViewport, deps: [{ token: i0.ElementRef }, { token: i0.ChangeDetectorRef }, { token: i0.NgZone }, { token: VIRTUAL_SCROLL_STRATEGY, optional: true }, { token: i2.Directionality, optional: true }, { token: ScrollDispatcher }, { token: ViewportRuler }, { token: VIRTUAL_SCROLLABLE, optional: true }], target: i0.ɵɵFactoryTarget.Component }); }\n static { this.ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"16.1.0\", version: \"18.2.0-next.2\", type: CdkVirtualScrollViewport, isStandalone: true, selector: \"cdk-virtual-scroll-viewport\", inputs: { orientation: \"orientation\", appendOnly: [\"appendOnly\", \"appendOnly\", booleanAttribute] }, outputs: { scrolledIndexChange: \"scrolledIndexChange\" }, host: { properties: { \"class.cdk-virtual-scroll-orientation-horizontal\": \"orientation === \\\"horizontal\\\"\", \"class.cdk-virtual-scroll-orientation-vertical\": \"orientation !== \\\"horizontal\\\"\" }, classAttribute: \"cdk-virtual-scroll-viewport\" }, providers: [\n {\n provide: CdkScrollable,\n useFactory: (virtualScrollable, viewport) => virtualScrollable || viewport,\n deps: [[new Optional(), new Inject(VIRTUAL_SCROLLABLE)], CdkVirtualScrollViewport],\n },\n ], viewQueries: [{ propertyName: \"_contentWrapper\", first: true, predicate: [\"contentWrapper\"], descendants: true, static: true }], usesInheritance: true, ngImport: i0, template: \"\\n
\\n
\\n\\n
\\n\", styles: [\"cdk-virtual-scroll-viewport{display:block;position:relative;transform:translateZ(0)}.cdk-virtual-scrollable{overflow:auto;will-change:scroll-position;contain:strict;-webkit-overflow-scrolling:touch}.cdk-virtual-scroll-content-wrapper{position:absolute;top:0;left:0;contain:content}[dir=rtl] .cdk-virtual-scroll-content-wrapper{right:0;left:auto}.cdk-virtual-scroll-orientation-horizontal .cdk-virtual-scroll-content-wrapper{min-height:100%}.cdk-virtual-scroll-orientation-horizontal .cdk-virtual-scroll-content-wrapper>dl:not([cdkVirtualFor]),.cdk-virtual-scroll-orientation-horizontal .cdk-virtual-scroll-content-wrapper>ol:not([cdkVirtualFor]),.cdk-virtual-scroll-orientation-horizontal .cdk-virtual-scroll-content-wrapper>table:not([cdkVirtualFor]),.cdk-virtual-scroll-orientation-horizontal .cdk-virtual-scroll-content-wrapper>ul:not([cdkVirtualFor]){padding-left:0;padding-right:0;margin-left:0;margin-right:0;border-left-width:0;border-right-width:0;outline:none}.cdk-virtual-scroll-orientation-vertical .cdk-virtual-scroll-content-wrapper{min-width:100%}.cdk-virtual-scroll-orientation-vertical .cdk-virtual-scroll-content-wrapper>dl:not([cdkVirtualFor]),.cdk-virtual-scroll-orientation-vertical .cdk-virtual-scroll-content-wrapper>ol:not([cdkVirtualFor]),.cdk-virtual-scroll-orientation-vertical .cdk-virtual-scroll-content-wrapper>table:not([cdkVirtualFor]),.cdk-virtual-scroll-orientation-vertical .cdk-virtual-scroll-content-wrapper>ul:not([cdkVirtualFor]){padding-top:0;padding-bottom:0;margin-top:0;margin-bottom:0;border-top-width:0;border-bottom-width:0;outline:none}.cdk-virtual-scroll-spacer{height:1px;transform-origin:0 0;flex:0 0 auto}[dir=rtl] .cdk-virtual-scroll-spacer{transform-origin:100% 0}\"], changeDetection: i0.ChangeDetectionStrategy.OnPush, encapsulation: i0.ViewEncapsulation.None }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkVirtualScrollViewport, decorators: [{\n type: Component,\n args: [{ selector: 'cdk-virtual-scroll-viewport', host: {\n 'class': 'cdk-virtual-scroll-viewport',\n '[class.cdk-virtual-scroll-orientation-horizontal]': 'orientation === \"horizontal\"',\n '[class.cdk-virtual-scroll-orientation-vertical]': 'orientation !== \"horizontal\"',\n }, encapsulation: ViewEncapsulation.None, changeDetection: ChangeDetectionStrategy.OnPush, standalone: true, providers: [\n {\n provide: CdkScrollable,\n useFactory: (virtualScrollable, viewport) => virtualScrollable || viewport,\n deps: [[new Optional(), new Inject(VIRTUAL_SCROLLABLE)], CdkVirtualScrollViewport],\n },\n ], template: \"\\n
\\n
\\n\\n
\\n\", styles: [\"cdk-virtual-scroll-viewport{display:block;position:relative;transform:translateZ(0)}.cdk-virtual-scrollable{overflow:auto;will-change:scroll-position;contain:strict;-webkit-overflow-scrolling:touch}.cdk-virtual-scroll-content-wrapper{position:absolute;top:0;left:0;contain:content}[dir=rtl] .cdk-virtual-scroll-content-wrapper{right:0;left:auto}.cdk-virtual-scroll-orientation-horizontal .cdk-virtual-scroll-content-wrapper{min-height:100%}.cdk-virtual-scroll-orientation-horizontal .cdk-virtual-scroll-content-wrapper>dl:not([cdkVirtualFor]),.cdk-virtual-scroll-orientation-horizontal .cdk-virtual-scroll-content-wrapper>ol:not([cdkVirtualFor]),.cdk-virtual-scroll-orientation-horizontal .cdk-virtual-scroll-content-wrapper>table:not([cdkVirtualFor]),.cdk-virtual-scroll-orientation-horizontal .cdk-virtual-scroll-content-wrapper>ul:not([cdkVirtualFor]){padding-left:0;padding-right:0;margin-left:0;margin-right:0;border-left-width:0;border-right-width:0;outline:none}.cdk-virtual-scroll-orientation-vertical .cdk-virtual-scroll-content-wrapper{min-width:100%}.cdk-virtual-scroll-orientation-vertical .cdk-virtual-scroll-content-wrapper>dl:not([cdkVirtualFor]),.cdk-virtual-scroll-orientation-vertical .cdk-virtual-scroll-content-wrapper>ol:not([cdkVirtualFor]),.cdk-virtual-scroll-orientation-vertical .cdk-virtual-scroll-content-wrapper>table:not([cdkVirtualFor]),.cdk-virtual-scroll-orientation-vertical .cdk-virtual-scroll-content-wrapper>ul:not([cdkVirtualFor]){padding-top:0;padding-bottom:0;margin-top:0;margin-bottom:0;border-top-width:0;border-bottom-width:0;outline:none}.cdk-virtual-scroll-spacer{height:1px;transform-origin:0 0;flex:0 0 auto}[dir=rtl] .cdk-virtual-scroll-spacer{transform-origin:100% 0}\"] }]\n }], ctorParameters: () => [{ type: i0.ElementRef }, { type: i0.ChangeDetectorRef }, { type: i0.NgZone }, { type: undefined, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [VIRTUAL_SCROLL_STRATEGY]\n }] }, { type: i2.Directionality, decorators: [{\n type: Optional\n }] }, { type: ScrollDispatcher }, { type: ViewportRuler }, { type: CdkVirtualScrollable, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [VIRTUAL_SCROLLABLE]\n }] }], propDecorators: { orientation: [{\n type: Input\n }], appendOnly: [{\n type: Input,\n args: [{ transform: booleanAttribute }]\n }], scrolledIndexChange: [{\n type: Output\n }], _contentWrapper: [{\n type: ViewChild,\n args: ['contentWrapper', { static: true }]\n }] } });\n\n/** Helper to extract the offset of a DOM Node in a certain direction. */\nfunction getOffset(orientation, direction, node) {\n const el = node;\n if (!el.getBoundingClientRect) {\n return 0;\n }\n const rect = el.getBoundingClientRect();\n if (orientation === 'horizontal') {\n return direction === 'start' ? rect.left : rect.right;\n }\n return direction === 'start' ? rect.top : rect.bottom;\n}\n/**\n * A directive similar to `ngForOf` to be used for rendering data inside a virtual scrolling\n * container.\n */\nclass CdkVirtualForOf {\n /** The DataSource to display. */\n get cdkVirtualForOf() {\n return this._cdkVirtualForOf;\n }\n set cdkVirtualForOf(value) {\n this._cdkVirtualForOf = value;\n if (isDataSource(value)) {\n this._dataSourceChanges.next(value);\n }\n else {\n // If value is an an NgIterable, convert it to an array.\n this._dataSourceChanges.next(new ArrayDataSource(isObservable(value) ? value : Array.from(value || [])));\n }\n }\n /**\n * The `TrackByFunction` to use for tracking changes. The `TrackByFunction` takes the index and\n * the item and produces a value to be used as the item's identity when tracking changes.\n */\n get cdkVirtualForTrackBy() {\n return this._cdkVirtualForTrackBy;\n }\n set cdkVirtualForTrackBy(fn) {\n this._needsUpdate = true;\n this._cdkVirtualForTrackBy = fn\n ? (index, item) => fn(index + (this._renderedRange ? this._renderedRange.start : 0), item)\n : undefined;\n }\n /** The template used to stamp out new elements. */\n set cdkVirtualForTemplate(value) {\n if (value) {\n this._needsUpdate = true;\n this._template = value;\n }\n }\n /**\n * The size of the cache used to store templates that are not being used for re-use later.\n * Setting the cache size to `0` will disable caching. Defaults to 20 templates.\n */\n get cdkVirtualForTemplateCacheSize() {\n return this._viewRepeater.viewCacheSize;\n }\n set cdkVirtualForTemplateCacheSize(size) {\n this._viewRepeater.viewCacheSize = coerceNumberProperty(size);\n }\n constructor(\n /** The view container to add items to. */\n _viewContainerRef, \n /** The template to use when stamping out new items. */\n _template, \n /** The set of available differs. */\n _differs, \n /** The strategy used to render items in the virtual scroll viewport. */\n _viewRepeater, \n /** The virtual scrolling viewport that these items are being rendered in. */\n _viewport, ngZone) {\n this._viewContainerRef = _viewContainerRef;\n this._template = _template;\n this._differs = _differs;\n this._viewRepeater = _viewRepeater;\n this._viewport = _viewport;\n /** Emits when the rendered view of the data changes. */\n this.viewChange = new Subject();\n /** Subject that emits when a new DataSource instance is given. */\n this._dataSourceChanges = new Subject();\n /** Emits whenever the data in the current DataSource changes. */\n this.dataStream = this._dataSourceChanges.pipe(\n // Start off with null `DataSource`.\n startWith(null), \n // Bundle up the previous and current data sources so we can work with both.\n pairwise(), \n // Use `_changeDataSource` to disconnect from the previous data source and connect to the\n // new one, passing back a stream of data changes which we run through `switchMap` to give\n // us a data stream that emits the latest data from whatever the current `DataSource` is.\n switchMap(([prev, cur]) => this._changeDataSource(prev, cur)), \n // Replay the last emitted data when someone subscribes.\n shareReplay(1));\n /** The differ used to calculate changes to the data. */\n this._differ = null;\n /** Whether the rendered data should be updated during the next ngDoCheck cycle. */\n this._needsUpdate = false;\n this._destroyed = new Subject();\n this.dataStream.subscribe(data => {\n this._data = data;\n this._onRenderedDataChange();\n });\n this._viewport.renderedRangeStream.pipe(takeUntil(this._destroyed)).subscribe(range => {\n this._renderedRange = range;\n if (this.viewChange.observers.length) {\n ngZone.run(() => this.viewChange.next(this._renderedRange));\n }\n this._onRenderedDataChange();\n });\n this._viewport.attach(this);\n }\n /**\n * Measures the combined size (width for horizontal orientation, height for vertical) of all items\n * in the specified range. Throws an error if the range includes items that are not currently\n * rendered.\n */\n measureRangeSize(range, orientation) {\n if (range.start >= range.end) {\n return 0;\n }\n if ((range.start < this._renderedRange.start || range.end > this._renderedRange.end) &&\n (typeof ngDevMode === 'undefined' || ngDevMode)) {\n throw Error(`Error: attempted to measure an item that isn't rendered.`);\n }\n // The index into the list of rendered views for the first item in the range.\n const renderedStartIndex = range.start - this._renderedRange.start;\n // The length of the range we're measuring.\n const rangeLen = range.end - range.start;\n // Loop over all the views, find the first and land node and compute the size by subtracting\n // the top of the first node from the bottom of the last one.\n let firstNode;\n let lastNode;\n // Find the first node by starting from the beginning and going forwards.\n for (let i = 0; i < rangeLen; i++) {\n const view = this._viewContainerRef.get(i + renderedStartIndex);\n if (view && view.rootNodes.length) {\n firstNode = lastNode = view.rootNodes[0];\n break;\n }\n }\n // Find the last node by starting from the end and going backwards.\n for (let i = rangeLen - 1; i > -1; i--) {\n const view = this._viewContainerRef.get(i + renderedStartIndex);\n if (view && view.rootNodes.length) {\n lastNode = view.rootNodes[view.rootNodes.length - 1];\n break;\n }\n }\n return firstNode && lastNode\n ? getOffset(orientation, 'end', lastNode) - getOffset(orientation, 'start', firstNode)\n : 0;\n }\n ngDoCheck() {\n if (this._differ && this._needsUpdate) {\n // TODO(mmalerba): We should differentiate needs update due to scrolling and a new portion of\n // this list being rendered (can use simpler algorithm) vs needs update due to data actually\n // changing (need to do this diff).\n const changes = this._differ.diff(this._renderedItems);\n if (!changes) {\n this._updateContext();\n }\n else {\n this._applyChanges(changes);\n }\n this._needsUpdate = false;\n }\n }\n ngOnDestroy() {\n this._viewport.detach();\n this._dataSourceChanges.next(undefined);\n this._dataSourceChanges.complete();\n this.viewChange.complete();\n this._destroyed.next();\n this._destroyed.complete();\n this._viewRepeater.detach();\n }\n /** React to scroll state changes in the viewport. */\n _onRenderedDataChange() {\n if (!this._renderedRange) {\n return;\n }\n this._renderedItems = this._data.slice(this._renderedRange.start, this._renderedRange.end);\n if (!this._differ) {\n // Use a wrapper function for the `trackBy` so any new values are\n // picked up automatically without having to recreate the differ.\n this._differ = this._differs.find(this._renderedItems).create((index, item) => {\n return this.cdkVirtualForTrackBy ? this.cdkVirtualForTrackBy(index, item) : item;\n });\n }\n this._needsUpdate = true;\n }\n /** Swap out one `DataSource` for another. */\n _changeDataSource(oldDs, newDs) {\n if (oldDs) {\n oldDs.disconnect(this);\n }\n this._needsUpdate = true;\n return newDs ? newDs.connect(this) : of();\n }\n /** Update the `CdkVirtualForOfContext` for all views. */\n _updateContext() {\n const count = this._data.length;\n let i = this._viewContainerRef.length;\n while (i--) {\n const view = this._viewContainerRef.get(i);\n view.context.index = this._renderedRange.start + i;\n view.context.count = count;\n this._updateComputedContextProperties(view.context);\n view.detectChanges();\n }\n }\n /** Apply changes to the DOM. */\n _applyChanges(changes) {\n this._viewRepeater.applyChanges(changes, this._viewContainerRef, (record, _adjustedPreviousIndex, currentIndex) => this._getEmbeddedViewArgs(record, currentIndex), record => record.item);\n // Update $implicit for any items that had an identity change.\n changes.forEachIdentityChange((record) => {\n const view = this._viewContainerRef.get(record.currentIndex);\n view.context.$implicit = record.item;\n });\n // Update the context variables on all items.\n const count = this._data.length;\n let i = this._viewContainerRef.length;\n while (i--) {\n const view = this._viewContainerRef.get(i);\n view.context.index = this._renderedRange.start + i;\n view.context.count = count;\n this._updateComputedContextProperties(view.context);\n }\n }\n /** Update the computed properties on the `CdkVirtualForOfContext`. */\n _updateComputedContextProperties(context) {\n context.first = context.index === 0;\n context.last = context.index === context.count - 1;\n context.even = context.index % 2 === 0;\n context.odd = !context.even;\n }\n _getEmbeddedViewArgs(record, index) {\n // Note that it's important that we insert the item directly at the proper index,\n // rather than inserting it and the moving it in place, because if there's a directive\n // on the same node that injects the `ViewContainerRef`, Angular will insert another\n // comment node which can throw off the move when it's being repeated for all items.\n return {\n templateRef: this._template,\n context: {\n $implicit: record.item,\n // It's guaranteed that the iterable is not \"undefined\" or \"null\" because we only\n // generate views for elements if the \"cdkVirtualForOf\" iterable has elements.\n cdkVirtualForOf: this._cdkVirtualForOf,\n index: -1,\n count: -1,\n first: false,\n last: false,\n odd: false,\n even: false,\n },\n index,\n };\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkVirtualForOf, deps: [{ token: i0.ViewContainerRef }, { token: i0.TemplateRef }, { token: i0.IterableDiffers }, { token: _VIEW_REPEATER_STRATEGY }, { token: CdkVirtualScrollViewport, skipSelf: true }, { token: i0.NgZone }], target: i0.ɵɵFactoryTarget.Directive }); }\n static { this.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"18.2.0-next.2\", type: CdkVirtualForOf, isStandalone: true, selector: \"[cdkVirtualFor][cdkVirtualForOf]\", inputs: { cdkVirtualForOf: \"cdkVirtualForOf\", cdkVirtualForTrackBy: \"cdkVirtualForTrackBy\", cdkVirtualForTemplate: \"cdkVirtualForTemplate\", cdkVirtualForTemplateCacheSize: \"cdkVirtualForTemplateCacheSize\" }, providers: [{ provide: _VIEW_REPEATER_STRATEGY, useClass: _RecycleViewRepeaterStrategy }], ngImport: i0 }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkVirtualForOf, decorators: [{\n type: Directive,\n args: [{\n selector: '[cdkVirtualFor][cdkVirtualForOf]',\n providers: [{ provide: _VIEW_REPEATER_STRATEGY, useClass: _RecycleViewRepeaterStrategy }],\n standalone: true,\n }]\n }], ctorParameters: () => [{ type: i0.ViewContainerRef }, { type: i0.TemplateRef }, { type: i0.IterableDiffers }, { type: i2$1._RecycleViewRepeaterStrategy, decorators: [{\n type: Inject,\n args: [_VIEW_REPEATER_STRATEGY]\n }] }, { type: CdkVirtualScrollViewport, decorators: [{\n type: SkipSelf\n }] }, { type: i0.NgZone }], propDecorators: { cdkVirtualForOf: [{\n type: Input\n }], cdkVirtualForTrackBy: [{\n type: Input\n }], cdkVirtualForTemplate: [{\n type: Input\n }], cdkVirtualForTemplateCacheSize: [{\n type: Input\n }] } });\n\n/**\n * Provides a virtual scrollable for the element it is attached to.\n */\nclass CdkVirtualScrollableElement extends CdkVirtualScrollable {\n constructor(elementRef, scrollDispatcher, ngZone, dir) {\n super(elementRef, scrollDispatcher, ngZone, dir);\n }\n measureBoundingClientRectWithScrollOffset(from) {\n return (this.getElementRef().nativeElement.getBoundingClientRect()[from] -\n this.measureScrollOffset(from));\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkVirtualScrollableElement, deps: [{ token: i0.ElementRef }, { token: ScrollDispatcher }, { token: i0.NgZone }, { token: i2.Directionality, optional: true }], target: i0.ɵɵFactoryTarget.Directive }); }\n static { this.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"18.2.0-next.2\", type: CdkVirtualScrollableElement, isStandalone: true, selector: \"[cdkVirtualScrollingElement]\", host: { classAttribute: \"cdk-virtual-scrollable\" }, providers: [{ provide: VIRTUAL_SCROLLABLE, useExisting: CdkVirtualScrollableElement }], usesInheritance: true, ngImport: i0 }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkVirtualScrollableElement, decorators: [{\n type: Directive,\n args: [{\n selector: '[cdkVirtualScrollingElement]',\n providers: [{ provide: VIRTUAL_SCROLLABLE, useExisting: CdkVirtualScrollableElement }],\n standalone: true,\n host: {\n 'class': 'cdk-virtual-scrollable',\n },\n }]\n }], ctorParameters: () => [{ type: i0.ElementRef }, { type: ScrollDispatcher }, { type: i0.NgZone }, { type: i2.Directionality, decorators: [{\n type: Optional\n }] }] });\n\n/**\n * Provides as virtual scrollable for the global / window scrollbar.\n */\nclass CdkVirtualScrollableWindow extends CdkVirtualScrollable {\n constructor(scrollDispatcher, ngZone, dir) {\n super(new ElementRef(document.documentElement), scrollDispatcher, ngZone, dir);\n this._elementScrolled = new Observable((observer) => this.ngZone.runOutsideAngular(() => fromEvent(document, 'scroll').pipe(takeUntil(this._destroyed)).subscribe(observer)));\n }\n measureBoundingClientRectWithScrollOffset(from) {\n return this.getElementRef().nativeElement.getBoundingClientRect()[from];\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkVirtualScrollableWindow, deps: [{ token: ScrollDispatcher }, { token: i0.NgZone }, { token: i2.Directionality, optional: true }], target: i0.ɵɵFactoryTarget.Directive }); }\n static { this.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"18.2.0-next.2\", type: CdkVirtualScrollableWindow, isStandalone: true, selector: \"cdk-virtual-scroll-viewport[scrollWindow]\", providers: [{ provide: VIRTUAL_SCROLLABLE, useExisting: CdkVirtualScrollableWindow }], usesInheritance: true, ngImport: i0 }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkVirtualScrollableWindow, decorators: [{\n type: Directive,\n args: [{\n selector: 'cdk-virtual-scroll-viewport[scrollWindow]',\n providers: [{ provide: VIRTUAL_SCROLLABLE, useExisting: CdkVirtualScrollableWindow }],\n standalone: true,\n }]\n }], ctorParameters: () => [{ type: ScrollDispatcher }, { type: i0.NgZone }, { type: i2.Directionality, decorators: [{\n type: Optional\n }] }] });\n\nclass CdkScrollableModule {\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkScrollableModule, deps: [], target: i0.ɵɵFactoryTarget.NgModule }); }\n static { this.ɵmod = i0.ɵɵngDeclareNgModule({ minVersion: \"14.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkScrollableModule, imports: [CdkScrollable], exports: [CdkScrollable] }); }\n static { this.ɵinj = i0.ɵɵngDeclareInjector({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkScrollableModule }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkScrollableModule, decorators: [{\n type: NgModule,\n args: [{\n exports: [CdkScrollable],\n imports: [CdkScrollable],\n }]\n }] });\n/**\n * @docs-primary-export\n */\nclass ScrollingModule {\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: ScrollingModule, deps: [], target: i0.ɵɵFactoryTarget.NgModule }); }\n static { this.ɵmod = i0.ɵɵngDeclareNgModule({ minVersion: \"14.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: ScrollingModule, imports: [BidiModule, CdkScrollableModule, CdkVirtualScrollViewport,\n CdkFixedSizeVirtualScroll,\n CdkVirtualForOf,\n CdkVirtualScrollableWindow,\n CdkVirtualScrollableElement], exports: [BidiModule, CdkScrollableModule, CdkFixedSizeVirtualScroll,\n CdkVirtualForOf,\n CdkVirtualScrollViewport,\n CdkVirtualScrollableWindow,\n CdkVirtualScrollableElement] }); }\n static { this.ɵinj = i0.ɵɵngDeclareInjector({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: ScrollingModule, imports: [BidiModule,\n CdkScrollableModule, BidiModule, CdkScrollableModule] }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: ScrollingModule, decorators: [{\n type: NgModule,\n args: [{\n imports: [\n BidiModule,\n CdkScrollableModule,\n CdkVirtualScrollViewport,\n CdkFixedSizeVirtualScroll,\n CdkVirtualForOf,\n CdkVirtualScrollableWindow,\n CdkVirtualScrollableElement,\n ],\n exports: [\n BidiModule,\n CdkScrollableModule,\n CdkFixedSizeVirtualScroll,\n CdkVirtualForOf,\n CdkVirtualScrollViewport,\n CdkVirtualScrollableWindow,\n CdkVirtualScrollableElement,\n ],\n }]\n }] });\n\n/**\n * Generated bundle index. Do not edit.\n */\n\nexport { CdkFixedSizeVirtualScroll, CdkScrollable, CdkScrollableModule, CdkVirtualForOf, CdkVirtualScrollViewport, CdkVirtualScrollable, CdkVirtualScrollableElement, CdkVirtualScrollableWindow, DEFAULT_RESIZE_TIME, DEFAULT_SCROLL_TIME, FixedSizeVirtualScrollStrategy, ScrollDispatcher, ScrollingModule, VIRTUAL_SCROLLABLE, VIRTUAL_SCROLL_STRATEGY, ViewportRuler, _fixedSizeVirtualScrollStrategyFactory };\n","import { FocusKeyManager } from '@angular/cdk/a11y';\nimport * as i1 from '@angular/cdk/bidi';\nimport { BidiModule } from '@angular/cdk/bidi';\nimport { hasModifierKey, SPACE, ENTER } from '@angular/cdk/keycodes';\nimport * as i0 from '@angular/core';\nimport { Directive, InjectionToken, EventEmitter, forwardRef, booleanAttribute, TemplateRef, Component, ViewEncapsulation, ChangeDetectionStrategy, Inject, Optional, ContentChild, ViewChild, Input, Output, QueryList, numberAttribute, ContentChildren, NgModule } from '@angular/core';\nimport { _getFocusedElementPierceShadowDom } from '@angular/cdk/platform';\nimport { Subject, of } from 'rxjs';\nimport { startWith, takeUntil } from 'rxjs/operators';\n\nclass CdkStepHeader {\n constructor(_elementRef) {\n this._elementRef = _elementRef;\n }\n /** Focuses the step header. */\n focus() {\n this._elementRef.nativeElement.focus();\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkStepHeader, deps: [{ token: i0.ElementRef }], target: i0.ɵɵFactoryTarget.Directive }); }\n static { this.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"18.2.0-next.2\", type: CdkStepHeader, isStandalone: true, selector: \"[cdkStepHeader]\", host: { attributes: { \"role\": \"tab\" } }, ngImport: i0 }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkStepHeader, decorators: [{\n type: Directive,\n args: [{\n selector: '[cdkStepHeader]',\n host: {\n 'role': 'tab',\n },\n standalone: true,\n }]\n }], ctorParameters: () => [{ type: i0.ElementRef }] });\n\nclass CdkStepLabel {\n constructor(/** @docs-private */ template) {\n this.template = template;\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkStepLabel, deps: [{ token: i0.TemplateRef }], target: i0.ɵɵFactoryTarget.Directive }); }\n static { this.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"18.2.0-next.2\", type: CdkStepLabel, isStandalone: true, selector: \"[cdkStepLabel]\", ngImport: i0 }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkStepLabel, decorators: [{\n type: Directive,\n args: [{\n selector: '[cdkStepLabel]',\n standalone: true,\n }]\n }], ctorParameters: () => [{ type: i0.TemplateRef }] });\n\n/** Used to generate unique ID for each stepper component. */\nlet nextId = 0;\n/** Change event emitted on selection changes. */\nclass StepperSelectionEvent {\n}\n/** Enum to represent the different states of the steps. */\nconst STEP_STATE = {\n NUMBER: 'number',\n EDIT: 'edit',\n DONE: 'done',\n ERROR: 'error',\n};\n/** InjectionToken that can be used to specify the global stepper options. */\nconst STEPPER_GLOBAL_OPTIONS = new InjectionToken('STEPPER_GLOBAL_OPTIONS');\nclass CdkStep {\n /** Whether step is marked as completed. */\n get completed() {\n return this._completedOverride == null ? this._getDefaultCompleted() : this._completedOverride;\n }\n set completed(value) {\n this._completedOverride = value;\n }\n _getDefaultCompleted() {\n return this.stepControl ? this.stepControl.valid && this.interacted : this.interacted;\n }\n /** Whether step has an error. */\n get hasError() {\n return this._customError == null ? this._getDefaultError() : this._customError;\n }\n set hasError(value) {\n this._customError = value;\n }\n _getDefaultError() {\n return this.stepControl && this.stepControl.invalid && this.interacted;\n }\n constructor(_stepper, stepperOptions) {\n this._stepper = _stepper;\n /** Whether user has attempted to move away from the step. */\n this.interacted = false;\n /** Emits when the user has attempted to move away from the step. */\n this.interactedStream = new EventEmitter();\n /** Whether the user can return to this step once it has been marked as completed. */\n this.editable = true;\n /** Whether the completion of step is optional. */\n this.optional = false;\n this._completedOverride = null;\n this._customError = null;\n this._stepperOptions = stepperOptions ? stepperOptions : {};\n this._displayDefaultIndicatorType = this._stepperOptions.displayDefaultIndicatorType !== false;\n }\n /** Selects this step component. */\n select() {\n this._stepper.selected = this;\n }\n /** Resets the step to its initial state. Note that this includes resetting form data. */\n reset() {\n this.interacted = false;\n if (this._completedOverride != null) {\n this._completedOverride = false;\n }\n if (this._customError != null) {\n this._customError = false;\n }\n if (this.stepControl) {\n this.stepControl.reset();\n }\n }\n ngOnChanges() {\n // Since basically all inputs of the MatStep get proxied through the view down to the\n // underlying MatStepHeader, we have to make sure that change detection runs correctly.\n this._stepper._stateChanged();\n }\n _markAsInteracted() {\n if (!this.interacted) {\n this.interacted = true;\n this.interactedStream.emit(this);\n }\n }\n /** Determines whether the error state can be shown. */\n _showError() {\n // We want to show the error state either if the user opted into/out of it using the\n // global options, or if they've explicitly set it through the `hasError` input.\n return this._stepperOptions.showError ?? this._customError != null;\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkStep, deps: [{ token: forwardRef(() => CdkStepper) }, { token: STEPPER_GLOBAL_OPTIONS, optional: true }], target: i0.ɵɵFactoryTarget.Component }); }\n static { this.ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"16.1.0\", version: \"18.2.0-next.2\", type: CdkStep, isStandalone: true, selector: \"cdk-step\", inputs: { stepControl: \"stepControl\", label: \"label\", errorMessage: \"errorMessage\", ariaLabel: [\"aria-label\", \"ariaLabel\"], ariaLabelledby: [\"aria-labelledby\", \"ariaLabelledby\"], state: \"state\", editable: [\"editable\", \"editable\", booleanAttribute], optional: [\"optional\", \"optional\", booleanAttribute], completed: [\"completed\", \"completed\", booleanAttribute], hasError: [\"hasError\", \"hasError\", booleanAttribute] }, outputs: { interactedStream: \"interacted\" }, queries: [{ propertyName: \"stepLabel\", first: true, predicate: CdkStepLabel, descendants: true }], viewQueries: [{ propertyName: \"content\", first: true, predicate: TemplateRef, descendants: true, static: true }], exportAs: [\"cdkStep\"], usesOnChanges: true, ngImport: i0, template: '
', isInline: true, changeDetection: i0.ChangeDetectionStrategy.OnPush, encapsulation: i0.ViewEncapsulation.None }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkStep, decorators: [{\n type: Component,\n args: [{\n selector: 'cdk-step',\n exportAs: 'cdkStep',\n template: '
',\n encapsulation: ViewEncapsulation.None,\n changeDetection: ChangeDetectionStrategy.OnPush,\n standalone: true,\n }]\n }], ctorParameters: () => [{ type: CdkStepper, decorators: [{\n type: Inject,\n args: [forwardRef(() => CdkStepper)]\n }] }, { type: undefined, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [STEPPER_GLOBAL_OPTIONS]\n }] }], propDecorators: { stepLabel: [{\n type: ContentChild,\n args: [CdkStepLabel]\n }], content: [{\n type: ViewChild,\n args: [TemplateRef, { static: true }]\n }], stepControl: [{\n type: Input\n }], interactedStream: [{\n type: Output,\n args: ['interacted']\n }], label: [{\n type: Input\n }], errorMessage: [{\n type: Input\n }], ariaLabel: [{\n type: Input,\n args: ['aria-label']\n }], ariaLabelledby: [{\n type: Input,\n args: ['aria-labelledby']\n }], state: [{\n type: Input\n }], editable: [{\n type: Input,\n args: [{ transform: booleanAttribute }]\n }], optional: [{\n type: Input,\n args: [{ transform: booleanAttribute }]\n }], completed: [{\n type: Input,\n args: [{ transform: booleanAttribute }]\n }], hasError: [{\n type: Input,\n args: [{ transform: booleanAttribute }]\n }] } });\nclass CdkStepper {\n /** The index of the selected step. */\n get selectedIndex() {\n return this._selectedIndex;\n }\n set selectedIndex(index) {\n if (this.steps && this._steps) {\n // Ensure that the index can't be out of bounds.\n if (!this._isValidIndex(index) && (typeof ngDevMode === 'undefined' || ngDevMode)) {\n throw Error('cdkStepper: Cannot assign out-of-bounds value to `selectedIndex`.');\n }\n this.selected?._markAsInteracted();\n if (this._selectedIndex !== index &&\n !this._anyControlsInvalidOrPending(index) &&\n (index >= this._selectedIndex || this.steps.toArray()[index].editable)) {\n this._updateSelectedItemIndex(index);\n }\n }\n else {\n this._selectedIndex = index;\n }\n }\n /** The step that is selected. */\n get selected() {\n return this.steps ? this.steps.toArray()[this.selectedIndex] : undefined;\n }\n set selected(step) {\n this.selectedIndex = step && this.steps ? this.steps.toArray().indexOf(step) : -1;\n }\n /** Orientation of the stepper. */\n get orientation() {\n return this._orientation;\n }\n set orientation(value) {\n // This is a protected method so that `MatStepper` can hook into it.\n this._orientation = value;\n if (this._keyManager) {\n this._keyManager.withVerticalOrientation(value === 'vertical');\n }\n }\n constructor(_dir, _changeDetectorRef, _elementRef) {\n this._dir = _dir;\n this._changeDetectorRef = _changeDetectorRef;\n this._elementRef = _elementRef;\n /** Emits when the component is destroyed. */\n this._destroyed = new Subject();\n /** Steps that belong to the current stepper, excluding ones from nested steppers. */\n this.steps = new QueryList();\n /** List of step headers sorted based on their DOM order. */\n this._sortedHeaders = new QueryList();\n /** Whether the validity of previous steps should be checked or not. */\n this.linear = false;\n this._selectedIndex = 0;\n /** Event emitted when the selected step has changed. */\n this.selectionChange = new EventEmitter();\n /** Output to support two-way binding on `[(selectedIndex)]` */\n this.selectedIndexChange = new EventEmitter();\n this._orientation = 'horizontal';\n this._groupId = nextId++;\n }\n ngAfterContentInit() {\n this._steps.changes\n .pipe(startWith(this._steps), takeUntil(this._destroyed))\n .subscribe((steps) => {\n this.steps.reset(steps.filter(step => step._stepper === this));\n this.steps.notifyOnChanges();\n });\n }\n ngAfterViewInit() {\n // If the step headers are defined outside of the `ngFor` that renders the steps, like in the\n // Material stepper, they won't appear in the `QueryList` in the same order as they're\n // rendered in the DOM which will lead to incorrect keyboard navigation. We need to sort\n // them manually to ensure that they're correct. Alternatively, we can change the Material\n // template to inline the headers in the `ngFor`, but that'll result in a lot of\n // code duplication. See #23539.\n this._stepHeader.changes\n .pipe(startWith(this._stepHeader), takeUntil(this._destroyed))\n .subscribe((headers) => {\n this._sortedHeaders.reset(headers.toArray().sort((a, b) => {\n const documentPosition = a._elementRef.nativeElement.compareDocumentPosition(b._elementRef.nativeElement);\n // `compareDocumentPosition` returns a bitmask so we have to use a bitwise operator.\n // https://developer.mozilla.org/en-US/docs/Web/API/Node/compareDocumentPosition\n // tslint:disable-next-line:no-bitwise\n return documentPosition & Node.DOCUMENT_POSITION_FOLLOWING ? -1 : 1;\n }));\n this._sortedHeaders.notifyOnChanges();\n });\n // Note that while the step headers are content children by default, any components that\n // extend this one might have them as view children. We initialize the keyboard handling in\n // AfterViewInit so we're guaranteed for both view and content children to be defined.\n this._keyManager = new FocusKeyManager(this._sortedHeaders)\n .withWrap()\n .withHomeAndEnd()\n .withVerticalOrientation(this._orientation === 'vertical');\n (this._dir ? this._dir.change : of())\n .pipe(startWith(this._layoutDirection()), takeUntil(this._destroyed))\n .subscribe(direction => this._keyManager.withHorizontalOrientation(direction));\n this._keyManager.updateActiveItem(this._selectedIndex);\n // No need to `takeUntil` here, because we're the ones destroying `steps`.\n this.steps.changes.subscribe(() => {\n if (!this.selected) {\n this._selectedIndex = Math.max(this._selectedIndex - 1, 0);\n }\n });\n // The logic which asserts that the selected index is within bounds doesn't run before the\n // steps are initialized, because we don't how many steps there are yet so we may have an\n // invalid index on init. If that's the case, auto-correct to the default so we don't throw.\n if (!this._isValidIndex(this._selectedIndex)) {\n this._selectedIndex = 0;\n }\n }\n ngOnDestroy() {\n this._keyManager?.destroy();\n this.steps.destroy();\n this._sortedHeaders.destroy();\n this._destroyed.next();\n this._destroyed.complete();\n }\n /** Selects and focuses the next step in list. */\n next() {\n this.selectedIndex = Math.min(this._selectedIndex + 1, this.steps.length - 1);\n }\n /** Selects and focuses the previous step in list. */\n previous() {\n this.selectedIndex = Math.max(this._selectedIndex - 1, 0);\n }\n /** Resets the stepper to its initial state. Note that this includes clearing form data. */\n reset() {\n this._updateSelectedItemIndex(0);\n this.steps.forEach(step => step.reset());\n this._stateChanged();\n }\n /** Returns a unique id for each step label element. */\n _getStepLabelId(i) {\n return `cdk-step-label-${this._groupId}-${i}`;\n }\n /** Returns unique id for each step content element. */\n _getStepContentId(i) {\n return `cdk-step-content-${this._groupId}-${i}`;\n }\n /** Marks the component to be change detected. */\n _stateChanged() {\n this._changeDetectorRef.markForCheck();\n }\n /** Returns position state of the step with the given index. */\n _getAnimationDirection(index) {\n const position = index - this._selectedIndex;\n if (position < 0) {\n return this._layoutDirection() === 'rtl' ? 'next' : 'previous';\n }\n else if (position > 0) {\n return this._layoutDirection() === 'rtl' ? 'previous' : 'next';\n }\n return 'current';\n }\n /** Returns the type of icon to be displayed. */\n _getIndicatorType(index, state = STEP_STATE.NUMBER) {\n const step = this.steps.toArray()[index];\n const isCurrentStep = this._isCurrentStep(index);\n return step._displayDefaultIndicatorType\n ? this._getDefaultIndicatorLogic(step, isCurrentStep)\n : this._getGuidelineLogic(step, isCurrentStep, state);\n }\n _getDefaultIndicatorLogic(step, isCurrentStep) {\n if (step._showError() && step.hasError && !isCurrentStep) {\n return STEP_STATE.ERROR;\n }\n else if (!step.completed || isCurrentStep) {\n return STEP_STATE.NUMBER;\n }\n else {\n return step.editable ? STEP_STATE.EDIT : STEP_STATE.DONE;\n }\n }\n _getGuidelineLogic(step, isCurrentStep, state = STEP_STATE.NUMBER) {\n if (step._showError() && step.hasError && !isCurrentStep) {\n return STEP_STATE.ERROR;\n }\n else if (step.completed && !isCurrentStep) {\n return STEP_STATE.DONE;\n }\n else if (step.completed && isCurrentStep) {\n return state;\n }\n else if (step.editable && isCurrentStep) {\n return STEP_STATE.EDIT;\n }\n else {\n return state;\n }\n }\n _isCurrentStep(index) {\n return this._selectedIndex === index;\n }\n /** Returns the index of the currently-focused step header. */\n _getFocusIndex() {\n return this._keyManager ? this._keyManager.activeItemIndex : this._selectedIndex;\n }\n _updateSelectedItemIndex(newIndex) {\n const stepsArray = this.steps.toArray();\n this.selectionChange.emit({\n selectedIndex: newIndex,\n previouslySelectedIndex: this._selectedIndex,\n selectedStep: stepsArray[newIndex],\n previouslySelectedStep: stepsArray[this._selectedIndex],\n });\n // If focus is inside the stepper, move it to the next header, otherwise it may become\n // lost when the active step content is hidden. We can't be more granular with the check\n // (e.g. checking whether focus is inside the active step), because we don't have a\n // reference to the elements that are rendering out the content.\n this._containsFocus()\n ? this._keyManager.setActiveItem(newIndex)\n : this._keyManager.updateActiveItem(newIndex);\n this._selectedIndex = newIndex;\n this.selectedIndexChange.emit(this._selectedIndex);\n this._stateChanged();\n }\n _onKeydown(event) {\n const hasModifier = hasModifierKey(event);\n const keyCode = event.keyCode;\n const manager = this._keyManager;\n if (manager.activeItemIndex != null &&\n !hasModifier &&\n (keyCode === SPACE || keyCode === ENTER)) {\n this.selectedIndex = manager.activeItemIndex;\n event.preventDefault();\n }\n else {\n manager.setFocusOrigin('keyboard').onKeydown(event);\n }\n }\n _anyControlsInvalidOrPending(index) {\n if (this.linear && index >= 0) {\n return this.steps\n .toArray()\n .slice(0, index)\n .some(step => {\n const control = step.stepControl;\n const isIncomplete = control\n ? control.invalid || control.pending || !step.interacted\n : !step.completed;\n return isIncomplete && !step.optional && !step._completedOverride;\n });\n }\n return false;\n }\n _layoutDirection() {\n return this._dir && this._dir.value === 'rtl' ? 'rtl' : 'ltr';\n }\n /** Checks whether the stepper contains the focused element. */\n _containsFocus() {\n const stepperElement = this._elementRef.nativeElement;\n const focusedElement = _getFocusedElementPierceShadowDom();\n return stepperElement === focusedElement || stepperElement.contains(focusedElement);\n }\n /** Checks whether the passed-in index is a valid step index. */\n _isValidIndex(index) {\n return index > -1 && (!this.steps || index < this.steps.length);\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkStepper, deps: [{ token: i1.Directionality, optional: true }, { token: i0.ChangeDetectorRef }, { token: i0.ElementRef }], target: i0.ɵɵFactoryTarget.Directive }); }\n static { this.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"16.1.0\", version: \"18.2.0-next.2\", type: CdkStepper, isStandalone: true, selector: \"[cdkStepper]\", inputs: { linear: [\"linear\", \"linear\", booleanAttribute], selectedIndex: [\"selectedIndex\", \"selectedIndex\", numberAttribute], selected: \"selected\", orientation: \"orientation\" }, outputs: { selectionChange: \"selectionChange\", selectedIndexChange: \"selectedIndexChange\" }, queries: [{ propertyName: \"_steps\", predicate: CdkStep, descendants: true }, { propertyName: \"_stepHeader\", predicate: CdkStepHeader, descendants: true }], exportAs: [\"cdkStepper\"], ngImport: i0 }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkStepper, decorators: [{\n type: Directive,\n args: [{\n selector: '[cdkStepper]',\n exportAs: 'cdkStepper',\n standalone: true,\n }]\n }], ctorParameters: () => [{ type: i1.Directionality, decorators: [{\n type: Optional\n }] }, { type: i0.ChangeDetectorRef }, { type: i0.ElementRef }], propDecorators: { _steps: [{\n type: ContentChildren,\n args: [CdkStep, { descendants: true }]\n }], _stepHeader: [{\n type: ContentChildren,\n args: [CdkStepHeader, { descendants: true }]\n }], linear: [{\n type: Input,\n args: [{ transform: booleanAttribute }]\n }], selectedIndex: [{\n type: Input,\n args: [{ transform: numberAttribute }]\n }], selected: [{\n type: Input\n }], selectionChange: [{\n type: Output\n }], selectedIndexChange: [{\n type: Output\n }], orientation: [{\n type: Input\n }] } });\n\n/** Button that moves to the next step in a stepper workflow. */\nclass CdkStepperNext {\n constructor(_stepper) {\n this._stepper = _stepper;\n /** Type of the next button. Defaults to \"submit\" if not specified. */\n this.type = 'submit';\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkStepperNext, deps: [{ token: CdkStepper }], target: i0.ɵɵFactoryTarget.Directive }); }\n static { this.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"18.2.0-next.2\", type: CdkStepperNext, isStandalone: true, selector: \"button[cdkStepperNext]\", inputs: { type: \"type\" }, host: { listeners: { \"click\": \"_stepper.next()\" }, properties: { \"type\": \"type\" } }, ngImport: i0 }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkStepperNext, decorators: [{\n type: Directive,\n args: [{\n selector: 'button[cdkStepperNext]',\n host: {\n '[type]': 'type',\n '(click)': '_stepper.next()',\n },\n standalone: true,\n }]\n }], ctorParameters: () => [{ type: CdkStepper }], propDecorators: { type: [{\n type: Input\n }] } });\n/** Button that moves to the previous step in a stepper workflow. */\nclass CdkStepperPrevious {\n constructor(_stepper) {\n this._stepper = _stepper;\n /** Type of the previous button. Defaults to \"button\" if not specified. */\n this.type = 'button';\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkStepperPrevious, deps: [{ token: CdkStepper }], target: i0.ɵɵFactoryTarget.Directive }); }\n static { this.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"18.2.0-next.2\", type: CdkStepperPrevious, isStandalone: true, selector: \"button[cdkStepperPrevious]\", inputs: { type: \"type\" }, host: { listeners: { \"click\": \"_stepper.previous()\" }, properties: { \"type\": \"type\" } }, ngImport: i0 }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkStepperPrevious, decorators: [{\n type: Directive,\n args: [{\n selector: 'button[cdkStepperPrevious]',\n host: {\n '[type]': 'type',\n '(click)': '_stepper.previous()',\n },\n standalone: true,\n }]\n }], ctorParameters: () => [{ type: CdkStepper }], propDecorators: { type: [{\n type: Input\n }] } });\n\nclass CdkStepperModule {\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkStepperModule, deps: [], target: i0.ɵɵFactoryTarget.NgModule }); }\n static { this.ɵmod = i0.ɵɵngDeclareNgModule({ minVersion: \"14.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkStepperModule, imports: [BidiModule,\n CdkStep,\n CdkStepper,\n CdkStepHeader,\n CdkStepLabel,\n CdkStepperNext,\n CdkStepperPrevious], exports: [CdkStep, CdkStepper, CdkStepHeader, CdkStepLabel, CdkStepperNext, CdkStepperPrevious] }); }\n static { this.ɵinj = i0.ɵɵngDeclareInjector({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkStepperModule, imports: [BidiModule] }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkStepperModule, decorators: [{\n type: NgModule,\n args: [{\n imports: [\n BidiModule,\n CdkStep,\n CdkStepper,\n CdkStepHeader,\n CdkStepLabel,\n CdkStepperNext,\n CdkStepperPrevious,\n ],\n exports: [CdkStep, CdkStepper, CdkStepHeader, CdkStepLabel, CdkStepperNext, CdkStepperPrevious],\n }]\n }] });\n\n/**\n * Generated bundle index. Do not edit.\n */\n\nexport { CdkStep, CdkStepHeader, CdkStepLabel, CdkStepper, CdkStepperModule, CdkStepperNext, CdkStepperPrevious, STEPPER_GLOBAL_OPTIONS, STEP_STATE, StepperSelectionEvent };\n","import * as i1 from '@angular/cdk/bidi';\nimport { _VIEW_REPEATER_STRATEGY, _RecycleViewRepeaterStrategy, isDataSource, _ViewRepeaterOperation, _DisposeViewRepeaterStrategy } from '@angular/cdk/collections';\nexport { DataSource } from '@angular/cdk/collections';\nimport * as i2 from '@angular/cdk/platform';\nimport * as i3 from '@angular/cdk/scrolling';\nimport { ScrollingModule } from '@angular/cdk/scrolling';\nimport { DOCUMENT } from '@angular/common';\nimport * as i0 from '@angular/core';\nimport { InjectionToken, Directive, booleanAttribute, Inject, Optional, Input, ContentChild, inject, NgZone, Injectable, Component, ChangeDetectionStrategy, ViewEncapsulation, EmbeddedViewRef, EventEmitter, Injector, afterNextRender, Attribute, SkipSelf, Output, ContentChildren, ViewChild, NgModule } from '@angular/core';\nimport { Subject, BehaviorSubject, isObservable, of } from 'rxjs';\nimport { takeUntil } from 'rxjs/operators';\nimport { coerceBooleanProperty } from '@angular/cdk/coercion';\n\n/**\n * Used to provide a table to some of the sub-components without causing a circular dependency.\n * @docs-private\n */\nconst CDK_TABLE = new InjectionToken('CDK_TABLE');\n/** Injection token that can be used to specify the text column options. */\nconst TEXT_COLUMN_OPTIONS = new InjectionToken('text-column-options');\n\n/**\n * Cell definition for a CDK table.\n * Captures the template of a column's data row cell as well as cell-specific properties.\n */\nclass CdkCellDef {\n constructor(/** @docs-private */ template) {\n this.template = template;\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkCellDef, deps: [{ token: i0.TemplateRef }], target: i0.ɵɵFactoryTarget.Directive }); }\n static { this.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"18.2.0-next.2\", type: CdkCellDef, isStandalone: true, selector: \"[cdkCellDef]\", ngImport: i0 }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkCellDef, decorators: [{\n type: Directive,\n args: [{\n selector: '[cdkCellDef]',\n standalone: true,\n }]\n }], ctorParameters: () => [{ type: i0.TemplateRef }] });\n/**\n * Header cell definition for a CDK table.\n * Captures the template of a column's header cell and as well as cell-specific properties.\n */\nclass CdkHeaderCellDef {\n constructor(/** @docs-private */ template) {\n this.template = template;\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkHeaderCellDef, deps: [{ token: i0.TemplateRef }], target: i0.ɵɵFactoryTarget.Directive }); }\n static { this.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"18.2.0-next.2\", type: CdkHeaderCellDef, isStandalone: true, selector: \"[cdkHeaderCellDef]\", ngImport: i0 }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkHeaderCellDef, decorators: [{\n type: Directive,\n args: [{\n selector: '[cdkHeaderCellDef]',\n standalone: true,\n }]\n }], ctorParameters: () => [{ type: i0.TemplateRef }] });\n/**\n * Footer cell definition for a CDK table.\n * Captures the template of a column's footer cell and as well as cell-specific properties.\n */\nclass CdkFooterCellDef {\n constructor(/** @docs-private */ template) {\n this.template = template;\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkFooterCellDef, deps: [{ token: i0.TemplateRef }], target: i0.ɵɵFactoryTarget.Directive }); }\n static { this.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"18.2.0-next.2\", type: CdkFooterCellDef, isStandalone: true, selector: \"[cdkFooterCellDef]\", ngImport: i0 }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkFooterCellDef, decorators: [{\n type: Directive,\n args: [{\n selector: '[cdkFooterCellDef]',\n standalone: true,\n }]\n }], ctorParameters: () => [{ type: i0.TemplateRef }] });\n/**\n * Column definition for the CDK table.\n * Defines a set of cells available for a table column.\n */\nclass CdkColumnDef {\n /** Unique name for this column. */\n get name() {\n return this._name;\n }\n set name(name) {\n this._setNameInput(name);\n }\n /** Whether the cell is sticky. */\n get sticky() {\n return this._sticky;\n }\n set sticky(value) {\n if (value !== this._sticky) {\n this._sticky = value;\n this._hasStickyChanged = true;\n }\n }\n /**\n * Whether this column should be sticky positioned on the end of the row. Should make sure\n * that it mimics the `CanStick` mixin such that `_hasStickyChanged` is set to true if the value\n * has been changed.\n */\n get stickyEnd() {\n return this._stickyEnd;\n }\n set stickyEnd(value) {\n if (value !== this._stickyEnd) {\n this._stickyEnd = value;\n this._hasStickyChanged = true;\n }\n }\n constructor(_table) {\n this._table = _table;\n this._hasStickyChanged = false;\n this._sticky = false;\n this._stickyEnd = false;\n }\n /** Whether the sticky state has changed. */\n hasStickyChanged() {\n const hasStickyChanged = this._hasStickyChanged;\n this.resetStickyChanged();\n return hasStickyChanged;\n }\n /** Resets the sticky changed state. */\n resetStickyChanged() {\n this._hasStickyChanged = false;\n }\n /**\n * Overridable method that sets the css classes that will be added to every cell in this\n * column.\n * In the future, columnCssClassName will change from type string[] to string and this\n * will set a single string value.\n * @docs-private\n */\n _updateColumnCssClassName() {\n this._columnCssClassName = [`cdk-column-${this.cssClassFriendlyName}`];\n }\n /**\n * This has been extracted to a util because of TS 4 and VE.\n * View Engine doesn't support property rename inheritance.\n * TS 4.0 doesn't allow properties to override accessors or vice-versa.\n * @docs-private\n */\n _setNameInput(value) {\n // If the directive is set without a name (updated programmatically), then this setter will\n // trigger with an empty string and should not overwrite the programmatically set value.\n if (value) {\n this._name = value;\n this.cssClassFriendlyName = value.replace(/[^a-z0-9_-]/gi, '-');\n this._updateColumnCssClassName();\n }\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkColumnDef, deps: [{ token: CDK_TABLE, optional: true }], target: i0.ɵɵFactoryTarget.Directive }); }\n static { this.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"16.1.0\", version: \"18.2.0-next.2\", type: CdkColumnDef, isStandalone: true, selector: \"[cdkColumnDef]\", inputs: { name: [\"cdkColumnDef\", \"name\"], sticky: [\"sticky\", \"sticky\", booleanAttribute], stickyEnd: [\"stickyEnd\", \"stickyEnd\", booleanAttribute] }, providers: [{ provide: 'MAT_SORT_HEADER_COLUMN_DEF', useExisting: CdkColumnDef }], queries: [{ propertyName: \"cell\", first: true, predicate: CdkCellDef, descendants: true }, { propertyName: \"headerCell\", first: true, predicate: CdkHeaderCellDef, descendants: true }, { propertyName: \"footerCell\", first: true, predicate: CdkFooterCellDef, descendants: true }], ngImport: i0 }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkColumnDef, decorators: [{\n type: Directive,\n args: [{\n selector: '[cdkColumnDef]',\n providers: [{ provide: 'MAT_SORT_HEADER_COLUMN_DEF', useExisting: CdkColumnDef }],\n standalone: true,\n }]\n }], ctorParameters: () => [{ type: undefined, decorators: [{\n type: Inject,\n args: [CDK_TABLE]\n }, {\n type: Optional\n }] }], propDecorators: { name: [{\n type: Input,\n args: ['cdkColumnDef']\n }], sticky: [{\n type: Input,\n args: [{ transform: booleanAttribute }]\n }], stickyEnd: [{\n type: Input,\n args: [{ transform: booleanAttribute }]\n }], cell: [{\n type: ContentChild,\n args: [CdkCellDef]\n }], headerCell: [{\n type: ContentChild,\n args: [CdkHeaderCellDef]\n }], footerCell: [{\n type: ContentChild,\n args: [CdkFooterCellDef]\n }] } });\n/** Base class for the cells. Adds a CSS classname that identifies the column it renders in. */\nclass BaseCdkCell {\n constructor(columnDef, elementRef) {\n elementRef.nativeElement.classList.add(...columnDef._columnCssClassName);\n }\n}\n/** Header cell template container that adds the right classes and role. */\nclass CdkHeaderCell extends BaseCdkCell {\n constructor(columnDef, elementRef) {\n super(columnDef, elementRef);\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkHeaderCell, deps: [{ token: CdkColumnDef }, { token: i0.ElementRef }], target: i0.ɵɵFactoryTarget.Directive }); }\n static { this.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"18.2.0-next.2\", type: CdkHeaderCell, isStandalone: true, selector: \"cdk-header-cell, th[cdk-header-cell]\", host: { attributes: { \"role\": \"columnheader\" }, classAttribute: \"cdk-header-cell\" }, usesInheritance: true, ngImport: i0 }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkHeaderCell, decorators: [{\n type: Directive,\n args: [{\n selector: 'cdk-header-cell, th[cdk-header-cell]',\n host: {\n 'class': 'cdk-header-cell',\n 'role': 'columnheader',\n },\n standalone: true,\n }]\n }], ctorParameters: () => [{ type: CdkColumnDef }, { type: i0.ElementRef }] });\n/** Footer cell template container that adds the right classes and role. */\nclass CdkFooterCell extends BaseCdkCell {\n constructor(columnDef, elementRef) {\n super(columnDef, elementRef);\n const role = columnDef._table?._getCellRole();\n if (role) {\n elementRef.nativeElement.setAttribute('role', role);\n }\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkFooterCell, deps: [{ token: CdkColumnDef }, { token: i0.ElementRef }], target: i0.ɵɵFactoryTarget.Directive }); }\n static { this.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"18.2.0-next.2\", type: CdkFooterCell, isStandalone: true, selector: \"cdk-footer-cell, td[cdk-footer-cell]\", host: { classAttribute: \"cdk-footer-cell\" }, usesInheritance: true, ngImport: i0 }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkFooterCell, decorators: [{\n type: Directive,\n args: [{\n selector: 'cdk-footer-cell, td[cdk-footer-cell]',\n host: {\n 'class': 'cdk-footer-cell',\n },\n standalone: true,\n }]\n }], ctorParameters: () => [{ type: CdkColumnDef }, { type: i0.ElementRef }] });\n/** Cell template container that adds the right classes and role. */\nclass CdkCell extends BaseCdkCell {\n constructor(columnDef, elementRef) {\n super(columnDef, elementRef);\n const role = columnDef._table?._getCellRole();\n if (role) {\n elementRef.nativeElement.setAttribute('role', role);\n }\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkCell, deps: [{ token: CdkColumnDef }, { token: i0.ElementRef }], target: i0.ɵɵFactoryTarget.Directive }); }\n static { this.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"18.2.0-next.2\", type: CdkCell, isStandalone: true, selector: \"cdk-cell, td[cdk-cell]\", host: { classAttribute: \"cdk-cell\" }, usesInheritance: true, ngImport: i0 }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkCell, decorators: [{\n type: Directive,\n args: [{\n selector: 'cdk-cell, td[cdk-cell]',\n host: {\n 'class': 'cdk-cell',\n },\n standalone: true,\n }]\n }], ctorParameters: () => [{ type: CdkColumnDef }, { type: i0.ElementRef }] });\n\n/**\n * @docs-private\n */\nclass _Schedule {\n constructor() {\n this.tasks = [];\n this.endTasks = [];\n }\n}\n/** Injection token used to provide a coalesced style scheduler. */\nconst _COALESCED_STYLE_SCHEDULER = new InjectionToken('_COALESCED_STYLE_SCHEDULER');\n/**\n * Allows grouping up CSSDom mutations after the current execution context.\n * This can significantly improve performance when separate consecutive functions are\n * reading from the CSSDom and then mutating it.\n *\n * @docs-private\n */\nclass _CoalescedStyleScheduler {\n constructor(_unusedNgZone) {\n this._currentSchedule = null;\n this._ngZone = inject(NgZone);\n }\n /**\n * Schedules the specified task to run at the end of the current VM turn.\n */\n schedule(task) {\n this._createScheduleIfNeeded();\n this._currentSchedule.tasks.push(task);\n }\n /**\n * Schedules the specified task to run after other scheduled tasks at the end of the current\n * VM turn.\n */\n scheduleEnd(task) {\n this._createScheduleIfNeeded();\n this._currentSchedule.endTasks.push(task);\n }\n _createScheduleIfNeeded() {\n if (this._currentSchedule) {\n return;\n }\n this._currentSchedule = new _Schedule();\n this._ngZone.runOutsideAngular(() => \n // TODO(mmalerba): Scheduling this using something that runs less frequently\n // (e.g. requestAnimationFrame, setTimeout, etc.) causes noticeable jank with the column\n // resizer. We should audit the usages of schedule / scheduleEnd in that component and see\n // if we can refactor it so that we don't need to flush the tasks quite so frequently.\n queueMicrotask(() => {\n while (this._currentSchedule.tasks.length || this._currentSchedule.endTasks.length) {\n const schedule = this._currentSchedule;\n // Capture new tasks scheduled by the current set of tasks.\n this._currentSchedule = new _Schedule();\n for (const task of schedule.tasks) {\n task();\n }\n for (const task of schedule.endTasks) {\n task();\n }\n }\n this._currentSchedule = null;\n }));\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: _CoalescedStyleScheduler, deps: [{ token: i0.NgZone }], target: i0.ɵɵFactoryTarget.Injectable }); }\n static { this.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: _CoalescedStyleScheduler }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: _CoalescedStyleScheduler, decorators: [{\n type: Injectable\n }], ctorParameters: () => [{ type: i0.NgZone }] });\n\n/**\n * The row template that can be used by the mat-table. Should not be used outside of the\n * material library.\n */\nconst CDK_ROW_TEMPLATE = `
`;\n/**\n * Base class for the CdkHeaderRowDef and CdkRowDef that handles checking their columns inputs\n * for changes and notifying the table.\n */\nclass BaseRowDef {\n constructor(\n /** @docs-private */ template, _differs) {\n this.template = template;\n this._differs = _differs;\n }\n ngOnChanges(changes) {\n // Create a new columns differ if one does not yet exist. Initialize it based on initial value\n // of the columns property or an empty array if none is provided.\n if (!this._columnsDiffer) {\n const columns = (changes['columns'] && changes['columns'].currentValue) || [];\n this._columnsDiffer = this._differs.find(columns).create();\n this._columnsDiffer.diff(columns);\n }\n }\n /**\n * Returns the difference between the current columns and the columns from the last diff, or null\n * if there is no difference.\n */\n getColumnsDiff() {\n return this._columnsDiffer.diff(this.columns);\n }\n /** Gets this row def's relevant cell template from the provided column def. */\n extractCellTemplate(column) {\n if (this instanceof CdkHeaderRowDef) {\n return column.headerCell.template;\n }\n if (this instanceof CdkFooterRowDef) {\n return column.footerCell.template;\n }\n else {\n return column.cell.template;\n }\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: BaseRowDef, deps: [{ token: i0.TemplateRef }, { token: i0.IterableDiffers }], target: i0.ɵɵFactoryTarget.Directive }); }\n static { this.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"18.2.0-next.2\", type: BaseRowDef, usesOnChanges: true, ngImport: i0 }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: BaseRowDef, decorators: [{\n type: Directive\n }], ctorParameters: () => [{ type: i0.TemplateRef }, { type: i0.IterableDiffers }] });\n/**\n * Header row definition for the CDK table.\n * Captures the header row's template and other header properties such as the columns to display.\n */\nclass CdkHeaderRowDef extends BaseRowDef {\n /** Whether the row is sticky. */\n get sticky() {\n return this._sticky;\n }\n set sticky(value) {\n if (value !== this._sticky) {\n this._sticky = value;\n this._hasStickyChanged = true;\n }\n }\n constructor(template, _differs, _table) {\n super(template, _differs);\n this._table = _table;\n this._hasStickyChanged = false;\n this._sticky = false;\n }\n // Prerender fails to recognize that ngOnChanges in a part of this class through inheritance.\n // Explicitly define it so that the method is called as part of the Angular lifecycle.\n ngOnChanges(changes) {\n super.ngOnChanges(changes);\n }\n /** Whether the sticky state has changed. */\n hasStickyChanged() {\n const hasStickyChanged = this._hasStickyChanged;\n this.resetStickyChanged();\n return hasStickyChanged;\n }\n /** Resets the sticky changed state. */\n resetStickyChanged() {\n this._hasStickyChanged = false;\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkHeaderRowDef, deps: [{ token: i0.TemplateRef }, { token: i0.IterableDiffers }, { token: CDK_TABLE, optional: true }], target: i0.ɵɵFactoryTarget.Directive }); }\n static { this.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"16.1.0\", version: \"18.2.0-next.2\", type: CdkHeaderRowDef, isStandalone: true, selector: \"[cdkHeaderRowDef]\", inputs: { columns: [\"cdkHeaderRowDef\", \"columns\"], sticky: [\"cdkHeaderRowDefSticky\", \"sticky\", booleanAttribute] }, usesInheritance: true, usesOnChanges: true, ngImport: i0 }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkHeaderRowDef, decorators: [{\n type: Directive,\n args: [{\n selector: '[cdkHeaderRowDef]',\n inputs: [{ name: 'columns', alias: 'cdkHeaderRowDef' }],\n standalone: true,\n }]\n }], ctorParameters: () => [{ type: i0.TemplateRef }, { type: i0.IterableDiffers }, { type: undefined, decorators: [{\n type: Inject,\n args: [CDK_TABLE]\n }, {\n type: Optional\n }] }], propDecorators: { sticky: [{\n type: Input,\n args: [{ alias: 'cdkHeaderRowDefSticky', transform: booleanAttribute }]\n }] } });\n/**\n * Footer row definition for the CDK table.\n * Captures the footer row's template and other footer properties such as the columns to display.\n */\nclass CdkFooterRowDef extends BaseRowDef {\n /** Whether the row is sticky. */\n get sticky() {\n return this._sticky;\n }\n set sticky(value) {\n if (value !== this._sticky) {\n this._sticky = value;\n this._hasStickyChanged = true;\n }\n }\n constructor(template, _differs, _table) {\n super(template, _differs);\n this._table = _table;\n this._hasStickyChanged = false;\n this._sticky = false;\n }\n // Prerender fails to recognize that ngOnChanges in a part of this class through inheritance.\n // Explicitly define it so that the method is called as part of the Angular lifecycle.\n ngOnChanges(changes) {\n super.ngOnChanges(changes);\n }\n /** Whether the sticky state has changed. */\n hasStickyChanged() {\n const hasStickyChanged = this._hasStickyChanged;\n this.resetStickyChanged();\n return hasStickyChanged;\n }\n /** Resets the sticky changed state. */\n resetStickyChanged() {\n this._hasStickyChanged = false;\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkFooterRowDef, deps: [{ token: i0.TemplateRef }, { token: i0.IterableDiffers }, { token: CDK_TABLE, optional: true }], target: i0.ɵɵFactoryTarget.Directive }); }\n static { this.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"16.1.0\", version: \"18.2.0-next.2\", type: CdkFooterRowDef, isStandalone: true, selector: \"[cdkFooterRowDef]\", inputs: { columns: [\"cdkFooterRowDef\", \"columns\"], sticky: [\"cdkFooterRowDefSticky\", \"sticky\", booleanAttribute] }, usesInheritance: true, usesOnChanges: true, ngImport: i0 }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkFooterRowDef, decorators: [{\n type: Directive,\n args: [{\n selector: '[cdkFooterRowDef]',\n inputs: [{ name: 'columns', alias: 'cdkFooterRowDef' }],\n standalone: true,\n }]\n }], ctorParameters: () => [{ type: i0.TemplateRef }, { type: i0.IterableDiffers }, { type: undefined, decorators: [{\n type: Inject,\n args: [CDK_TABLE]\n }, {\n type: Optional\n }] }], propDecorators: { sticky: [{\n type: Input,\n args: [{ alias: 'cdkFooterRowDefSticky', transform: booleanAttribute }]\n }] } });\n/**\n * Data row definition for the CDK table.\n * Captures the header row's template and other row properties such as the columns to display and\n * a when predicate that describes when this row should be used.\n */\nclass CdkRowDef extends BaseRowDef {\n // TODO(andrewseguin): Add an input for providing a switch function to determine\n // if this template should be used.\n constructor(template, _differs, _table) {\n super(template, _differs);\n this._table = _table;\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkRowDef, deps: [{ token: i0.TemplateRef }, { token: i0.IterableDiffers }, { token: CDK_TABLE, optional: true }], target: i0.ɵɵFactoryTarget.Directive }); }\n static { this.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"18.2.0-next.2\", type: CdkRowDef, isStandalone: true, selector: \"[cdkRowDef]\", inputs: { columns: [\"cdkRowDefColumns\", \"columns\"], when: [\"cdkRowDefWhen\", \"when\"] }, usesInheritance: true, ngImport: i0 }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkRowDef, decorators: [{\n type: Directive,\n args: [{\n selector: '[cdkRowDef]',\n inputs: [\n { name: 'columns', alias: 'cdkRowDefColumns' },\n { name: 'when', alias: 'cdkRowDefWhen' },\n ],\n standalone: true,\n }]\n }], ctorParameters: () => [{ type: i0.TemplateRef }, { type: i0.IterableDiffers }, { type: undefined, decorators: [{\n type: Inject,\n args: [CDK_TABLE]\n }, {\n type: Optional\n }] }] });\n/**\n * Outlet for rendering cells inside of a row or header row.\n * @docs-private\n */\nclass CdkCellOutlet {\n /**\n * Static property containing the latest constructed instance of this class.\n * Used by the CDK table when each CdkHeaderRow and CdkRow component is created using\n * createEmbeddedView. After one of these components are created, this property will provide\n * a handle to provide that component's cells and context. After init, the CdkCellOutlet will\n * construct the cells with the provided context.\n */\n static { this.mostRecentCellOutlet = null; }\n constructor(_viewContainer) {\n this._viewContainer = _viewContainer;\n CdkCellOutlet.mostRecentCellOutlet = this;\n }\n ngOnDestroy() {\n // If this was the last outlet being rendered in the view, remove the reference\n // from the static property after it has been destroyed to avoid leaking memory.\n if (CdkCellOutlet.mostRecentCellOutlet === this) {\n CdkCellOutlet.mostRecentCellOutlet = null;\n }\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkCellOutlet, deps: [{ token: i0.ViewContainerRef }], target: i0.ɵɵFactoryTarget.Directive }); }\n static { this.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"18.2.0-next.2\", type: CdkCellOutlet, isStandalone: true, selector: \"[cdkCellOutlet]\", ngImport: i0 }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkCellOutlet, decorators: [{\n type: Directive,\n args: [{\n selector: '[cdkCellOutlet]',\n standalone: true,\n }]\n }], ctorParameters: () => [{ type: i0.ViewContainerRef }] });\n/** Header template container that contains the cell outlet. Adds the right class and role. */\nclass CdkHeaderRow {\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkHeaderRow, deps: [], target: i0.ɵɵFactoryTarget.Component }); }\n static { this.ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"18.2.0-next.2\", type: CdkHeaderRow, isStandalone: true, selector: \"cdk-header-row, tr[cdk-header-row]\", host: { attributes: { \"role\": \"row\" }, classAttribute: \"cdk-header-row\" }, ngImport: i0, template: \"
\", isInline: true, dependencies: [{ kind: \"directive\", type: CdkCellOutlet, selector: \"[cdkCellOutlet]\" }], changeDetection: i0.ChangeDetectionStrategy.Default, encapsulation: i0.ViewEncapsulation.None }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkHeaderRow, decorators: [{\n type: Component,\n args: [{\n selector: 'cdk-header-row, tr[cdk-header-row]',\n template: CDK_ROW_TEMPLATE,\n host: {\n 'class': 'cdk-header-row',\n 'role': 'row',\n },\n // See note on CdkTable for explanation on why this uses the default change detection strategy.\n // tslint:disable-next-line:validate-decorators\n changeDetection: ChangeDetectionStrategy.Default,\n encapsulation: ViewEncapsulation.None,\n standalone: true,\n imports: [CdkCellOutlet],\n }]\n }] });\n/** Footer template container that contains the cell outlet. Adds the right class and role. */\nclass CdkFooterRow {\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkFooterRow, deps: [], target: i0.ɵɵFactoryTarget.Component }); }\n static { this.ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"18.2.0-next.2\", type: CdkFooterRow, isStandalone: true, selector: \"cdk-footer-row, tr[cdk-footer-row]\", host: { attributes: { \"role\": \"row\" }, classAttribute: \"cdk-footer-row\" }, ngImport: i0, template: \"
\", isInline: true, dependencies: [{ kind: \"directive\", type: CdkCellOutlet, selector: \"[cdkCellOutlet]\" }], changeDetection: i0.ChangeDetectionStrategy.Default, encapsulation: i0.ViewEncapsulation.None }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkFooterRow, decorators: [{\n type: Component,\n args: [{\n selector: 'cdk-footer-row, tr[cdk-footer-row]',\n template: CDK_ROW_TEMPLATE,\n host: {\n 'class': 'cdk-footer-row',\n 'role': 'row',\n },\n // See note on CdkTable for explanation on why this uses the default change detection strategy.\n // tslint:disable-next-line:validate-decorators\n changeDetection: ChangeDetectionStrategy.Default,\n encapsulation: ViewEncapsulation.None,\n standalone: true,\n imports: [CdkCellOutlet],\n }]\n }] });\n/** Data row template container that contains the cell outlet. Adds the right class and role. */\nclass CdkRow {\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkRow, deps: [], target: i0.ɵɵFactoryTarget.Component }); }\n static { this.ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"18.2.0-next.2\", type: CdkRow, isStandalone: true, selector: \"cdk-row, tr[cdk-row]\", host: { attributes: { \"role\": \"row\" }, classAttribute: \"cdk-row\" }, ngImport: i0, template: \"
\", isInline: true, dependencies: [{ kind: \"directive\", type: CdkCellOutlet, selector: \"[cdkCellOutlet]\" }], changeDetection: i0.ChangeDetectionStrategy.Default, encapsulation: i0.ViewEncapsulation.None }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkRow, decorators: [{\n type: Component,\n args: [{\n selector: 'cdk-row, tr[cdk-row]',\n template: CDK_ROW_TEMPLATE,\n host: {\n 'class': 'cdk-row',\n 'role': 'row',\n },\n // See note on CdkTable for explanation on why this uses the default change detection strategy.\n // tslint:disable-next-line:validate-decorators\n changeDetection: ChangeDetectionStrategy.Default,\n encapsulation: ViewEncapsulation.None,\n standalone: true,\n imports: [CdkCellOutlet],\n }]\n }] });\n/** Row that can be used to display a message when no data is shown in the table. */\nclass CdkNoDataRow {\n constructor(templateRef) {\n this.templateRef = templateRef;\n this._contentClassName = 'cdk-no-data-row';\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkNoDataRow, deps: [{ token: i0.TemplateRef }], target: i0.ɵɵFactoryTarget.Directive }); }\n static { this.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"18.2.0-next.2\", type: CdkNoDataRow, isStandalone: true, selector: \"ng-template[cdkNoDataRow]\", ngImport: i0 }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkNoDataRow, decorators: [{\n type: Directive,\n args: [{\n selector: 'ng-template[cdkNoDataRow]',\n standalone: true,\n }]\n }], ctorParameters: () => [{ type: i0.TemplateRef }] });\n\n/**\n * List of all possible directions that can be used for sticky positioning.\n * @docs-private\n */\nconst STICKY_DIRECTIONS = ['top', 'bottom', 'left', 'right'];\n/**\n * Applies and removes sticky positioning styles to the `CdkTable` rows and columns cells.\n * @docs-private\n */\nclass StickyStyler {\n /**\n * @param _isNativeHtmlTable Whether the sticky logic should be based on a table\n * that uses the native `
` element.\n * @param _stickCellCss The CSS class that will be applied to every row/cell that has\n * sticky positioning applied.\n * @param direction The directionality context of the table (ltr/rtl); affects column positioning\n * by reversing left/right positions.\n * @param _isBrowser Whether the table is currently being rendered on the server or the client.\n * @param _needsPositionStickyOnElement Whether we need to specify position: sticky on cells\n * using inline styles. If false, it is assumed that position: sticky is included in\n * the component stylesheet for _stickCellCss.\n * @param _positionListener A listener that is notified of changes to sticky rows/columns\n * and their dimensions.\n */\n constructor(_isNativeHtmlTable, _stickCellCss, direction, _coalescedStyleScheduler, _isBrowser = true, _needsPositionStickyOnElement = true, _positionListener) {\n this._isNativeHtmlTable = _isNativeHtmlTable;\n this._stickCellCss = _stickCellCss;\n this.direction = direction;\n this._coalescedStyleScheduler = _coalescedStyleScheduler;\n this._isBrowser = _isBrowser;\n this._needsPositionStickyOnElement = _needsPositionStickyOnElement;\n this._positionListener = _positionListener;\n this._cachedCellWidths = [];\n this._borderCellCss = {\n 'top': `${_stickCellCss}-border-elem-top`,\n 'bottom': `${_stickCellCss}-border-elem-bottom`,\n 'left': `${_stickCellCss}-border-elem-left`,\n 'right': `${_stickCellCss}-border-elem-right`,\n };\n }\n /**\n * Clears the sticky positioning styles from the row and its cells by resetting the `position`\n * style, setting the zIndex to 0, and unsetting each provided sticky direction.\n * @param rows The list of rows that should be cleared from sticking in the provided directions\n * @param stickyDirections The directions that should no longer be set as sticky on the rows.\n */\n clearStickyPositioning(rows, stickyDirections) {\n const elementsToClear = [];\n for (const row of rows) {\n // If the row isn't an element (e.g. if it's an `ng-container`),\n // it won't have inline styles or `children` so we skip it.\n if (row.nodeType !== row.ELEMENT_NODE) {\n continue;\n }\n elementsToClear.push(row);\n for (let i = 0; i < row.children.length; i++) {\n elementsToClear.push(row.children[i]);\n }\n }\n // Coalesce with sticky row/column updates (and potentially other changes like column resize).\n this._coalescedStyleScheduler.schedule(() => {\n for (const element of elementsToClear) {\n this._removeStickyStyle(element, stickyDirections);\n }\n });\n }\n /**\n * Applies sticky left and right positions to the cells of each row according to the sticky\n * states of the rendered column definitions.\n * @param rows The rows that should have its set of cells stuck according to the sticky states.\n * @param stickyStartStates A list of boolean states where each state represents whether the cell\n * in this index position should be stuck to the start of the row.\n * @param stickyEndStates A list of boolean states where each state represents whether the cell\n * in this index position should be stuck to the end of the row.\n * @param recalculateCellWidths Whether the sticky styler should recalculate the width of each\n * column cell. If `false` cached widths will be used instead.\n */\n updateStickyColumns(rows, stickyStartStates, stickyEndStates, recalculateCellWidths = true) {\n if (!rows.length ||\n !this._isBrowser ||\n !(stickyStartStates.some(state => state) || stickyEndStates.some(state => state))) {\n if (this._positionListener) {\n this._positionListener.stickyColumnsUpdated({ sizes: [] });\n this._positionListener.stickyEndColumnsUpdated({ sizes: [] });\n }\n return;\n }\n // Coalesce with sticky row updates (and potentially other changes like column resize).\n this._coalescedStyleScheduler.schedule(() => {\n const firstRow = rows[0];\n const numCells = firstRow.children.length;\n const cellWidths = this._getCellWidths(firstRow, recalculateCellWidths);\n const startPositions = this._getStickyStartColumnPositions(cellWidths, stickyStartStates);\n const endPositions = this._getStickyEndColumnPositions(cellWidths, stickyEndStates);\n const lastStickyStart = stickyStartStates.lastIndexOf(true);\n const firstStickyEnd = stickyEndStates.indexOf(true);\n const isRtl = this.direction === 'rtl';\n const start = isRtl ? 'right' : 'left';\n const end = isRtl ? 'left' : 'right';\n for (const row of rows) {\n for (let i = 0; i < numCells; i++) {\n const cell = row.children[i];\n if (stickyStartStates[i]) {\n this._addStickyStyle(cell, start, startPositions[i], i === lastStickyStart);\n }\n if (stickyEndStates[i]) {\n this._addStickyStyle(cell, end, endPositions[i], i === firstStickyEnd);\n }\n }\n }\n if (this._positionListener) {\n this._positionListener.stickyColumnsUpdated({\n sizes: lastStickyStart === -1\n ? []\n : cellWidths\n .slice(0, lastStickyStart + 1)\n .map((width, index) => (stickyStartStates[index] ? width : null)),\n });\n this._positionListener.stickyEndColumnsUpdated({\n sizes: firstStickyEnd === -1\n ? []\n : cellWidths\n .slice(firstStickyEnd)\n .map((width, index) => (stickyEndStates[index + firstStickyEnd] ? width : null))\n .reverse(),\n });\n }\n });\n }\n /**\n * Applies sticky positioning to the row's cells if using the native table layout, and to the\n * row itself otherwise.\n * @param rowsToStick The list of rows that should be stuck according to their corresponding\n * sticky state and to the provided top or bottom position.\n * @param stickyStates A list of boolean states where each state represents whether the row\n * should be stuck in the particular top or bottom position.\n * @param position The position direction in which the row should be stuck if that row should be\n * sticky.\n *\n */\n stickRows(rowsToStick, stickyStates, position) {\n // Since we can't measure the rows on the server, we can't stick the rows properly.\n if (!this._isBrowser) {\n return;\n }\n // Coalesce with other sticky row updates (top/bottom), sticky columns updates\n // (and potentially other changes like column resize).\n this._coalescedStyleScheduler.schedule(() => {\n // If positioning the rows to the bottom, reverse their order when evaluating the sticky\n // position such that the last row stuck will be \"bottom: 0px\" and so on. Note that the\n // sticky states need to be reversed as well.\n const rows = position === 'bottom' ? rowsToStick.slice().reverse() : rowsToStick;\n const states = position === 'bottom' ? stickyStates.slice().reverse() : stickyStates;\n // Measure row heights all at once before adding sticky styles to reduce layout thrashing.\n const stickyOffsets = [];\n const stickyCellHeights = [];\n const elementsToStick = [];\n for (let rowIndex = 0, stickyOffset = 0; rowIndex < rows.length; rowIndex++) {\n if (!states[rowIndex]) {\n continue;\n }\n stickyOffsets[rowIndex] = stickyOffset;\n const row = rows[rowIndex];\n elementsToStick[rowIndex] = this._isNativeHtmlTable\n ? Array.from(row.children)\n : [row];\n const height = row.getBoundingClientRect().height;\n stickyOffset += height;\n stickyCellHeights[rowIndex] = height;\n }\n const borderedRowIndex = states.lastIndexOf(true);\n for (let rowIndex = 0; rowIndex < rows.length; rowIndex++) {\n if (!states[rowIndex]) {\n continue;\n }\n const offset = stickyOffsets[rowIndex];\n const isBorderedRowIndex = rowIndex === borderedRowIndex;\n for (const element of elementsToStick[rowIndex]) {\n this._addStickyStyle(element, position, offset, isBorderedRowIndex);\n }\n }\n if (position === 'top') {\n this._positionListener?.stickyHeaderRowsUpdated({\n sizes: stickyCellHeights,\n offsets: stickyOffsets,\n elements: elementsToStick,\n });\n }\n else {\n this._positionListener?.stickyFooterRowsUpdated({\n sizes: stickyCellHeights,\n offsets: stickyOffsets,\n elements: elementsToStick,\n });\n }\n });\n }\n /**\n * When using the native table in Safari, sticky footer cells do not stick. The only way to stick\n * footer rows is to apply sticky styling to the tfoot container. This should only be done if\n * all footer rows are sticky. If not all footer rows are sticky, remove sticky positioning from\n * the tfoot element.\n */\n updateStickyFooterContainer(tableElement, stickyStates) {\n if (!this._isNativeHtmlTable) {\n return;\n }\n // Coalesce with other sticky updates (and potentially other changes like column resize).\n this._coalescedStyleScheduler.schedule(() => {\n const tfoot = tableElement.querySelector('tfoot');\n if (tfoot) {\n if (stickyStates.some(state => !state)) {\n this._removeStickyStyle(tfoot, ['bottom']);\n }\n else {\n this._addStickyStyle(tfoot, 'bottom', 0, false);\n }\n }\n });\n }\n /**\n * Removes the sticky style on the element by removing the sticky cell CSS class, re-evaluating\n * the zIndex, removing each of the provided sticky directions, and removing the\n * sticky position if there are no more directions.\n */\n _removeStickyStyle(element, stickyDirections) {\n for (const dir of stickyDirections) {\n element.style[dir] = '';\n element.classList.remove(this._borderCellCss[dir]);\n }\n // If the element no longer has any more sticky directions, remove sticky positioning and\n // the sticky CSS class.\n // Short-circuit checking element.style[dir] for stickyDirections as they\n // were already removed above.\n const hasDirection = STICKY_DIRECTIONS.some(dir => stickyDirections.indexOf(dir) === -1 && element.style[dir]);\n if (hasDirection) {\n element.style.zIndex = this._getCalculatedZIndex(element);\n }\n else {\n // When not hasDirection, _getCalculatedZIndex will always return ''.\n element.style.zIndex = '';\n if (this._needsPositionStickyOnElement) {\n element.style.position = '';\n }\n element.classList.remove(this._stickCellCss);\n }\n }\n /**\n * Adds the sticky styling to the element by adding the sticky style class, changing position\n * to be sticky (and -webkit-sticky), setting the appropriate zIndex, and adding a sticky\n * direction and value.\n */\n _addStickyStyle(element, dir, dirValue, isBorderElement) {\n element.classList.add(this._stickCellCss);\n if (isBorderElement) {\n element.classList.add(this._borderCellCss[dir]);\n }\n element.style[dir] = `${dirValue}px`;\n element.style.zIndex = this._getCalculatedZIndex(element);\n if (this._needsPositionStickyOnElement) {\n element.style.cssText += 'position: -webkit-sticky; position: sticky; ';\n }\n }\n /**\n * Calculate what the z-index should be for the element, depending on what directions (top,\n * bottom, left, right) have been set. It should be true that elements with a top direction\n * should have the highest index since these are elements like a table header. If any of those\n * elements are also sticky in another direction, then they should appear above other elements\n * that are only sticky top (e.g. a sticky column on a sticky header). Bottom-sticky elements\n * (e.g. footer rows) should then be next in the ordering such that they are below the header\n * but above any non-sticky elements. Finally, left/right sticky elements (e.g. sticky columns)\n * should minimally increment so that they are above non-sticky elements but below top and bottom\n * elements.\n */\n _getCalculatedZIndex(element) {\n const zIndexIncrements = {\n top: 100,\n bottom: 10,\n left: 1,\n right: 1,\n };\n let zIndex = 0;\n // Use `Iterable` instead of `Array` because TypeScript, as of 3.6.3,\n // loses the array generic type in the `for of`. But we *also* have to use `Array` because\n // typescript won't iterate over an `Iterable` unless you compile with `--downlevelIteration`\n for (const dir of STICKY_DIRECTIONS) {\n if (element.style[dir]) {\n zIndex += zIndexIncrements[dir];\n }\n }\n return zIndex ? `${zIndex}` : '';\n }\n /** Gets the widths for each cell in the provided row. */\n _getCellWidths(row, recalculateCellWidths = true) {\n if (!recalculateCellWidths && this._cachedCellWidths.length) {\n return this._cachedCellWidths;\n }\n const cellWidths = [];\n const firstRowCells = row.children;\n for (let i = 0; i < firstRowCells.length; i++) {\n let cell = firstRowCells[i];\n cellWidths.push(cell.getBoundingClientRect().width);\n }\n this._cachedCellWidths = cellWidths;\n return cellWidths;\n }\n /**\n * Determines the left and right positions of each sticky column cell, which will be the\n * accumulation of all sticky column cell widths to the left and right, respectively.\n * Non-sticky cells do not need to have a value set since their positions will not be applied.\n */\n _getStickyStartColumnPositions(widths, stickyStates) {\n const positions = [];\n let nextPosition = 0;\n for (let i = 0; i < widths.length; i++) {\n if (stickyStates[i]) {\n positions[i] = nextPosition;\n nextPosition += widths[i];\n }\n }\n return positions;\n }\n /**\n * Determines the left and right positions of each sticky column cell, which will be the\n * accumulation of all sticky column cell widths to the left and right, respectively.\n * Non-sticky cells do not need to have a value set since their positions will not be applied.\n */\n _getStickyEndColumnPositions(widths, stickyStates) {\n const positions = [];\n let nextPosition = 0;\n for (let i = widths.length; i > 0; i--) {\n if (stickyStates[i]) {\n positions[i] = nextPosition;\n nextPosition += widths[i];\n }\n }\n return positions;\n }\n}\n\n/**\n * Returns an error to be thrown when attempting to find an nonexistent column.\n * @param id Id whose lookup failed.\n * @docs-private\n */\nfunction getTableUnknownColumnError(id) {\n return Error(`Could not find column with id \"${id}\".`);\n}\n/**\n * Returns an error to be thrown when two column definitions have the same name.\n * @docs-private\n */\nfunction getTableDuplicateColumnNameError(name) {\n return Error(`Duplicate column definition name provided: \"${name}\".`);\n}\n/**\n * Returns an error to be thrown when there are multiple rows that are missing a when function.\n * @docs-private\n */\nfunction getTableMultipleDefaultRowDefsError() {\n return Error(`There can only be one default row without a when predicate function.`);\n}\n/**\n * Returns an error to be thrown when there are no matching row defs for a particular set of data.\n * @docs-private\n */\nfunction getTableMissingMatchingRowDefError(data) {\n return Error(`Could not find a matching row definition for the` +\n `provided row data: ${JSON.stringify(data)}`);\n}\n/**\n * Returns an error to be thrown when there is no row definitions present in the content.\n * @docs-private\n */\nfunction getTableMissingRowDefsError() {\n return Error('Missing definitions for header, footer, and row; ' +\n 'cannot determine which columns should be rendered.');\n}\n/**\n * Returns an error to be thrown when the data source does not match the compatible types.\n * @docs-private\n */\nfunction getTableUnknownDataSourceError() {\n return Error(`Provided data source did not match an array, Observable, or DataSource`);\n}\n/**\n * Returns an error to be thrown when the text column cannot find a parent table to inject.\n * @docs-private\n */\nfunction getTableTextColumnMissingParentTableError() {\n return Error(`Text column could not find a parent table for registration.`);\n}\n/**\n * Returns an error to be thrown when a table text column doesn't have a name.\n * @docs-private\n */\nfunction getTableTextColumnMissingNameError() {\n return Error(`Table text column must have a name.`);\n}\n\n/** The injection token used to specify the StickyPositioningListener. */\nconst STICKY_POSITIONING_LISTENER = new InjectionToken('CDK_SPL');\n\n/**\n * Enables the recycle view repeater strategy, which reduces rendering latency. Not compatible with\n * tables that animate rows.\n */\nclass CdkRecycleRows {\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkRecycleRows, deps: [], target: i0.ɵɵFactoryTarget.Directive }); }\n static { this.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"18.2.0-next.2\", type: CdkRecycleRows, isStandalone: true, selector: \"cdk-table[recycleRows], table[cdk-table][recycleRows]\", providers: [{ provide: _VIEW_REPEATER_STRATEGY, useClass: _RecycleViewRepeaterStrategy }], ngImport: i0 }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkRecycleRows, decorators: [{\n type: Directive,\n args: [{\n selector: 'cdk-table[recycleRows], table[cdk-table][recycleRows]',\n providers: [{ provide: _VIEW_REPEATER_STRATEGY, useClass: _RecycleViewRepeaterStrategy }],\n standalone: true,\n }]\n }] });\n/**\n * Provides a handle for the table to grab the view container's ng-container to insert data rows.\n * @docs-private\n */\nclass DataRowOutlet {\n constructor(viewContainer, elementRef) {\n this.viewContainer = viewContainer;\n this.elementRef = elementRef;\n const table = inject(CDK_TABLE);\n table._rowOutlet = this;\n table._outletAssigned();\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: DataRowOutlet, deps: [{ token: i0.ViewContainerRef }, { token: i0.ElementRef }], target: i0.ɵɵFactoryTarget.Directive }); }\n static { this.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"18.2.0-next.2\", type: DataRowOutlet, isStandalone: true, selector: \"[rowOutlet]\", ngImport: i0 }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: DataRowOutlet, decorators: [{\n type: Directive,\n args: [{\n selector: '[rowOutlet]',\n standalone: true,\n }]\n }], ctorParameters: () => [{ type: i0.ViewContainerRef }, { type: i0.ElementRef }] });\n/**\n * Provides a handle for the table to grab the view container's ng-container to insert the header.\n * @docs-private\n */\nclass HeaderRowOutlet {\n constructor(viewContainer, elementRef) {\n this.viewContainer = viewContainer;\n this.elementRef = elementRef;\n const table = inject(CDK_TABLE);\n table._headerRowOutlet = this;\n table._outletAssigned();\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: HeaderRowOutlet, deps: [{ token: i0.ViewContainerRef }, { token: i0.ElementRef }], target: i0.ɵɵFactoryTarget.Directive }); }\n static { this.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"18.2.0-next.2\", type: HeaderRowOutlet, isStandalone: true, selector: \"[headerRowOutlet]\", ngImport: i0 }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: HeaderRowOutlet, decorators: [{\n type: Directive,\n args: [{\n selector: '[headerRowOutlet]',\n standalone: true,\n }]\n }], ctorParameters: () => [{ type: i0.ViewContainerRef }, { type: i0.ElementRef }] });\n/**\n * Provides a handle for the table to grab the view container's ng-container to insert the footer.\n * @docs-private\n */\nclass FooterRowOutlet {\n constructor(viewContainer, elementRef) {\n this.viewContainer = viewContainer;\n this.elementRef = elementRef;\n const table = inject(CDK_TABLE);\n table._footerRowOutlet = this;\n table._outletAssigned();\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: FooterRowOutlet, deps: [{ token: i0.ViewContainerRef }, { token: i0.ElementRef }], target: i0.ɵɵFactoryTarget.Directive }); }\n static { this.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"18.2.0-next.2\", type: FooterRowOutlet, isStandalone: true, selector: \"[footerRowOutlet]\", ngImport: i0 }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: FooterRowOutlet, decorators: [{\n type: Directive,\n args: [{\n selector: '[footerRowOutlet]',\n standalone: true,\n }]\n }], ctorParameters: () => [{ type: i0.ViewContainerRef }, { type: i0.ElementRef }] });\n/**\n * Provides a handle for the table to grab the view\n * container's ng-container to insert the no data row.\n * @docs-private\n */\nclass NoDataRowOutlet {\n constructor(viewContainer, elementRef) {\n this.viewContainer = viewContainer;\n this.elementRef = elementRef;\n const table = inject(CDK_TABLE);\n table._noDataRowOutlet = this;\n table._outletAssigned();\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: NoDataRowOutlet, deps: [{ token: i0.ViewContainerRef }, { token: i0.ElementRef }], target: i0.ɵɵFactoryTarget.Directive }); }\n static { this.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"18.2.0-next.2\", type: NoDataRowOutlet, isStandalone: true, selector: \"[noDataRowOutlet]\", ngImport: i0 }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: NoDataRowOutlet, decorators: [{\n type: Directive,\n args: [{\n selector: '[noDataRowOutlet]',\n standalone: true,\n }]\n }], ctorParameters: () => [{ type: i0.ViewContainerRef }, { type: i0.ElementRef }] });\n/**\n * The table template that can be used by the mat-table. Should not be used outside of the\n * material library.\n * @docs-private\n */\nconst CDK_TABLE_TEMPLATE = \n// Note that according to MDN, the `caption` element has to be projected as the **first**\n// element in the table. See https://developer.mozilla.org/en-US/docs/Web/HTML/Element/caption\n`\n \n \n \n \n \n \n \n } @else {\n ),\n // this setter will be invoked before the row outlet has been defined hence the null check.\n if (this._rowOutlet && this._rowOutlet.viewContainer.length) {\n this._forceRenderDataRows();\n this.updateStickyColumnStyles();\n }\n }\n /**\n * Whether to use a fixed table layout. Enabling this option will enforce consistent column widths\n * and optimize rendering sticky styles for native tables. No-op for flex tables.\n */\n get fixedLayout() {\n return this._fixedLayout;\n }\n set fixedLayout(value) {\n this._fixedLayout = value;\n // Toggling `fixedLayout` may change column widths. Sticky column styles should be recalculated.\n this._forceRecalculateCellWidths = true;\n this._stickyColumnStylesNeedReset = true;\n }\n constructor(_differs, _changeDetectorRef, _elementRef, role, _dir, _document, _platform, _viewRepeater, _coalescedStyleScheduler, _viewportRuler, \n /**\n * @deprecated `_stickyPositioningListener` parameter to become required.\n * @breaking-change 13.0.0\n */\n _stickyPositioningListener, \n /**\n * @deprecated `_unusedNgZone` parameter to be removed.\n * @breaking-change 19.0.0\n */\n _unusedNgZone) {\n this._differs = _differs;\n this._changeDetectorRef = _changeDetectorRef;\n this._elementRef = _elementRef;\n this._dir = _dir;\n this._platform = _platform;\n this._viewRepeater = _viewRepeater;\n this._coalescedStyleScheduler = _coalescedStyleScheduler;\n this._viewportRuler = _viewportRuler;\n this._stickyPositioningListener = _stickyPositioningListener;\n /** Subject that emits when the component has been destroyed. */\n this._onDestroy = new Subject();\n /**\n * Map of all the user's defined columns (header, data, and footer cell template) identified by\n * name. Collection populated by the column definitions gathered by `ContentChildren` as well as\n * any custom column definitions added to `_customColumnDefs`.\n */\n this._columnDefsByName = new Map();\n /**\n * Column definitions that were defined outside of the direct content children of the table.\n * These will be defined when, e.g., creating a wrapper around the cdkTable that has\n * column definitions as *its* content child.\n */\n this._customColumnDefs = new Set();\n /**\n * Data row definitions that were defined outside of the direct content children of the table.\n * These will be defined when, e.g., creating a wrapper around the cdkTable that has\n * built-in data rows as *its* content child.\n */\n this._customRowDefs = new Set();\n /**\n * Header row definitions that were defined outside of the direct content children of the table.\n * These will be defined when, e.g., creating a wrapper around the cdkTable that has\n * built-in header rows as *its* content child.\n */\n this._customHeaderRowDefs = new Set();\n /**\n * Footer row definitions that were defined outside of the direct content children of the table.\n * These will be defined when, e.g., creating a wrapper around the cdkTable that has a\n * built-in footer row as *its* content child.\n */\n this._customFooterRowDefs = new Set();\n /**\n * Whether the header row definition has been changed. Triggers an update to the header row after\n * content is checked. Initialized as true so that the table renders the initial set of rows.\n */\n this._headerRowDefChanged = true;\n /**\n * Whether the footer row definition has been changed. Triggers an update to the footer row after\n * content is checked. Initialized as true so that the table renders the initial set of rows.\n */\n this._footerRowDefChanged = true;\n /**\n * Whether the sticky column styles need to be updated. Set to `true` when the visible columns\n * change.\n */\n this._stickyColumnStylesNeedReset = true;\n /**\n * Whether the sticky styler should recalculate cell widths when applying sticky styles. If\n * `false`, cached values will be used instead. This is only applicable to tables with\n * {@link fixedLayout} enabled. For other tables, cell widths will always be recalculated.\n */\n this._forceRecalculateCellWidths = true;\n /**\n * Cache of the latest rendered `RenderRow` objects as a map for easy retrieval when constructing\n * a new list of `RenderRow` objects for rendering rows. Since the new list is constructed with\n * the cached `RenderRow` objects when possible, the row identity is preserved when the data\n * and row template matches, which allows the `IterableDiffer` to check rows by reference\n * and understand which rows are added/moved/removed.\n *\n * Implemented as a map of maps where the first key is the `data: T` object and the second is the\n * `CdkRowDef` object. With the two keys, the cache points to a `RenderRow` object that\n * contains an array of created pairs. The array is necessary to handle cases where the data\n * array contains multiple duplicate data objects and each instantiated `RenderRow` must be\n * stored.\n */\n this._cachedRenderRowsMap = new Map();\n /**\n * CSS class added to any row or cell that has sticky positioning applied. May be overridden by\n * table subclasses.\n */\n this.stickyCssClass = 'cdk-table-sticky';\n /**\n * Whether to manually add position: sticky to all sticky cell elements. Not needed if\n * the position is set in a selector associated with the value of stickyCssClass. May be\n * overridden by table subclasses\n */\n this.needsPositionStickyOnElement = true;\n /** Whether the no data row is currently showing anything. */\n this._isShowingNoDataRow = false;\n /** Whether the table has rendered out all the outlets for the first time. */\n this._hasAllOutlets = false;\n /** Whether the table is done initializing. */\n this._hasInitialized = false;\n this._cellRoleInternal = undefined;\n this._multiTemplateDataRows = false;\n this._fixedLayout = false;\n /**\n * Emits when the table completes rendering a set of data rows based on the latest data from the\n * data source, even if the set of rows is empty.\n */\n this.contentChanged = new EventEmitter();\n // TODO(andrewseguin): Remove max value as the end index\n // and instead calculate the view on init and scroll.\n /**\n * Stream containing the latest information on what rows are being displayed on screen.\n * Can be used by the data source to as a heuristic of what data should be provided.\n *\n * @docs-private\n */\n this.viewChange = new BehaviorSubject({\n start: 0,\n end: Number.MAX_VALUE,\n });\n this._injector = inject(Injector);\n if (!role) {\n _elementRef.nativeElement.setAttribute('role', 'table');\n }\n this._document = _document;\n this._isServer = !_platform.isBrowser;\n this._isNativeHtmlTable = _elementRef.nativeElement.nodeName === 'TABLE';\n }\n ngOnInit() {\n this._setupStickyStyler();\n // Set up the trackBy function so that it uses the `RenderRow` as its identity by default. If\n // the user has provided a custom trackBy, return the result of that function as evaluated\n // with the values of the `RenderRow`'s data and index.\n this._dataDiffer = this._differs.find([]).create((_i, dataRow) => {\n return this.trackBy ? this.trackBy(dataRow.dataIndex, dataRow.data) : dataRow;\n });\n this._viewportRuler\n .change()\n .pipe(takeUntil(this._onDestroy))\n .subscribe(() => {\n this._forceRecalculateCellWidths = true;\n });\n }\n ngAfterContentInit() {\n this._hasInitialized = true;\n }\n ngAfterContentChecked() {\n // Only start re-rendering in `ngAfterContentChecked` after the first render.\n if (this._canRender()) {\n this._render();\n }\n }\n ngOnDestroy() {\n [\n this._rowOutlet?.viewContainer,\n this._headerRowOutlet?.viewContainer,\n this._footerRowOutlet?.viewContainer,\n this._cachedRenderRowsMap,\n this._customColumnDefs,\n this._customRowDefs,\n this._customHeaderRowDefs,\n this._customFooterRowDefs,\n this._columnDefsByName,\n ].forEach((def) => {\n def?.clear();\n });\n this._headerRowDefs = [];\n this._footerRowDefs = [];\n this._defaultRowDef = null;\n this._onDestroy.next();\n this._onDestroy.complete();\n if (isDataSource(this.dataSource)) {\n this.dataSource.disconnect(this);\n }\n }\n /**\n * Renders rows based on the table's latest set of data, which was either provided directly as an\n * input or retrieved through an Observable stream (directly or from a DataSource).\n * Checks for differences in the data since the last diff to perform only the necessary\n * changes (add/remove/move rows).\n *\n * If the table's data source is a DataSource or Observable, this will be invoked automatically\n * each time the provided Observable stream emits a new data array. Otherwise if your data is\n * an array, this function will need to be called to render any changes.\n */\n renderRows() {\n this._renderRows = this._getAllRenderRows();\n const changes = this._dataDiffer.diff(this._renderRows);\n if (!changes) {\n this._updateNoDataRow();\n this.contentChanged.next();\n return;\n }\n const viewContainer = this._rowOutlet.viewContainer;\n this._viewRepeater.applyChanges(changes, viewContainer, (record, _adjustedPreviousIndex, currentIndex) => this._getEmbeddedViewArgs(record.item, currentIndex), record => record.item.data, (change) => {\n if (change.operation === _ViewRepeaterOperation.INSERTED && change.context) {\n this._renderCellTemplateForItem(change.record.item.rowDef, change.context);\n }\n });\n // Update the meta context of a row's context data (index, count, first, last, ...)\n this._updateRowIndexContext();\n // Update rows that did not get added/removed/moved but may have had their identity changed,\n // e.g. if trackBy matched data on some property but the actual data reference changed.\n changes.forEachIdentityChange((record) => {\n const rowView = viewContainer.get(record.currentIndex);\n rowView.context.$implicit = record.item.data;\n });\n this._updateNoDataRow();\n afterNextRender(() => {\n this.updateStickyColumnStyles();\n }, { injector: this._injector });\n this.contentChanged.next();\n }\n /** Adds a column definition that was not included as part of the content children. */\n addColumnDef(columnDef) {\n this._customColumnDefs.add(columnDef);\n }\n /** Removes a column definition that was not included as part of the content children. */\n removeColumnDef(columnDef) {\n this._customColumnDefs.delete(columnDef);\n }\n /** Adds a row definition that was not included as part of the content children. */\n addRowDef(rowDef) {\n this._customRowDefs.add(rowDef);\n }\n /** Removes a row definition that was not included as part of the content children. */\n removeRowDef(rowDef) {\n this._customRowDefs.delete(rowDef);\n }\n /** Adds a header row definition that was not included as part of the content children. */\n addHeaderRowDef(headerRowDef) {\n this._customHeaderRowDefs.add(headerRowDef);\n this._headerRowDefChanged = true;\n }\n /** Removes a header row definition that was not included as part of the content children. */\n removeHeaderRowDef(headerRowDef) {\n this._customHeaderRowDefs.delete(headerRowDef);\n this._headerRowDefChanged = true;\n }\n /** Adds a footer row definition that was not included as part of the content children. */\n addFooterRowDef(footerRowDef) {\n this._customFooterRowDefs.add(footerRowDef);\n this._footerRowDefChanged = true;\n }\n /** Removes a footer row definition that was not included as part of the content children. */\n removeFooterRowDef(footerRowDef) {\n this._customFooterRowDefs.delete(footerRowDef);\n this._footerRowDefChanged = true;\n }\n /** Sets a no data row definition that was not included as a part of the content children. */\n setNoDataRow(noDataRow) {\n this._customNoDataRow = noDataRow;\n }\n /**\n * Updates the header sticky styles. First resets all applied styles with respect to the cells\n * sticking to the top. Then, evaluating which cells need to be stuck to the top. This is\n * automatically called when the header row changes its displayed set of columns, or if its\n * sticky input changes. May be called manually for cases where the cell content changes outside\n * of these events.\n */\n updateStickyHeaderRowStyles() {\n const headerRows = this._getRenderedRows(this._headerRowOutlet);\n // Hide the thead element if there are no header rows. This is necessary to satisfy\n // overzealous a11y checkers that fail because the `rowgroup` element does not contain\n // required child `row`.\n if (this._isNativeHtmlTable) {\n const thead = closestTableSection(this._headerRowOutlet, 'thead');\n if (thead) {\n thead.style.display = headerRows.length ? '' : 'none';\n }\n }\n const stickyStates = this._headerRowDefs.map(def => def.sticky);\n this._stickyStyler.clearStickyPositioning(headerRows, ['top']);\n this._stickyStyler.stickRows(headerRows, stickyStates, 'top');\n // Reset the dirty state of the sticky input change since it has been used.\n this._headerRowDefs.forEach(def => def.resetStickyChanged());\n }\n /**\n * Updates the footer sticky styles. First resets all applied styles with respect to the cells\n * sticking to the bottom. Then, evaluating which cells need to be stuck to the bottom. This is\n * automatically called when the footer row changes its displayed set of columns, or if its\n * sticky input changes. May be called manually for cases where the cell content changes outside\n * of these events.\n */\n updateStickyFooterRowStyles() {\n const footerRows = this._getRenderedRows(this._footerRowOutlet);\n // Hide the tfoot element if there are no footer rows. This is necessary to satisfy\n // overzealous a11y checkers that fail because the `rowgroup` element does not contain\n // required child `row`.\n if (this._isNativeHtmlTable) {\n const tfoot = closestTableSection(this._footerRowOutlet, 'tfoot');\n if (tfoot) {\n tfoot.style.display = footerRows.length ? '' : 'none';\n }\n }\n const stickyStates = this._footerRowDefs.map(def => def.sticky);\n this._stickyStyler.clearStickyPositioning(footerRows, ['bottom']);\n this._stickyStyler.stickRows(footerRows, stickyStates, 'bottom');\n this._stickyStyler.updateStickyFooterContainer(this._elementRef.nativeElement, stickyStates);\n // Reset the dirty state of the sticky input change since it has been used.\n this._footerRowDefs.forEach(def => def.resetStickyChanged());\n }\n /**\n * Updates the column sticky styles. First resets all applied styles with respect to the cells\n * sticking to the left and right. Then sticky styles are added for the left and right according\n * to the column definitions for each cell in each row. This is automatically called when\n * the data source provides a new set of data or when a column definition changes its sticky\n * input. May be called manually for cases where the cell content changes outside of these events.\n */\n updateStickyColumnStyles() {\n const headerRows = this._getRenderedRows(this._headerRowOutlet);\n const dataRows = this._getRenderedRows(this._rowOutlet);\n const footerRows = this._getRenderedRows(this._footerRowOutlet);\n // For tables not using a fixed layout, the column widths may change when new rows are rendered.\n // In a table using a fixed layout, row content won't affect column width, so sticky styles\n // don't need to be cleared unless either the sticky column config changes or one of the row\n // defs change.\n if ((this._isNativeHtmlTable && !this._fixedLayout) || this._stickyColumnStylesNeedReset) {\n // Clear the left and right positioning from all columns in the table across all rows since\n // sticky columns span across all table sections (header, data, footer)\n this._stickyStyler.clearStickyPositioning([...headerRows, ...dataRows, ...footerRows], ['left', 'right']);\n this._stickyColumnStylesNeedReset = false;\n }\n // Update the sticky styles for each header row depending on the def's sticky state\n headerRows.forEach((headerRow, i) => {\n this._addStickyColumnStyles([headerRow], this._headerRowDefs[i]);\n });\n // Update the sticky styles for each data row depending on its def's sticky state\n this._rowDefs.forEach(rowDef => {\n // Collect all the rows rendered with this row definition.\n const rows = [];\n for (let i = 0; i < dataRows.length; i++) {\n if (this._renderRows[i].rowDef === rowDef) {\n rows.push(dataRows[i]);\n }\n }\n this._addStickyColumnStyles(rows, rowDef);\n });\n // Update the sticky styles for each footer row depending on the def's sticky state\n footerRows.forEach((footerRow, i) => {\n this._addStickyColumnStyles([footerRow], this._footerRowDefs[i]);\n });\n // Reset the dirty state of the sticky input change since it has been used.\n Array.from(this._columnDefsByName.values()).forEach(def => def.resetStickyChanged());\n }\n /** Invoked whenever an outlet is created and has been assigned to the table. */\n _outletAssigned() {\n // Trigger the first render once all outlets have been assigned. We do it this way, as\n // opposed to waiting for the next `ngAfterContentChecked`, because we don't know when\n // the next change detection will happen.\n // Also we can't use queries to resolve the outlets, because they're wrapped in a\n // conditional, so we have to rely on them being assigned via DI.\n if (!this._hasAllOutlets &&\n this._rowOutlet &&\n this._headerRowOutlet &&\n this._footerRowOutlet &&\n this._noDataRowOutlet) {\n this._hasAllOutlets = true;\n // In some setups this may fire before `ngAfterContentInit`\n // so we need a check here. See #28538.\n if (this._canRender()) {\n this._render();\n }\n }\n }\n /** Whether the table has all the information to start rendering. */\n _canRender() {\n return this._hasAllOutlets && this._hasInitialized;\n }\n /** Renders the table if its state has changed. */\n _render() {\n // Cache the row and column definitions gathered by ContentChildren and programmatic injection.\n this._cacheRowDefs();\n this._cacheColumnDefs();\n // Make sure that the user has at least added header, footer, or data row def.\n if (!this._headerRowDefs.length &&\n !this._footerRowDefs.length &&\n !this._rowDefs.length &&\n (typeof ngDevMode === 'undefined' || ngDevMode)) {\n throw getTableMissingRowDefsError();\n }\n // Render updates if the list of columns have been changed for the header, row, or footer defs.\n const columnsChanged = this._renderUpdatedColumns();\n const rowDefsChanged = columnsChanged || this._headerRowDefChanged || this._footerRowDefChanged;\n // Ensure sticky column styles are reset if set to `true` elsewhere.\n this._stickyColumnStylesNeedReset = this._stickyColumnStylesNeedReset || rowDefsChanged;\n this._forceRecalculateCellWidths = rowDefsChanged;\n // If the header row definition has been changed, trigger a render to the header row.\n if (this._headerRowDefChanged) {\n this._forceRenderHeaderRows();\n this._headerRowDefChanged = false;\n }\n // If the footer row definition has been changed, trigger a render to the footer row.\n if (this._footerRowDefChanged) {\n this._forceRenderFooterRows();\n this._footerRowDefChanged = false;\n }\n // If there is a data source and row definitions, connect to the data source unless a\n // connection has already been made.\n if (this.dataSource && this._rowDefs.length > 0 && !this._renderChangeSubscription) {\n this._observeRenderChanges();\n }\n else if (this._stickyColumnStylesNeedReset) {\n // In the above case, _observeRenderChanges will result in updateStickyColumnStyles being\n // called when it row data arrives. Otherwise, we need to call it proactively.\n this.updateStickyColumnStyles();\n }\n this._checkStickyStates();\n }\n /**\n * Get the list of RenderRow objects to render according to the current list of data and defined\n * row definitions. If the previous list already contained a particular pair, it should be reused\n * so that the differ equates their references.\n */\n _getAllRenderRows() {\n const renderRows = [];\n // Store the cache and create a new one. Any re-used RenderRow objects will be moved into the\n // new cache while unused ones can be picked up by garbage collection.\n const prevCachedRenderRows = this._cachedRenderRowsMap;\n this._cachedRenderRowsMap = new Map();\n // For each data object, get the list of rows that should be rendered, represented by the\n // respective `RenderRow` object which is the pair of `data` and `CdkRowDef`.\n for (let i = 0; i < this._data.length; i++) {\n let data = this._data[i];\n const renderRowsForData = this._getRenderRowsForData(data, i, prevCachedRenderRows.get(data));\n if (!this._cachedRenderRowsMap.has(data)) {\n this._cachedRenderRowsMap.set(data, new WeakMap());\n }\n for (let j = 0; j < renderRowsForData.length; j++) {\n let renderRow = renderRowsForData[j];\n const cache = this._cachedRenderRowsMap.get(renderRow.data);\n if (cache.has(renderRow.rowDef)) {\n cache.get(renderRow.rowDef).push(renderRow);\n }\n else {\n cache.set(renderRow.rowDef, [renderRow]);\n }\n renderRows.push(renderRow);\n }\n }\n return renderRows;\n }\n /**\n * Gets a list of `RenderRow` for the provided data object and any `CdkRowDef` objects that\n * should be rendered for this data. Reuses the cached RenderRow objects if they match the same\n * `(T, CdkRowDef)` pair.\n */\n _getRenderRowsForData(data, dataIndex, cache) {\n const rowDefs = this._getRowDefs(data, dataIndex);\n return rowDefs.map(rowDef => {\n const cachedRenderRows = cache && cache.has(rowDef) ? cache.get(rowDef) : [];\n if (cachedRenderRows.length) {\n const dataRow = cachedRenderRows.shift();\n dataRow.dataIndex = dataIndex;\n return dataRow;\n }\n else {\n return { data, rowDef, dataIndex };\n }\n });\n }\n /** Update the map containing the content's column definitions. */\n _cacheColumnDefs() {\n this._columnDefsByName.clear();\n const columnDefs = mergeArrayAndSet(this._getOwnDefs(this._contentColumnDefs), this._customColumnDefs);\n columnDefs.forEach(columnDef => {\n if (this._columnDefsByName.has(columnDef.name) &&\n (typeof ngDevMode === 'undefined' || ngDevMode)) {\n throw getTableDuplicateColumnNameError(columnDef.name);\n }\n this._columnDefsByName.set(columnDef.name, columnDef);\n });\n }\n /** Update the list of all available row definitions that can be used. */\n _cacheRowDefs() {\n this._headerRowDefs = mergeArrayAndSet(this._getOwnDefs(this._contentHeaderRowDefs), this._customHeaderRowDefs);\n this._footerRowDefs = mergeArrayAndSet(this._getOwnDefs(this._contentFooterRowDefs), this._customFooterRowDefs);\n this._rowDefs = mergeArrayAndSet(this._getOwnDefs(this._contentRowDefs), this._customRowDefs);\n // After all row definitions are determined, find the row definition to be considered default.\n const defaultRowDefs = this._rowDefs.filter(def => !def.when);\n if (!this.multiTemplateDataRows &&\n defaultRowDefs.length > 1 &&\n (typeof ngDevMode === 'undefined' || ngDevMode)) {\n throw getTableMultipleDefaultRowDefsError();\n }\n this._defaultRowDef = defaultRowDefs[0];\n }\n /**\n * Check if the header, data, or footer rows have changed what columns they want to display or\n * whether the sticky states have changed for the header or footer. If there is a diff, then\n * re-render that section.\n */\n _renderUpdatedColumns() {\n const columnsDiffReducer = (acc, def) => acc || !!def.getColumnsDiff();\n // Force re-render data rows if the list of column definitions have changed.\n const dataColumnsChanged = this._rowDefs.reduce(columnsDiffReducer, false);\n if (dataColumnsChanged) {\n this._forceRenderDataRows();\n }\n // Force re-render header/footer rows if the list of column definitions have changed.\n const headerColumnsChanged = this._headerRowDefs.reduce(columnsDiffReducer, false);\n if (headerColumnsChanged) {\n this._forceRenderHeaderRows();\n }\n const footerColumnsChanged = this._footerRowDefs.reduce(columnsDiffReducer, false);\n if (footerColumnsChanged) {\n this._forceRenderFooterRows();\n }\n return dataColumnsChanged || headerColumnsChanged || footerColumnsChanged;\n }\n /**\n * Switch to the provided data source by resetting the data and unsubscribing from the current\n * render change subscription if one exists. If the data source is null, interpret this by\n * clearing the row outlet. Otherwise start listening for new data.\n */\n _switchDataSource(dataSource) {\n this._data = [];\n if (isDataSource(this.dataSource)) {\n this.dataSource.disconnect(this);\n }\n // Stop listening for data from the previous data source.\n if (this._renderChangeSubscription) {\n this._renderChangeSubscription.unsubscribe();\n this._renderChangeSubscription = null;\n }\n if (!dataSource) {\n if (this._dataDiffer) {\n this._dataDiffer.diff([]);\n }\n if (this._rowOutlet) {\n this._rowOutlet.viewContainer.clear();\n }\n }\n this._dataSource = dataSource;\n }\n /** Set up a subscription for the data provided by the data source. */\n _observeRenderChanges() {\n // If no data source has been set, there is nothing to observe for changes.\n if (!this.dataSource) {\n return;\n }\n let dataStream;\n if (isDataSource(this.dataSource)) {\n dataStream = this.dataSource.connect(this);\n }\n else if (isObservable(this.dataSource)) {\n dataStream = this.dataSource;\n }\n else if (Array.isArray(this.dataSource)) {\n dataStream = of(this.dataSource);\n }\n if (dataStream === undefined && (typeof ngDevMode === 'undefined' || ngDevMode)) {\n throw getTableUnknownDataSourceError();\n }\n this._renderChangeSubscription = dataStream\n .pipe(takeUntil(this._onDestroy))\n .subscribe(data => {\n this._data = data || [];\n this.renderRows();\n });\n }\n /**\n * Clears any existing content in the header row outlet and creates a new embedded view\n * in the outlet using the header row definition.\n */\n _forceRenderHeaderRows() {\n // Clear the header row outlet if any content exists.\n if (this._headerRowOutlet.viewContainer.length > 0) {\n this._headerRowOutlet.viewContainer.clear();\n }\n this._headerRowDefs.forEach((def, i) => this._renderRow(this._headerRowOutlet, def, i));\n this.updateStickyHeaderRowStyles();\n }\n /**\n * Clears any existing content in the footer row outlet and creates a new embedded view\n * in the outlet using the footer row definition.\n */\n _forceRenderFooterRows() {\n // Clear the footer row outlet if any content exists.\n if (this._footerRowOutlet.viewContainer.length > 0) {\n this._footerRowOutlet.viewContainer.clear();\n }\n this._footerRowDefs.forEach((def, i) => this._renderRow(this._footerRowOutlet, def, i));\n this.updateStickyFooterRowStyles();\n }\n /** Adds the sticky column styles for the rows according to the columns' stick states. */\n _addStickyColumnStyles(rows, rowDef) {\n const columnDefs = Array.from(rowDef.columns || []).map(columnName => {\n const columnDef = this._columnDefsByName.get(columnName);\n if (!columnDef && (typeof ngDevMode === 'undefined' || ngDevMode)) {\n throw getTableUnknownColumnError(columnName);\n }\n return columnDef;\n });\n const stickyStartStates = columnDefs.map(columnDef => columnDef.sticky);\n const stickyEndStates = columnDefs.map(columnDef => columnDef.stickyEnd);\n this._stickyStyler.updateStickyColumns(rows, stickyStartStates, stickyEndStates, !this._fixedLayout || this._forceRecalculateCellWidths);\n }\n /** Gets the list of rows that have been rendered in the row outlet. */\n _getRenderedRows(rowOutlet) {\n const renderedRows = [];\n for (let i = 0; i < rowOutlet.viewContainer.length; i++) {\n const viewRef = rowOutlet.viewContainer.get(i);\n renderedRows.push(viewRef.rootNodes[0]);\n }\n return renderedRows;\n }\n /**\n * Get the matching row definitions that should be used for this row data. If there is only\n * one row definition, it is returned. Otherwise, find the row definitions that has a when\n * predicate that returns true with the data. If none return true, return the default row\n * definition.\n */\n _getRowDefs(data, dataIndex) {\n if (this._rowDefs.length == 1) {\n return [this._rowDefs[0]];\n }\n let rowDefs = [];\n if (this.multiTemplateDataRows) {\n rowDefs = this._rowDefs.filter(def => !def.when || def.when(dataIndex, data));\n }\n else {\n let rowDef = this._rowDefs.find(def => def.when && def.when(dataIndex, data)) || this._defaultRowDef;\n if (rowDef) {\n rowDefs.push(rowDef);\n }\n }\n if (!rowDefs.length && (typeof ngDevMode === 'undefined' || ngDevMode)) {\n throw getTableMissingMatchingRowDefError(data);\n }\n return rowDefs;\n }\n _getEmbeddedViewArgs(renderRow, index) {\n const rowDef = renderRow.rowDef;\n const context = { $implicit: renderRow.data };\n return {\n templateRef: rowDef.template,\n context,\n index,\n };\n }\n /**\n * Creates a new row template in the outlet and fills it with the set of cell templates.\n * Optionally takes a context to provide to the row and cells, as well as an optional index\n * of where to place the new row template in the outlet.\n */\n _renderRow(outlet, rowDef, index, context = {}) {\n // TODO(andrewseguin): enforce that one outlet was instantiated from createEmbeddedView\n const view = outlet.viewContainer.createEmbeddedView(rowDef.template, context, index);\n this._renderCellTemplateForItem(rowDef, context);\n return view;\n }\n _renderCellTemplateForItem(rowDef, context) {\n for (let cellTemplate of this._getCellTemplates(rowDef)) {\n if (CdkCellOutlet.mostRecentCellOutlet) {\n CdkCellOutlet.mostRecentCellOutlet._viewContainer.createEmbeddedView(cellTemplate, context);\n }\n }\n this._changeDetectorRef.markForCheck();\n }\n /**\n * Updates the index-related context for each row to reflect any changes in the index of the rows,\n * e.g. first/last/even/odd.\n */\n _updateRowIndexContext() {\n const viewContainer = this._rowOutlet.viewContainer;\n for (let renderIndex = 0, count = viewContainer.length; renderIndex < count; renderIndex++) {\n const viewRef = viewContainer.get(renderIndex);\n const context = viewRef.context;\n context.count = count;\n context.first = renderIndex === 0;\n context.last = renderIndex === count - 1;\n context.even = renderIndex % 2 === 0;\n context.odd = !context.even;\n if (this.multiTemplateDataRows) {\n context.dataIndex = this._renderRows[renderIndex].dataIndex;\n context.renderIndex = renderIndex;\n }\n else {\n context.index = this._renderRows[renderIndex].dataIndex;\n }\n }\n }\n /** Gets the column definitions for the provided row def. */\n _getCellTemplates(rowDef) {\n if (!rowDef || !rowDef.columns) {\n return [];\n }\n return Array.from(rowDef.columns, columnId => {\n const column = this._columnDefsByName.get(columnId);\n if (!column && (typeof ngDevMode === 'undefined' || ngDevMode)) {\n throw getTableUnknownColumnError(columnId);\n }\n return rowDef.extractCellTemplate(column);\n });\n }\n /**\n * Forces a re-render of the data rows. Should be called in cases where there has been an input\n * change that affects the evaluation of which rows should be rendered, e.g. toggling\n * `multiTemplateDataRows` or adding/removing row definitions.\n */\n _forceRenderDataRows() {\n this._dataDiffer.diff([]);\n this._rowOutlet.viewContainer.clear();\n this.renderRows();\n }\n /**\n * Checks if there has been a change in sticky states since last check and applies the correct\n * sticky styles. Since checking resets the \"dirty\" state, this should only be performed once\n * during a change detection and after the inputs are settled (after content check).\n */\n _checkStickyStates() {\n const stickyCheckReducer = (acc, d) => {\n return acc || d.hasStickyChanged();\n };\n // Note that the check needs to occur for every definition since it notifies the definition\n // that it can reset its dirty state. Using another operator like `some` may short-circuit\n // remaining definitions and leave them in an unchecked state.\n if (this._headerRowDefs.reduce(stickyCheckReducer, false)) {\n this.updateStickyHeaderRowStyles();\n }\n if (this._footerRowDefs.reduce(stickyCheckReducer, false)) {\n this.updateStickyFooterRowStyles();\n }\n if (Array.from(this._columnDefsByName.values()).reduce(stickyCheckReducer, false)) {\n this._stickyColumnStylesNeedReset = true;\n this.updateStickyColumnStyles();\n }\n }\n /**\n * Creates the sticky styler that will be used for sticky rows and columns. Listens\n * for directionality changes and provides the latest direction to the styler. Re-applies column\n * stickiness when directionality changes.\n */\n _setupStickyStyler() {\n const direction = this._dir ? this._dir.value : 'ltr';\n this._stickyStyler = new StickyStyler(this._isNativeHtmlTable, this.stickyCssClass, direction, this._coalescedStyleScheduler, this._platform.isBrowser, this.needsPositionStickyOnElement, this._stickyPositioningListener);\n (this._dir ? this._dir.change : of())\n .pipe(takeUntil(this._onDestroy))\n .subscribe(value => {\n this._stickyStyler.direction = value;\n this.updateStickyColumnStyles();\n });\n }\n /** Filters definitions that belong to this table from a QueryList. */\n _getOwnDefs(items) {\n return items.filter(item => !item._table || item._table === this);\n }\n /** Creates or removes the no data row, depending on whether any data is being shown. */\n _updateNoDataRow() {\n const noDataRow = this._customNoDataRow || this._noDataRow;\n if (!noDataRow) {\n return;\n }\n const shouldShow = this._rowOutlet.viewContainer.length === 0;\n if (shouldShow === this._isShowingNoDataRow) {\n return;\n }\n const container = this._noDataRowOutlet.viewContainer;\n if (shouldShow) {\n const view = container.createEmbeddedView(noDataRow.templateRef);\n const rootNode = view.rootNodes[0];\n // Only add the attributes if we have a single root node since it's hard\n // to figure out which one to add it to when there are multiple.\n if (view.rootNodes.length === 1 && rootNode?.nodeType === this._document.ELEMENT_NODE) {\n rootNode.setAttribute('role', 'row');\n rootNode.classList.add(noDataRow._contentClassName);\n }\n }\n else {\n container.clear();\n }\n this._isShowingNoDataRow = shouldShow;\n this._changeDetectorRef.markForCheck();\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkTable, deps: [{ token: i0.IterableDiffers }, { token: i0.ChangeDetectorRef }, { token: i0.ElementRef }, { token: 'role', attribute: true }, { token: i1.Directionality, optional: true }, { token: DOCUMENT }, { token: i2.Platform }, { token: _VIEW_REPEATER_STRATEGY }, { token: _COALESCED_STYLE_SCHEDULER }, { token: i3.ViewportRuler }, { token: STICKY_POSITIONING_LISTENER, optional: true, skipSelf: true }, { token: i0.NgZone, optional: true }], target: i0.ɵɵFactoryTarget.Component }); }\n static { this.ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"17.0.0\", version: \"18.2.0-next.2\", type: CdkTable, isStandalone: true, selector: \"cdk-table, table[cdk-table]\", inputs: { trackBy: \"trackBy\", dataSource: \"dataSource\", multiTemplateDataRows: [\"multiTemplateDataRows\", \"multiTemplateDataRows\", booleanAttribute], fixedLayout: [\"fixedLayout\", \"fixedLayout\", booleanAttribute] }, outputs: { contentChanged: \"contentChanged\" }, host: { properties: { \"class.cdk-table-fixed-layout\": \"fixedLayout\" }, classAttribute: \"cdk-table\" }, providers: [\n { provide: CDK_TABLE, useExisting: CdkTable },\n { provide: _VIEW_REPEATER_STRATEGY, useClass: _DisposeViewRepeaterStrategy },\n { provide: _COALESCED_STYLE_SCHEDULER, useClass: _CoalescedStyleScheduler },\n // Prevent nested tables from seeing this table's StickyPositioningListener.\n { provide: STICKY_POSITIONING_LISTENER, useValue: null },\n ], queries: [{ propertyName: \"_noDataRow\", first: true, predicate: CdkNoDataRow, descendants: true }, { propertyName: \"_contentColumnDefs\", predicate: CdkColumnDef, descendants: true }, { propertyName: \"_contentRowDefs\", predicate: CdkRowDef, descendants: true }, { propertyName: \"_contentHeaderRowDefs\", predicate: CdkHeaderRowDef, descendants: true }, { propertyName: \"_contentFooterRowDefs\", predicate: CdkFooterRowDef, descendants: true }], exportAs: [\"cdkTable\"], ngImport: i0, template: \"\\n \\n \\n \\n \\n \\n \\n \\n } @else {\\n `).\n *\n * By default, the name of this column will be the header text and data property accessor.\n * The header text can be overridden with the `headerText` input. Cell values can be overridden with\n * the `dataAccessor` input. Change the text justification to the start or end using the `justify`\n * input.\n */\nclass CdkTextColumn {\n /** Column name that should be used to reference this column. */\n get name() {\n return this._name;\n }\n set name(name) {\n this._name = name;\n // With Ivy, inputs can be initialized before static query results are\n // available. In that case, we defer the synchronization until \"ngOnInit\" fires.\n this._syncColumnDefName();\n }\n constructor(\n // `CdkTextColumn` is always requiring a table, but we just assert it manually\n // for better error reporting.\n // tslint:disable-next-line: lightweight-tokens\n _table, _options) {\n this._table = _table;\n this._options = _options;\n /** Alignment of the cell values. */\n this.justify = 'start';\n this._options = _options || {};\n }\n ngOnInit() {\n this._syncColumnDefName();\n if (this.headerText === undefined) {\n this.headerText = this._createDefaultHeaderText();\n }\n if (!this.dataAccessor) {\n this.dataAccessor =\n this._options.defaultDataAccessor || ((data, name) => data[name]);\n }\n if (this._table) {\n // Provide the cell and headerCell directly to the table with the static `ViewChild` query,\n // since the columnDef will not pick up its content by the time the table finishes checking\n // its content and initializing the rows.\n this.columnDef.cell = this.cell;\n this.columnDef.headerCell = this.headerCell;\n this._table.addColumnDef(this.columnDef);\n }\n else if (typeof ngDevMode === 'undefined' || ngDevMode) {\n throw getTableTextColumnMissingParentTableError();\n }\n }\n ngOnDestroy() {\n if (this._table) {\n this._table.removeColumnDef(this.columnDef);\n }\n }\n /**\n * Creates a default header text. Use the options' header text transformation function if one\n * has been provided. Otherwise simply capitalize the column name.\n */\n _createDefaultHeaderText() {\n const name = this.name;\n if (!name && (typeof ngDevMode === 'undefined' || ngDevMode)) {\n throw getTableTextColumnMissingNameError();\n }\n if (this._options && this._options.defaultHeaderTextTransform) {\n return this._options.defaultHeaderTextTransform(name);\n }\n return name[0].toUpperCase() + name.slice(1);\n }\n /** Synchronizes the column definition name with the text column name. */\n _syncColumnDefName() {\n if (this.columnDef) {\n this.columnDef.name = this.name;\n }\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkTextColumn, deps: [{ token: CdkTable, optional: true }, { token: TEXT_COLUMN_OPTIONS, optional: true }], target: i0.ɵɵFactoryTarget.Component }); }\n static { this.ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"18.2.0-next.2\", type: CdkTextColumn, isStandalone: true, selector: \"cdk-text-column\", inputs: { name: \"name\", headerText: \"headerText\", dataAccessor: \"dataAccessor\", justify: \"justify\" }, viewQueries: [{ propertyName: \"columnDef\", first: true, predicate: CdkColumnDef, descendants: true, static: true }, { propertyName: \"cell\", first: true, predicate: CdkCellDef, descendants: true, static: true }, { propertyName: \"headerCell\", first: true, predicate: CdkHeaderCellDef, descendants: true, static: true }], ngImport: i0, template: `\n \n \n {{headerText}}\n \n \n {{dataAccessor(data, name)}}\n \n \n `, isInline: true, dependencies: [{ kind: \"directive\", type: CdkColumnDef, selector: \"[cdkColumnDef]\", inputs: [\"cdkColumnDef\", \"sticky\", \"stickyEnd\"] }, { kind: \"directive\", type: CdkHeaderCellDef, selector: \"[cdkHeaderCellDef]\" }, { kind: \"directive\", type: CdkHeaderCell, selector: \"cdk-header-cell, th[cdk-header-cell]\" }, { kind: \"directive\", type: CdkCellDef, selector: \"[cdkCellDef]\" }, { kind: \"directive\", type: CdkCell, selector: \"cdk-cell, td[cdk-cell]\" }], changeDetection: i0.ChangeDetectionStrategy.Default, encapsulation: i0.ViewEncapsulation.None }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkTextColumn, decorators: [{\n type: Component,\n args: [{\n selector: 'cdk-text-column',\n template: `\n \n \n {{headerText}}\n \n \n {{dataAccessor(data, name)}}\n \n \n `,\n encapsulation: ViewEncapsulation.None,\n // Change detection is intentionally not set to OnPush. This component's template will be provided\n // to the table to be inserted into its view. This is problematic when change detection runs since\n // the bindings in this template will be evaluated _after_ the table's view is evaluated, which\n // mean's the template in the table's view will not have the updated value (and in fact will cause\n // an ExpressionChangedAfterItHasBeenCheckedError).\n // tslint:disable-next-line:validate-decorators\n changeDetection: ChangeDetectionStrategy.Default,\n standalone: true,\n imports: [CdkColumnDef, CdkHeaderCellDef, CdkHeaderCell, CdkCellDef, CdkCell],\n }]\n }], ctorParameters: () => [{ type: CdkTable, decorators: [{\n type: Optional\n }] }, { type: undefined, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [TEXT_COLUMN_OPTIONS]\n }] }], propDecorators: { name: [{\n type: Input\n }], headerText: [{\n type: Input\n }], dataAccessor: [{\n type: Input\n }], justify: [{\n type: Input\n }], columnDef: [{\n type: ViewChild,\n args: [CdkColumnDef, { static: true }]\n }], cell: [{\n type: ViewChild,\n args: [CdkCellDef, { static: true }]\n }], headerCell: [{\n type: ViewChild,\n args: [CdkHeaderCellDef, { static: true }]\n }] } });\n\nconst EXPORTED_DECLARATIONS = [\n CdkTable,\n CdkRowDef,\n CdkCellDef,\n CdkCellOutlet,\n CdkHeaderCellDef,\n CdkFooterCellDef,\n CdkColumnDef,\n CdkCell,\n CdkRow,\n CdkHeaderCell,\n CdkFooterCell,\n CdkHeaderRow,\n CdkHeaderRowDef,\n CdkFooterRow,\n CdkFooterRowDef,\n DataRowOutlet,\n HeaderRowOutlet,\n FooterRowOutlet,\n CdkTextColumn,\n CdkNoDataRow,\n CdkRecycleRows,\n NoDataRowOutlet,\n];\nclass CdkTableModule {\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkTableModule, deps: [], target: i0.ɵɵFactoryTarget.NgModule }); }\n static { this.ɵmod = i0.ɵɵngDeclareNgModule({ minVersion: \"14.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkTableModule, imports: [ScrollingModule, CdkTable,\n CdkRowDef,\n CdkCellDef,\n CdkCellOutlet,\n CdkHeaderCellDef,\n CdkFooterCellDef,\n CdkColumnDef,\n CdkCell,\n CdkRow,\n CdkHeaderCell,\n CdkFooterCell,\n CdkHeaderRow,\n CdkHeaderRowDef,\n CdkFooterRow,\n CdkFooterRowDef,\n DataRowOutlet,\n HeaderRowOutlet,\n FooterRowOutlet,\n CdkTextColumn,\n CdkNoDataRow,\n CdkRecycleRows,\n NoDataRowOutlet], exports: [CdkTable,\n CdkRowDef,\n CdkCellDef,\n CdkCellOutlet,\n CdkHeaderCellDef,\n CdkFooterCellDef,\n CdkColumnDef,\n CdkCell,\n CdkRow,\n CdkHeaderCell,\n CdkFooterCell,\n CdkHeaderRow,\n CdkHeaderRowDef,\n CdkFooterRow,\n CdkFooterRowDef,\n DataRowOutlet,\n HeaderRowOutlet,\n FooterRowOutlet,\n CdkTextColumn,\n CdkNoDataRow,\n CdkRecycleRows,\n NoDataRowOutlet] }); }\n static { this.ɵinj = i0.ɵɵngDeclareInjector({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkTableModule, imports: [ScrollingModule] }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkTableModule, decorators: [{\n type: NgModule,\n args: [{\n exports: EXPORTED_DECLARATIONS,\n imports: [ScrollingModule, ...EXPORTED_DECLARATIONS],\n }]\n }] });\n\n/**\n * Mixin to provide a directive with a function that checks if the sticky input has been\n * changed since the last time the function was called. Essentially adds a dirty-check to the\n * sticky value.\n * @docs-private\n * @deprecated Implement the `CanStick` interface instead.\n * @breaking-change 19.0.0\n */\nfunction mixinHasStickyInput(base) {\n return class extends base {\n /** Whether sticky positioning should be applied. */\n get sticky() {\n return this._sticky;\n }\n set sticky(v) {\n const prevValue = this._sticky;\n this._sticky = coerceBooleanProperty(v);\n this._hasStickyChanged = prevValue !== this._sticky;\n }\n /** Whether the sticky value has changed since this was last called. */\n hasStickyChanged() {\n const hasStickyChanged = this._hasStickyChanged;\n this._hasStickyChanged = false;\n return hasStickyChanged;\n }\n /** Resets the dirty check for cases where the sticky state has been used without checking. */\n resetStickyChanged() {\n this._hasStickyChanged = false;\n }\n constructor(...args) {\n super(...args);\n this._sticky = false;\n /** Whether the sticky input has changed since it was last checked. */\n this._hasStickyChanged = false;\n }\n };\n}\n\n/**\n * Generated bundle index. Do not edit.\n */\n\nexport { BaseCdkCell, BaseRowDef, CDK_ROW_TEMPLATE, CDK_TABLE, CDK_TABLE_TEMPLATE, CdkCell, CdkCellDef, CdkCellOutlet, CdkColumnDef, CdkFooterCell, CdkFooterCellDef, CdkFooterRow, CdkFooterRowDef, CdkHeaderCell, CdkHeaderCellDef, CdkHeaderRow, CdkHeaderRowDef, CdkNoDataRow, CdkRecycleRows, CdkRow, CdkRowDef, CdkTable, CdkTableModule, CdkTextColumn, DataRowOutlet, FooterRowOutlet, HeaderRowOutlet, NoDataRowOutlet, STICKY_DIRECTIONS, STICKY_POSITIONING_LISTENER, StickyStyler, TEXT_COLUMN_OPTIONS, _COALESCED_STYLE_SCHEDULER, _CoalescedStyleScheduler, _Schedule, mixinHasStickyInput };\n","import * as i1 from '@angular/cdk/platform';\nimport { normalizePassiveListenerOptions } from '@angular/cdk/platform';\nimport * as i0 from '@angular/core';\nimport { Injectable, EventEmitter, Directive, Output, booleanAttribute, Optional, Inject, Input, NgModule } from '@angular/core';\nimport { coerceElement, coerceNumberProperty } from '@angular/cdk/coercion';\nimport { EMPTY, Subject, fromEvent } from 'rxjs';\nimport { auditTime, takeUntil } from 'rxjs/operators';\nimport { DOCUMENT } from '@angular/common';\n\n/** Options to pass to the animationstart listener. */\nconst listenerOptions = normalizePassiveListenerOptions({ passive: true });\n/**\n * An injectable service that can be used to monitor the autofill state of an input.\n * Based on the following blog post:\n * https://medium.com/@brunn/detecting-autofilled-fields-in-javascript-aed598d25da7\n */\nclass AutofillMonitor {\n constructor(_platform, _ngZone) {\n this._platform = _platform;\n this._ngZone = _ngZone;\n this._monitoredElements = new Map();\n }\n monitor(elementOrRef) {\n if (!this._platform.isBrowser) {\n return EMPTY;\n }\n const element = coerceElement(elementOrRef);\n const info = this._monitoredElements.get(element);\n if (info) {\n return info.subject;\n }\n const result = new Subject();\n const cssClass = 'cdk-text-field-autofilled';\n const listener = ((event) => {\n // Animation events fire on initial element render, we check for the presence of the autofill\n // CSS class to make sure this is a real change in state, not just the initial render before\n // we fire off events.\n if (event.animationName === 'cdk-text-field-autofill-start' &&\n !element.classList.contains(cssClass)) {\n element.classList.add(cssClass);\n this._ngZone.run(() => result.next({ target: event.target, isAutofilled: true }));\n }\n else if (event.animationName === 'cdk-text-field-autofill-end' &&\n element.classList.contains(cssClass)) {\n element.classList.remove(cssClass);\n this._ngZone.run(() => result.next({ target: event.target, isAutofilled: false }));\n }\n });\n this._ngZone.runOutsideAngular(() => {\n element.addEventListener('animationstart', listener, listenerOptions);\n element.classList.add('cdk-text-field-autofill-monitored');\n });\n this._monitoredElements.set(element, {\n subject: result,\n unlisten: () => {\n element.removeEventListener('animationstart', listener, listenerOptions);\n },\n });\n return result;\n }\n stopMonitoring(elementOrRef) {\n const element = coerceElement(elementOrRef);\n const info = this._monitoredElements.get(element);\n if (info) {\n info.unlisten();\n info.subject.complete();\n element.classList.remove('cdk-text-field-autofill-monitored');\n element.classList.remove('cdk-text-field-autofilled');\n this._monitoredElements.delete(element);\n }\n }\n ngOnDestroy() {\n this._monitoredElements.forEach((_info, element) => this.stopMonitoring(element));\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: AutofillMonitor, deps: [{ token: i1.Platform }, { token: i0.NgZone }], target: i0.ɵɵFactoryTarget.Injectable }); }\n static { this.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: AutofillMonitor, providedIn: 'root' }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: AutofillMonitor, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: () => [{ type: i1.Platform }, { type: i0.NgZone }] });\n/** A directive that can be used to monitor the autofill state of an input. */\nclass CdkAutofill {\n constructor(_elementRef, _autofillMonitor) {\n this._elementRef = _elementRef;\n this._autofillMonitor = _autofillMonitor;\n /** Emits when the autofill state of the element changes. */\n this.cdkAutofill = new EventEmitter();\n }\n ngOnInit() {\n this._autofillMonitor\n .monitor(this._elementRef)\n .subscribe(event => this.cdkAutofill.emit(event));\n }\n ngOnDestroy() {\n this._autofillMonitor.stopMonitoring(this._elementRef);\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkAutofill, deps: [{ token: i0.ElementRef }, { token: AutofillMonitor }], target: i0.ɵɵFactoryTarget.Directive }); }\n static { this.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"18.2.0-next.2\", type: CdkAutofill, isStandalone: true, selector: \"[cdkAutofill]\", outputs: { cdkAutofill: \"cdkAutofill\" }, ngImport: i0 }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkAutofill, decorators: [{\n type: Directive,\n args: [{\n selector: '[cdkAutofill]',\n standalone: true,\n }]\n }], ctorParameters: () => [{ type: i0.ElementRef }, { type: AutofillMonitor }], propDecorators: { cdkAutofill: [{\n type: Output\n }] } });\n\n/** Directive to automatically resize a textarea to fit its content. */\nclass CdkTextareaAutosize {\n /** Minimum amount of rows in the textarea. */\n get minRows() {\n return this._minRows;\n }\n set minRows(value) {\n this._minRows = coerceNumberProperty(value);\n this._setMinHeight();\n }\n /** Maximum amount of rows in the textarea. */\n get maxRows() {\n return this._maxRows;\n }\n set maxRows(value) {\n this._maxRows = coerceNumberProperty(value);\n this._setMaxHeight();\n }\n /** Whether autosizing is enabled or not */\n get enabled() {\n return this._enabled;\n }\n set enabled(value) {\n // Only act if the actual value changed. This specifically helps to not run\n // resizeToFitContent too early (i.e. before ngAfterViewInit)\n if (this._enabled !== value) {\n (this._enabled = value) ? this.resizeToFitContent(true) : this.reset();\n }\n }\n get placeholder() {\n return this._textareaElement.placeholder;\n }\n set placeholder(value) {\n this._cachedPlaceholderHeight = undefined;\n if (value) {\n this._textareaElement.setAttribute('placeholder', value);\n }\n else {\n this._textareaElement.removeAttribute('placeholder');\n }\n this._cacheTextareaPlaceholderHeight();\n }\n constructor(_elementRef, _platform, _ngZone, \n /** @breaking-change 11.0.0 make document required */\n document) {\n this._elementRef = _elementRef;\n this._platform = _platform;\n this._ngZone = _ngZone;\n this._destroyed = new Subject();\n this._enabled = true;\n /**\n * Value of minRows as of last resize. If the minRows has decreased, the\n * height of the textarea needs to be recomputed to reflect the new minimum. The maxHeight\n * does not have the same problem because it does not affect the textarea's scrollHeight.\n */\n this._previousMinRows = -1;\n this._isViewInited = false;\n /** Handles `focus` and `blur` events. */\n this._handleFocusEvent = (event) => {\n this._hasFocus = event.type === 'focus';\n };\n this._document = document;\n this._textareaElement = this._elementRef.nativeElement;\n }\n /** Sets the minimum height of the textarea as determined by minRows. */\n _setMinHeight() {\n const minHeight = this.minRows && this._cachedLineHeight ? `${this.minRows * this._cachedLineHeight}px` : null;\n if (minHeight) {\n this._textareaElement.style.minHeight = minHeight;\n }\n }\n /** Sets the maximum height of the textarea as determined by maxRows. */\n _setMaxHeight() {\n const maxHeight = this.maxRows && this._cachedLineHeight ? `${this.maxRows * this._cachedLineHeight}px` : null;\n if (maxHeight) {\n this._textareaElement.style.maxHeight = maxHeight;\n }\n }\n ngAfterViewInit() {\n if (this._platform.isBrowser) {\n // Remember the height which we started with in case autosizing is disabled\n this._initialHeight = this._textareaElement.style.height;\n this.resizeToFitContent();\n this._ngZone.runOutsideAngular(() => {\n const window = this._getWindow();\n fromEvent(window, 'resize')\n .pipe(auditTime(16), takeUntil(this._destroyed))\n .subscribe(() => this.resizeToFitContent(true));\n this._textareaElement.addEventListener('focus', this._handleFocusEvent);\n this._textareaElement.addEventListener('blur', this._handleFocusEvent);\n });\n this._isViewInited = true;\n this.resizeToFitContent(true);\n }\n }\n ngOnDestroy() {\n this._textareaElement.removeEventListener('focus', this._handleFocusEvent);\n this._textareaElement.removeEventListener('blur', this._handleFocusEvent);\n this._destroyed.next();\n this._destroyed.complete();\n }\n /**\n * Cache the height of a single-row textarea if it has not already been cached.\n *\n * We need to know how large a single \"row\" of a textarea is in order to apply minRows and\n * maxRows. For the initial version, we will assume that the height of a single line in the\n * textarea does not ever change.\n */\n _cacheTextareaLineHeight() {\n if (this._cachedLineHeight) {\n return;\n }\n // Use a clone element because we have to override some styles.\n let textareaClone = this._textareaElement.cloneNode(false);\n textareaClone.rows = 1;\n // Use `position: absolute` so that this doesn't cause a browser layout and use\n // `visibility: hidden` so that nothing is rendered. Clear any other styles that\n // would affect the height.\n textareaClone.style.position = 'absolute';\n textareaClone.style.visibility = 'hidden';\n textareaClone.style.border = 'none';\n textareaClone.style.padding = '0';\n textareaClone.style.height = '';\n textareaClone.style.minHeight = '';\n textareaClone.style.maxHeight = '';\n // In Firefox it happens that textarea elements are always bigger than the specified amount\n // of rows. This is because Firefox tries to add extra space for the horizontal scrollbar.\n // As a workaround that removes the extra space for the scrollbar, we can just set overflow\n // to hidden. This ensures that there is no invalid calculation of the line height.\n // See Firefox bug report: https://bugzilla.mozilla.org/show_bug.cgi?id=33654\n textareaClone.style.overflow = 'hidden';\n this._textareaElement.parentNode.appendChild(textareaClone);\n this._cachedLineHeight = textareaClone.clientHeight;\n textareaClone.remove();\n // Min and max heights have to be re-calculated if the cached line height changes\n this._setMinHeight();\n this._setMaxHeight();\n }\n _measureScrollHeight() {\n const element = this._textareaElement;\n const previousMargin = element.style.marginBottom || '';\n const isFirefox = this._platform.FIREFOX;\n const needsMarginFiller = isFirefox && this._hasFocus;\n const measuringClass = isFirefox\n ? 'cdk-textarea-autosize-measuring-firefox'\n : 'cdk-textarea-autosize-measuring';\n // In some cases the page might move around while we're measuring the `textarea` on Firefox. We\n // work around it by assigning a temporary margin with the same height as the `textarea` so that\n // it occupies the same amount of space. See #23233.\n if (needsMarginFiller) {\n element.style.marginBottom = `${element.clientHeight}px`;\n }\n // Reset the textarea height to auto in order to shrink back to its default size.\n // Also temporarily force overflow:hidden, so scroll bars do not interfere with calculations.\n element.classList.add(measuringClass);\n // The measuring class includes a 2px padding to workaround an issue with Chrome,\n // so we account for that extra space here by subtracting 4 (2px top + 2px bottom).\n const scrollHeight = element.scrollHeight - 4;\n element.classList.remove(measuringClass);\n if (needsMarginFiller) {\n element.style.marginBottom = previousMargin;\n }\n return scrollHeight;\n }\n _cacheTextareaPlaceholderHeight() {\n if (!this._isViewInited || this._cachedPlaceholderHeight != undefined) {\n return;\n }\n if (!this.placeholder) {\n this._cachedPlaceholderHeight = 0;\n return;\n }\n const value = this._textareaElement.value;\n this._textareaElement.value = this._textareaElement.placeholder;\n this._cachedPlaceholderHeight = this._measureScrollHeight();\n this._textareaElement.value = value;\n }\n ngDoCheck() {\n if (this._platform.isBrowser) {\n this.resizeToFitContent();\n }\n }\n /**\n * Resize the textarea to fit its content.\n * @param force Whether to force a height recalculation. By default the height will be\n * recalculated only if the value changed since the last call.\n */\n resizeToFitContent(force = false) {\n // If autosizing is disabled, just skip everything else\n if (!this._enabled) {\n return;\n }\n this._cacheTextareaLineHeight();\n this._cacheTextareaPlaceholderHeight();\n // If we haven't determined the line-height yet, we know we're still hidden and there's no point\n // in checking the height of the textarea.\n if (!this._cachedLineHeight) {\n return;\n }\n const textarea = this._elementRef.nativeElement;\n const value = textarea.value;\n // Only resize if the value or minRows have changed since these calculations can be expensive.\n if (!force && this._minRows === this._previousMinRows && value === this._previousValue) {\n return;\n }\n const scrollHeight = this._measureScrollHeight();\n const height = Math.max(scrollHeight, this._cachedPlaceholderHeight || 0);\n // Use the scrollHeight to know how large the textarea *would* be if fit its entire value.\n textarea.style.height = `${height}px`;\n this._ngZone.runOutsideAngular(() => {\n if (typeof requestAnimationFrame !== 'undefined') {\n requestAnimationFrame(() => this._scrollToCaretPosition(textarea));\n }\n else {\n setTimeout(() => this._scrollToCaretPosition(textarea));\n }\n });\n this._previousValue = value;\n this._previousMinRows = this._minRows;\n }\n /**\n * Resets the textarea to its original size\n */\n reset() {\n // Do not try to change the textarea, if the initialHeight has not been determined yet\n // This might potentially remove styles when reset() is called before ngAfterViewInit\n if (this._initialHeight !== undefined) {\n this._textareaElement.style.height = this._initialHeight;\n }\n }\n _noopInputHandler() {\n // no-op handler that ensures we're running change detection on input events.\n }\n /** Access injected document if available or fallback to global document reference */\n _getDocument() {\n return this._document || document;\n }\n /** Use defaultView of injected document if available or fallback to global window reference */\n _getWindow() {\n const doc = this._getDocument();\n return doc.defaultView || window;\n }\n /**\n * Scrolls a textarea to the caret position. On Firefox resizing the textarea will\n * prevent it from scrolling to the caret position. We need to re-set the selection\n * in order for it to scroll to the proper position.\n */\n _scrollToCaretPosition(textarea) {\n const { selectionStart, selectionEnd } = textarea;\n // IE will throw an \"Unspecified error\" if we try to set the selection range after the\n // element has been removed from the DOM. Assert that the directive hasn't been destroyed\n // between the time we requested the animation frame and when it was executed.\n // Also note that we have to assert that the textarea is focused before we set the\n // selection range. Setting the selection range on a non-focused textarea will cause\n // it to receive focus on IE and Edge.\n if (!this._destroyed.isStopped && this._hasFocus) {\n textarea.setSelectionRange(selectionStart, selectionEnd);\n }\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkTextareaAutosize, deps: [{ token: i0.ElementRef }, { token: i1.Platform }, { token: i0.NgZone }, { token: DOCUMENT, optional: true }], target: i0.ɵɵFactoryTarget.Directive }); }\n static { this.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"16.1.0\", version: \"18.2.0-next.2\", type: CdkTextareaAutosize, isStandalone: true, selector: \"textarea[cdkTextareaAutosize]\", inputs: { minRows: [\"cdkAutosizeMinRows\", \"minRows\"], maxRows: [\"cdkAutosizeMaxRows\", \"maxRows\"], enabled: [\"cdkTextareaAutosize\", \"enabled\", booleanAttribute], placeholder: \"placeholder\" }, host: { attributes: { \"rows\": \"1\" }, listeners: { \"input\": \"_noopInputHandler()\" }, classAttribute: \"cdk-textarea-autosize\" }, exportAs: [\"cdkTextareaAutosize\"], ngImport: i0 }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkTextareaAutosize, decorators: [{\n type: Directive,\n args: [{\n selector: 'textarea[cdkTextareaAutosize]',\n exportAs: 'cdkTextareaAutosize',\n host: {\n 'class': 'cdk-textarea-autosize',\n // Textarea elements that have the directive applied should have a single row by default.\n // Browsers normally show two rows by default and therefore this limits the minRows binding.\n 'rows': '1',\n '(input)': '_noopInputHandler()',\n },\n standalone: true,\n }]\n }], ctorParameters: () => [{ type: i0.ElementRef }, { type: i1.Platform }, { type: i0.NgZone }, { type: undefined, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [DOCUMENT]\n }] }], propDecorators: { minRows: [{\n type: Input,\n args: ['cdkAutosizeMinRows']\n }], maxRows: [{\n type: Input,\n args: ['cdkAutosizeMaxRows']\n }], enabled: [{\n type: Input,\n args: [{ alias: 'cdkTextareaAutosize', transform: booleanAttribute }]\n }], placeholder: [{\n type: Input\n }] } });\n\nclass TextFieldModule {\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: TextFieldModule, deps: [], target: i0.ɵɵFactoryTarget.NgModule }); }\n static { this.ɵmod = i0.ɵɵngDeclareNgModule({ minVersion: \"14.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: TextFieldModule, imports: [CdkAutofill, CdkTextareaAutosize], exports: [CdkAutofill, CdkTextareaAutosize] }); }\n static { this.ɵinj = i0.ɵɵngDeclareInjector({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: TextFieldModule }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: TextFieldModule, decorators: [{\n type: NgModule,\n args: [{\n imports: [CdkAutofill, CdkTextareaAutosize],\n exports: [CdkAutofill, CdkTextareaAutosize],\n }]\n }] });\n\n/**\n * Generated bundle index. Do not edit.\n */\n\nexport { AutofillMonitor, CdkAutofill, CdkTextareaAutosize, TextFieldModule };\n","import { SelectionModel, isDataSource } from '@angular/cdk/collections';\nimport { isObservable, Subject, BehaviorSubject, of, combineLatest, EMPTY, concat } from 'rxjs';\nimport { take, filter, takeUntil, startWith, tap, switchMap, map, reduce, concatMap, distinctUntilChanged } from 'rxjs/operators';\nimport * as i0 from '@angular/core';\nimport { InjectionToken, Directive, Inject, Optional, inject, Component, ViewEncapsulation, ChangeDetectionStrategy, Input, ViewChild, ContentChildren, EventEmitter, ChangeDetectorRef, booleanAttribute, Output, numberAttribute, NgModule } from '@angular/core';\nimport { TREE_KEY_MANAGER } from '@angular/cdk/a11y';\nimport * as i1 from '@angular/cdk/bidi';\nimport { coerceObservable } from '@angular/cdk/coercion/private';\n\n/**\n * Base tree control. It has basic toggle/expand/collapse operations on a single data node.\n *\n * @deprecated Use one of levelAccessor or childrenAccessor. To be removed in a future version.\n * @breaking-change 21.0.0\n */\nclass BaseTreeControl {\n constructor() {\n /** A selection model with multi-selection to track expansion status. */\n this.expansionModel = new SelectionModel(true);\n }\n /** Toggles one single data node's expanded/collapsed state. */\n toggle(dataNode) {\n this.expansionModel.toggle(this._trackByValue(dataNode));\n }\n /** Expands one single data node. */\n expand(dataNode) {\n this.expansionModel.select(this._trackByValue(dataNode));\n }\n /** Collapses one single data node. */\n collapse(dataNode) {\n this.expansionModel.deselect(this._trackByValue(dataNode));\n }\n /** Whether a given data node is expanded or not. Returns true if the data node is expanded. */\n isExpanded(dataNode) {\n return this.expansionModel.isSelected(this._trackByValue(dataNode));\n }\n /** Toggles a subtree rooted at `node` recursively. */\n toggleDescendants(dataNode) {\n this.expansionModel.isSelected(this._trackByValue(dataNode))\n ? this.collapseDescendants(dataNode)\n : this.expandDescendants(dataNode);\n }\n /** Collapse all dataNodes in the tree. */\n collapseAll() {\n this.expansionModel.clear();\n }\n /** Expands a subtree rooted at given data node recursively. */\n expandDescendants(dataNode) {\n let toBeProcessed = [dataNode];\n toBeProcessed.push(...this.getDescendants(dataNode));\n this.expansionModel.select(...toBeProcessed.map(value => this._trackByValue(value)));\n }\n /** Collapses a subtree rooted at given data node recursively. */\n collapseDescendants(dataNode) {\n let toBeProcessed = [dataNode];\n toBeProcessed.push(...this.getDescendants(dataNode));\n this.expansionModel.deselect(...toBeProcessed.map(value => this._trackByValue(value)));\n }\n _trackByValue(value) {\n return this.trackBy ? this.trackBy(value) : value;\n }\n}\n\n/**\n * Flat tree control. Able to expand/collapse a subtree recursively for flattened tree.\n *\n * @deprecated Use one of levelAccessor or childrenAccessor instead. To be removed in a future\n * version.\n * @breaking-change 21.0.0\n */\nclass FlatTreeControl extends BaseTreeControl {\n /** Construct with flat tree data node functions getLevel and isExpandable. */\n constructor(getLevel, isExpandable, options) {\n super();\n this.getLevel = getLevel;\n this.isExpandable = isExpandable;\n this.options = options;\n if (this.options) {\n this.trackBy = this.options.trackBy;\n }\n }\n /**\n * Gets a list of the data node's subtree of descendent data nodes.\n *\n * To make this working, the `dataNodes` of the TreeControl must be flattened tree nodes\n * with correct levels.\n */\n getDescendants(dataNode) {\n const startIndex = this.dataNodes.indexOf(dataNode);\n const results = [];\n // Goes through flattened tree nodes in the `dataNodes` array, and get all descendants.\n // The level of descendants of a tree node must be greater than the level of the given\n // tree node.\n // If we reach a node whose level is equal to the level of the tree node, we hit a sibling.\n // If we reach a node whose level is greater than the level of the tree node, we hit a\n // sibling of an ancestor.\n for (let i = startIndex + 1; i < this.dataNodes.length && this.getLevel(dataNode) < this.getLevel(this.dataNodes[i]); i++) {\n results.push(this.dataNodes[i]);\n }\n return results;\n }\n /**\n * Expands all data nodes in the tree.\n *\n * To make this working, the `dataNodes` variable of the TreeControl must be set to all flattened\n * data nodes of the tree.\n */\n expandAll() {\n this.expansionModel.select(...this.dataNodes.map(node => this._trackByValue(node)));\n }\n}\n\n/**\n * Nested tree control. Able to expand/collapse a subtree recursively for NestedNode type.\n *\n * @deprecated Use one of levelAccessor or childrenAccessor instead. To be removed in a future\n * version.\n * @breaking-change 21.0.0\n */\nclass NestedTreeControl extends BaseTreeControl {\n /** Construct with nested tree function getChildren. */\n constructor(getChildren, options) {\n super();\n this.getChildren = getChildren;\n this.options = options;\n if (this.options) {\n this.trackBy = this.options.trackBy;\n }\n if (this.options?.isExpandable) {\n this.isExpandable = this.options.isExpandable;\n }\n }\n /**\n * Expands all dataNodes in the tree.\n *\n * To make this working, the `dataNodes` variable of the TreeControl must be set to all root level\n * data nodes of the tree.\n */\n expandAll() {\n this.expansionModel.clear();\n const allNodes = this.dataNodes.reduce((accumulator, dataNode) => [...accumulator, ...this.getDescendants(dataNode), dataNode], []);\n this.expansionModel.select(...allNodes.map(node => this._trackByValue(node)));\n }\n /** Gets a list of descendant dataNodes of a subtree rooted at given data node recursively. */\n getDescendants(dataNode) {\n const descendants = [];\n this._getDescendants(descendants, dataNode);\n // Remove the node itself\n return descendants.splice(1);\n }\n /** A helper function to get descendants recursively. */\n _getDescendants(descendants, dataNode) {\n descendants.push(dataNode);\n const childrenNodes = this.getChildren(dataNode);\n if (Array.isArray(childrenNodes)) {\n childrenNodes.forEach((child) => this._getDescendants(descendants, child));\n }\n else if (isObservable(childrenNodes)) {\n // TypeScript as of version 3.5 doesn't seem to treat `Boolean` like a function that\n // returns a `boolean` specifically in the context of `filter`, so we manually clarify that.\n childrenNodes.pipe(take(1), filter(Boolean)).subscribe(children => {\n for (const child of children) {\n this._getDescendants(descendants, child);\n }\n });\n }\n }\n}\n\n/**\n * Injection token used to provide a `CdkTreeNode` to its outlet.\n * Used primarily to avoid circular imports.\n * @docs-private\n */\nconst CDK_TREE_NODE_OUTLET_NODE = new InjectionToken('CDK_TREE_NODE_OUTLET_NODE');\n/**\n * Outlet for nested CdkNode. Put `[cdkTreeNodeOutlet]` on a tag to place children dataNodes\n * inside the outlet.\n */\nclass CdkTreeNodeOutlet {\n constructor(viewContainer, _node) {\n this.viewContainer = viewContainer;\n this._node = _node;\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkTreeNodeOutlet, deps: [{ token: i0.ViewContainerRef }, { token: CDK_TREE_NODE_OUTLET_NODE, optional: true }], target: i0.ɵɵFactoryTarget.Directive }); }\n static { this.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"18.2.0-next.2\", type: CdkTreeNodeOutlet, isStandalone: true, selector: \"[cdkTreeNodeOutlet]\", ngImport: i0 }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkTreeNodeOutlet, decorators: [{\n type: Directive,\n args: [{\n selector: '[cdkTreeNodeOutlet]',\n standalone: true,\n }]\n }], ctorParameters: () => [{ type: i0.ViewContainerRef }, { type: undefined, decorators: [{\n type: Inject,\n args: [CDK_TREE_NODE_OUTLET_NODE]\n }, {\n type: Optional\n }] }] });\n\n/** Context provided to the tree node component. */\nclass CdkTreeNodeOutletContext {\n constructor(data) {\n this.$implicit = data;\n }\n}\n/**\n * Data node definition for the CdkTree.\n * Captures the node's template and a when predicate that describes when this node should be used.\n */\nclass CdkTreeNodeDef {\n /** @docs-private */\n constructor(template) {\n this.template = template;\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkTreeNodeDef, deps: [{ token: i0.TemplateRef }], target: i0.ɵɵFactoryTarget.Directive }); }\n static { this.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"18.2.0-next.2\", type: CdkTreeNodeDef, isStandalone: true, selector: \"[cdkTreeNodeDef]\", inputs: { when: [\"cdkTreeNodeDefWhen\", \"when\"] }, ngImport: i0 }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkTreeNodeDef, decorators: [{\n type: Directive,\n args: [{\n selector: '[cdkTreeNodeDef]',\n inputs: [{ name: 'when', alias: 'cdkTreeNodeDefWhen' }],\n standalone: true,\n }]\n }], ctorParameters: () => [{ type: i0.TemplateRef }] });\n\n/**\n * Returns an error to be thrown when there is no usable data.\n * @docs-private\n */\nfunction getTreeNoValidDataSourceError() {\n return Error(`A valid data source must be provided.`);\n}\n/**\n * Returns an error to be thrown when there are multiple nodes that are missing a when function.\n * @docs-private\n */\nfunction getTreeMultipleDefaultNodeDefsError() {\n return Error(`There can only be one default row without a when predicate function.`);\n}\n/**\n * Returns an error to be thrown when there are no matching node defs for a particular set of data.\n * @docs-private\n */\nfunction getTreeMissingMatchingNodeDefError() {\n return Error(`Could not find a matching node definition for the provided node data.`);\n}\n/**\n * Returns an error to be thrown when there is no tree control.\n * @docs-private\n */\nfunction getTreeControlMissingError() {\n return Error(`Could not find a tree control, levelAccessor, or childrenAccessor for the tree.`);\n}\n/**\n * Returns an error to be thrown when there are multiple ways of specifying children or level\n * provided to the tree.\n * @docs-private\n */\nfunction getMultipleTreeControlsError() {\n return Error(`More than one of tree control, levelAccessor, or childrenAccessor were provided.`);\n}\n\n/**\n * CDK tree component that connects with a data source to retrieve data of type `T` and renders\n * dataNodes with hierarchy. Updates the dataNodes when new data is provided by the data source.\n */\nclass CdkTree {\n /**\n * Provides a stream containing the latest data array to render. Influenced by the tree's\n * stream of view window (what dataNodes are currently on screen).\n * Data source can be an observable of data array, or a data array to render.\n */\n get dataSource() {\n return this._dataSource;\n }\n set dataSource(dataSource) {\n if (this._dataSource !== dataSource) {\n this._switchDataSource(dataSource);\n }\n }\n constructor(_differs, _changeDetectorRef, _dir) {\n this._differs = _differs;\n this._changeDetectorRef = _changeDetectorRef;\n this._dir = _dir;\n /** Subject that emits when the component has been destroyed. */\n this._onDestroy = new Subject();\n /** Level of nodes */\n this._levels = new Map();\n /** The immediate parents for a node. This is `null` if there is no parent. */\n this._parents = new Map();\n /**\n * Nodes grouped into each set, which is a list of nodes displayed together in the DOM.\n *\n * Lookup key is the parent of a set. Root nodes have key of null.\n *\n * Values is a 'set' of tree nodes. Each tree node maps to a treeitem element. Sets are in the\n * order that it is rendered. Each set maps directly to aria-posinset and aria-setsize attributes.\n */\n this._ariaSets = new Map();\n // TODO(tinayuangao): Setup a listener for scrolling, emit the calculated view to viewChange.\n // Remove the MAX_VALUE in viewChange\n /**\n * Stream containing the latest information on what rows are being displayed on screen.\n * Can be used by the data source to as a heuristic of what data should be provided.\n */\n this.viewChange = new BehaviorSubject({\n start: 0,\n end: Number.MAX_VALUE,\n });\n /**\n * Maintain a synchronous cache of flattened data nodes. This will only be\n * populated after initial render, and in certain cases, will be delayed due to\n * relying on Observable `getChildren` calls.\n */\n this._flattenedNodes = new BehaviorSubject([]);\n /** The automatically determined node type for the tree. */\n this._nodeType = new BehaviorSubject(null);\n /** The mapping between data and the node that is rendered. */\n this._nodes = new BehaviorSubject(new Map());\n /**\n * Synchronous cache of nodes for the `TreeKeyManager`. This is separate\n * from `_flattenedNodes` so they can be independently updated at different\n * times.\n */\n this._keyManagerNodes = new BehaviorSubject([]);\n this._keyManagerFactory = inject(TREE_KEY_MANAGER);\n this._viewInit = false;\n }\n ngAfterContentInit() {\n this._initializeKeyManager();\n }\n ngAfterContentChecked() {\n this._updateDefaultNodeDefinition();\n this._subscribeToDataChanges();\n }\n ngOnDestroy() {\n this._nodeOutlet.viewContainer.clear();\n this.viewChange.complete();\n this._onDestroy.next();\n this._onDestroy.complete();\n if (this._dataSource && typeof this._dataSource.disconnect === 'function') {\n this.dataSource.disconnect(this);\n }\n if (this._dataSubscription) {\n this._dataSubscription.unsubscribe();\n this._dataSubscription = null;\n }\n // In certain tests, the tree might be destroyed before this is initialized\n // in `ngAfterContentInit`.\n this._keyManager?.destroy();\n }\n ngOnInit() {\n this._checkTreeControlUsage();\n this._initializeDataDiffer();\n }\n ngAfterViewInit() {\n this._viewInit = true;\n }\n _updateDefaultNodeDefinition() {\n const defaultNodeDefs = this._nodeDefs.filter(def => !def.when);\n if (defaultNodeDefs.length > 1 && (typeof ngDevMode === 'undefined' || ngDevMode)) {\n throw getTreeMultipleDefaultNodeDefsError();\n }\n this._defaultNodeDef = defaultNodeDefs[0];\n }\n /**\n * Sets the node type for the tree, if it hasn't been set yet.\n *\n * This will be called by the first node that's rendered in order for the tree\n * to determine what data transformations are required.\n */\n _setNodeTypeIfUnset(nodeType) {\n if (this._nodeType.value === null) {\n this._nodeType.next(nodeType);\n }\n }\n /**\n * Switch to the provided data source by resetting the data and unsubscribing from the current\n * render change subscription if one exists. If the data source is null, interpret this by\n * clearing the node outlet. Otherwise start listening for new data.\n */\n _switchDataSource(dataSource) {\n if (this._dataSource && typeof this._dataSource.disconnect === 'function') {\n this.dataSource.disconnect(this);\n }\n if (this._dataSubscription) {\n this._dataSubscription.unsubscribe();\n this._dataSubscription = null;\n }\n // Remove the all dataNodes if there is now no data source\n if (!dataSource) {\n this._nodeOutlet.viewContainer.clear();\n }\n this._dataSource = dataSource;\n if (this._nodeDefs) {\n this._subscribeToDataChanges();\n }\n }\n _getExpansionModel() {\n if (!this.treeControl) {\n this._expansionModel ??= new SelectionModel(true);\n return this._expansionModel;\n }\n return this.treeControl.expansionModel;\n }\n /** Set up a subscription for the data provided by the data source. */\n _subscribeToDataChanges() {\n if (this._dataSubscription) {\n return;\n }\n let dataStream;\n if (isDataSource(this._dataSource)) {\n dataStream = this._dataSource.connect(this);\n }\n else if (isObservable(this._dataSource)) {\n dataStream = this._dataSource;\n }\n else if (Array.isArray(this._dataSource)) {\n dataStream = of(this._dataSource);\n }\n if (!dataStream) {\n if (typeof ngDevMode === 'undefined' || ngDevMode) {\n throw getTreeNoValidDataSourceError();\n }\n return;\n }\n this._dataSubscription = this._getRenderData(dataStream)\n .pipe(takeUntil(this._onDestroy))\n .subscribe(renderingData => {\n this._renderDataChanges(renderingData);\n });\n }\n /** Given an Observable containing a stream of the raw data, returns an Observable containing the RenderingData */\n _getRenderData(dataStream) {\n const expansionModel = this._getExpansionModel();\n return combineLatest([\n dataStream,\n this._nodeType,\n // We don't use the expansion data directly, however we add it here to essentially\n // trigger data rendering when expansion changes occur.\n expansionModel.changed.pipe(startWith(null), tap(expansionChanges => {\n this._emitExpansionChanges(expansionChanges);\n })),\n ]).pipe(switchMap(([data, nodeType]) => {\n if (nodeType === null) {\n return of({ renderNodes: data, flattenedNodes: null, nodeType });\n }\n // If we're here, then we know what our node type is, and therefore can\n // perform our usual rendering pipeline, which necessitates converting the data\n return this._computeRenderingData(data, nodeType).pipe(map(convertedData => ({ ...convertedData, nodeType })));\n }));\n }\n _renderDataChanges(data) {\n if (data.nodeType === null) {\n this.renderNodeChanges(data.renderNodes);\n return;\n }\n // If we're here, then we know what our node type is, and therefore can\n // perform our usual rendering pipeline.\n this._updateCachedData(data.flattenedNodes);\n this.renderNodeChanges(data.renderNodes);\n this._updateKeyManagerItems(data.flattenedNodes);\n }\n _emitExpansionChanges(expansionChanges) {\n if (!expansionChanges) {\n return;\n }\n const nodes = this._nodes.value;\n for (const added of expansionChanges.added) {\n const node = nodes.get(added);\n node?._emitExpansionState(true);\n }\n for (const removed of expansionChanges.removed) {\n const node = nodes.get(removed);\n node?._emitExpansionState(false);\n }\n }\n _initializeKeyManager() {\n const items = combineLatest([this._keyManagerNodes, this._nodes]).pipe(map(([keyManagerNodes, renderNodes]) => keyManagerNodes.reduce((items, data) => {\n const node = renderNodes.get(this._getExpansionKey(data));\n if (node) {\n items.push(node);\n }\n return items;\n }, [])));\n const keyManagerOptions = {\n trackBy: node => this._getExpansionKey(node.data),\n skipPredicate: node => !!node.isDisabled,\n typeAheadDebounceInterval: true,\n horizontalOrientation: this._dir.value,\n };\n this._keyManager = this._keyManagerFactory(items, keyManagerOptions);\n }\n _initializeDataDiffer() {\n // Provide a default trackBy based on `_getExpansionKey` if one isn't provided.\n const trackBy = this.trackBy ?? ((_index, item) => this._getExpansionKey(item));\n this._dataDiffer = this._differs.find([]).create(trackBy);\n }\n _checkTreeControlUsage() {\n if (typeof ngDevMode === 'undefined' || ngDevMode) {\n // Verify that Tree follows API contract of using one of TreeControl, levelAccessor or\n // childrenAccessor. Throw an appropriate error if contract is not met.\n let numTreeControls = 0;\n if (this.treeControl) {\n numTreeControls++;\n }\n if (this.levelAccessor) {\n numTreeControls++;\n }\n if (this.childrenAccessor) {\n numTreeControls++;\n }\n if (!numTreeControls) {\n throw getTreeControlMissingError();\n }\n else if (numTreeControls > 1) {\n throw getMultipleTreeControlsError();\n }\n }\n }\n /** Check for changes made in the data and render each change (node added/removed/moved). */\n renderNodeChanges(data, dataDiffer = this._dataDiffer, viewContainer = this._nodeOutlet.viewContainer, parentData) {\n const changes = dataDiffer.diff(data);\n // Some tree consumers expect change detection to propagate to nodes\n // even when the array itself hasn't changed; we explicitly detect changes\n // anyways in order for nodes to update their data.\n //\n // However, if change detection is called while the component's view is\n // still initing, then the order of child views initing will be incorrect;\n // to prevent this, we only exit early if the view hasn't initialized yet.\n if (!changes && !this._viewInit) {\n return;\n }\n changes?.forEachOperation((item, adjustedPreviousIndex, currentIndex) => {\n if (item.previousIndex == null) {\n this.insertNode(data[currentIndex], currentIndex, viewContainer, parentData);\n }\n else if (currentIndex == null) {\n viewContainer.remove(adjustedPreviousIndex);\n }\n else {\n const view = viewContainer.get(adjustedPreviousIndex);\n viewContainer.move(view, currentIndex);\n }\n });\n // If the data itself changes, but keeps the same trackBy, we need to update the templates'\n // context to reflect the new object.\n changes?.forEachIdentityChange((record) => {\n const newData = record.item;\n if (record.currentIndex != undefined) {\n const view = viewContainer.get(record.currentIndex);\n view.context.$implicit = newData;\n }\n });\n // TODO: change to `this._changeDetectorRef.markForCheck()`, or just switch this component to\n // use signals.\n this._changeDetectorRef.detectChanges();\n }\n /**\n * Finds the matching node definition that should be used for this node data. If there is only\n * one node definition, it is returned. Otherwise, find the node definition that has a when\n * predicate that returns true with the data. If none return true, return the default node\n * definition.\n */\n _getNodeDef(data, i) {\n if (this._nodeDefs.length === 1) {\n return this._nodeDefs.first;\n }\n const nodeDef = this._nodeDefs.find(def => def.when && def.when(i, data)) || this._defaultNodeDef;\n if (!nodeDef && (typeof ngDevMode === 'undefined' || ngDevMode)) {\n throw getTreeMissingMatchingNodeDefError();\n }\n return nodeDef;\n }\n /**\n * Create the embedded view for the data node template and place it in the correct index location\n * within the data node view container.\n */\n insertNode(nodeData, index, viewContainer, parentData) {\n const levelAccessor = this._getLevelAccessor();\n const node = this._getNodeDef(nodeData, index);\n const key = this._getExpansionKey(nodeData);\n // Node context that will be provided to created embedded view\n const context = new CdkTreeNodeOutletContext(nodeData);\n parentData ??= this._parents.get(key) ?? undefined;\n // If the tree is flat tree, then use the `getLevel` function in flat tree control\n // Otherwise, use the level of parent node.\n if (levelAccessor) {\n context.level = levelAccessor(nodeData);\n }\n else if (parentData !== undefined && this._levels.has(this._getExpansionKey(parentData))) {\n context.level = this._levels.get(this._getExpansionKey(parentData)) + 1;\n }\n else {\n context.level = 0;\n }\n this._levels.set(key, context.level);\n // Use default tree nodeOutlet, or nested node's nodeOutlet\n const container = viewContainer ? viewContainer : this._nodeOutlet.viewContainer;\n container.createEmbeddedView(node.template, context, index);\n // Set the data to just created `CdkTreeNode`.\n // The `CdkTreeNode` created from `createEmbeddedView` will be saved in static variable\n // `mostRecentTreeNode`. We get it from static variable and pass the node data to it.\n if (CdkTreeNode.mostRecentTreeNode) {\n CdkTreeNode.mostRecentTreeNode.data = nodeData;\n }\n }\n /** Whether the data node is expanded or collapsed. Returns true if it's expanded. */\n isExpanded(dataNode) {\n return !!(this.treeControl?.isExpanded(dataNode) ||\n this._expansionModel?.isSelected(this._getExpansionKey(dataNode)));\n }\n /** If the data node is currently expanded, collapse it. Otherwise, expand it. */\n toggle(dataNode) {\n if (this.treeControl) {\n this.treeControl.toggle(dataNode);\n }\n else if (this._expansionModel) {\n this._expansionModel.toggle(this._getExpansionKey(dataNode));\n }\n }\n /** Expand the data node. If it is already expanded, does nothing. */\n expand(dataNode) {\n if (this.treeControl) {\n this.treeControl.expand(dataNode);\n }\n else if (this._expansionModel) {\n this._expansionModel.select(this._getExpansionKey(dataNode));\n }\n }\n /** Collapse the data node. If it is already collapsed, does nothing. */\n collapse(dataNode) {\n if (this.treeControl) {\n this.treeControl.collapse(dataNode);\n }\n else if (this._expansionModel) {\n this._expansionModel.deselect(this._getExpansionKey(dataNode));\n }\n }\n /**\n * If the data node is currently expanded, collapse it and all its descendants.\n * Otherwise, expand it and all its descendants.\n */\n toggleDescendants(dataNode) {\n if (this.treeControl) {\n this.treeControl.toggleDescendants(dataNode);\n }\n else if (this._expansionModel) {\n if (this.isExpanded(dataNode)) {\n this.collapseDescendants(dataNode);\n }\n else {\n this.expandDescendants(dataNode);\n }\n }\n }\n /**\n * Expand the data node and all its descendants. If they are already expanded, does nothing.\n */\n expandDescendants(dataNode) {\n if (this.treeControl) {\n this.treeControl.expandDescendants(dataNode);\n }\n else if (this._expansionModel) {\n const expansionModel = this._expansionModel;\n expansionModel.select(this._getExpansionKey(dataNode));\n this._getDescendants(dataNode)\n .pipe(take(1), takeUntil(this._onDestroy))\n .subscribe(children => {\n expansionModel.select(...children.map(child => this._getExpansionKey(child)));\n });\n }\n }\n /** Collapse the data node and all its descendants. If it is already collapsed, does nothing. */\n collapseDescendants(dataNode) {\n if (this.treeControl) {\n this.treeControl.collapseDescendants(dataNode);\n }\n else if (this._expansionModel) {\n const expansionModel = this._expansionModel;\n expansionModel.deselect(this._getExpansionKey(dataNode));\n this._getDescendants(dataNode)\n .pipe(take(1), takeUntil(this._onDestroy))\n .subscribe(children => {\n expansionModel.deselect(...children.map(child => this._getExpansionKey(child)));\n });\n }\n }\n /** Expands all data nodes in the tree. */\n expandAll() {\n if (this.treeControl) {\n this.treeControl.expandAll();\n }\n else if (this._expansionModel) {\n const expansionModel = this._expansionModel;\n expansionModel.select(...this._flattenedNodes.value.map(child => this._getExpansionKey(child)));\n }\n }\n /** Collapse all data nodes in the tree. */\n collapseAll() {\n if (this.treeControl) {\n this.treeControl.collapseAll();\n }\n else if (this._expansionModel) {\n const expansionModel = this._expansionModel;\n expansionModel.deselect(...this._flattenedNodes.value.map(child => this._getExpansionKey(child)));\n }\n }\n /** Level accessor, used for compatibility between the old Tree and new Tree */\n _getLevelAccessor() {\n return this.treeControl?.getLevel?.bind(this.treeControl) ?? this.levelAccessor;\n }\n /** Children accessor, used for compatibility between the old Tree and new Tree */\n _getChildrenAccessor() {\n return this.treeControl?.getChildren?.bind(this.treeControl) ?? this.childrenAccessor;\n }\n /**\n * Gets the direct children of a node; used for compatibility between the old tree and the\n * new tree.\n */\n _getDirectChildren(dataNode) {\n const levelAccessor = this._getLevelAccessor();\n const expansionModel = this._expansionModel ?? this.treeControl?.expansionModel;\n if (!expansionModel) {\n return of([]);\n }\n const key = this._getExpansionKey(dataNode);\n const isExpanded = expansionModel.changed.pipe(switchMap(changes => {\n if (changes.added.includes(key)) {\n return of(true);\n }\n else if (changes.removed.includes(key)) {\n return of(false);\n }\n return EMPTY;\n }), startWith(this.isExpanded(dataNode)));\n if (levelAccessor) {\n return combineLatest([isExpanded, this._flattenedNodes]).pipe(map(([expanded, flattenedNodes]) => {\n if (!expanded) {\n return [];\n }\n return this._findChildrenByLevel(levelAccessor, flattenedNodes, dataNode, 1);\n }));\n }\n const childrenAccessor = this._getChildrenAccessor();\n if (childrenAccessor) {\n return coerceObservable(childrenAccessor(dataNode) ?? []);\n }\n throw getTreeControlMissingError();\n }\n /**\n * Given the list of flattened nodes, the level accessor, and the level range within\n * which to consider children, finds the children for a given node.\n *\n * For example, for direct children, `levelDelta` would be 1. For all descendants,\n * `levelDelta` would be Infinity.\n */\n _findChildrenByLevel(levelAccessor, flattenedNodes, dataNode, levelDelta) {\n const key = this._getExpansionKey(dataNode);\n const startIndex = flattenedNodes.findIndex(node => this._getExpansionKey(node) === key);\n const dataNodeLevel = levelAccessor(dataNode);\n const expectedLevel = dataNodeLevel + levelDelta;\n const results = [];\n // Goes through flattened tree nodes in the `flattenedNodes` array, and get all\n // descendants within a certain level range.\n //\n // If we reach a node whose level is equal to or less than the level of the tree node,\n // we hit a sibling or parent's sibling, and should stop.\n for (let i = startIndex + 1; i < flattenedNodes.length; i++) {\n const currentLevel = levelAccessor(flattenedNodes[i]);\n if (currentLevel <= dataNodeLevel) {\n break;\n }\n if (currentLevel <= expectedLevel) {\n results.push(flattenedNodes[i]);\n }\n }\n return results;\n }\n /**\n * Adds the specified node component to the tree's internal registry.\n *\n * This primarily facilitates keyboard navigation.\n */\n _registerNode(node) {\n this._nodes.value.set(this._getExpansionKey(node.data), node);\n this._nodes.next(this._nodes.value);\n }\n /** Removes the specified node component from the tree's internal registry. */\n _unregisterNode(node) {\n this._nodes.value.delete(this._getExpansionKey(node.data));\n this._nodes.next(this._nodes.value);\n }\n /**\n * For the given node, determine the level where this node appears in the tree.\n *\n * This is intended to be used for `aria-level` but is 0-indexed.\n */\n _getLevel(node) {\n return this._levels.get(this._getExpansionKey(node));\n }\n /**\n * For the given node, determine the size of the parent's child set.\n *\n * This is intended to be used for `aria-setsize`.\n */\n _getSetSize(dataNode) {\n const set = this._getAriaSet(dataNode);\n return set.length;\n }\n /**\n * For the given node, determine the index (starting from 1) of the node in its parent's child set.\n *\n * This is intended to be used for `aria-posinset`.\n */\n _getPositionInSet(dataNode) {\n const set = this._getAriaSet(dataNode);\n const key = this._getExpansionKey(dataNode);\n return set.findIndex(node => this._getExpansionKey(node) === key) + 1;\n }\n /** Given a CdkTreeNode, gets the node that renders that node's parent's data. */\n _getNodeParent(node) {\n const parent = this._parents.get(this._getExpansionKey(node.data));\n return parent && this._nodes.value.get(this._getExpansionKey(parent));\n }\n /** Given a CdkTreeNode, gets the nodes that renders that node's child data. */\n _getNodeChildren(node) {\n return this._getDirectChildren(node.data).pipe(map(children => children.reduce((nodes, child) => {\n const value = this._nodes.value.get(this._getExpansionKey(child));\n if (value) {\n nodes.push(value);\n }\n return nodes;\n }, [])));\n }\n /** `keydown` event handler; this just passes the event to the `TreeKeyManager`. */\n _sendKeydownToKeyManager(event) {\n this._keyManager.onKeydown(event);\n }\n /** Gets all nested descendants of a given node. */\n _getDescendants(dataNode) {\n if (this.treeControl) {\n return of(this.treeControl.getDescendants(dataNode));\n }\n if (this.levelAccessor) {\n const results = this._findChildrenByLevel(this.levelAccessor, this._flattenedNodes.value, dataNode, Infinity);\n return of(results);\n }\n if (this.childrenAccessor) {\n return this._getAllChildrenRecursively(dataNode).pipe(reduce((allChildren, nextChildren) => {\n allChildren.push(...nextChildren);\n return allChildren;\n }, []));\n }\n throw getTreeControlMissingError();\n }\n /**\n * Gets all children and sub-children of the provided node.\n *\n * This will emit multiple times, in the order that the children will appear\n * in the tree, and can be combined with a `reduce` operator.\n */\n _getAllChildrenRecursively(dataNode) {\n if (!this.childrenAccessor) {\n return of([]);\n }\n return coerceObservable(this.childrenAccessor(dataNode)).pipe(take(1), switchMap(children => {\n // Here, we cache the parents of a particular child so that we can compute the levels.\n for (const child of children) {\n this._parents.set(this._getExpansionKey(child), dataNode);\n }\n return of(...children).pipe(concatMap(child => concat(of([child]), this._getAllChildrenRecursively(child))));\n }));\n }\n _getExpansionKey(dataNode) {\n // In the case that a key accessor function was not provided by the\n // tree user, we'll default to using the node object itself as the key.\n //\n // This cast is safe since:\n // - if an expansionKey is provided, TS will infer the type of K to be\n // the return type.\n // - if it's not, then K will be defaulted to T.\n return this.expansionKey?.(dataNode) ?? dataNode;\n }\n _getAriaSet(node) {\n const key = this._getExpansionKey(node);\n const parent = this._parents.get(key);\n const parentKey = parent ? this._getExpansionKey(parent) : null;\n const set = this._ariaSets.get(parentKey);\n return set ?? [node];\n }\n /**\n * Finds the parent for the given node. If this is a root node, this\n * returns null. If we're unable to determine the parent, for example,\n * if we don't have cached node data, this returns undefined.\n */\n _findParentForNode(node, index, cachedNodes) {\n // In all cases, we have a mapping from node to level; all we need to do here is backtrack in\n // our flattened list of nodes to determine the first node that's of a level lower than the\n // provided node.\n if (!cachedNodes.length) {\n return null;\n }\n const currentLevel = this._levels.get(this._getExpansionKey(node)) ?? 0;\n for (let parentIndex = index - 1; parentIndex >= 0; parentIndex--) {\n const parentNode = cachedNodes[parentIndex];\n const parentLevel = this._levels.get(this._getExpansionKey(parentNode)) ?? 0;\n if (parentLevel < currentLevel) {\n return parentNode;\n }\n }\n return null;\n }\n /**\n * Given a set of root nodes and the current node level, flattens any nested\n * nodes into a single array.\n *\n * If any nodes are not expanded, then their children will not be added into the array.\n * This will still traverse all nested children in order to build up our internal data\n * models, but will not include them in the returned array.\n */\n _flattenNestedNodesWithExpansion(nodes, level = 0) {\n const childrenAccessor = this._getChildrenAccessor();\n // If we're using a level accessor, we don't need to flatten anything.\n if (!childrenAccessor) {\n return of([...nodes]);\n }\n return of(...nodes).pipe(concatMap(node => {\n const parentKey = this._getExpansionKey(node);\n if (!this._parents.has(parentKey)) {\n this._parents.set(parentKey, null);\n }\n this._levels.set(parentKey, level);\n const children = coerceObservable(childrenAccessor(node));\n return concat(of([node]), children.pipe(take(1), tap(childNodes => {\n this._ariaSets.set(parentKey, [...(childNodes ?? [])]);\n for (const child of childNodes ?? []) {\n const childKey = this._getExpansionKey(child);\n this._parents.set(childKey, node);\n this._levels.set(childKey, level + 1);\n }\n }), switchMap(childNodes => {\n if (!childNodes) {\n return of([]);\n }\n return this._flattenNestedNodesWithExpansion(childNodes, level + 1).pipe(map(nestedNodes => (this.isExpanded(node) ? nestedNodes : [])));\n })));\n }), reduce((results, children) => {\n results.push(...children);\n return results;\n }, []));\n }\n /**\n * Converts children for certain tree configurations.\n *\n * This also computes parent, level, and group data.\n */\n _computeRenderingData(nodes, nodeType) {\n // The only situations where we have to convert children types is when\n // they're mismatched; i.e. if the tree is using a childrenAccessor and the\n // nodes are flat, or if the tree is using a levelAccessor and the nodes are\n // nested.\n if (this.childrenAccessor && nodeType === 'flat') {\n // This flattens children into a single array.\n this._ariaSets.set(null, [...nodes]);\n return this._flattenNestedNodesWithExpansion(nodes).pipe(map(flattenedNodes => ({\n renderNodes: flattenedNodes,\n flattenedNodes,\n })));\n }\n else if (this.levelAccessor && nodeType === 'nested') {\n // In the nested case, we only look for root nodes. The CdkNestedNode\n // itself will handle rendering each individual node's children.\n const levelAccessor = this.levelAccessor;\n return of(nodes.filter(node => levelAccessor(node) === 0)).pipe(map(rootNodes => ({\n renderNodes: rootNodes,\n flattenedNodes: nodes,\n })), tap(({ flattenedNodes }) => {\n this._calculateParents(flattenedNodes);\n }));\n }\n else if (nodeType === 'flat') {\n // In the case of a TreeControl, we know that the node type matches up\n // with the TreeControl, and so no conversions are necessary. Otherwise,\n // we've already confirmed that the data model matches up with the\n // desired node type here.\n return of({ renderNodes: nodes, flattenedNodes: nodes }).pipe(tap(({ flattenedNodes }) => {\n this._calculateParents(flattenedNodes);\n }));\n }\n else {\n // For nested nodes, we still need to perform the node flattening in order\n // to maintain our caches for various tree operations.\n this._ariaSets.set(null, [...nodes]);\n return this._flattenNestedNodesWithExpansion(nodes).pipe(map(flattenedNodes => ({\n renderNodes: nodes,\n flattenedNodes,\n })));\n }\n }\n _updateCachedData(flattenedNodes) {\n this._flattenedNodes.next(flattenedNodes);\n }\n _updateKeyManagerItems(flattenedNodes) {\n this._keyManagerNodes.next(flattenedNodes);\n }\n /** Traverse the flattened node data and compute parents, levels, and group data. */\n _calculateParents(flattenedNodes) {\n const levelAccessor = this._getLevelAccessor();\n if (!levelAccessor) {\n return;\n }\n this._parents.clear();\n this._ariaSets.clear();\n for (let index = 0; index < flattenedNodes.length; index++) {\n const dataNode = flattenedNodes[index];\n const key = this._getExpansionKey(dataNode);\n this._levels.set(key, levelAccessor(dataNode));\n const parent = this._findParentForNode(dataNode, index, flattenedNodes);\n this._parents.set(key, parent);\n const parentKey = parent ? this._getExpansionKey(parent) : null;\n const group = this._ariaSets.get(parentKey) ?? [];\n group.splice(index, 0, dataNode);\n this._ariaSets.set(parentKey, group);\n }\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkTree, deps: [{ token: i0.IterableDiffers }, { token: i0.ChangeDetectorRef }, { token: i1.Directionality }], target: i0.ɵɵFactoryTarget.Component }); }\n static { this.ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"18.2.0-next.2\", type: CdkTree, isStandalone: true, selector: \"cdk-tree\", inputs: { dataSource: \"dataSource\", treeControl: \"treeControl\", levelAccessor: \"levelAccessor\", childrenAccessor: \"childrenAccessor\", trackBy: \"trackBy\", expansionKey: \"expansionKey\" }, host: { attributes: { \"role\": \"tree\" }, listeners: { \"keydown\": \"_sendKeydownToKeyManager($event)\" }, classAttribute: \"cdk-tree\" }, queries: [{ propertyName: \"_nodeDefs\", predicate: CdkTreeNodeDef, descendants: true }], viewQueries: [{ propertyName: \"_nodeOutlet\", first: true, predicate: CdkTreeNodeOutlet, descendants: true, static: true }], exportAs: [\"cdkTree\"], ngImport: i0, template: ``. It works with nested tree.\n * By using `cdk-nested-tree-node` component in tree node template, children of the parent node will\n * be added in the `cdkTreeNodeOutlet` in tree node template.\n * The children of node will be automatically added to `cdkTreeNodeOutlet`.\n */\nclass CdkNestedTreeNode extends CdkTreeNode {\n constructor(elementRef, tree, _differs) {\n super(elementRef, tree);\n this._differs = _differs;\n }\n ngAfterContentInit() {\n this._dataDiffer = this._differs.find([]).create(this._tree.trackBy);\n this._tree\n ._getDirectChildren(this.data)\n .pipe(takeUntil(this._destroyed))\n .subscribe(result => this.updateChildrenNodes(result));\n this.nodeOutlet.changes\n .pipe(takeUntil(this._destroyed))\n .subscribe(() => this.updateChildrenNodes());\n }\n // This is a workaround for https://github.com/angular/angular/issues/23091\n // In aot mode, the lifecycle hooks from parent class are not called.\n ngOnInit() {\n this._tree._setNodeTypeIfUnset('nested');\n super.ngOnInit();\n }\n ngOnDestroy() {\n this._clear();\n super.ngOnDestroy();\n }\n /** Add children dataNodes to the NodeOutlet */\n updateChildrenNodes(children) {\n const outlet = this._getNodeOutlet();\n if (children) {\n this._children = children;\n }\n if (outlet && this._children) {\n const viewContainer = outlet.viewContainer;\n this._tree.renderNodeChanges(this._children, this._dataDiffer, viewContainer, this._data);\n }\n else {\n // Reset the data differ if there's no children nodes displayed\n this._dataDiffer.diff([]);\n }\n }\n /** Clear the children dataNodes. */\n _clear() {\n const outlet = this._getNodeOutlet();\n if (outlet) {\n outlet.viewContainer.clear();\n this._dataDiffer.diff([]);\n }\n }\n /** Gets the outlet for the current node. */\n _getNodeOutlet() {\n const outlets = this.nodeOutlet;\n // Note that since we use `descendants: true` on the query, we have to ensure\n // that we don't pick up the outlet of a child node by accident.\n return outlets && outlets.find(outlet => !outlet._node || outlet._node === this);\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkNestedTreeNode, deps: [{ token: i0.ElementRef }, { token: CdkTree }, { token: i0.IterableDiffers }], target: i0.ɵɵFactoryTarget.Directive }); }\n static { this.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"18.2.0-next.2\", type: CdkNestedTreeNode, isStandalone: true, selector: \"cdk-nested-tree-node\", host: { classAttribute: \"cdk-nested-tree-node\" }, providers: [\n { provide: CdkTreeNode, useExisting: CdkNestedTreeNode },\n { provide: CDK_TREE_NODE_OUTLET_NODE, useExisting: CdkNestedTreeNode },\n ], queries: [{ propertyName: \"nodeOutlet\", predicate: CdkTreeNodeOutlet, descendants: true }], exportAs: [\"cdkNestedTreeNode\"], usesInheritance: true, ngImport: i0 }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkNestedTreeNode, decorators: [{\n type: Directive,\n args: [{\n selector: 'cdk-nested-tree-node',\n exportAs: 'cdkNestedTreeNode',\n providers: [\n { provide: CdkTreeNode, useExisting: CdkNestedTreeNode },\n { provide: CDK_TREE_NODE_OUTLET_NODE, useExisting: CdkNestedTreeNode },\n ],\n host: {\n 'class': 'cdk-nested-tree-node',\n },\n standalone: true,\n }]\n }], ctorParameters: () => [{ type: i0.ElementRef }, { type: CdkTree }, { type: i0.IterableDiffers }], propDecorators: { nodeOutlet: [{\n type: ContentChildren,\n args: [CdkTreeNodeOutlet, {\n // We need to use `descendants: true`, because Ivy will no longer match\n // indirect descendants if it's left as false.\n descendants: true,\n }]\n }] } });\n\n/** Regex used to split a string on its CSS units. */\nconst cssUnitPattern = /([A-Za-z%]+)$/;\n/**\n * Indent for the children tree dataNodes.\n * This directive will add left-padding to the node to show hierarchy.\n */\nclass CdkTreeNodePadding {\n /** The level of depth of the tree node. The padding will be `level * indent` pixels. */\n get level() {\n return this._level;\n }\n set level(value) {\n this._setLevelInput(value);\n }\n /**\n * The indent for each level. Can be a number or a CSS string.\n * Default number 40px from material design menu sub-menu spec.\n */\n get indent() {\n return this._indent;\n }\n set indent(indent) {\n this._setIndentInput(indent);\n }\n constructor(_treeNode, _tree, _element, _dir) {\n this._treeNode = _treeNode;\n this._tree = _tree;\n this._element = _element;\n this._dir = _dir;\n /** Subject that emits when the component has been destroyed. */\n this._destroyed = new Subject();\n /** CSS units used for the indentation value. */\n this.indentUnits = 'px';\n this._indent = 40;\n this._setPadding();\n if (_dir) {\n _dir.change.pipe(takeUntil(this._destroyed)).subscribe(() => this._setPadding(true));\n }\n // In Ivy the indentation binding might be set before the tree node's data has been added,\n // which means that we'll miss the first render. We have to subscribe to changes in the\n // data to ensure that everything is up to date.\n _treeNode._dataChanges.subscribe(() => this._setPadding());\n }\n ngOnDestroy() {\n this._destroyed.next();\n this._destroyed.complete();\n }\n /** The padding indent value for the tree node. Returns a string with px numbers if not null. */\n _paddingIndent() {\n const nodeLevel = (this._treeNode.data && this._tree._getLevel(this._treeNode.data)) ?? null;\n const level = this._level == null ? nodeLevel : this._level;\n return typeof level === 'number' ? `${level * this._indent}${this.indentUnits}` : null;\n }\n _setPadding(forceChange = false) {\n const padding = this._paddingIndent();\n if (padding !== this._currentPadding || forceChange) {\n const element = this._element.nativeElement;\n const paddingProp = this._dir && this._dir.value === 'rtl' ? 'paddingRight' : 'paddingLeft';\n const resetProp = paddingProp === 'paddingLeft' ? 'paddingRight' : 'paddingLeft';\n element.style[paddingProp] = padding || '';\n element.style[resetProp] = '';\n this._currentPadding = padding;\n }\n }\n /**\n * This has been extracted to a util because of TS 4 and VE.\n * View Engine doesn't support property rename inheritance.\n * TS 4.0 doesn't allow properties to override accessors or vice-versa.\n * @docs-private\n */\n _setLevelInput(value) {\n // Set to null as the fallback value so that _setPadding can fall back to the node level if the\n // consumer set the directive as `cdkTreeNodePadding=\"\"`. We still want to take this value if\n // they set 0 explicitly.\n this._level = isNaN(value) ? null : value;\n this._setPadding();\n }\n /**\n * This has been extracted to a util because of TS 4 and VE.\n * View Engine doesn't support property rename inheritance.\n * TS 4.0 doesn't allow properties to override accessors or vice-versa.\n * @docs-private\n */\n _setIndentInput(indent) {\n let value = indent;\n let units = 'px';\n if (typeof indent === 'string') {\n const parts = indent.split(cssUnitPattern);\n value = parts[0];\n units = parts[1] || units;\n }\n this.indentUnits = units;\n this._indent = numberAttribute(value);\n this._setPadding();\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkTreeNodePadding, deps: [{ token: CdkTreeNode }, { token: CdkTree }, { token: i0.ElementRef }, { token: i1.Directionality, optional: true }], target: i0.ɵɵFactoryTarget.Directive }); }\n static { this.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"16.1.0\", version: \"18.2.0-next.2\", type: CdkTreeNodePadding, isStandalone: true, selector: \"[cdkTreeNodePadding]\", inputs: { level: [\"cdkTreeNodePadding\", \"level\", numberAttribute], indent: [\"cdkTreeNodePaddingIndent\", \"indent\"] }, ngImport: i0 }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkTreeNodePadding, decorators: [{\n type: Directive,\n args: [{\n selector: '[cdkTreeNodePadding]',\n standalone: true,\n }]\n }], ctorParameters: () => [{ type: CdkTreeNode }, { type: CdkTree }, { type: i0.ElementRef }, { type: i1.Directionality, decorators: [{\n type: Optional\n }] }], propDecorators: { level: [{\n type: Input,\n args: [{ alias: 'cdkTreeNodePadding', transform: numberAttribute }]\n }], indent: [{\n type: Input,\n args: ['cdkTreeNodePaddingIndent']\n }] } });\n\n/**\n * Node toggle to expand and collapse the node.\n */\nclass CdkTreeNodeToggle {\n constructor(_tree, _treeNode) {\n this._tree = _tree;\n this._treeNode = _treeNode;\n /** Whether expand/collapse the node recursively. */\n this.recursive = false;\n }\n // Toggle the expanded or collapsed state of this node.\n //\n // Focus this node with expanding or collapsing it. This ensures that the active node will always\n // be visible when expanding and collapsing.\n _toggle() {\n this.recursive\n ? this._tree.toggleDescendants(this._treeNode.data)\n : this._tree.toggle(this._treeNode.data);\n this._tree._keyManager.focusItem(this._treeNode);\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkTreeNodeToggle, deps: [{ token: CdkTree }, { token: CdkTreeNode }], target: i0.ɵɵFactoryTarget.Directive }); }\n static { this.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"16.1.0\", version: \"18.2.0-next.2\", type: CdkTreeNodeToggle, isStandalone: true, selector: \"[cdkTreeNodeToggle]\", inputs: { recursive: [\"cdkTreeNodeToggleRecursive\", \"recursive\", booleanAttribute] }, host: { attributes: { \"tabindex\": \"-1\" }, listeners: { \"click\": \"_toggle(); $event.stopPropagation();\", \"keydown.Enter\": \"_toggle(); $event.preventDefault();\", \"keydown.Space\": \"_toggle(); $event.preventDefault();\" } }, ngImport: i0 }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkTreeNodeToggle, decorators: [{\n type: Directive,\n args: [{\n selector: '[cdkTreeNodeToggle]',\n host: {\n '(click)': '_toggle(); $event.stopPropagation();',\n '(keydown.Enter)': '_toggle(); $event.preventDefault();',\n '(keydown.Space)': '_toggle(); $event.preventDefault();',\n 'tabindex': '-1',\n },\n standalone: true,\n }]\n }], ctorParameters: () => [{ type: CdkTree }, { type: CdkTreeNode }], propDecorators: { recursive: [{\n type: Input,\n args: [{ alias: 'cdkTreeNodeToggleRecursive', transform: booleanAttribute }]\n }] } });\n\nconst EXPORTED_DECLARATIONS = [\n CdkNestedTreeNode,\n CdkTreeNodeDef,\n CdkTreeNodePadding,\n CdkTreeNodeToggle,\n CdkTree,\n CdkTreeNode,\n CdkTreeNodeOutlet,\n];\nclass CdkTreeModule {\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkTreeModule, deps: [], target: i0.ɵɵFactoryTarget.NgModule }); }\n static { this.ɵmod = i0.ɵɵngDeclareNgModule({ minVersion: \"14.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkTreeModule, imports: [CdkNestedTreeNode,\n CdkTreeNodeDef,\n CdkTreeNodePadding,\n CdkTreeNodeToggle,\n CdkTree,\n CdkTreeNode,\n CdkTreeNodeOutlet], exports: [CdkNestedTreeNode,\n CdkTreeNodeDef,\n CdkTreeNodePadding,\n CdkTreeNodeToggle,\n CdkTree,\n CdkTreeNode,\n CdkTreeNodeOutlet] }); }\n static { this.ɵinj = i0.ɵɵngDeclareInjector({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkTreeModule }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0-next.2\", ngImport: i0, type: CdkTreeModule, decorators: [{\n type: NgModule,\n args: [{\n imports: EXPORTED_DECLARATIONS,\n exports: EXPORTED_DECLARATIONS,\n }]\n }] });\n\n/**\n * Generated bundle index. Do not edit.\n */\n\nexport { BaseTreeControl, CDK_TREE_NODE_OUTLET_NODE, CdkNestedTreeNode, CdkTree, CdkTreeModule, CdkTreeNode, CdkTreeNodeDef, CdkTreeNodeOutlet, CdkTreeNodeOutletContext, CdkTreeNodePadding, CdkTreeNodeToggle, FlatTreeControl, NestedTreeControl, getMultipleTreeControlsError, getTreeControlMissingError, getTreeMissingMatchingNodeDefError, getTreeMultipleDefaultNodeDefsError, getTreeNoValidDataSourceError };\n","/**\n * @license Angular v18.2.0\n * (c) 2010-2024 Google LLC. https://angular.io/\n * License: MIT\n */\n\nimport * as i0 from '@angular/core';\nimport { Injectable, InjectionToken, inject, Optional, Inject, EventEmitter, ɵɵinject, ɵfindLocaleData, ɵLocaleDataIndex, ɵgetLocaleCurrencyCode, ɵgetLocalePluralCase, LOCALE_ID, ɵregisterLocaleData, ɵstringify, Directive, Input, createNgModule, NgModuleRef, ɵRuntimeError, Host, Attribute, RendererStyleFlags2, untracked, ɵisPromise, ɵisSubscribable, Pipe, DEFAULT_CURRENCY_CODE, NgModule, Version, ɵɵdefineInjectable, PLATFORM_ID, ɵformatRuntimeError, ɵIMAGE_CONFIG, Renderer2, ElementRef, Injector, ɵperformanceMarkFeature, NgZone, ApplicationRef, ChangeDetectorRef, numberAttribute, booleanAttribute, ɵIMAGE_CONFIG_DEFAULTS, ɵwhenStable, ɵunwrapSafeValue } from '@angular/core';\nexport { ɵIMAGE_CONFIG as IMAGE_CONFIG } from '@angular/core';\n\nlet _DOM = null;\nfunction getDOM() {\n return _DOM;\n}\nfunction setRootDomAdapter(adapter) {\n _DOM ??= adapter;\n}\n/* tslint:disable:requireParameterType */\n/**\n * Provides DOM operations in an environment-agnostic way.\n *\n * @security Tread carefully! Interacting with the DOM directly is dangerous and\n * can introduce XSS risks.\n */\nclass DomAdapter {\n}\n\n/**\n * This class wraps the platform Navigation API which allows server-specific and test\n * implementations.\n */\nclass PlatformNavigation {\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0\", ngImport: i0, type: PlatformNavigation, deps: [], target: i0.ɵɵFactoryTarget.Injectable }); }\n static { this.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"18.2.0\", ngImport: i0, type: PlatformNavigation, providedIn: 'platform', useFactory: () => window.navigation }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0\", ngImport: i0, type: PlatformNavigation, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'platform', useFactory: () => window.navigation }]\n }] });\n\n/**\n * A DI Token representing the main rendering context.\n * In a browser and SSR this is the DOM Document.\n * When using SSR, that document is created by [Domino](https://github.com/angular/domino).\n *\n * @publicApi\n */\nconst DOCUMENT = new InjectionToken(ngDevMode ? 'DocumentToken' : '');\n\n/**\n * This class should not be used directly by an application developer. Instead, use\n * {@link Location}.\n *\n * `PlatformLocation` encapsulates all calls to DOM APIs, which allows the Router to be\n * platform-agnostic.\n * This means that we can have different implementation of `PlatformLocation` for the different\n * platforms that Angular supports. For example, `@angular/platform-browser` provides an\n * implementation specific to the browser environment, while `@angular/platform-server` provides\n * one suitable for use with server-side rendering.\n *\n * The `PlatformLocation` class is used directly by all implementations of {@link LocationStrategy}\n * when they need to interact with the DOM APIs like pushState, popState, etc.\n *\n * {@link LocationStrategy} in turn is used by the {@link Location} service which is used directly\n * by the {@link Router} in order to navigate between routes. Since all interactions between {@link\n * Router} /\n * {@link Location} / {@link LocationStrategy} and DOM APIs flow through the `PlatformLocation`\n * class, they are all platform-agnostic.\n *\n * @publicApi\n */\nclass PlatformLocation {\n historyGo(relativePosition) {\n throw new Error(ngDevMode ? 'Not implemented' : '');\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0\", ngImport: i0, type: PlatformLocation, deps: [], target: i0.ɵɵFactoryTarget.Injectable }); }\n static { this.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"18.2.0\", ngImport: i0, type: PlatformLocation, providedIn: 'platform', useFactory: () => inject(BrowserPlatformLocation) }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0\", ngImport: i0, type: PlatformLocation, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'platform', useFactory: () => inject(BrowserPlatformLocation) }]\n }] });\n/**\n * @description\n * Indicates when a location is initialized.\n *\n * @publicApi\n */\nconst LOCATION_INITIALIZED = new InjectionToken(ngDevMode ? 'Location Initialized' : '');\n/**\n * `PlatformLocation` encapsulates all of the direct calls to platform APIs.\n * This class should not be used directly by an application developer. Instead, use\n * {@link Location}.\n *\n * @publicApi\n */\nclass BrowserPlatformLocation extends PlatformLocation {\n constructor() {\n super();\n this._doc = inject(DOCUMENT);\n this._location = window.location;\n this._history = window.history;\n }\n getBaseHrefFromDOM() {\n return getDOM().getBaseHref(this._doc);\n }\n onPopState(fn) {\n const window = getDOM().getGlobalEventTarget(this._doc, 'window');\n window.addEventListener('popstate', fn, false);\n return () => window.removeEventListener('popstate', fn);\n }\n onHashChange(fn) {\n const window = getDOM().getGlobalEventTarget(this._doc, 'window');\n window.addEventListener('hashchange', fn, false);\n return () => window.removeEventListener('hashchange', fn);\n }\n get href() {\n return this._location.href;\n }\n get protocol() {\n return this._location.protocol;\n }\n get hostname() {\n return this._location.hostname;\n }\n get port() {\n return this._location.port;\n }\n get pathname() {\n return this._location.pathname;\n }\n get search() {\n return this._location.search;\n }\n get hash() {\n return this._location.hash;\n }\n set pathname(newPath) {\n this._location.pathname = newPath;\n }\n pushState(state, title, url) {\n this._history.pushState(state, title, url);\n }\n replaceState(state, title, url) {\n this._history.replaceState(state, title, url);\n }\n forward() {\n this._history.forward();\n }\n back() {\n this._history.back();\n }\n historyGo(relativePosition = 0) {\n this._history.go(relativePosition);\n }\n getState() {\n return this._history.state;\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0\", ngImport: i0, type: BrowserPlatformLocation, deps: [], target: i0.ɵɵFactoryTarget.Injectable }); }\n static { this.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"18.2.0\", ngImport: i0, type: BrowserPlatformLocation, providedIn: 'platform', useFactory: () => new BrowserPlatformLocation() }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0\", ngImport: i0, type: BrowserPlatformLocation, decorators: [{\n type: Injectable,\n args: [{\n providedIn: 'platform',\n useFactory: () => new BrowserPlatformLocation(),\n }]\n }], ctorParameters: () => [] });\n\n/**\n * Joins two parts of a URL with a slash if needed.\n *\n * @param start URL string\n * @param end URL string\n *\n *\n * @returns The joined URL string.\n */\nfunction joinWithSlash(start, end) {\n if (start.length == 0) {\n return end;\n }\n if (end.length == 0) {\n return start;\n }\n let slashes = 0;\n if (start.endsWith('/')) {\n slashes++;\n }\n if (end.startsWith('/')) {\n slashes++;\n }\n if (slashes == 2) {\n return start + end.substring(1);\n }\n if (slashes == 1) {\n return start + end;\n }\n return start + '/' + end;\n}\n/**\n * Removes a trailing slash from a URL string if needed.\n * Looks for the first occurrence of either `#`, `?`, or the end of the\n * line as `/` characters and removes the trailing slash if one exists.\n *\n * @param url URL string.\n *\n * @returns The URL string, modified if needed.\n */\nfunction stripTrailingSlash(url) {\n const match = url.match(/#|\\?|$/);\n const pathEndIdx = (match && match.index) || url.length;\n const droppedSlashIdx = pathEndIdx - (url[pathEndIdx - 1] === '/' ? 1 : 0);\n return url.slice(0, droppedSlashIdx) + url.slice(pathEndIdx);\n}\n/**\n * Normalizes URL parameters by prepending with `?` if needed.\n *\n * @param params String of URL parameters.\n *\n * @returns The normalized URL parameters string.\n */\nfunction normalizeQueryParams(params) {\n return params && params[0] !== '?' ? '?' + params : params;\n}\n\n/**\n * Enables the `Location` service to read route state from the browser's URL.\n * Angular provides two strategies:\n * `HashLocationStrategy` and `PathLocationStrategy`.\n *\n * Applications should use the `Router` or `Location` services to\n * interact with application route state.\n *\n * For instance, `HashLocationStrategy` produces URLs like\n * http://example.com#/foo,\n * and `PathLocationStrategy` produces\n * http://example.com/foo as an equivalent URL.\n *\n * See these two classes for more.\n *\n * @publicApi\n */\nclass LocationStrategy {\n historyGo(relativePosition) {\n throw new Error(ngDevMode ? 'Not implemented' : '');\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0\", ngImport: i0, type: LocationStrategy, deps: [], target: i0.ɵɵFactoryTarget.Injectable }); }\n static { this.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"18.2.0\", ngImport: i0, type: LocationStrategy, providedIn: 'root', useFactory: () => inject(PathLocationStrategy) }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0\", ngImport: i0, type: LocationStrategy, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root', useFactory: () => inject(PathLocationStrategy) }]\n }] });\n/**\n * A predefined DI token for the base href\n * to be used with the `PathLocationStrategy`.\n * The base href is the URL prefix that should be preserved when generating\n * and recognizing URLs.\n *\n * @usageNotes\n *\n * The following example shows how to use this token to configure the root app injector\n * with a base href value, so that the DI framework can supply the dependency anywhere in the app.\n *\n * ```typescript\n * import {NgModule} from '@angular/core';\n * import {APP_BASE_HREF} from '@angular/common';\n *\n * @NgModule({\n * providers: [{provide: APP_BASE_HREF, useValue: '/my/app'}]\n * })\n * class AppModule {}\n * ```\n *\n * @publicApi\n */\nconst APP_BASE_HREF = new InjectionToken(ngDevMode ? 'appBaseHref' : '');\n/**\n * @description\n * A {@link LocationStrategy} used to configure the {@link Location} service to\n * represent its state in the\n * [path](https://en.wikipedia.org/wiki/Uniform_Resource_Locator#Syntax) of the\n * browser's URL.\n *\n * If you're using `PathLocationStrategy`, you may provide a {@link APP_BASE_HREF}\n * or add a `Important: The characters `.` `,` `0` `#` (and others below) are special placeholders\n * that stand for the decimal separator, and so on, and are NOT real characters.\n * You must NOT \"translate\" the placeholders. For example, don't change `.` to `,` even though in\n * your language the decimal point is written with a comma. The symbols should be replaced by the\n * local equivalents, using the appropriate `NumberSymbol` for your language.\n *\n * Here are the special characters used in number patterns:\n *\n * | Symbol | Meaning |\n * |--------|---------|\n * | . | Replaced automatically by the character used for the decimal point. |\n * | , | Replaced by the \"grouping\" (thousands) separator. |\n * | 0 | Replaced by a digit (or zero if there aren't enough digits). |\n * | # | Replaced by a digit (or nothing if there aren't enough). |\n * | ¤ | Replaced by a currency symbol, such as $ or USD. |\n * | % | Marks a percent format. The % symbol may change position, but must be retained. |\n * | E | Marks a scientific format. The E symbol may change position, but must be retained. |\n * | ' | Special characters used as literal characters are quoted with ASCII single quotes. |\n *\n * @param locale A locale code for the locale format rules to use.\n * @param type The type of numeric value to be formatted (such as `Decimal` or `Currency`.)\n * @returns The localized format string.\n * @see {@link NumberFormatStyle}\n * @see [CLDR website](http://cldr.unicode.org/translation/number-patterns)\n * @see [Internationalization (i18n) Guide](guide/i18n)\n *\n * @publicApi\n *\n * @deprecated Angular recommends relying on the `Intl` API for i18n.\n * Let `Intl.NumberFormat` determine the number format instead\n */\nfunction getLocaleNumberFormat(locale, type) {\n const data = ɵfindLocaleData(locale);\n return data[ɵLocaleDataIndex.NumberFormats][type];\n}\n/**\n * Retrieves the symbol used to represent the currency for the main country\n * corresponding to a given locale. For example, '$' for `en-US`.\n *\n * @param locale A locale code for the locale format rules to use.\n * @returns The localized symbol character,\n * or `null` if the main country cannot be determined.\n * @see [Internationalization (i18n) Guide](guide/i18n)\n *\n * @publicApi\n *\n * @deprecated Use the `Intl` API to format a currency with from currency code\n */\nfunction getLocaleCurrencySymbol(locale) {\n const data = ɵfindLocaleData(locale);\n return data[ɵLocaleDataIndex.CurrencySymbol] || null;\n}\n/**\n * Retrieves the name of the currency for the main country corresponding\n * to a given locale. For example, 'US Dollar' for `en-US`.\n * @param locale A locale code for the locale format rules to use.\n * @returns The currency name,\n * or `null` if the main country cannot be determined.\n * @see [Internationalization (i18n) Guide](guide/i18n)\n *\n * @publicApi\n *\n * @deprecated Use the `Intl` API to format a currency with from currency code\n */\nfunction getLocaleCurrencyName(locale) {\n const data = ɵfindLocaleData(locale);\n return data[ɵLocaleDataIndex.CurrencyName] || null;\n}\n/**\n * Retrieves the default currency code for the given locale.\n *\n * The default is defined as the first currency which is still in use.\n *\n * @param locale The code of the locale whose currency code we want.\n * @returns The code of the default currency for the given locale.\n *\n * @publicApi\n *\n * @deprecated We recommend you create a map of locale to ISO 4217 currency codes.\n * Time relative currency data is provided by the CLDR project. See https://www.unicode.org/cldr/charts/44/supplemental/detailed_territory_currency_information.html\n */\nfunction getLocaleCurrencyCode(locale) {\n return ɵgetLocaleCurrencyCode(locale);\n}\n/**\n * Retrieves the currency values for a given locale.\n * @param locale A locale code for the locale format rules to use.\n * @returns The currency values.\n * @see [Internationalization (i18n) Guide](guide/i18n)\n */\nfunction getLocaleCurrencies(locale) {\n const data = ɵfindLocaleData(locale);\n return data[ɵLocaleDataIndex.Currencies];\n}\n/**\n * @publicApi\n *\n * @deprecated Angular recommends relying on the `Intl` API for i18n.\n * Use `Intl.PluralRules` instead\n */\nconst getLocalePluralCase = ɵgetLocalePluralCase;\nfunction checkFullData(data) {\n if (!data[ɵLocaleDataIndex.ExtraData]) {\n throw new Error(`Missing extra locale data for the locale \"${data[ɵLocaleDataIndex.LocaleId]}\". Use \"registerLocaleData\" to load new data. See the \"I18n guide\" on angular.io to know more.`);\n }\n}\n/**\n * Retrieves locale-specific rules used to determine which day period to use\n * when more than one period is defined for a locale.\n *\n * There is a rule for each defined day period. The\n * first rule is applied to the first day period and so on.\n * Fall back to AM/PM when no rules are available.\n *\n * A rule can specify a period as time range, or as a single time value.\n *\n * This functionality is only available when you have loaded the full locale data.\n * See the [\"I18n guide\"](guide/i18n/format-data-locale).\n *\n * @param locale A locale code for the locale format rules to use.\n * @returns The rules for the locale, a single time value or array of *from-time, to-time*,\n * or null if no periods are available.\n *\n * @see {@link getLocaleExtraDayPeriods}\n * @see [Internationalization (i18n) Guide](guide/i18n)\n *\n * @publicApi\n *\n * @deprecated Angular recommends relying on the `Intl` API for i18n.\n * Let `Intl.DateTimeFormat` determine the day period instead.\n */\nfunction getLocaleExtraDayPeriodRules(locale) {\n const data = ɵfindLocaleData(locale);\n checkFullData(data);\n const rules = data[ɵLocaleDataIndex.ExtraData][2 /* ɵExtraLocaleDataIndex.ExtraDayPeriodsRules */] || [];\n return rules.map((rule) => {\n if (typeof rule === 'string') {\n return extractTime(rule);\n }\n return [extractTime(rule[0]), extractTime(rule[1])];\n });\n}\n/**\n * Retrieves locale-specific day periods, which indicate roughly how a day is broken up\n * in different languages.\n * For example, for `en-US`, periods are morning, noon, afternoon, evening, and midnight.\n *\n * This functionality is only available when you have loaded the full locale data.\n * See the [\"I18n guide\"](guide/i18n/format-data-locale).\n *\n * @param locale A locale code for the locale format rules to use.\n * @param formStyle The required grammatical form.\n * @param width The required character width.\n * @returns The translated day-period strings.\n * @see {@link getLocaleExtraDayPeriodRules}\n * @see [Internationalization (i18n) Guide](guide/i18n)\n *\n * @publicApi\n *\n * @deprecated Angular recommends relying on the `Intl` API for i18n.\n * To extract a day period use `Intl.DateTimeFormat` with the `dayPeriod` option instead.\n */\nfunction getLocaleExtraDayPeriods(locale, formStyle, width) {\n const data = ɵfindLocaleData(locale);\n checkFullData(data);\n const dayPeriodsData = [\n data[ɵLocaleDataIndex.ExtraData][0 /* ɵExtraLocaleDataIndex.ExtraDayPeriodFormats */],\n data[ɵLocaleDataIndex.ExtraData][1 /* ɵExtraLocaleDataIndex.ExtraDayPeriodStandalone */],\n ];\n const dayPeriods = getLastDefinedValue(dayPeriodsData, formStyle) || [];\n return getLastDefinedValue(dayPeriods, width) || [];\n}\n/**\n * Retrieves the writing direction of a specified locale\n * @param locale A locale code for the locale format rules to use.\n * @publicApi\n * @returns 'rtl' or 'ltr'\n * @see [Internationalization (i18n) Guide](guide/i18n)\n *\n * @deprecated Angular recommends relying on the `Intl` API for i18n.\n * For dates and numbers, let `Intl.DateTimeFormat()` and `Intl.NumberFormat()` determine the writing direction.\n * The `Intl` alternative [`getTextInfo`](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Intl/Locale/getTextInfo).\n * has only partial support (Chromium M99 & Safari 17).\n * 3rd party alternatives like [`rtl-detect`](https://www.npmjs.com/package/rtl-detect) can work around this issue.\n */\nfunction getLocaleDirection(locale) {\n const data = ɵfindLocaleData(locale);\n return data[ɵLocaleDataIndex.Directionality];\n}\n/**\n * Retrieves the first value that is defined in an array, going backwards from an index position.\n *\n * To avoid repeating the same data (as when the \"format\" and \"standalone\" forms are the same)\n * add the first value to the locale data arrays, and add other values only if they are different.\n *\n * @param data The data array to retrieve from.\n * @param index A 0-based index into the array to start from.\n * @returns The value immediately before the given index position.\n * @see [Internationalization (i18n) Guide](guide/i18n)\n *\n */\nfunction getLastDefinedValue(data, index) {\n for (let i = index; i > -1; i--) {\n if (typeof data[i] !== 'undefined') {\n return data[i];\n }\n }\n throw new Error('Locale data API: locale data undefined');\n}\n/**\n * Extracts the hours and minutes from a string like \"15:45\"\n */\nfunction extractTime(time) {\n const [h, m] = time.split(':');\n return { hours: +h, minutes: +m };\n}\n/**\n * Retrieves the currency symbol for a given currency code.\n *\n * For example, for the default `en-US` locale, the code `USD` can\n * be represented by the narrow symbol `$` or the wide symbol `US$`.\n *\n * @param code The currency code.\n * @param format The format, `wide` or `narrow`.\n * @param locale A locale code for the locale format rules to use.\n *\n * @returns The symbol, or the currency code if no symbol is available.\n * @see [Internationalization (i18n) Guide](guide/i18n)\n *\n * @publicApi\n *\n * @deprecated Angular recommends relying on the `Intl` API for i18n.\n * You can use `Intl.NumberFormat().formatToParts()` to extract the currency symbol.\n * For example: `Intl.NumberFormat('en', {style:'currency', currency: 'USD'}).formatToParts().find(part => part.type === 'currency').value`\n * returns `$` for USD currency code in the `en` locale.\n * Note: `US$` is a currency symbol for the `en-ca` locale but not the `en-us` locale.\n */\nfunction getCurrencySymbol(code, format, locale = 'en') {\n const currency = getLocaleCurrencies(locale)[code] || CURRENCIES_EN[code] || [];\n const symbolNarrow = currency[1 /* ɵCurrencyIndex.SymbolNarrow */];\n if (format === 'narrow' && typeof symbolNarrow === 'string') {\n return symbolNarrow;\n }\n return currency[0 /* ɵCurrencyIndex.Symbol */] || code;\n}\n// Most currencies have cents, that's why the default is 2\nconst DEFAULT_NB_OF_CURRENCY_DIGITS = 2;\n/**\n * Reports the number of decimal digits for a given currency.\n * The value depends upon the presence of cents in that particular currency.\n *\n * @param code The currency code.\n * @returns The number of decimal digits, typically 0 or 2.\n * @see [Internationalization (i18n) Guide](guide/i18n)\n *\n * @publicApi\n *\n * @deprecated Angular recommends relying on the `Intl` API for i18n.\n * This function should not be used anymore. Let `Intl.NumberFormat` determine the number of digits to display for the currency\n */\nfunction getNumberOfCurrencyDigits(code) {\n let digits;\n const currency = CURRENCIES_EN[code];\n if (currency) {\n digits = currency[2 /* ɵCurrencyIndex.NbOfDigits */];\n }\n return typeof digits === 'number' ? digits : DEFAULT_NB_OF_CURRENCY_DIGITS;\n}\n\nconst ISO8601_DATE_REGEX = /^(\\d{4,})-?(\\d\\d)-?(\\d\\d)(?:T(\\d\\d)(?::?(\\d\\d)(?::?(\\d\\d)(?:\\.(\\d+))?)?)?(Z|([+-])(\\d\\d):?(\\d\\d))?)?$/;\n// 1 2 3 4 5 6 7 8 9 10 11\nconst NAMED_FORMATS = {};\nconst DATE_FORMATS_SPLIT = /((?:[^BEGHLMOSWYZabcdhmswyz']+)|(?:'(?:[^']|'')*')|(?:G{1,5}|y{1,4}|Y{1,4}|M{1,5}|L{1,5}|w{1,2}|W{1}|d{1,2}|E{1,6}|c{1,6}|a{1,5}|b{1,5}|B{1,5}|h{1,2}|H{1,2}|m{1,2}|s{1,2}|S{1,3}|z{1,4}|Z{1,5}|O{1,4}))([\\s\\S]*)/;\nvar ZoneWidth;\n(function (ZoneWidth) {\n ZoneWidth[ZoneWidth[\"Short\"] = 0] = \"Short\";\n ZoneWidth[ZoneWidth[\"ShortGMT\"] = 1] = \"ShortGMT\";\n ZoneWidth[ZoneWidth[\"Long\"] = 2] = \"Long\";\n ZoneWidth[ZoneWidth[\"Extended\"] = 3] = \"Extended\";\n})(ZoneWidth || (ZoneWidth = {}));\nvar DateType;\n(function (DateType) {\n DateType[DateType[\"FullYear\"] = 0] = \"FullYear\";\n DateType[DateType[\"Month\"] = 1] = \"Month\";\n DateType[DateType[\"Date\"] = 2] = \"Date\";\n DateType[DateType[\"Hours\"] = 3] = \"Hours\";\n DateType[DateType[\"Minutes\"] = 4] = \"Minutes\";\n DateType[DateType[\"Seconds\"] = 5] = \"Seconds\";\n DateType[DateType[\"FractionalSeconds\"] = 6] = \"FractionalSeconds\";\n DateType[DateType[\"Day\"] = 7] = \"Day\";\n})(DateType || (DateType = {}));\nvar TranslationType;\n(function (TranslationType) {\n TranslationType[TranslationType[\"DayPeriods\"] = 0] = \"DayPeriods\";\n TranslationType[TranslationType[\"Days\"] = 1] = \"Days\";\n TranslationType[TranslationType[\"Months\"] = 2] = \"Months\";\n TranslationType[TranslationType[\"Eras\"] = 3] = \"Eras\";\n})(TranslationType || (TranslationType = {}));\n/**\n * @ngModule CommonModule\n * @description\n *\n * Formats a date according to locale rules.\n *\n * @param value The date to format, as a Date, or a number (milliseconds since UTC epoch)\n * or an [ISO date-time string](https://www.w3.org/TR/NOTE-datetime).\n * @param format The date-time components to include. See `DatePipe` for details.\n * @param locale A locale code for the locale format rules to use.\n * @param timezone The time zone. A time zone offset from GMT (such as `'+0430'`),\n * or a standard UTC/GMT or continental US time zone abbreviation.\n * If not specified, uses host system settings.\n *\n * @returns The formatted date string.\n *\n * @see {@link DatePipe}\n * @see [Internationalization (i18n) Guide](guide/i18n)\n *\n * @publicApi\n */\nfunction formatDate(value, format, locale, timezone) {\n let date = toDate(value);\n const namedFormat = getNamedFormat(locale, format);\n format = namedFormat || format;\n let parts = [];\n let match;\n while (format) {\n match = DATE_FORMATS_SPLIT.exec(format);\n if (match) {\n parts = parts.concat(match.slice(1));\n const part = parts.pop();\n if (!part) {\n break;\n }\n format = part;\n }\n else {\n parts.push(format);\n break;\n }\n }\n let dateTimezoneOffset = date.getTimezoneOffset();\n if (timezone) {\n dateTimezoneOffset = timezoneToOffset(timezone, dateTimezoneOffset);\n date = convertTimezoneToLocal(date, timezone, true);\n }\n let text = '';\n parts.forEach((value) => {\n const dateFormatter = getDateFormatter(value);\n text += dateFormatter\n ? dateFormatter(date, locale, dateTimezoneOffset)\n : value === \"''\"\n ? \"'\"\n : value.replace(/(^'|'$)/g, '').replace(/''/g, \"'\");\n });\n return text;\n}\n/**\n * Create a new Date object with the given date value, and the time set to midnight.\n *\n * We cannot use `new Date(year, month, date)` because it maps years between 0 and 99 to 1900-1999.\n * See: https://github.com/angular/angular/issues/40377\n *\n * Note that this function returns a Date object whose time is midnight in the current locale's\n * timezone. In the future we might want to change this to be midnight in UTC, but this would be a\n * considerable breaking change.\n */\nfunction createDate(year, month, date) {\n // The `newDate` is set to midnight (UTC) on January 1st 1970.\n // - In PST this will be December 31st 1969 at 4pm.\n // - In GMT this will be January 1st 1970 at 1am.\n // Note that they even have different years, dates and months!\n const newDate = new Date(0);\n // `setFullYear()` allows years like 0001 to be set correctly. This function does not\n // change the internal time of the date.\n // Consider calling `setFullYear(2019, 8, 20)` (September 20, 2019).\n // - In PST this will now be September 20, 2019 at 4pm\n // - In GMT this will now be September 20, 2019 at 1am\n newDate.setFullYear(year, month, date);\n // We want the final date to be at local midnight, so we reset the time.\n // - In PST this will now be September 20, 2019 at 12am\n // - In GMT this will now be September 20, 2019 at 12am\n newDate.setHours(0, 0, 0);\n return newDate;\n}\nfunction getNamedFormat(locale, format) {\n const localeId = getLocaleId(locale);\n NAMED_FORMATS[localeId] ??= {};\n if (NAMED_FORMATS[localeId][format]) {\n return NAMED_FORMATS[localeId][format];\n }\n let formatValue = '';\n switch (format) {\n case 'shortDate':\n formatValue = getLocaleDateFormat(locale, FormatWidth.Short);\n break;\n case 'mediumDate':\n formatValue = getLocaleDateFormat(locale, FormatWidth.Medium);\n break;\n case 'longDate':\n formatValue = getLocaleDateFormat(locale, FormatWidth.Long);\n break;\n case 'fullDate':\n formatValue = getLocaleDateFormat(locale, FormatWidth.Full);\n break;\n case 'shortTime':\n formatValue = getLocaleTimeFormat(locale, FormatWidth.Short);\n break;\n case 'mediumTime':\n formatValue = getLocaleTimeFormat(locale, FormatWidth.Medium);\n break;\n case 'longTime':\n formatValue = getLocaleTimeFormat(locale, FormatWidth.Long);\n break;\n case 'fullTime':\n formatValue = getLocaleTimeFormat(locale, FormatWidth.Full);\n break;\n case 'short':\n const shortTime = getNamedFormat(locale, 'shortTime');\n const shortDate = getNamedFormat(locale, 'shortDate');\n formatValue = formatDateTime(getLocaleDateTimeFormat(locale, FormatWidth.Short), [\n shortTime,\n shortDate,\n ]);\n break;\n case 'medium':\n const mediumTime = getNamedFormat(locale, 'mediumTime');\n const mediumDate = getNamedFormat(locale, 'mediumDate');\n formatValue = formatDateTime(getLocaleDateTimeFormat(locale, FormatWidth.Medium), [\n mediumTime,\n mediumDate,\n ]);\n break;\n case 'long':\n const longTime = getNamedFormat(locale, 'longTime');\n const longDate = getNamedFormat(locale, 'longDate');\n formatValue = formatDateTime(getLocaleDateTimeFormat(locale, FormatWidth.Long), [\n longTime,\n longDate,\n ]);\n break;\n case 'full':\n const fullTime = getNamedFormat(locale, 'fullTime');\n const fullDate = getNamedFormat(locale, 'fullDate');\n formatValue = formatDateTime(getLocaleDateTimeFormat(locale, FormatWidth.Full), [\n fullTime,\n fullDate,\n ]);\n break;\n }\n if (formatValue) {\n NAMED_FORMATS[localeId][format] = formatValue;\n }\n return formatValue;\n}\nfunction formatDateTime(str, opt_values) {\n if (opt_values) {\n str = str.replace(/\\{([^}]+)}/g, function (match, key) {\n return opt_values != null && key in opt_values ? opt_values[key] : match;\n });\n }\n return str;\n}\nfunction padNumber(num, digits, minusSign = '-', trim, negWrap) {\n let neg = '';\n if (num < 0 || (negWrap && num <= 0)) {\n if (negWrap) {\n num = -num + 1;\n }\n else {\n num = -num;\n neg = minusSign;\n }\n }\n let strNum = String(num);\n while (strNum.length < digits) {\n strNum = '0' + strNum;\n }\n if (trim) {\n strNum = strNum.slice(strNum.length - digits);\n }\n return neg + strNum;\n}\nfunction formatFractionalSeconds(milliseconds, digits) {\n const strMs = padNumber(milliseconds, 3);\n return strMs.substring(0, digits);\n}\n/**\n * Returns a date formatter that transforms a date into its locale digit representation\n */\nfunction dateGetter(name, size, offset = 0, trim = false, negWrap = false) {\n return function (date, locale) {\n let part = getDatePart(name, date);\n if (offset > 0 || part > -offset) {\n part += offset;\n }\n if (name === DateType.Hours) {\n if (part === 0 && offset === -12) {\n part = 12;\n }\n }\n else if (name === DateType.FractionalSeconds) {\n return formatFractionalSeconds(part, size);\n }\n const localeMinus = getLocaleNumberSymbol(locale, NumberSymbol.MinusSign);\n return padNumber(part, size, localeMinus, trim, negWrap);\n };\n}\nfunction getDatePart(part, date) {\n switch (part) {\n case DateType.FullYear:\n return date.getFullYear();\n case DateType.Month:\n return date.getMonth();\n case DateType.Date:\n return date.getDate();\n case DateType.Hours:\n return date.getHours();\n case DateType.Minutes:\n return date.getMinutes();\n case DateType.Seconds:\n return date.getSeconds();\n case DateType.FractionalSeconds:\n return date.getMilliseconds();\n case DateType.Day:\n return date.getDay();\n default:\n throw new Error(`Unknown DateType value \"${part}\".`);\n }\n}\n/**\n * Returns a date formatter that transforms a date into its locale string representation\n */\nfunction dateStrGetter(name, width, form = FormStyle.Format, extended = false) {\n return function (date, locale) {\n return getDateTranslation(date, locale, name, width, form, extended);\n };\n}\n/**\n * Returns the locale translation of a date for a given form, type and width\n */\nfunction getDateTranslation(date, locale, name, width, form, extended) {\n switch (name) {\n case TranslationType.Months:\n return getLocaleMonthNames(locale, form, width)[date.getMonth()];\n case TranslationType.Days:\n return getLocaleDayNames(locale, form, width)[date.getDay()];\n case TranslationType.DayPeriods:\n const currentHours = date.getHours();\n const currentMinutes = date.getMinutes();\n if (extended) {\n const rules = getLocaleExtraDayPeriodRules(locale);\n const dayPeriods = getLocaleExtraDayPeriods(locale, form, width);\n const index = rules.findIndex((rule) => {\n if (Array.isArray(rule)) {\n // morning, afternoon, evening, night\n const [from, to] = rule;\n const afterFrom = currentHours >= from.hours && currentMinutes >= from.minutes;\n const beforeTo = currentHours < to.hours || (currentHours === to.hours && currentMinutes < to.minutes);\n // We must account for normal rules that span a period during the day (e.g. 6am-9am)\n // where `from` is less (earlier) than `to`. But also rules that span midnight (e.g.\n // 10pm - 5am) where `from` is greater (later!) than `to`.\n //\n // In the first case the current time must be BOTH after `from` AND before `to`\n // (e.g. 8am is after 6am AND before 10am).\n //\n // In the second case the current time must be EITHER after `from` OR before `to`\n // (e.g. 4am is before 5am but not after 10pm; and 11pm is not before 5am but it is\n // after 10pm).\n if (from.hours < to.hours) {\n if (afterFrom && beforeTo) {\n return true;\n }\n }\n else if (afterFrom || beforeTo) {\n return true;\n }\n }\n else {\n // noon or midnight\n if (rule.hours === currentHours && rule.minutes === currentMinutes) {\n return true;\n }\n }\n return false;\n });\n if (index !== -1) {\n return dayPeriods[index];\n }\n }\n // if no rules for the day periods, we use am/pm by default\n return getLocaleDayPeriods(locale, form, width)[currentHours < 12 ? 0 : 1];\n case TranslationType.Eras:\n return getLocaleEraNames(locale, width)[date.getFullYear() <= 0 ? 0 : 1];\n default:\n // This default case is not needed by TypeScript compiler, as the switch is exhaustive.\n // However Closure Compiler does not understand that and reports an error in typed mode.\n // The `throw new Error` below works around the problem, and the unexpected: never variable\n // makes sure tsc still checks this code is unreachable.\n const unexpected = name;\n throw new Error(`unexpected translation type ${unexpected}`);\n }\n}\n/**\n * Returns a date formatter that transforms a date and an offset into a timezone with ISO8601 or\n * GMT format depending on the width (eg: short = +0430, short:GMT = GMT+4, long = GMT+04:30,\n * extended = +04:30)\n */\nfunction timeZoneGetter(width) {\n return function (date, locale, offset) {\n const zone = -1 * offset;\n const minusSign = getLocaleNumberSymbol(locale, NumberSymbol.MinusSign);\n const hours = zone > 0 ? Math.floor(zone / 60) : Math.ceil(zone / 60);\n switch (width) {\n case ZoneWidth.Short:\n return ((zone >= 0 ? '+' : '') +\n padNumber(hours, 2, minusSign) +\n padNumber(Math.abs(zone % 60), 2, minusSign));\n case ZoneWidth.ShortGMT:\n return 'GMT' + (zone >= 0 ? '+' : '') + padNumber(hours, 1, minusSign);\n case ZoneWidth.Long:\n return ('GMT' +\n (zone >= 0 ? '+' : '') +\n padNumber(hours, 2, minusSign) +\n ':' +\n padNumber(Math.abs(zone % 60), 2, minusSign));\n case ZoneWidth.Extended:\n if (offset === 0) {\n return 'Z';\n }\n else {\n return ((zone >= 0 ? '+' : '') +\n padNumber(hours, 2, minusSign) +\n ':' +\n padNumber(Math.abs(zone % 60), 2, minusSign));\n }\n default:\n throw new Error(`Unknown zone width \"${width}\"`);\n }\n };\n}\nconst JANUARY = 0;\nconst THURSDAY = 4;\nfunction getFirstThursdayOfYear(year) {\n const firstDayOfYear = createDate(year, JANUARY, 1).getDay();\n return createDate(year, 0, 1 + (firstDayOfYear <= THURSDAY ? THURSDAY : THURSDAY + 7) - firstDayOfYear);\n}\n/**\n * ISO Week starts on day 1 (Monday) and ends with day 0 (Sunday)\n */\nfunction getThursdayThisIsoWeek(datetime) {\n // getDay returns 0-6 range with sunday as 0.\n const currentDay = datetime.getDay();\n // On a Sunday, read the previous Thursday since ISO weeks start on Monday.\n const deltaToThursday = currentDay === 0 ? -3 : THURSDAY - currentDay;\n return createDate(datetime.getFullYear(), datetime.getMonth(), datetime.getDate() + deltaToThursday);\n}\nfunction weekGetter(size, monthBased = false) {\n return function (date, locale) {\n let result;\n if (monthBased) {\n const nbDaysBefore1stDayOfMonth = new Date(date.getFullYear(), date.getMonth(), 1).getDay() - 1;\n const today = date.getDate();\n result = 1 + Math.floor((today + nbDaysBefore1stDayOfMonth) / 7);\n }\n else {\n const thisThurs = getThursdayThisIsoWeek(date);\n // Some days of a year are part of next year according to ISO 8601.\n // Compute the firstThurs from the year of this week's Thursday\n const firstThurs = getFirstThursdayOfYear(thisThurs.getFullYear());\n const diff = thisThurs.getTime() - firstThurs.getTime();\n result = 1 + Math.round(diff / 6.048e8); // 6.048e8 ms per week\n }\n return padNumber(result, size, getLocaleNumberSymbol(locale, NumberSymbol.MinusSign));\n };\n}\n/**\n * Returns a date formatter that provides the week-numbering year for the input date.\n */\nfunction weekNumberingYearGetter(size, trim = false) {\n return function (date, locale) {\n const thisThurs = getThursdayThisIsoWeek(date);\n const weekNumberingYear = thisThurs.getFullYear();\n return padNumber(weekNumberingYear, size, getLocaleNumberSymbol(locale, NumberSymbol.MinusSign), trim);\n };\n}\nconst DATE_FORMATS = {};\n// Based on CLDR formats:\n// See complete list: http://www.unicode.org/reports/tr35/tr35-dates.html#Date_Field_Symbol_Table\n// See also explanations: http://cldr.unicode.org/translation/date-time\n// TODO(ocombe): support all missing cldr formats: U, Q, D, F, e, j, J, C, A, v, V, X, x\nfunction getDateFormatter(format) {\n if (DATE_FORMATS[format]) {\n return DATE_FORMATS[format];\n }\n let formatter;\n switch (format) {\n // Era name (AD/BC)\n case 'G':\n case 'GG':\n case 'GGG':\n formatter = dateStrGetter(TranslationType.Eras, TranslationWidth.Abbreviated);\n break;\n case 'GGGG':\n formatter = dateStrGetter(TranslationType.Eras, TranslationWidth.Wide);\n break;\n case 'GGGGG':\n formatter = dateStrGetter(TranslationType.Eras, TranslationWidth.Narrow);\n break;\n // 1 digit representation of the year, e.g. (AD 1 => 1, AD 199 => 199)\n case 'y':\n formatter = dateGetter(DateType.FullYear, 1, 0, false, true);\n break;\n // 2 digit representation of the year, padded (00-99). (e.g. AD 2001 => 01, AD 2010 => 10)\n case 'yy':\n formatter = dateGetter(DateType.FullYear, 2, 0, true, true);\n break;\n // 3 digit representation of the year, padded (000-999). (e.g. AD 2001 => 01, AD 2010 => 10)\n case 'yyy':\n formatter = dateGetter(DateType.FullYear, 3, 0, false, true);\n break;\n // 4 digit representation of the year (e.g. AD 1 => 0001, AD 2010 => 2010)\n case 'yyyy':\n formatter = dateGetter(DateType.FullYear, 4, 0, false, true);\n break;\n // 1 digit representation of the week-numbering year, e.g. (AD 1 => 1, AD 199 => 199)\n case 'Y':\n formatter = weekNumberingYearGetter(1);\n break;\n // 2 digit representation of the week-numbering year, padded (00-99). (e.g. AD 2001 => 01, AD\n // 2010 => 10)\n case 'YY':\n formatter = weekNumberingYearGetter(2, true);\n break;\n // 3 digit representation of the week-numbering year, padded (000-999). (e.g. AD 1 => 001, AD\n // 2010 => 2010)\n case 'YYY':\n formatter = weekNumberingYearGetter(3);\n break;\n // 4 digit representation of the week-numbering year (e.g. AD 1 => 0001, AD 2010 => 2010)\n case 'YYYY':\n formatter = weekNumberingYearGetter(4);\n break;\n // Month of the year (1-12), numeric\n case 'M':\n case 'L':\n formatter = dateGetter(DateType.Month, 1, 1);\n break;\n case 'MM':\n case 'LL':\n formatter = dateGetter(DateType.Month, 2, 1);\n break;\n // Month of the year (January, ...), string, format\n case 'MMM':\n formatter = dateStrGetter(TranslationType.Months, TranslationWidth.Abbreviated);\n break;\n case 'MMMM':\n formatter = dateStrGetter(TranslationType.Months, TranslationWidth.Wide);\n break;\n case 'MMMMM':\n formatter = dateStrGetter(TranslationType.Months, TranslationWidth.Narrow);\n break;\n // Month of the year (January, ...), string, standalone\n case 'LLL':\n formatter = dateStrGetter(TranslationType.Months, TranslationWidth.Abbreviated, FormStyle.Standalone);\n break;\n case 'LLLL':\n formatter = dateStrGetter(TranslationType.Months, TranslationWidth.Wide, FormStyle.Standalone);\n break;\n case 'LLLLL':\n formatter = dateStrGetter(TranslationType.Months, TranslationWidth.Narrow, FormStyle.Standalone);\n break;\n // Week of the year (1, ... 52)\n case 'w':\n formatter = weekGetter(1);\n break;\n case 'ww':\n formatter = weekGetter(2);\n break;\n // Week of the month (1, ...)\n case 'W':\n formatter = weekGetter(1, true);\n break;\n // Day of the month (1-31)\n case 'd':\n formatter = dateGetter(DateType.Date, 1);\n break;\n case 'dd':\n formatter = dateGetter(DateType.Date, 2);\n break;\n // Day of the Week StandAlone (1, 1, Mon, Monday, M, Mo)\n case 'c':\n case 'cc':\n formatter = dateGetter(DateType.Day, 1);\n break;\n case 'ccc':\n formatter = dateStrGetter(TranslationType.Days, TranslationWidth.Abbreviated, FormStyle.Standalone);\n break;\n case 'cccc':\n formatter = dateStrGetter(TranslationType.Days, TranslationWidth.Wide, FormStyle.Standalone);\n break;\n case 'ccccc':\n formatter = dateStrGetter(TranslationType.Days, TranslationWidth.Narrow, FormStyle.Standalone);\n break;\n case 'cccccc':\n formatter = dateStrGetter(TranslationType.Days, TranslationWidth.Short, FormStyle.Standalone);\n break;\n // Day of the Week\n case 'E':\n case 'EE':\n case 'EEE':\n formatter = dateStrGetter(TranslationType.Days, TranslationWidth.Abbreviated);\n break;\n case 'EEEE':\n formatter = dateStrGetter(TranslationType.Days, TranslationWidth.Wide);\n break;\n case 'EEEEE':\n formatter = dateStrGetter(TranslationType.Days, TranslationWidth.Narrow);\n break;\n case 'EEEEEE':\n formatter = dateStrGetter(TranslationType.Days, TranslationWidth.Short);\n break;\n // Generic period of the day (am-pm)\n case 'a':\n case 'aa':\n case 'aaa':\n formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Abbreviated);\n break;\n case 'aaaa':\n formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Wide);\n break;\n case 'aaaaa':\n formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Narrow);\n break;\n // Extended period of the day (midnight, at night, ...), standalone\n case 'b':\n case 'bb':\n case 'bbb':\n formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Abbreviated, FormStyle.Standalone, true);\n break;\n case 'bbbb':\n formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Wide, FormStyle.Standalone, true);\n break;\n case 'bbbbb':\n formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Narrow, FormStyle.Standalone, true);\n break;\n // Extended period of the day (midnight, night, ...), standalone\n case 'B':\n case 'BB':\n case 'BBB':\n formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Abbreviated, FormStyle.Format, true);\n break;\n case 'BBBB':\n formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Wide, FormStyle.Format, true);\n break;\n case 'BBBBB':\n formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Narrow, FormStyle.Format, true);\n break;\n // Hour in AM/PM, (1-12)\n case 'h':\n formatter = dateGetter(DateType.Hours, 1, -12);\n break;\n case 'hh':\n formatter = dateGetter(DateType.Hours, 2, -12);\n break;\n // Hour of the day (0-23)\n case 'H':\n formatter = dateGetter(DateType.Hours, 1);\n break;\n // Hour in day, padded (00-23)\n case 'HH':\n formatter = dateGetter(DateType.Hours, 2);\n break;\n // Minute of the hour (0-59)\n case 'm':\n formatter = dateGetter(DateType.Minutes, 1);\n break;\n case 'mm':\n formatter = dateGetter(DateType.Minutes, 2);\n break;\n // Second of the minute (0-59)\n case 's':\n formatter = dateGetter(DateType.Seconds, 1);\n break;\n case 'ss':\n formatter = dateGetter(DateType.Seconds, 2);\n break;\n // Fractional second\n case 'S':\n formatter = dateGetter(DateType.FractionalSeconds, 1);\n break;\n case 'SS':\n formatter = dateGetter(DateType.FractionalSeconds, 2);\n break;\n case 'SSS':\n formatter = dateGetter(DateType.FractionalSeconds, 3);\n break;\n // Timezone ISO8601 short format (-0430)\n case 'Z':\n case 'ZZ':\n case 'ZZZ':\n formatter = timeZoneGetter(ZoneWidth.Short);\n break;\n // Timezone ISO8601 extended format (-04:30)\n case 'ZZZZZ':\n formatter = timeZoneGetter(ZoneWidth.Extended);\n break;\n // Timezone GMT short format (GMT+4)\n case 'O':\n case 'OO':\n case 'OOO':\n // Should be location, but fallback to format O instead because we don't have the data yet\n case 'z':\n case 'zz':\n case 'zzz':\n formatter = timeZoneGetter(ZoneWidth.ShortGMT);\n break;\n // Timezone GMT long format (GMT+0430)\n case 'OOOO':\n case 'ZZZZ':\n // Should be location, but fallback to format O instead because we don't have the data yet\n case 'zzzz':\n formatter = timeZoneGetter(ZoneWidth.Long);\n break;\n default:\n return null;\n }\n DATE_FORMATS[format] = formatter;\n return formatter;\n}\nfunction timezoneToOffset(timezone, fallback) {\n // Support: IE 11 only, Edge 13-15+\n // IE/Edge do not \"understand\" colon (`:`) in timezone\n timezone = timezone.replace(/:/g, '');\n const requestedTimezoneOffset = Date.parse('Jan 01, 1970 00:00:00 ' + timezone) / 60000;\n return isNaN(requestedTimezoneOffset) ? fallback : requestedTimezoneOffset;\n}\nfunction addDateMinutes(date, minutes) {\n date = new Date(date.getTime());\n date.setMinutes(date.getMinutes() + minutes);\n return date;\n}\nfunction convertTimezoneToLocal(date, timezone, reverse) {\n const reverseValue = reverse ? -1 : 1;\n const dateTimezoneOffset = date.getTimezoneOffset();\n const timezoneOffset = timezoneToOffset(timezone, dateTimezoneOffset);\n return addDateMinutes(date, reverseValue * (timezoneOffset - dateTimezoneOffset));\n}\n/**\n * Converts a value to date.\n *\n * Supported input formats:\n * - `Date`\n * - number: timestamp\n * - string: numeric (e.g. \"1234\"), ISO and date strings in a format supported by\n * [Date.parse()](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Date/parse).\n * Note: ISO strings without time return a date without timeoffset.\n *\n * Throws if unable to convert to a date.\n */\nfunction toDate(value) {\n if (isDate(value)) {\n return value;\n }\n if (typeof value === 'number' && !isNaN(value)) {\n return new Date(value);\n }\n if (typeof value === 'string') {\n value = value.trim();\n if (/^(\\d{4}(-\\d{1,2}(-\\d{1,2})?)?)$/.test(value)) {\n /* For ISO Strings without time the day, month and year must be extracted from the ISO String\n before Date creation to avoid time offset and errors in the new Date.\n If we only replace '-' with ',' in the ISO String (\"2015,01,01\"), and try to create a new\n date, some browsers (e.g. IE 9) will throw an invalid Date error.\n If we leave the '-' (\"2015-01-01\") and try to create a new Date(\"2015-01-01\") the timeoffset\n is applied.\n Note: ISO months are 0 for January, 1 for February, ... */\n const [y, m = 1, d = 1] = value.split('-').map((val) => +val);\n return createDate(y, m - 1, d);\n }\n const parsedNb = parseFloat(value);\n // any string that only contains numbers, like \"1234\" but not like \"1234hello\"\n if (!isNaN(value - parsedNb)) {\n return new Date(parsedNb);\n }\n let match;\n if ((match = value.match(ISO8601_DATE_REGEX))) {\n return isoStringToDate(match);\n }\n }\n const date = new Date(value);\n if (!isDate(date)) {\n throw new Error(`Unable to convert \"${value}\" into a date`);\n }\n return date;\n}\n/**\n * Converts a date in ISO8601 to a Date.\n * Used instead of `Date.parse` because of browser discrepancies.\n */\nfunction isoStringToDate(match) {\n const date = new Date(0);\n let tzHour = 0;\n let tzMin = 0;\n // match[8] means that the string contains \"Z\" (UTC) or a timezone like \"+01:00\" or \"+0100\"\n const dateSetter = match[8] ? date.setUTCFullYear : date.setFullYear;\n const timeSetter = match[8] ? date.setUTCHours : date.setHours;\n // if there is a timezone defined like \"+01:00\" or \"+0100\"\n if (match[9]) {\n tzHour = Number(match[9] + match[10]);\n tzMin = Number(match[9] + match[11]);\n }\n dateSetter.call(date, Number(match[1]), Number(match[2]) - 1, Number(match[3]));\n const h = Number(match[4] || 0) - tzHour;\n const m = Number(match[5] || 0) - tzMin;\n const s = Number(match[6] || 0);\n // The ECMAScript specification (https://www.ecma-international.org/ecma-262/5.1/#sec-15.9.1.11)\n // defines that `DateTime` milliseconds should always be rounded down, so that `999.9ms`\n // becomes `999ms`.\n const ms = Math.floor(parseFloat('0.' + (match[7] || 0)) * 1000);\n timeSetter.call(date, h, m, s, ms);\n return date;\n}\nfunction isDate(value) {\n return value instanceof Date && !isNaN(value.valueOf());\n}\n\nconst NUMBER_FORMAT_REGEXP = /^(\\d+)?\\.((\\d+)(-(\\d+))?)?$/;\nconst MAX_DIGITS = 22;\nconst DECIMAL_SEP = '.';\nconst ZERO_CHAR = '0';\nconst PATTERN_SEP = ';';\nconst GROUP_SEP = ',';\nconst DIGIT_CHAR = '#';\nconst CURRENCY_CHAR = '¤';\nconst PERCENT_CHAR = '%';\n/**\n * Transforms a number to a locale string based on a style and a format.\n */\nfunction formatNumberToLocaleString(value, pattern, locale, groupSymbol, decimalSymbol, digitsInfo, isPercent = false) {\n let formattedText = '';\n let isZero = false;\n if (!isFinite(value)) {\n formattedText = getLocaleNumberSymbol(locale, NumberSymbol.Infinity);\n }\n else {\n let parsedNumber = parseNumber(value);\n if (isPercent) {\n parsedNumber = toPercent(parsedNumber);\n }\n let minInt = pattern.minInt;\n let minFraction = pattern.minFrac;\n let maxFraction = pattern.maxFrac;\n if (digitsInfo) {\n const parts = digitsInfo.match(NUMBER_FORMAT_REGEXP);\n if (parts === null) {\n throw new Error(`${digitsInfo} is not a valid digit info`);\n }\n const minIntPart = parts[1];\n const minFractionPart = parts[3];\n const maxFractionPart = parts[5];\n if (minIntPart != null) {\n minInt = parseIntAutoRadix(minIntPart);\n }\n if (minFractionPart != null) {\n minFraction = parseIntAutoRadix(minFractionPart);\n }\n if (maxFractionPart != null) {\n maxFraction = parseIntAutoRadix(maxFractionPart);\n }\n else if (minFractionPart != null && minFraction > maxFraction) {\n maxFraction = minFraction;\n }\n }\n roundNumber(parsedNumber, minFraction, maxFraction);\n let digits = parsedNumber.digits;\n let integerLen = parsedNumber.integerLen;\n const exponent = parsedNumber.exponent;\n let decimals = [];\n isZero = digits.every((d) => !d);\n // pad zeros for small numbers\n for (; integerLen < minInt; integerLen++) {\n digits.unshift(0);\n }\n // pad zeros for small numbers\n for (; integerLen < 0; integerLen++) {\n digits.unshift(0);\n }\n // extract decimals digits\n if (integerLen > 0) {\n decimals = digits.splice(integerLen, digits.length);\n }\n else {\n decimals = digits;\n digits = [0];\n }\n // format the integer digits with grouping separators\n const groups = [];\n if (digits.length >= pattern.lgSize) {\n groups.unshift(digits.splice(-pattern.lgSize, digits.length).join(''));\n }\n while (digits.length > pattern.gSize) {\n groups.unshift(digits.splice(-pattern.gSize, digits.length).join(''));\n }\n if (digits.length) {\n groups.unshift(digits.join(''));\n }\n formattedText = groups.join(getLocaleNumberSymbol(locale, groupSymbol));\n // append the decimal digits\n if (decimals.length) {\n formattedText += getLocaleNumberSymbol(locale, decimalSymbol) + decimals.join('');\n }\n if (exponent) {\n formattedText += getLocaleNumberSymbol(locale, NumberSymbol.Exponential) + '+' + exponent;\n }\n }\n if (value < 0 && !isZero) {\n formattedText = pattern.negPre + formattedText + pattern.negSuf;\n }\n else {\n formattedText = pattern.posPre + formattedText + pattern.posSuf;\n }\n return formattedText;\n}\n/**\n * @ngModule CommonModule\n * @description\n *\n * Formats a number as currency using locale rules.\n *\n * @param value The number to format.\n * @param locale A locale code for the locale format rules to use.\n * @param currency A string containing the currency symbol or its name,\n * such as \"$\" or \"Canadian Dollar\". Used in output string, but does not affect the operation\n * of the function.\n * @param currencyCode The [ISO 4217](https://en.wikipedia.org/wiki/ISO_4217)\n * currency code, such as `USD` for the US dollar and `EUR` for the euro.\n * Used to determine the number of digits in the decimal part.\n * @param digitsInfo Decimal representation options, specified by a string in the following format:\n * `{minIntegerDigits}.{minFractionDigits}-{maxFractionDigits}`. See `DecimalPipe` for more details.\n *\n * @returns The formatted currency value.\n *\n * @see {@link formatNumber}\n * @see {@link DecimalPipe}\n * @see [Internationalization (i18n) Guide](guide/i18n)\n *\n * @publicApi\n */\nfunction formatCurrency(value, locale, currency, currencyCode, digitsInfo) {\n const format = getLocaleNumberFormat(locale, NumberFormatStyle.Currency);\n const pattern = parseNumberFormat(format, getLocaleNumberSymbol(locale, NumberSymbol.MinusSign));\n pattern.minFrac = getNumberOfCurrencyDigits(currencyCode);\n pattern.maxFrac = pattern.minFrac;\n const res = formatNumberToLocaleString(value, pattern, locale, NumberSymbol.CurrencyGroup, NumberSymbol.CurrencyDecimal, digitsInfo);\n return (res\n .replace(CURRENCY_CHAR, currency)\n // if we have 2 time the currency character, the second one is ignored\n .replace(CURRENCY_CHAR, '')\n // If there is a spacing between currency character and the value and\n // the currency character is suppressed by passing an empty string, the\n // spacing character would remain as part of the string. Then we\n // should remove it.\n .trim());\n}\n/**\n * @ngModule CommonModule\n * @description\n *\n * Formats a number as a percentage according to locale rules.\n *\n * @param value The number to format.\n * @param locale A locale code for the locale format rules to use.\n * @param digitsInfo Decimal representation options, specified by a string in the following format:\n * `{minIntegerDigits}.{minFractionDigits}-{maxFractionDigits}`. See `DecimalPipe` for more details.\n *\n * @returns The formatted percentage value.\n *\n * @see {@link formatNumber}\n * @see {@link DecimalPipe}\n * @see [Internationalization (i18n) Guide](guide/i18n)\n * @publicApi\n *\n */\nfunction formatPercent(value, locale, digitsInfo) {\n const format = getLocaleNumberFormat(locale, NumberFormatStyle.Percent);\n const pattern = parseNumberFormat(format, getLocaleNumberSymbol(locale, NumberSymbol.MinusSign));\n const res = formatNumberToLocaleString(value, pattern, locale, NumberSymbol.Group, NumberSymbol.Decimal, digitsInfo, true);\n return res.replace(new RegExp(PERCENT_CHAR, 'g'), getLocaleNumberSymbol(locale, NumberSymbol.PercentSign));\n}\n/**\n * @ngModule CommonModule\n * @description\n *\n * Formats a number as text, with group sizing, separator, and other\n * parameters based on the locale.\n *\n * @param value The number to format.\n * @param locale A locale code for the locale format rules to use.\n * @param digitsInfo Decimal representation options, specified by a string in the following format:\n * `{minIntegerDigits}.{minFractionDigits}-{maxFractionDigits}`. See `DecimalPipe` for more details.\n *\n * @returns The formatted text string.\n * @see [Internationalization (i18n) Guide](guide/i18n)\n *\n * @publicApi\n */\nfunction formatNumber(value, locale, digitsInfo) {\n const format = getLocaleNumberFormat(locale, NumberFormatStyle.Decimal);\n const pattern = parseNumberFormat(format, getLocaleNumberSymbol(locale, NumberSymbol.MinusSign));\n return formatNumberToLocaleString(value, pattern, locale, NumberSymbol.Group, NumberSymbol.Decimal, digitsInfo);\n}\nfunction parseNumberFormat(format, minusSign = '-') {\n const p = {\n minInt: 1,\n minFrac: 0,\n maxFrac: 0,\n posPre: '',\n posSuf: '',\n negPre: '',\n negSuf: '',\n gSize: 0,\n lgSize: 0,\n };\n const patternParts = format.split(PATTERN_SEP);\n const positive = patternParts[0];\n const negative = patternParts[1];\n const positiveParts = positive.indexOf(DECIMAL_SEP) !== -1\n ? positive.split(DECIMAL_SEP)\n : [\n positive.substring(0, positive.lastIndexOf(ZERO_CHAR) + 1),\n positive.substring(positive.lastIndexOf(ZERO_CHAR) + 1),\n ], integer = positiveParts[0], fraction = positiveParts[1] || '';\n p.posPre = integer.substring(0, integer.indexOf(DIGIT_CHAR));\n for (let i = 0; i < fraction.length; i++) {\n const ch = fraction.charAt(i);\n if (ch === ZERO_CHAR) {\n p.minFrac = p.maxFrac = i + 1;\n }\n else if (ch === DIGIT_CHAR) {\n p.maxFrac = i + 1;\n }\n else {\n p.posSuf += ch;\n }\n }\n const groups = integer.split(GROUP_SEP);\n p.gSize = groups[1] ? groups[1].length : 0;\n p.lgSize = groups[2] || groups[1] ? (groups[2] || groups[1]).length : 0;\n if (negative) {\n const trunkLen = positive.length - p.posPre.length - p.posSuf.length, pos = negative.indexOf(DIGIT_CHAR);\n p.negPre = negative.substring(0, pos).replace(/'/g, '');\n p.negSuf = negative.slice(pos + trunkLen).replace(/'/g, '');\n }\n else {\n p.negPre = minusSign + p.posPre;\n p.negSuf = p.posSuf;\n }\n return p;\n}\n// Transforms a parsed number into a percentage by multiplying it by 100\nfunction toPercent(parsedNumber) {\n // if the number is 0, don't do anything\n if (parsedNumber.digits[0] === 0) {\n return parsedNumber;\n }\n // Getting the current number of decimals\n const fractionLen = parsedNumber.digits.length - parsedNumber.integerLen;\n if (parsedNumber.exponent) {\n parsedNumber.exponent += 2;\n }\n else {\n if (fractionLen === 0) {\n parsedNumber.digits.push(0, 0);\n }\n else if (fractionLen === 1) {\n parsedNumber.digits.push(0);\n }\n parsedNumber.integerLen += 2;\n }\n return parsedNumber;\n}\n/**\n * Parses a number.\n * Significant bits of this parse algorithm came from https://github.com/MikeMcl/big.js/\n */\nfunction parseNumber(num) {\n let numStr = Math.abs(num) + '';\n let exponent = 0, digits, integerLen;\n let i, j, zeros;\n // Decimal point?\n if ((integerLen = numStr.indexOf(DECIMAL_SEP)) > -1) {\n numStr = numStr.replace(DECIMAL_SEP, '');\n }\n // Exponential form?\n if ((i = numStr.search(/e/i)) > 0) {\n // Work out the exponent.\n if (integerLen < 0)\n integerLen = i;\n integerLen += +numStr.slice(i + 1);\n numStr = numStr.substring(0, i);\n }\n else if (integerLen < 0) {\n // There was no decimal point or exponent so it is an integer.\n integerLen = numStr.length;\n }\n // Count the number of leading zeros.\n for (i = 0; numStr.charAt(i) === ZERO_CHAR; i++) {\n /* empty */\n }\n if (i === (zeros = numStr.length)) {\n // The digits are all zero.\n digits = [0];\n integerLen = 1;\n }\n else {\n // Count the number of trailing zeros\n zeros--;\n while (numStr.charAt(zeros) === ZERO_CHAR)\n zeros--;\n // Trailing zeros are insignificant so ignore them\n integerLen -= i;\n digits = [];\n // Convert string to array of digits without leading/trailing zeros.\n for (j = 0; i <= zeros; i++, j++) {\n digits[j] = Number(numStr.charAt(i));\n }\n }\n // If the number overflows the maximum allowed digits then use an exponent.\n if (integerLen > MAX_DIGITS) {\n digits = digits.splice(0, MAX_DIGITS - 1);\n exponent = integerLen - 1;\n integerLen = 1;\n }\n return { digits, exponent, integerLen };\n}\n/**\n * Round the parsed number to the specified number of decimal places\n * This function changes the parsedNumber in-place\n */\nfunction roundNumber(parsedNumber, minFrac, maxFrac) {\n if (minFrac > maxFrac) {\n throw new Error(`The minimum number of digits after fraction (${minFrac}) is higher than the maximum (${maxFrac}).`);\n }\n let digits = parsedNumber.digits;\n let fractionLen = digits.length - parsedNumber.integerLen;\n const fractionSize = Math.min(Math.max(minFrac, fractionLen), maxFrac);\n // The index of the digit to where rounding is to occur\n let roundAt = fractionSize + parsedNumber.integerLen;\n let digit = digits[roundAt];\n if (roundAt > 0) {\n // Drop fractional digits beyond `roundAt`\n digits.splice(Math.max(parsedNumber.integerLen, roundAt));\n // Set non-fractional digits beyond `roundAt` to 0\n for (let j = roundAt; j < digits.length; j++) {\n digits[j] = 0;\n }\n }\n else {\n // We rounded to zero so reset the parsedNumber\n fractionLen = Math.max(0, fractionLen);\n parsedNumber.integerLen = 1;\n digits.length = Math.max(1, (roundAt = fractionSize + 1));\n digits[0] = 0;\n for (let i = 1; i < roundAt; i++)\n digits[i] = 0;\n }\n if (digit >= 5) {\n if (roundAt - 1 < 0) {\n for (let k = 0; k > roundAt; k--) {\n digits.unshift(0);\n parsedNumber.integerLen++;\n }\n digits.unshift(1);\n parsedNumber.integerLen++;\n }\n else {\n digits[roundAt - 1]++;\n }\n }\n // Pad out with zeros to get the required fraction length\n for (; fractionLen < Math.max(0, fractionSize); fractionLen++)\n digits.push(0);\n let dropTrailingZeros = fractionSize !== 0;\n // Minimal length = nb of decimals required + current nb of integers\n // Any number besides that is optional and can be removed if it's a trailing 0\n const minLen = minFrac + parsedNumber.integerLen;\n // Do any carrying, e.g. a digit was rounded up to 10\n const carry = digits.reduceRight(function (carry, d, i, digits) {\n d = d + carry;\n digits[i] = d < 10 ? d : d - 10; // d % 10\n if (dropTrailingZeros) {\n // Do not keep meaningless fractional trailing zeros (e.g. 15.52000 --> 15.52)\n if (digits[i] === 0 && i >= minLen) {\n digits.pop();\n }\n else {\n dropTrailingZeros = false;\n }\n }\n return d >= 10 ? 1 : 0; // Math.floor(d / 10);\n }, 0);\n if (carry) {\n digits.unshift(carry);\n parsedNumber.integerLen++;\n }\n}\nfunction parseIntAutoRadix(text) {\n const result = parseInt(text);\n if (isNaN(result)) {\n throw new Error('Invalid integer literal when parsing ' + text);\n }\n return result;\n}\n\n/**\n * @publicApi\n */\nclass NgLocalization {\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0\", ngImport: i0, type: NgLocalization, deps: [], target: i0.ɵɵFactoryTarget.Injectable }); }\n static { this.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"18.2.0\", ngImport: i0, type: NgLocalization, providedIn: 'root', useFactory: (locale) => new NgLocaleLocalization(locale), deps: [{ token: LOCALE_ID }] }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0\", ngImport: i0, type: NgLocalization, decorators: [{\n type: Injectable,\n args: [{\n providedIn: 'root',\n useFactory: (locale) => new NgLocaleLocalization(locale),\n deps: [LOCALE_ID],\n }]\n }] });\n/**\n * Returns the plural category for a given value.\n * - \"=value\" when the case exists,\n * - the plural category otherwise\n */\nfunction getPluralCategory(value, cases, ngLocalization, locale) {\n let key = `=${value}`;\n if (cases.indexOf(key) > -1) {\n return key;\n }\n key = ngLocalization.getPluralCategory(value, locale);\n if (cases.indexOf(key) > -1) {\n return key;\n }\n if (cases.indexOf('other') > -1) {\n return 'other';\n }\n throw new Error(`No plural message found for value \"${value}\"`);\n}\n/**\n * Returns the plural case based on the locale\n *\n * @publicApi\n */\nclass NgLocaleLocalization extends NgLocalization {\n constructor(locale) {\n super();\n this.locale = locale;\n }\n getPluralCategory(value, locale) {\n const plural = getLocalePluralCase(locale || this.locale)(value);\n switch (plural) {\n case Plural.Zero:\n return 'zero';\n case Plural.One:\n return 'one';\n case Plural.Two:\n return 'two';\n case Plural.Few:\n return 'few';\n case Plural.Many:\n return 'many';\n default:\n return 'other';\n }\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0\", ngImport: i0, type: NgLocaleLocalization, deps: [{ token: LOCALE_ID }], target: i0.ɵɵFactoryTarget.Injectable }); }\n static { this.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"18.2.0\", ngImport: i0, type: NgLocaleLocalization }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0\", ngImport: i0, type: NgLocaleLocalization, decorators: [{\n type: Injectable\n }], ctorParameters: () => [{ type: undefined, decorators: [{\n type: Inject,\n args: [LOCALE_ID]\n }] }] });\n\n/**\n * Register global data to be used internally by Angular. See the\n * [\"I18n guide\"](guide/i18n/format-data-locale) to know how to import additional locale\n * data.\n *\n * The signature registerLocaleData(data: any, extraData?: any) is deprecated since v5.1\n *\n * @publicApi\n */\nfunction registerLocaleData(data, localeId, extraData) {\n return ɵregisterLocaleData(data, localeId, extraData);\n}\n\nfunction parseCookieValue(cookieStr, name) {\n name = encodeURIComponent(name);\n for (const cookie of cookieStr.split(';')) {\n const eqIndex = cookie.indexOf('=');\n const [cookieName, cookieValue] = eqIndex == -1 ? [cookie, ''] : [cookie.slice(0, eqIndex), cookie.slice(eqIndex + 1)];\n if (cookieName.trim() === name) {\n return decodeURIComponent(cookieValue);\n }\n }\n return null;\n}\n\nconst WS_REGEXP = /\\s+/;\nconst EMPTY_ARRAY = [];\n/**\n * @ngModule CommonModule\n *\n * @usageNotes\n * ```\n * ... \n *\n * ... \n *\n * ... \n *\n * ... \n *\n * ... \n * ```\n *\n * @description\n *\n * Adds and removes CSS classes on an HTML element.\n *\n * The CSS classes are updated as follows, depending on the type of the expression evaluation:\n * - `string` - the CSS classes listed in the string (space delimited) are added,\n * - `Array` - the CSS classes declared as Array elements are added,\n * - `Object` - keys are CSS classes that get added when the expression given in the value\n * evaluates to a truthy value, otherwise they are removed.\n *\n * @publicApi\n */\nclass NgClass {\n constructor(_ngEl, _renderer) {\n this._ngEl = _ngEl;\n this._renderer = _renderer;\n this.initialClasses = EMPTY_ARRAY;\n this.stateMap = new Map();\n }\n set klass(value) {\n this.initialClasses = value != null ? value.trim().split(WS_REGEXP) : EMPTY_ARRAY;\n }\n set ngClass(value) {\n this.rawClass = typeof value === 'string' ? value.trim().split(WS_REGEXP) : value;\n }\n /*\n The NgClass directive uses the custom change detection algorithm for its inputs. The custom\n algorithm is necessary since inputs are represented as complex object or arrays that need to be\n deeply-compared.\n \n This algorithm is perf-sensitive since NgClass is used very frequently and its poor performance\n might negatively impact runtime performance of the entire change detection cycle. The design of\n this algorithm is making sure that:\n - there is no unnecessary DOM manipulation (CSS classes are added / removed from the DOM only when\n needed), even if references to bound objects change;\n - there is no memory allocation if nothing changes (even relatively modest memory allocation\n during the change detection cycle can result in GC pauses for some of the CD cycles).\n \n The algorithm works by iterating over the set of bound classes, staring with [class] binding and\n then going over [ngClass] binding. For each CSS class name:\n - check if it was seen before (this information is tracked in the state map) and if its value\n changed;\n - mark it as \"touched\" - names that are not marked are not present in the latest set of binding\n and we can remove such class name from the internal data structures;\n \n After iteration over all the CSS class names we've got data structure with all the information\n necessary to synchronize changes to the DOM - it is enough to iterate over the state map, flush\n changes to the DOM and reset internal data structures so those are ready for the next change\n detection cycle.\n */\n ngDoCheck() {\n // classes from the [class] binding\n for (const klass of this.initialClasses) {\n this._updateState(klass, true);\n }\n // classes from the [ngClass] binding\n const rawClass = this.rawClass;\n if (Array.isArray(rawClass) || rawClass instanceof Set) {\n for (const klass of rawClass) {\n this._updateState(klass, true);\n }\n }\n else if (rawClass != null) {\n for (const klass of Object.keys(rawClass)) {\n this._updateState(klass, Boolean(rawClass[klass]));\n }\n }\n this._applyStateDiff();\n }\n _updateState(klass, nextEnabled) {\n const state = this.stateMap.get(klass);\n if (state !== undefined) {\n if (state.enabled !== nextEnabled) {\n state.changed = true;\n state.enabled = nextEnabled;\n }\n state.touched = true;\n }\n else {\n this.stateMap.set(klass, { enabled: nextEnabled, changed: true, touched: true });\n }\n }\n _applyStateDiff() {\n for (const stateEntry of this.stateMap) {\n const klass = stateEntry[0];\n const state = stateEntry[1];\n if (state.changed) {\n this._toggleClass(klass, state.enabled);\n state.changed = false;\n }\n else if (!state.touched) {\n // A class that was previously active got removed from the new collection of classes -\n // remove from the DOM as well.\n if (state.enabled) {\n this._toggleClass(klass, false);\n }\n this.stateMap.delete(klass);\n }\n state.touched = false;\n }\n }\n _toggleClass(klass, enabled) {\n if (ngDevMode) {\n if (typeof klass !== 'string') {\n throw new Error(`NgClass can only toggle CSS classes expressed as strings, got ${ɵstringify(klass)}`);\n }\n }\n klass = klass.trim();\n if (klass.length > 0) {\n klass.split(WS_REGEXP).forEach((klass) => {\n if (enabled) {\n this._renderer.addClass(this._ngEl.nativeElement, klass);\n }\n else {\n this._renderer.removeClass(this._ngEl.nativeElement, klass);\n }\n });\n }\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0\", ngImport: i0, type: NgClass, deps: [{ token: i0.ElementRef }, { token: i0.Renderer2 }], target: i0.ɵɵFactoryTarget.Directive }); }\n static { this.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"18.2.0\", type: NgClass, isStandalone: true, selector: \"[ngClass]\", inputs: { klass: [\"class\", \"klass\"], ngClass: \"ngClass\" }, ngImport: i0 }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0\", ngImport: i0, type: NgClass, decorators: [{\n type: Directive,\n args: [{\n selector: '[ngClass]',\n standalone: true,\n }]\n }], ctorParameters: () => [{ type: i0.ElementRef }, { type: i0.Renderer2 }], propDecorators: { klass: [{\n type: Input,\n args: ['class']\n }], ngClass: [{\n type: Input,\n args: ['ngClass']\n }] } });\n\n/**\n * Instantiates a {@link Component} type and inserts its Host View into the current View.\n * `NgComponentOutlet` provides a declarative approach for dynamic component creation.\n *\n * `NgComponentOutlet` requires a component type, if a falsy value is set the view will clear and\n * any existing component will be destroyed.\n *\n * @usageNotes\n *\n * ### Fine tune control\n *\n * You can control the component creation process by using the following optional attributes:\n *\n * * `ngComponentOutletInputs`: Optional component inputs object, which will be bind to the\n * component.\n *\n * * `ngComponentOutletInjector`: Optional custom {@link Injector} that will be used as parent for\n * the Component. Defaults to the injector of the current view container.\n *\n * * `ngComponentOutletContent`: Optional list of projectable nodes to insert into the content\n * section of the component, if it exists.\n *\n * * `ngComponentOutletNgModule`: Optional NgModule class reference to allow loading another\n * module dynamically, then loading a component from that module.\n *\n * * `ngComponentOutletNgModuleFactory`: Deprecated config option that allows providing optional\n * NgModule factory to allow loading another module dynamically, then loading a component from that\n * module. Use `ngComponentOutletNgModule` instead.\n *\n * ### Syntax\n *\n * Simple\n * ```\n * \n * \n * ```\n *\n * Customized injector/content\n * ```\n * \n * \n * ```\n *\n * Customized NgModule reference\n * ```\n * \n * \n * ```\n *\n * ### A simple example\n *\n * {@example common/ngComponentOutlet/ts/module.ts region='SimpleExample'}\n *\n * A more complete example with additional options:\n *\n * {@example common/ngComponentOutlet/ts/module.ts region='CompleteExample'}\n *\n * @publicApi\n * @ngModule CommonModule\n */\nclass NgComponentOutlet {\n constructor(_viewContainerRef) {\n this._viewContainerRef = _viewContainerRef;\n this.ngComponentOutlet = null;\n /**\n * A helper data structure that allows us to track inputs that were part of the\n * ngComponentOutletInputs expression. Tracking inputs is necessary for proper removal of ones\n * that are no longer referenced.\n */\n this._inputsUsed = new Map();\n }\n _needToReCreateNgModuleInstance(changes) {\n // Note: square brackets property accessor is safe for Closure compiler optimizations (the\n // `changes` argument of the `ngOnChanges` lifecycle hook retains the names of the fields that\n // were changed).\n return (changes['ngComponentOutletNgModule'] !== undefined ||\n changes['ngComponentOutletNgModuleFactory'] !== undefined);\n }\n _needToReCreateComponentInstance(changes) {\n // Note: square brackets property accessor is safe for Closure compiler optimizations (the\n // `changes` argument of the `ngOnChanges` lifecycle hook retains the names of the fields that\n // were changed).\n return (changes['ngComponentOutlet'] !== undefined ||\n changes['ngComponentOutletContent'] !== undefined ||\n changes['ngComponentOutletInjector'] !== undefined ||\n this._needToReCreateNgModuleInstance(changes));\n }\n /** @nodoc */\n ngOnChanges(changes) {\n if (this._needToReCreateComponentInstance(changes)) {\n this._viewContainerRef.clear();\n this._inputsUsed.clear();\n this._componentRef = undefined;\n if (this.ngComponentOutlet) {\n const injector = this.ngComponentOutletInjector || this._viewContainerRef.parentInjector;\n if (this._needToReCreateNgModuleInstance(changes)) {\n this._moduleRef?.destroy();\n if (this.ngComponentOutletNgModule) {\n this._moduleRef = createNgModule(this.ngComponentOutletNgModule, getParentInjector(injector));\n }\n else if (this.ngComponentOutletNgModuleFactory) {\n this._moduleRef = this.ngComponentOutletNgModuleFactory.create(getParentInjector(injector));\n }\n else {\n this._moduleRef = undefined;\n }\n }\n this._componentRef = this._viewContainerRef.createComponent(this.ngComponentOutlet, {\n injector,\n ngModuleRef: this._moduleRef,\n projectableNodes: this.ngComponentOutletContent,\n });\n }\n }\n }\n /** @nodoc */\n ngDoCheck() {\n if (this._componentRef) {\n if (this.ngComponentOutletInputs) {\n for (const inputName of Object.keys(this.ngComponentOutletInputs)) {\n this._inputsUsed.set(inputName, true);\n }\n }\n this._applyInputStateDiff(this._componentRef);\n }\n }\n /** @nodoc */\n ngOnDestroy() {\n this._moduleRef?.destroy();\n }\n _applyInputStateDiff(componentRef) {\n for (const [inputName, touched] of this._inputsUsed) {\n if (!touched) {\n // The input that was previously active no longer exists and needs to be set to undefined.\n componentRef.setInput(inputName, undefined);\n this._inputsUsed.delete(inputName);\n }\n else {\n // Since touched is true, it can be asserted that the inputs object is not empty.\n componentRef.setInput(inputName, this.ngComponentOutletInputs[inputName]);\n this._inputsUsed.set(inputName, false);\n }\n }\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0\", ngImport: i0, type: NgComponentOutlet, deps: [{ token: i0.ViewContainerRef }], target: i0.ɵɵFactoryTarget.Directive }); }\n static { this.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"18.2.0\", type: NgComponentOutlet, isStandalone: true, selector: \"[ngComponentOutlet]\", inputs: { ngComponentOutlet: \"ngComponentOutlet\", ngComponentOutletInputs: \"ngComponentOutletInputs\", ngComponentOutletInjector: \"ngComponentOutletInjector\", ngComponentOutletContent: \"ngComponentOutletContent\", ngComponentOutletNgModule: \"ngComponentOutletNgModule\", ngComponentOutletNgModuleFactory: \"ngComponentOutletNgModuleFactory\" }, usesOnChanges: true, ngImport: i0 }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0\", ngImport: i0, type: NgComponentOutlet, decorators: [{\n type: Directive,\n args: [{\n selector: '[ngComponentOutlet]',\n standalone: true,\n }]\n }], ctorParameters: () => [{ type: i0.ViewContainerRef }], propDecorators: { ngComponentOutlet: [{\n type: Input\n }], ngComponentOutletInputs: [{\n type: Input\n }], ngComponentOutletInjector: [{\n type: Input\n }], ngComponentOutletContent: [{\n type: Input\n }], ngComponentOutletNgModule: [{\n type: Input\n }], ngComponentOutletNgModuleFactory: [{\n type: Input\n }] } });\n// Helper function that returns an Injector instance of a parent NgModule.\nfunction getParentInjector(injector) {\n const parentNgModule = injector.get(NgModuleRef);\n return parentNgModule.injector;\n}\n\n/**\n * @publicApi\n */\nclass NgForOfContext {\n constructor($implicit, ngForOf, index, count) {\n this.$implicit = $implicit;\n this.ngForOf = ngForOf;\n this.index = index;\n this.count = count;\n }\n get first() {\n return this.index === 0;\n }\n get last() {\n return this.index === this.count - 1;\n }\n get even() {\n return this.index % 2 === 0;\n }\n get odd() {\n return !this.even;\n }\n}\n/**\n * A [structural directive](guide/directives/structural-directives) that renders\n * a template for each item in a collection.\n * The directive is placed on an element, which becomes the parent\n * of the cloned templates.\n *\n * The `ngForOf` directive is generally used in the\n * [shorthand form](guide/directives/structural-directives#asterisk) `*ngFor`.\n * In this form, the template to be rendered for each iteration is the content\n * of an anchor element containing the directive.\n *\n * The following example shows the shorthand syntax with some options,\n * contained in an `` element.\n *\n * ```\n * ... \n * ```\n *\n * The shorthand form expands into a long form that uses the `ngForOf` selector\n * on an `` element.\n * The content of the `` element is the `` element that held the\n * short-form directive.\n *\n * Here is the expanded version of the short-form example.\n *\n * ```\n * \n * ... \n * \n * ```\n *\n * Angular automatically expands the shorthand syntax as it compiles the template.\n * The context for each embedded view is logically merged to the current component\n * context according to its lexical position.\n *\n * When using the shorthand syntax, Angular allows only [one structural directive\n * on an element](guide/directives/structural-directives#one-per-element).\n * If you want to iterate conditionally, for example,\n * put the `*ngIf` on a container element that wraps the `*ngFor` element.\n * For further discussion, see\n * [Structural Directives](guide/directives/structural-directives#one-per-element).\n *\n * @usageNotes\n *\n * ### Local variables\n *\n * `NgForOf` provides exported values that can be aliased to local variables.\n * For example:\n *\n * ```\n * \n * {{i}}/{{users.length}}. {{user}} default \n * \n * ```\n *\n * The following exported values can be aliased to local variables:\n *\n * - `$implicit: T`: The value of the individual items in the iterable (`ngForOf`).\n * - `ngForOf: NgIterable`: The value of the iterable expression. Useful when the expression is\n * more complex then a property access, for example when using the async pipe (`userStreams |\n * async`).\n * - `index: number`: The index of the current item in the iterable.\n * - `count: number`: The length of the iterable.\n * - `first: boolean`: True when the item is the first item in the iterable.\n * - `last: boolean`: True when the item is the last item in the iterable.\n * - `even: boolean`: True when the item has an even index in the iterable.\n * - `odd: boolean`: True when the item has an odd index in the iterable.\n *\n * ### Change propagation\n *\n * When the contents of the iterator changes, `NgForOf` makes the corresponding changes to the DOM:\n *\n * * When an item is added, a new instance of the template is added to the DOM.\n * * When an item is removed, its template instance is removed from the DOM.\n * * When items are reordered, their respective templates are reordered in the DOM.\n *\n * Angular uses object identity to track insertions and deletions within the iterator and reproduce\n * those changes in the DOM. This has important implications for animations and any stateful\n * controls that are present, such as `>> once we move to TS v2.1\n // The current type is too restrictive; a template that just uses index, for example,\n // should be acceptable.\n if (value) {\n this._template = value;\n }\n }\n /**\n * Applies the changes when needed.\n * @nodoc\n */\n ngDoCheck() {\n if (this._ngForOfDirty) {\n this._ngForOfDirty = false;\n // React on ngForOf changes only once all inputs have been initialized\n const value = this._ngForOf;\n if (!this._differ && value) {\n if (typeof ngDevMode === 'undefined' || ngDevMode) {\n try {\n // CAUTION: this logic is duplicated for production mode below, as the try-catch\n // is only present in development builds.\n this._differ = this._differs.find(value).create(this.ngForTrackBy);\n }\n catch {\n let errorMessage = `Cannot find a differ supporting object '${value}' of type '` +\n `${getTypeName(value)}'. NgFor only supports binding to Iterables, such as Arrays.`;\n if (typeof value === 'object') {\n errorMessage += ' Did you mean to use the keyvalue pipe?';\n }\n throw new ɵRuntimeError(-2200 /* RuntimeErrorCode.NG_FOR_MISSING_DIFFER */, errorMessage);\n }\n }\n else {\n // CAUTION: this logic is duplicated for development mode above, as the try-catch\n // is only present in development builds.\n this._differ = this._differs.find(value).create(this.ngForTrackBy);\n }\n }\n }\n if (this._differ) {\n const changes = this._differ.diff(this._ngForOf);\n if (changes)\n this._applyChanges(changes);\n }\n }\n _applyChanges(changes) {\n const viewContainer = this._viewContainer;\n changes.forEachOperation((item, adjustedPreviousIndex, currentIndex) => {\n if (item.previousIndex == null) {\n // NgForOf is never \"null\" or \"undefined\" here because the differ detected\n // that a new item needs to be inserted from the iterable. This implies that\n // there is an iterable value for \"_ngForOf\".\n viewContainer.createEmbeddedView(this._template, new NgForOfContext(item.item, this._ngForOf, -1, -1), currentIndex === null ? undefined : currentIndex);\n }\n else if (currentIndex == null) {\n viewContainer.remove(adjustedPreviousIndex === null ? undefined : adjustedPreviousIndex);\n }\n else if (adjustedPreviousIndex !== null) {\n const view = viewContainer.get(adjustedPreviousIndex);\n viewContainer.move(view, currentIndex);\n applyViewChange(view, item);\n }\n });\n for (let i = 0, ilen = viewContainer.length; i < ilen; i++) {\n const viewRef = viewContainer.get(i);\n const context = viewRef.context;\n context.index = i;\n context.count = ilen;\n context.ngForOf = this._ngForOf;\n }\n changes.forEachIdentityChange((record) => {\n const viewRef = viewContainer.get(record.currentIndex);\n applyViewChange(viewRef, record);\n });\n }\n /**\n * Asserts the correct type of the context for the template that `NgForOf` will render.\n *\n * The presence of this method is a signal to the Ivy template type-check compiler that the\n * `NgForOf` structural directive renders its template with a specific context type.\n */\n static ngTemplateContextGuard(dir, ctx) {\n return true;\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0\", ngImport: i0, type: NgForOf, deps: [{ token: i0.ViewContainerRef }, { token: i0.TemplateRef }, { token: i0.IterableDiffers }], target: i0.ɵɵFactoryTarget.Directive }); }\n static { this.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"18.2.0\", type: NgForOf, isStandalone: true, selector: \"[ngFor][ngForOf]\", inputs: { ngForOf: \"ngForOf\", ngForTrackBy: \"ngForTrackBy\", ngForTemplate: \"ngForTemplate\" }, ngImport: i0 }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0\", ngImport: i0, type: NgForOf, decorators: [{\n type: Directive,\n args: [{\n selector: '[ngFor][ngForOf]',\n standalone: true,\n }]\n }], ctorParameters: () => [{ type: i0.ViewContainerRef }, { type: i0.TemplateRef }, { type: i0.IterableDiffers }], propDecorators: { ngForOf: [{\n type: Input\n }], ngForTrackBy: [{\n type: Input\n }], ngForTemplate: [{\n type: Input\n }] } });\nfunction applyViewChange(view, record) {\n view.context.$implicit = record.item;\n}\nfunction getTypeName(type) {\n return type['name'] || typeof type;\n}\n\n/**\n * A structural directive that conditionally includes a template based on the value of\n * an expression coerced to Boolean.\n * When the expression evaluates to true, Angular renders the template\n * provided in a `then` clause, and when false or null,\n * Angular renders the template provided in an optional `else` clause. The default\n * template for the `else` clause is blank.\n *\n * A [shorthand form](guide/directives/structural-directives#asterisk) of the directive,\n * `*ngIf=\"condition\"`, is generally used, provided\n * as an attribute of the anchor element for the inserted template.\n * Angular expands this into a more explicit version, in which the anchor element\n * is contained in an `` element.\n *\n * Simple form with shorthand syntax:\n *\n * ```\n * Content to render when condition is true.
\n * ```\n *\n * Simple form with expanded syntax:\n *\n * ```\n * Content to render when condition is\n * true.
Content to render when condition is true.
\n * Content to render when condition is false. \n * ```\n *\n * Shorthand form with \"then\" and \"else\" blocks:\n *\n * ```\n *
\n * Content to render when condition is true. \n * Content to render when condition is false. \n * ```\n *\n * Form with storing the value locally:\n *\n * ```\n * {{value}}
\n * Content to render when value is null. \n * ```\n *\n * @usageNotes\n *\n * The `*ngIf` directive is most commonly used to conditionally show an inline template,\n * as seen in the following example.\n * The default `else` template is blank.\n *\n * {@example common/ngIf/ts/module.ts region='NgIfSimple'}\n *\n * ### Showing an alternative template using `else`\n *\n * To display a template when `expression` evaluates to false, use an `else` template\n * binding as shown in the following example.\n * The `else` binding points to an `` element labeled `#elseBlock`.\n * The template can be defined anywhere in the component view, but is typically placed right after\n * `ngIf` for readability.\n *\n * {@example common/ngIf/ts/module.ts region='NgIfElse'}\n *\n * ### Using an external `then` template\n *\n * In the previous example, the then-clause template is specified inline, as the content of the\n * tag that contains the `ngIf` directive. You can also specify a template that is defined\n * externally, by referencing a labeled `` element. When you do this, you can\n * change which template to use at runtime, as shown in the following example.\n *\n * {@example common/ngIf/ts/module.ts region='NgIfThenElse'}\n *\n * ### Storing a conditional result in a variable\n *\n * You might want to show a set of properties from the same object. If you are waiting\n * for asynchronous data, the object can be undefined.\n * In this case, you can use `ngIf` and store the result of the condition in a local\n * variable as shown in the following example.\n *\n * {@example common/ngIf/ts/module.ts region='NgIfAs'}\n *\n * This code uses only one `AsyncPipe`, so only one subscription is created.\n * The conditional statement stores the result of `userStream|async` in the local variable `user`.\n * You can then bind the local `user` repeatedly.\n *\n * The conditional displays the data only if `userStream` returns a value,\n * so you don't need to use the\n * safe-navigation-operator (`?.`)\n * to guard against null values when accessing properties.\n * You can display an alternative template while waiting for the data.\n *\n * ### Shorthand syntax\n *\n * The shorthand syntax `*ngIf` expands into two separate template specifications\n * for the \"then\" and \"else\" clauses. For example, consider the following shorthand statement,\n * that is meant to show a loading page while waiting for data to be loaded.\n *\n * ```\n * \n * ...\n *
\n *\n * \n * Loading...
\n * \n * ```\n *\n * You can see that the \"else\" clause references the ``\n * with the `#loading` label, and the template for the \"then\" clause\n * is provided as the content of the anchor element.\n *\n * However, when Angular expands the shorthand syntax, it creates\n * another `` tag, with `ngIf` and `ngIfElse` directives.\n * The anchor element containing the template for the \"then\" clause becomes\n * the content of this unlabeled `` tag.\n *\n * ```\n * \n * \n * ...\n *
\n * \n *\n * \n * Loading...
\n * \n * ```\n *\n * The presence of the implicit template object has implications for the nesting of\n * structural directives. For more on this subject, see\n * [Structural Directives](guide/directives/structural-directives#one-per-element).\n *\n * @ngModule CommonModule\n * @publicApi\n */\nclass NgIf {\n constructor(_viewContainer, templateRef) {\n this._viewContainer = _viewContainer;\n this._context = new NgIfContext();\n this._thenTemplateRef = null;\n this._elseTemplateRef = null;\n this._thenViewRef = null;\n this._elseViewRef = null;\n this._thenTemplateRef = templateRef;\n }\n /**\n * The Boolean expression to evaluate as the condition for showing a template.\n */\n set ngIf(condition) {\n this._context.$implicit = this._context.ngIf = condition;\n this._updateView();\n }\n /**\n * A template to show if the condition expression evaluates to true.\n */\n set ngIfThen(templateRef) {\n assertTemplate('ngIfThen', templateRef);\n this._thenTemplateRef = templateRef;\n this._thenViewRef = null; // clear previous view if any.\n this._updateView();\n }\n /**\n * A template to show if the condition expression evaluates to false.\n */\n set ngIfElse(templateRef) {\n assertTemplate('ngIfElse', templateRef);\n this._elseTemplateRef = templateRef;\n this._elseViewRef = null; // clear previous view if any.\n this._updateView();\n }\n _updateView() {\n if (this._context.$implicit) {\n if (!this._thenViewRef) {\n this._viewContainer.clear();\n this._elseViewRef = null;\n if (this._thenTemplateRef) {\n this._thenViewRef = this._viewContainer.createEmbeddedView(this._thenTemplateRef, this._context);\n }\n }\n }\n else {\n if (!this._elseViewRef) {\n this._viewContainer.clear();\n this._thenViewRef = null;\n if (this._elseTemplateRef) {\n this._elseViewRef = this._viewContainer.createEmbeddedView(this._elseTemplateRef, this._context);\n }\n }\n }\n }\n /**\n * Asserts the correct type of the context for the template that `NgIf` will render.\n *\n * The presence of this method is a signal to the Ivy template type-check compiler that the\n * `NgIf` structural directive renders its template with a specific context type.\n */\n static ngTemplateContextGuard(dir, ctx) {\n return true;\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0\", ngImport: i0, type: NgIf, deps: [{ token: i0.ViewContainerRef }, { token: i0.TemplateRef }], target: i0.ɵɵFactoryTarget.Directive }); }\n static { this.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"18.2.0\", type: NgIf, isStandalone: true, selector: \"[ngIf]\", inputs: { ngIf: \"ngIf\", ngIfThen: \"ngIfThen\", ngIfElse: \"ngIfElse\" }, ngImport: i0 }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0\", ngImport: i0, type: NgIf, decorators: [{\n type: Directive,\n args: [{\n selector: '[ngIf]',\n standalone: true,\n }]\n }], ctorParameters: () => [{ type: i0.ViewContainerRef }, { type: i0.TemplateRef }], propDecorators: { ngIf: [{\n type: Input\n }], ngIfThen: [{\n type: Input\n }], ngIfElse: [{\n type: Input\n }] } });\n/**\n * @publicApi\n */\nclass NgIfContext {\n constructor() {\n this.$implicit = null;\n this.ngIf = null;\n }\n}\nfunction assertTemplate(property, templateRef) {\n const isTemplateRefOrNull = !!(!templateRef || templateRef.createEmbeddedView);\n if (!isTemplateRefOrNull) {\n throw new Error(`${property} must be a TemplateRef, but received '${ɵstringify(templateRef)}'.`);\n }\n}\n\nclass SwitchView {\n constructor(_viewContainerRef, _templateRef) {\n this._viewContainerRef = _viewContainerRef;\n this._templateRef = _templateRef;\n this._created = false;\n }\n create() {\n this._created = true;\n this._viewContainerRef.createEmbeddedView(this._templateRef);\n }\n destroy() {\n this._created = false;\n this._viewContainerRef.clear();\n }\n enforceState(created) {\n if (created && !this._created) {\n this.create();\n }\n else if (!created && this._created) {\n this.destroy();\n }\n }\n}\n/**\n * @ngModule CommonModule\n *\n * @description\n * The `[ngSwitch]` directive on a container specifies an expression to match against.\n * The expressions to match are provided by `ngSwitchCase` directives on views within the container.\n * - Every view that matches is rendered.\n * - If there are no matches, a view with the `ngSwitchDefault` directive is rendered.\n * - Elements within the `[NgSwitch]` statement but outside of any `NgSwitchCase`\n * or `ngSwitchDefault` directive are preserved at the location.\n *\n * @usageNotes\n * Define a container element for the directive, and specify the switch expression\n * to match against as an attribute:\n *\n * ```\n * \n * ```\n *\n * Within the container, `*ngSwitchCase` statements specify the match expressions\n * as attributes. Include `*ngSwitchDefault` as the final case.\n *\n * ```\n * \n * ... \n * ...\n * ... \n * \n * ```\n *\n * ### Usage Examples\n *\n * The following example shows how to use more than one case to display the same view:\n *\n * ```\n * \n * \n * ... \n * ... \n * ... \n * \n * ... \n * \n * ```\n *\n * The following example shows how cases can be nested:\n * ```\n * \n * ... \n * ... \n * ... \n * \n * \n * \n * ... \n * \n * ```\n *\n * @publicApi\n * @see {@link NgSwitchCase}\n * @see {@link NgSwitchDefault}\n * @see [Structural Directives](guide/directives/structural-directives)\n *\n */\nclass NgSwitch {\n constructor() {\n this._defaultViews = [];\n this._defaultUsed = false;\n this._caseCount = 0;\n this._lastCaseCheckIndex = 0;\n this._lastCasesMatched = false;\n }\n set ngSwitch(newValue) {\n this._ngSwitch = newValue;\n if (this._caseCount === 0) {\n this._updateDefaultCases(true);\n }\n }\n /** @internal */\n _addCase() {\n return this._caseCount++;\n }\n /** @internal */\n _addDefault(view) {\n this._defaultViews.push(view);\n }\n /** @internal */\n _matchCase(value) {\n const matched = value === this._ngSwitch;\n this._lastCasesMatched ||= matched;\n this._lastCaseCheckIndex++;\n if (this._lastCaseCheckIndex === this._caseCount) {\n this._updateDefaultCases(!this._lastCasesMatched);\n this._lastCaseCheckIndex = 0;\n this._lastCasesMatched = false;\n }\n return matched;\n }\n _updateDefaultCases(useDefault) {\n if (this._defaultViews.length > 0 && useDefault !== this._defaultUsed) {\n this._defaultUsed = useDefault;\n for (const defaultView of this._defaultViews) {\n defaultView.enforceState(useDefault);\n }\n }\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0\", ngImport: i0, type: NgSwitch, deps: [], target: i0.ɵɵFactoryTarget.Directive }); }\n static { this.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"18.2.0\", type: NgSwitch, isStandalone: true, selector: \"[ngSwitch]\", inputs: { ngSwitch: \"ngSwitch\" }, ngImport: i0 }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0\", ngImport: i0, type: NgSwitch, decorators: [{\n type: Directive,\n args: [{\n selector: '[ngSwitch]',\n standalone: true,\n }]\n }], propDecorators: { ngSwitch: [{\n type: Input\n }] } });\n/**\n * @ngModule CommonModule\n *\n * @description\n * Provides a switch case expression to match against an enclosing `ngSwitch` expression.\n * When the expressions match, the given `NgSwitchCase` template is rendered.\n * If multiple match expressions match the switch expression value, all of them are displayed.\n *\n * @usageNotes\n *\n * Within a switch container, `*ngSwitchCase` statements specify the match expressions\n * as attributes. Include `*ngSwitchDefault` as the final case.\n *\n * ```\n * \n * ... \n * ...\n * ... \n * \n * ```\n *\n * Each switch-case statement contains an in-line HTML template or template reference\n * that defines the subtree to be selected if the value of the match expression\n * matches the value of the switch expression.\n *\n * As of Angular v17 the NgSwitch directive uses strict equality comparison (`===`) instead of\n * loose equality (`==`) to match different cases.\n *\n * @publicApi\n * @see {@link NgSwitch}\n * @see {@link NgSwitchDefault}\n *\n */\nclass NgSwitchCase {\n constructor(viewContainer, templateRef, ngSwitch) {\n this.ngSwitch = ngSwitch;\n if ((typeof ngDevMode === 'undefined' || ngDevMode) && !ngSwitch) {\n throwNgSwitchProviderNotFoundError('ngSwitchCase', 'NgSwitchCase');\n }\n ngSwitch._addCase();\n this._view = new SwitchView(viewContainer, templateRef);\n }\n /**\n * Performs case matching. For internal use only.\n * @nodoc\n */\n ngDoCheck() {\n this._view.enforceState(this.ngSwitch._matchCase(this.ngSwitchCase));\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0\", ngImport: i0, type: NgSwitchCase, deps: [{ token: i0.ViewContainerRef }, { token: i0.TemplateRef }, { token: NgSwitch, host: true, optional: true }], target: i0.ɵɵFactoryTarget.Directive }); }\n static { this.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"18.2.0\", type: NgSwitchCase, isStandalone: true, selector: \"[ngSwitchCase]\", inputs: { ngSwitchCase: \"ngSwitchCase\" }, ngImport: i0 }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0\", ngImport: i0, type: NgSwitchCase, decorators: [{\n type: Directive,\n args: [{\n selector: '[ngSwitchCase]',\n standalone: true,\n }]\n }], ctorParameters: () => [{ type: i0.ViewContainerRef }, { type: i0.TemplateRef }, { type: NgSwitch, decorators: [{\n type: Optional\n }, {\n type: Host\n }] }], propDecorators: { ngSwitchCase: [{\n type: Input\n }] } });\n/**\n * @ngModule CommonModule\n *\n * @description\n *\n * Creates a view that is rendered when no `NgSwitchCase` expressions\n * match the `NgSwitch` expression.\n * This statement should be the final case in an `NgSwitch`.\n *\n * @publicApi\n * @see {@link NgSwitch}\n * @see {@link NgSwitchCase}\n *\n */\nclass NgSwitchDefault {\n constructor(viewContainer, templateRef, ngSwitch) {\n if ((typeof ngDevMode === 'undefined' || ngDevMode) && !ngSwitch) {\n throwNgSwitchProviderNotFoundError('ngSwitchDefault', 'NgSwitchDefault');\n }\n ngSwitch._addDefault(new SwitchView(viewContainer, templateRef));\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0\", ngImport: i0, type: NgSwitchDefault, deps: [{ token: i0.ViewContainerRef }, { token: i0.TemplateRef }, { token: NgSwitch, host: true, optional: true }], target: i0.ɵɵFactoryTarget.Directive }); }\n static { this.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"18.2.0\", type: NgSwitchDefault, isStandalone: true, selector: \"[ngSwitchDefault]\", ngImport: i0 }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0\", ngImport: i0, type: NgSwitchDefault, decorators: [{\n type: Directive,\n args: [{\n selector: '[ngSwitchDefault]',\n standalone: true,\n }]\n }], ctorParameters: () => [{ type: i0.ViewContainerRef }, { type: i0.TemplateRef }, { type: NgSwitch, decorators: [{\n type: Optional\n }, {\n type: Host\n }] }] });\nfunction throwNgSwitchProviderNotFoundError(attrName, directiveName) {\n throw new ɵRuntimeError(2000 /* RuntimeErrorCode.PARENT_NG_SWITCH_NOT_FOUND */, `An element with the \"${attrName}\" attribute ` +\n `(matching the \"${directiveName}\" directive) must be located inside an element with the \"ngSwitch\" attribute ` +\n `(matching \"NgSwitch\" directive)`);\n}\nfunction stringifyValue(value) {\n return typeof value === 'string' ? `'${value}'` : String(value);\n}\n\n/**\n * @ngModule CommonModule\n *\n * @usageNotes\n * ```\n * \n * there is nothing \n * there is one \n * there are a few \n * \n * ```\n *\n * @description\n *\n * Adds / removes DOM sub-trees based on a numeric value. Tailored for pluralization.\n *\n * Displays DOM sub-trees that match the switch expression value, or failing that, DOM sub-trees\n * that match the switch expression's pluralization category.\n *\n * To use this directive you must provide a container element that sets the `[ngPlural]` attribute\n * to a switch expression. Inner elements with a `[ngPluralCase]` will display based on their\n * expression:\n * - if `[ngPluralCase]` is set to a value starting with `=`, it will only display if the value\n * matches the switch expression exactly,\n * - otherwise, the view will be treated as a \"category match\", and will only display if exact\n * value matches aren't found and the value maps to its category for the defined locale.\n *\n * See http://cldr.unicode.org/index/cldr-spec/plural-rules\n *\n * @publicApi\n */\nclass NgPlural {\n constructor(_localization) {\n this._localization = _localization;\n this._caseViews = {};\n }\n set ngPlural(value) {\n this._updateView(value);\n }\n addCase(value, switchView) {\n this._caseViews[value] = switchView;\n }\n _updateView(switchValue) {\n this._clearViews();\n const cases = Object.keys(this._caseViews);\n const key = getPluralCategory(switchValue, cases, this._localization);\n this._activateView(this._caseViews[key]);\n }\n _clearViews() {\n if (this._activeView)\n this._activeView.destroy();\n }\n _activateView(view) {\n if (view) {\n this._activeView = view;\n this._activeView.create();\n }\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0\", ngImport: i0, type: NgPlural, deps: [{ token: NgLocalization }], target: i0.ɵɵFactoryTarget.Directive }); }\n static { this.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"18.2.0\", type: NgPlural, isStandalone: true, selector: \"[ngPlural]\", inputs: { ngPlural: \"ngPlural\" }, ngImport: i0 }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0\", ngImport: i0, type: NgPlural, decorators: [{\n type: Directive,\n args: [{\n selector: '[ngPlural]',\n standalone: true,\n }]\n }], ctorParameters: () => [{ type: NgLocalization }], propDecorators: { ngPlural: [{\n type: Input\n }] } });\n/**\n * @ngModule CommonModule\n *\n * @description\n *\n * Creates a view that will be added/removed from the parent {@link NgPlural} when the\n * given expression matches the plural expression according to CLDR rules.\n *\n * @usageNotes\n * ```\n * \n * ... \n * ... \n * \n *```\n *\n * See {@link NgPlural} for more details and example.\n *\n * @publicApi\n */\nclass NgPluralCase {\n constructor(value, template, viewContainer, ngPlural) {\n this.value = value;\n const isANumber = !isNaN(Number(value));\n ngPlural.addCase(isANumber ? `=${value}` : value, new SwitchView(viewContainer, template));\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0\", ngImport: i0, type: NgPluralCase, deps: [{ token: 'ngPluralCase', attribute: true }, { token: i0.TemplateRef }, { token: i0.ViewContainerRef }, { token: NgPlural, host: true }], target: i0.ɵɵFactoryTarget.Directive }); }\n static { this.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"18.2.0\", type: NgPluralCase, isStandalone: true, selector: \"[ngPluralCase]\", ngImport: i0 }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0\", ngImport: i0, type: NgPluralCase, decorators: [{\n type: Directive,\n args: [{\n selector: '[ngPluralCase]',\n standalone: true,\n }]\n }], ctorParameters: () => [{ type: undefined, decorators: [{\n type: Attribute,\n args: ['ngPluralCase']\n }] }, { type: i0.TemplateRef }, { type: i0.ViewContainerRef }, { type: NgPlural, decorators: [{\n type: Host\n }] }] });\n\n/**\n * @ngModule CommonModule\n *\n * @usageNotes\n *\n * Set the font of the containing element to the result of an expression.\n *\n * ```\n * ... \n * ```\n *\n * Set the width of the containing element to a pixel value returned by an expression.\n *\n * ```\n * ... \n * ```\n *\n * Set a collection of style values using an expression that returns key-value pairs.\n *\n * ```\n * ... \n * ```\n *\n * @description\n *\n * An attribute directive that updates styles for the containing HTML element.\n * Sets one or more style properties, specified as colon-separated key-value pairs.\n * The key is a style name, with an optional `.` suffix\n * (such as 'top.px', 'font-style.em').\n * The value is an expression to be evaluated.\n * The resulting non-null value, expressed in the given unit,\n * is assigned to the given style property.\n * If the result of evaluation is null, the corresponding style is removed.\n *\n * @publicApi\n */\nclass NgStyle {\n constructor(_ngEl, _differs, _renderer) {\n this._ngEl = _ngEl;\n this._differs = _differs;\n this._renderer = _renderer;\n this._ngStyle = null;\n this._differ = null;\n }\n set ngStyle(values) {\n this._ngStyle = values;\n if (!this._differ && values) {\n this._differ = this._differs.find(values).create();\n }\n }\n ngDoCheck() {\n if (this._differ) {\n const changes = this._differ.diff(this._ngStyle);\n if (changes) {\n this._applyChanges(changes);\n }\n }\n }\n _setStyle(nameAndUnit, value) {\n const [name, unit] = nameAndUnit.split('.');\n const flags = name.indexOf('-') === -1 ? undefined : RendererStyleFlags2.DashCase;\n if (value != null) {\n this._renderer.setStyle(this._ngEl.nativeElement, name, unit ? `${value}${unit}` : value, flags);\n }\n else {\n this._renderer.removeStyle(this._ngEl.nativeElement, name, flags);\n }\n }\n _applyChanges(changes) {\n changes.forEachRemovedItem((record) => this._setStyle(record.key, null));\n changes.forEachAddedItem((record) => this._setStyle(record.key, record.currentValue));\n changes.forEachChangedItem((record) => this._setStyle(record.key, record.currentValue));\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0\", ngImport: i0, type: NgStyle, deps: [{ token: i0.ElementRef }, { token: i0.KeyValueDiffers }, { token: i0.Renderer2 }], target: i0.ɵɵFactoryTarget.Directive }); }\n static { this.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"18.2.0\", type: NgStyle, isStandalone: true, selector: \"[ngStyle]\", inputs: { ngStyle: \"ngStyle\" }, ngImport: i0 }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0\", ngImport: i0, type: NgStyle, decorators: [{\n type: Directive,\n args: [{\n selector: '[ngStyle]',\n standalone: true,\n }]\n }], ctorParameters: () => [{ type: i0.ElementRef }, { type: i0.KeyValueDiffers }, { type: i0.Renderer2 }], propDecorators: { ngStyle: [{\n type: Input,\n args: ['ngStyle']\n }] } });\n\n/**\n * @ngModule CommonModule\n *\n * @description\n *\n * Inserts an embedded view from a prepared `TemplateRef`.\n *\n * You can attach a context object to the `EmbeddedViewRef` by setting `[ngTemplateOutletContext]`.\n * `[ngTemplateOutletContext]` should be an object, the object's keys will be available for binding\n * by the local template `let` declarations.\n *\n * @usageNotes\n * ```\n * \n *
Today is {{today | date}}
\n *
Or if you prefer, {{today | date:'fullDate'}}
\n *
The time is {{today | date:'h:mm a z'}}
\n *
{minIntegerDigits}.{minFractionDigits}-{maxFractionDigits}.\n * - `minIntegerDigits`: The minimum number of integer digits before the decimal point.\n * Default is `1`.\n * - `minFractionDigits`: The minimum number of digits after the decimal point.\n * Default is `0`.\n * - `maxFractionDigits`: The maximum number of digits after the decimal point.\n * Default is `0`.\n * @param locale A locale code for the locale format rules to use.\n * When not supplied, uses the value of `LOCALE_ID`, which is `en-US` by default.\n * See [Setting your app locale](guide/i18n/locale-id).\n */\n transform(value, digitsInfo, locale) {\n if (!isValue(value))\n return null;\n locale ||= this._locale;\n try {\n const num = strToNumber(value);\n return formatPercent(num, locale, digitsInfo);\n }\n catch (error) {\n throw invalidPipeArgumentError(PercentPipe, error.message);\n }\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0\", ngImport: i0, type: PercentPipe, deps: [{ token: LOCALE_ID }], target: i0.ɵɵFactoryTarget.Pipe }); }\n static { this.ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"14.0.0\", version: \"18.2.0\", ngImport: i0, type: PercentPipe, isStandalone: true, name: \"percent\" }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0\", ngImport: i0, type: PercentPipe, decorators: [{\n type: Pipe,\n args: [{\n name: 'percent',\n standalone: true,\n }]\n }], ctorParameters: () => [{ type: undefined, decorators: [{\n type: Inject,\n args: [LOCALE_ID]\n }] }] });\n/**\n * @ngModule CommonModule\n * @description\n *\n * Transforms a number to a currency string, formatted according to locale rules\n * that determine group sizing and separator, decimal-point character,\n * and other locale-specific configurations.\n *\n *\n * @see {@link getCurrencySymbol}\n * @see {@link formatCurrency}\n *\n * @usageNotes\n * The following code shows how the pipe transforms numbers\n * into text strings, according to various format specifications,\n * where the caller's default locale is `en-US`.\n *\n * {minIntegerDigits}.{minFractionDigits}-{maxFractionDigits}.\n * - `minIntegerDigits`: The minimum number of integer digits before the decimal point.\n * Default is `1`.\n * - `minFractionDigits`: The minimum number of digits after the decimal point.\n * Default is `2`.\n * - `maxFractionDigits`: The maximum number of digits after the decimal point.\n * Default is `2`.\n * If not provided, the number will be formatted with the proper amount of digits,\n * depending on what the [ISO 4217](https://en.wikipedia.org/wiki/ISO_4217) specifies.\n * For example, the Canadian dollar has 2 digits, whereas the Chilean peso has none.\n * @param locale A locale code for the locale format rules to use.\n * When not supplied, uses the value of `LOCALE_ID`, which is `en-US` by default.\n * See [Setting your app locale](guide/i18n/locale-id).\n */\n transform(value, currencyCode = this._defaultCurrencyCode, display = 'symbol', digitsInfo, locale) {\n if (!isValue(value))\n return null;\n locale ||= this._locale;\n if (typeof display === 'boolean') {\n if ((typeof ngDevMode === 'undefined' || ngDevMode) && console && console.warn) {\n console.warn(`Warning: the currency pipe has been changed in Angular v5. The symbolDisplay option (third parameter) is now a string instead of a boolean. The accepted values are \"code\", \"symbol\" or \"symbol-narrow\".`);\n }\n display = display ? 'symbol' : 'code';\n }\n let currency = currencyCode || this._defaultCurrencyCode;\n if (display !== 'code') {\n if (display === 'symbol' || display === 'symbol-narrow') {\n currency = getCurrencySymbol(currency, display === 'symbol' ? 'wide' : 'narrow', locale);\n }\n else {\n currency = display;\n }\n }\n try {\n const num = strToNumber(value);\n return formatCurrency(num, locale, currency, currencyCode, digitsInfo);\n }\n catch (error) {\n throw invalidPipeArgumentError(CurrencyPipe, error.message);\n }\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0\", ngImport: i0, type: CurrencyPipe, deps: [{ token: LOCALE_ID }, { token: DEFAULT_CURRENCY_CODE }], target: i0.ɵɵFactoryTarget.Pipe }); }\n static { this.ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"14.0.0\", version: \"18.2.0\", ngImport: i0, type: CurrencyPipe, isStandalone: true, name: \"currency\" }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0\", ngImport: i0, type: CurrencyPipe, decorators: [{\n type: Pipe,\n args: [{\n name: 'currency',\n standalone: true,\n }]\n }], ctorParameters: () => [{ type: undefined, decorators: [{\n type: Inject,\n args: [LOCALE_ID]\n }] }, { type: undefined, decorators: [{\n type: Inject,\n args: [DEFAULT_CURRENCY_CODE]\n }] }] });\nfunction isValue(value) {\n return !(value == null || value === '' || value !== value);\n}\n/**\n * Transforms a string into a number (if needed).\n */\nfunction strToNumber(value) {\n // Convert strings to numbers\n if (typeof value === 'string' && !isNaN(Number(value) - parseFloat(value))) {\n return Number(value);\n }\n if (typeof value !== 'number') {\n throw new Error(`${value} is not a number`);\n }\n return value;\n}\n\n/**\n * @ngModule CommonModule\n * @description\n *\n * Creates a new `Array` or `String` containing a subset (slice) of the elements.\n *\n * @usageNotes\n *\n * All behavior is based on the expected behavior of the JavaScript API `Array.prototype.slice()`\n * and `String.prototype.slice()`.\n *\n * When operating on an `Array`, the returned `Array` is always a copy even when all\n * the elements are being returned.\n *\n * When operating on a blank value, the pipe returns the blank value.\n *\n * ### List Example\n *\n * This `ngFor` example:\n *\n * {@example common/pipes/ts/slice_pipe.ts region='SlicePipe_list'}\n *\n * produces the following:\n *\n * ```html\n * b \n * c \n * ```\n *\n * ### String Examples\n *\n * {@example common/pipes/ts/slice_pipe.ts region='SlicePipe_string'}\n *\n * @publicApi\n */\nclass SlicePipe {\n transform(value, start, end) {\n if (value == null)\n return null;\n if (!this.supports(value)) {\n throw invalidPipeArgumentError(SlicePipe, value);\n }\n return value.slice(start, end);\n }\n supports(obj) {\n return typeof obj === 'string' || Array.isArray(obj);\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0\", ngImport: i0, type: SlicePipe, deps: [], target: i0.ɵɵFactoryTarget.Pipe }); }\n static { this.ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"14.0.0\", version: \"18.2.0\", ngImport: i0, type: SlicePipe, isStandalone: true, name: \"slice\", pure: false }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0\", ngImport: i0, type: SlicePipe, decorators: [{\n type: Pipe,\n args: [{\n name: 'slice',\n pure: false,\n standalone: true,\n }]\n }] });\n\n/**\n * @module\n * @description\n * This module provides a set of common Pipes.\n */\n/**\n * A collection of Angular pipes that are likely to be used in each and every application.\n */\nconst COMMON_PIPES = [\n AsyncPipe,\n UpperCasePipe,\n LowerCasePipe,\n JsonPipe,\n SlicePipe,\n DecimalPipe,\n PercentPipe,\n TitleCasePipe,\n CurrencyPipe,\n DatePipe,\n I18nPluralPipe,\n I18nSelectPipe,\n KeyValuePipe,\n];\n\n// Note: This does not contain the location providers,\n// as they need some platform specific implementations to work.\n/**\n * Exports all the basic Angular directives and pipes,\n * such as `NgIf`, `NgForOf`, `DecimalPipe`, and so on.\n * Re-exported by `BrowserModule`, which is included automatically in the root\n * `AppModule` when you create a new app with the CLI `new` command.\n *\n * @publicApi\n */\nclass CommonModule {\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0\", ngImport: i0, type: CommonModule, deps: [], target: i0.ɵɵFactoryTarget.NgModule }); }\n static { this.ɵmod = i0.ɵɵngDeclareNgModule({ minVersion: \"14.0.0\", version: \"18.2.0\", ngImport: i0, type: CommonModule, imports: [NgClass, NgComponentOutlet, NgForOf, NgIf, NgTemplateOutlet, NgStyle, NgSwitch, NgSwitchCase, NgSwitchDefault, NgPlural, NgPluralCase, AsyncPipe, UpperCasePipe, LowerCasePipe, JsonPipe, SlicePipe, DecimalPipe, PercentPipe, TitleCasePipe, CurrencyPipe, DatePipe, I18nPluralPipe, I18nSelectPipe, KeyValuePipe], exports: [NgClass, NgComponentOutlet, NgForOf, NgIf, NgTemplateOutlet, NgStyle, NgSwitch, NgSwitchCase, NgSwitchDefault, NgPlural, NgPluralCase, AsyncPipe, UpperCasePipe, LowerCasePipe, JsonPipe, SlicePipe, DecimalPipe, PercentPipe, TitleCasePipe, CurrencyPipe, DatePipe, I18nPluralPipe, I18nSelectPipe, KeyValuePipe] }); }\n static { this.ɵinj = i0.ɵɵngDeclareInjector({ minVersion: \"12.0.0\", version: \"18.2.0\", ngImport: i0, type: CommonModule }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0\", ngImport: i0, type: CommonModule, decorators: [{\n type: NgModule,\n args: [{\n imports: [COMMON_DIRECTIVES, COMMON_PIPES],\n exports: [COMMON_DIRECTIVES, COMMON_PIPES],\n }]\n }] });\n\nconst PLATFORM_BROWSER_ID = 'browser';\nconst PLATFORM_SERVER_ID = 'server';\n/**\n * Returns whether a platform id represents a browser platform.\n * @publicApi\n */\nfunction isPlatformBrowser(platformId) {\n return platformId === PLATFORM_BROWSER_ID;\n}\n/**\n * Returns whether a platform id represents a server platform.\n * @publicApi\n */\nfunction isPlatformServer(platformId) {\n return platformId === PLATFORM_SERVER_ID;\n}\n\n/**\n * @module\n * @description\n * Entry point for all public APIs of the common package.\n */\n/**\n * @publicApi\n */\nconst VERSION = new Version('18.2.0');\n\n/**\n * Defines a scroll position manager. Implemented by `BrowserViewportScroller`.\n *\n * @publicApi\n */\nclass ViewportScroller {\n // De-sugared tree-shakable injection\n // See #23917\n /** @nocollapse */\n static { this.ɵprov = ɵɵdefineInjectable({\n token: ViewportScroller,\n providedIn: 'root',\n factory: () => isPlatformBrowser(inject(PLATFORM_ID))\n ? new BrowserViewportScroller(inject(DOCUMENT), window)\n : new NullViewportScroller(),\n }); }\n}\n/**\n * Manages the scroll position for a browser window.\n */\nclass BrowserViewportScroller {\n constructor(document, window) {\n this.document = document;\n this.window = window;\n this.offset = () => [0, 0];\n }\n /**\n * Configures the top offset used when scrolling to an anchor.\n * @param offset A position in screen coordinates (a tuple with x and y values)\n * or a function that returns the top offset position.\n *\n */\n setOffset(offset) {\n if (Array.isArray(offset)) {\n this.offset = () => offset;\n }\n else {\n this.offset = offset;\n }\n }\n /**\n * Retrieves the current scroll position.\n * @returns The position in screen coordinates.\n */\n getScrollPosition() {\n return [this.window.scrollX, this.window.scrollY];\n }\n /**\n * Sets the scroll position.\n * @param position The new position in screen coordinates.\n */\n scrollToPosition(position) {\n this.window.scrollTo(position[0], position[1]);\n }\n /**\n * Scrolls to an element and attempts to focus the element.\n *\n * Note that the function name here is misleading in that the target string may be an ID for a\n * non-anchor element.\n *\n * @param target The ID of an element or name of the anchor.\n *\n * @see https://html.spec.whatwg.org/#the-indicated-part-of-the-document\n * @see https://html.spec.whatwg.org/#scroll-to-fragid\n */\n scrollToAnchor(target) {\n const elSelected = findAnchorFromDocument(this.document, target);\n if (elSelected) {\n this.scrollToElement(elSelected);\n // After scrolling to the element, the spec dictates that we follow the focus steps for the\n // target. Rather than following the robust steps, simply attempt focus.\n //\n // @see https://html.spec.whatwg.org/#get-the-focusable-area\n // @see https://developer.mozilla.org/en-US/docs/Web/API/HTMLOrForeignElement/focus\n // @see https://html.spec.whatwg.org/#focusable-area\n elSelected.focus();\n }\n }\n /**\n * Disables automatic scroll restoration provided by the browser.\n */\n setHistoryScrollRestoration(scrollRestoration) {\n this.window.history.scrollRestoration = scrollRestoration;\n }\n /**\n * Scrolls to an element using the native offset and the specified offset set on this scroller.\n *\n * The offset can be used when we know that there is a floating header and scrolling naively to an\n * element (ex: `scrollIntoView`) leaves the element hidden behind the floating header.\n */\n scrollToElement(el) {\n const rect = el.getBoundingClientRect();\n const left = rect.left + this.window.pageXOffset;\n const top = rect.top + this.window.pageYOffset;\n const offset = this.offset();\n this.window.scrollTo(left - offset[0], top - offset[1]);\n }\n}\nfunction findAnchorFromDocument(document, target) {\n const documentResult = document.getElementById(target) || document.getElementsByName(target)[0];\n if (documentResult) {\n return documentResult;\n }\n // `getElementById` and `getElementsByName` won't pierce through the shadow DOM so we\n // have to traverse the DOM manually and do the lookup through the shadow roots.\n if (typeof document.createTreeWalker === 'function' &&\n document.body &&\n typeof document.body.attachShadow === 'function') {\n const treeWalker = document.createTreeWalker(document.body, NodeFilter.SHOW_ELEMENT);\n let currentNode = treeWalker.currentNode;\n while (currentNode) {\n const shadowRoot = currentNode.shadowRoot;\n if (shadowRoot) {\n // Note that `ShadowRoot` doesn't support `getElementsByName`\n // so we have to fall back to `querySelector`.\n const result = shadowRoot.getElementById(target) || shadowRoot.querySelector(`[name=\"${target}\"]`);\n if (result) {\n return result;\n }\n }\n currentNode = treeWalker.nextNode();\n }\n }\n return null;\n}\n/**\n * Provides an empty implementation of the viewport scroller.\n */\nclass NullViewportScroller {\n /**\n * Empty implementation\n */\n setOffset(offset) { }\n /**\n * Empty implementation\n */\n getScrollPosition() {\n return [0, 0];\n }\n /**\n * Empty implementation\n */\n scrollToPosition(position) { }\n /**\n * Empty implementation\n */\n scrollToAnchor(anchor) { }\n /**\n * Empty implementation\n */\n setHistoryScrollRestoration(scrollRestoration) { }\n}\n\n/**\n * A wrapper around the `XMLHttpRequest` constructor.\n *\n * @publicApi\n */\nclass XhrFactory {\n}\n\n/**\n * Value (out of 100) of the requested quality for placeholder images.\n */\nconst PLACEHOLDER_QUALITY = '20';\n\n// Converts a string that represents a URL into a URL class instance.\nfunction getUrl(src, win) {\n // Don't use a base URL is the URL is absolute.\n return isAbsoluteUrl(src) ? new URL(src) : new URL(src, win.location.href);\n}\n// Checks whether a URL is absolute (i.e. starts with `http://` or `https://`).\nfunction isAbsoluteUrl(src) {\n return /^https?:\\/\\//.test(src);\n}\n// Given a URL, extract the hostname part.\n// If a URL is a relative one - the URL is returned as is.\nfunction extractHostname(url) {\n return isAbsoluteUrl(url) ? new URL(url).hostname : url;\n}\nfunction isValidPath(path) {\n const isString = typeof path === 'string';\n if (!isString || path.trim() === '') {\n return false;\n }\n // Calling new URL() will throw if the path string is malformed\n try {\n const url = new URL(path);\n return true;\n }\n catch {\n return false;\n }\n}\nfunction normalizePath(path) {\n return path.endsWith('/') ? path.slice(0, -1) : path;\n}\nfunction normalizeSrc(src) {\n return src.startsWith('/') ? src.slice(1) : src;\n}\n\n/**\n * Noop image loader that does no transformation to the original src and just returns it as is.\n * This loader is used as a default one if more specific logic is not provided in an app config.\n *\n * @see {@link ImageLoader}\n * @see {@link NgOptimizedImage}\n */\nconst noopImageLoader = (config) => config.src;\n/**\n * Injection token that configures the image loader function.\n *\n * @see {@link ImageLoader}\n * @see {@link NgOptimizedImage}\n * @publicApi\n */\nconst IMAGE_LOADER = new InjectionToken(ngDevMode ? 'ImageLoader' : '', {\n providedIn: 'root',\n factory: () => noopImageLoader,\n});\n/**\n * Internal helper function that makes it easier to introduce custom image loaders for the\n * `NgOptimizedImage` directive. It is enough to specify a URL builder function to obtain full DI\n * configuration for a given loader: a DI token corresponding to the actual loader function, plus DI\n * tokens managing preconnect check functionality.\n * @param buildUrlFn a function returning a full URL based on loader's configuration\n * @param exampleUrls example of full URLs for a given loader (used in error messages)\n * @returns a set of DI providers corresponding to the configured image loader\n */\nfunction createImageLoader(buildUrlFn, exampleUrls) {\n return function provideImageLoader(path) {\n if (!isValidPath(path)) {\n throwInvalidPathError(path, exampleUrls || []);\n }\n // The trailing / is stripped (if provided) to make URL construction (concatenation) easier in\n // the individual loader functions.\n path = normalizePath(path);\n const loaderFn = (config) => {\n if (isAbsoluteUrl(config.src)) {\n // Image loader functions expect an image file name (e.g. `my-image.png`)\n // or a relative path + a file name (e.g. `/a/b/c/my-image.png`) as an input,\n // so the final absolute URL can be constructed.\n // When an absolute URL is provided instead - the loader can not\n // build a final URL, thus the error is thrown to indicate that.\n throwUnexpectedAbsoluteUrlError(path, config.src);\n }\n return buildUrlFn(path, { ...config, src: normalizeSrc(config.src) });\n };\n const providers = [{ provide: IMAGE_LOADER, useValue: loaderFn }];\n return providers;\n };\n}\nfunction throwInvalidPathError(path, exampleUrls) {\n throw new ɵRuntimeError(2959 /* RuntimeErrorCode.INVALID_LOADER_ARGUMENTS */, ngDevMode &&\n `Image loader has detected an invalid path (\\`${path}\\`). ` +\n `To fix this, supply a path using one of the following formats: ${exampleUrls.join(' or ')}`);\n}\nfunction throwUnexpectedAbsoluteUrlError(path, url) {\n throw new ɵRuntimeError(2959 /* RuntimeErrorCode.INVALID_LOADER_ARGUMENTS */, ngDevMode &&\n `Image loader has detected a \\`/cdn-cgi/image//'] : undefined);\nfunction createCloudflareUrl(path, config) {\n let params = `format=auto`;\n if (config.width) {\n params += `,width=${config.width}`;\n }\n // When requesting a placeholder image we ask for a low quality image to reduce the load time.\n if (config.isPlaceholder) {\n params += `,quality=${PLACEHOLDER_QUALITY}`;\n }\n // Cloudflare image URLs format:\n // https://developers.cloudflare.com/images/image-resizing/url-format/\n return `${path}/cdn-cgi/image/${params}/${config.src}`;\n}\n\n/**\n * Name and URL tester for Cloudinary.\n */\nconst cloudinaryLoaderInfo = {\n name: 'Cloudinary',\n testUrl: isCloudinaryUrl,\n};\nconst CLOUDINARY_LOADER_REGEX = /https?\\:\\/\\/[^\\/]+\\.cloudinary\\.com\\/.+/;\n/**\n * Tests whether a URL is from Cloudinary CDN.\n */\nfunction isCloudinaryUrl(url) {\n return CLOUDINARY_LOADER_REGEX.test(url);\n}\n/**\n * Function that generates an ImageLoader for Cloudinary and turns it into an Angular provider.\n *\n * @param path Base URL of your Cloudinary images\n * This URL should match one of the following formats:\n * https://res.cloudinary.com/mysite\n * https://mysite.cloudinary.com\n * https://subdomain.mysite.com\n * @returns Set of providers to configure the Cloudinary loader.\n *\n * @publicApi\n */\nconst provideCloudinaryLoader = createImageLoader(createCloudinaryUrl, ngDevMode\n ? [\n 'https://res.cloudinary.com/mysite',\n 'https://mysite.cloudinary.com',\n 'https://subdomain.mysite.com',\n ]\n : undefined);\nfunction createCloudinaryUrl(path, config) {\n // Cloudinary image URLformat:\n // https://cloudinary.com/documentation/image_transformations#transformation_url_structure\n // Example of a Cloudinary image URL:\n // https://res.cloudinary.com/mysite/image/upload/c_scale,f_auto,q_auto,w_600/marketing/tile-topics-m.png\n // For a placeholder image, we use the lowest image setting available to reduce the load time\n // else we use the auto size\n const quality = config.isPlaceholder ? 'q_auto:low' : 'q_auto';\n let params = `f_auto,${quality}`;\n if (config.width) {\n params += `,w_${config.width}`;\n }\n return `${path}/image/upload/${params}/${config.src}`;\n}\n\n/**\n * Name and URL tester for ImageKit.\n */\nconst imageKitLoaderInfo = {\n name: 'ImageKit',\n testUrl: isImageKitUrl,\n};\nconst IMAGE_KIT_LOADER_REGEX = /https?\\:\\/\\/[^\\/]+\\.imagekit\\.io\\/.+/;\n/**\n * Tests whether a URL is from ImageKit CDN.\n */\nfunction isImageKitUrl(url) {\n return IMAGE_KIT_LOADER_REGEX.test(url);\n}\n/**\n * Function that generates an ImageLoader for ImageKit and turns it into an Angular provider.\n *\n * @param path Base URL of your ImageKit images\n * This URL should match one of the following formats:\n * https://ik.imagekit.io/myaccount\n * https://subdomain.mysite.com\n * @returns Set of providers to configure the ImageKit loader.\n *\n * @publicApi\n */\nconst provideImageKitLoader = createImageLoader(createImagekitUrl, ngDevMode ? ['https://ik.imagekit.io/mysite', 'https://subdomain.mysite.com'] : undefined);\nfunction createImagekitUrl(path, config) {\n // Example of an ImageKit image URL:\n // https://ik.imagekit.io/demo/tr:w-300,h-300/medium_cafe_B1iTdD0C.jpg\n const { src, width } = config;\n const params = [];\n if (width) {\n params.push(`w-${width}`);\n }\n // When requesting a placeholder image we ask for a low quality image to reduce the load time.\n if (config.isPlaceholder) {\n params.push(`q-${PLACEHOLDER_QUALITY}`);\n }\n const urlSegments = params.length ? [path, `tr:${params.join(',')}`, src] : [path, src];\n const url = new URL(urlSegments.join('/'));\n return url.href;\n}\n\n/**\n * Name and URL tester for Imgix.\n */\nconst imgixLoaderInfo = {\n name: 'Imgix',\n testUrl: isImgixUrl,\n};\nconst IMGIX_LOADER_REGEX = /https?\\:\\/\\/[^\\/]+\\.imgix\\.net\\/.+/;\n/**\n * Tests whether a URL is from Imgix CDN.\n */\nfunction isImgixUrl(url) {\n return IMGIX_LOADER_REGEX.test(url);\n}\n/**\n * Function that generates an ImageLoader for Imgix and turns it into an Angular provider.\n *\n * @param path path to the desired Imgix origin,\n * e.g. https://somepath.imgix.net or https://images.mysite.com\n * @returns Set of providers to configure the Imgix loader.\n *\n * @publicApi\n */\nconst provideImgixLoader = createImageLoader(createImgixUrl, ngDevMode ? ['https://somepath.imgix.net/'] : undefined);\nfunction createImgixUrl(path, config) {\n const url = new URL(`${path}/${config.src}`);\n // This setting ensures the smallest allowable format is set.\n url.searchParams.set('auto', 'format');\n if (config.width) {\n url.searchParams.set('w', config.width.toString());\n }\n // When requesting a placeholder image we ask a low quality image to reduce the load time.\n if (config.isPlaceholder) {\n url.searchParams.set('q', PLACEHOLDER_QUALITY);\n }\n return url.href;\n}\n\n/**\n * Name and URL tester for Netlify.\n */\nconst netlifyLoaderInfo = {\n name: 'Netlify',\n testUrl: isNetlifyUrl,\n};\nconst NETLIFY_LOADER_REGEX = /https?\\:\\/\\/[^\\/]+\\.netlify\\.app\\/.+/;\n/**\n * Tests whether a URL is from a Netlify site. This won't catch sites with a custom domain,\n * but it's a good start for sites in development. This is only used to warn users who haven't\n * configured an image loader.\n */\nfunction isNetlifyUrl(url) {\n return NETLIFY_LOADER_REGEX.test(url);\n}\n/**\n * Function that generates an ImageLoader for Netlify and turns it into an Angular provider.\n *\n * @param path optional URL of the desired Netlify site. Defaults to the current site.\n * @returns Set of providers to configure the Netlify loader.\n *\n * @publicApi\n */\nfunction provideNetlifyLoader(path) {\n if (path && !isValidPath(path)) {\n throw new ɵRuntimeError(2959 /* RuntimeErrorCode.INVALID_LOADER_ARGUMENTS */, ngDevMode &&\n `Image loader has detected an invalid path (\\`${path}\\`). ` +\n `To fix this, supply either the full URL to the Netlify site, or leave it empty to use the current site.`);\n }\n if (path) {\n const url = new URL(path);\n path = url.origin;\n }\n const loaderFn = (config) => {\n return createNetlifyUrl(config, path);\n };\n const providers = [{ provide: IMAGE_LOADER, useValue: loaderFn }];\n return providers;\n}\nconst validParams = new Map([\n ['height', 'h'],\n ['fit', 'fit'],\n ['quality', 'q'],\n ['q', 'q'],\n ['position', 'position'],\n]);\nfunction createNetlifyUrl(config, path) {\n // Note: `path` can be undefined, in which case we use a fake one to construct a `URL` instance.\n const url = new URL(path ?? 'https://a/');\n url.pathname = '/.netlify/images';\n if (!isAbsoluteUrl(config.src) && !config.src.startsWith('/')) {\n config.src = '/' + config.src;\n }\n url.searchParams.set('url', config.src);\n if (config.width) {\n url.searchParams.set('w', config.width.toString());\n }\n // When requesting a placeholder image we ask for a low quality image to reduce the load time.\n // If the quality is specified in the loader config - always use provided value.\n const configQuality = config.loaderParams?.['quality'] ?? config.loaderParams?.['q'];\n if (config.isPlaceholder && !configQuality) {\n url.searchParams.set('q', PLACEHOLDER_QUALITY);\n }\n for (const [param, value] of Object.entries(config.loaderParams ?? {})) {\n if (validParams.has(param)) {\n url.searchParams.set(validParams.get(param), value.toString());\n }\n else {\n if (ngDevMode) {\n console.warn(ɵformatRuntimeError(2959 /* RuntimeErrorCode.INVALID_LOADER_ARGUMENTS */, `The Netlify image loader has detected an \\`(() => false);\n *\n * export class CacheInterceptor implements HttpInterceptor {\n *\n * intercept(req: HttpRequest, delegate: HttpHandler): Observable> {\n * if (req.context.get(IS_CACHE_ENABLED) === true) {\n * return ...;\n * }\n * return delegate.handle(req);\n * }\n * }\n *\n * // inside a service\n *\n * this.httpClient.get('/api/weather', {\n * context: new HttpContext().set(IS_CACHE_ENABLED, true)\n * }).subscribe(...);\n * ```\n *\n * @publicApi\n */\nclass HttpContext {\n constructor() {\n this.map = new Map();\n }\n /**\n * Store a value in the context. If a value is already present it will be overwritten.\n *\n * @param token The reference to an instance of `HttpContextToken`.\n * @param value The value to store.\n *\n * @returns A reference to itself for easy chaining.\n */\n set(token, value) {\n this.map.set(token, value);\n return this;\n }\n /**\n * Retrieve the value associated with the given token.\n *\n * @param token The reference to an instance of `HttpContextToken`.\n *\n * @returns The stored value or default if one is defined.\n */\n get(token) {\n if (!this.map.has(token)) {\n this.map.set(token, token.defaultValue());\n }\n return this.map.get(token);\n }\n /**\n * Delete the value associated with the given token.\n *\n * @param token The reference to an instance of `HttpContextToken`.\n *\n * @returns A reference to itself for easy chaining.\n */\n delete(token) {\n this.map.delete(token);\n return this;\n }\n /**\n * Checks for existence of a given token.\n *\n * @param token The reference to an instance of `HttpContextToken`.\n *\n * @returns True if the token exists, false otherwise.\n */\n has(token) {\n return this.map.has(token);\n }\n /**\n * @returns a list of tokens currently stored in the context.\n */\n keys() {\n return this.map.keys();\n }\n}\n\n/**\n * Determine whether the given HTTP method may include a body.\n */\nfunction mightHaveBody(method) {\n switch (method) {\n case 'DELETE':\n case 'GET':\n case 'HEAD':\n case 'OPTIONS':\n case 'JSONP':\n return false;\n default:\n return true;\n }\n}\n/**\n * Safely assert whether the given value is an ArrayBuffer.\n *\n * In some execution environments ArrayBuffer is not defined.\n */\nfunction isArrayBuffer(value) {\n return typeof ArrayBuffer !== 'undefined' && value instanceof ArrayBuffer;\n}\n/**\n * Safely assert whether the given value is a Blob.\n *\n * In some execution environments Blob is not defined.\n */\nfunction isBlob(value) {\n return typeof Blob !== 'undefined' && value instanceof Blob;\n}\n/**\n * Safely assert whether the given value is a FormData instance.\n *\n * In some execution environments FormData is not defined.\n */\nfunction isFormData(value) {\n return typeof FormData !== 'undefined' && value instanceof FormData;\n}\n/**\n * Safely assert whether the given value is a URLSearchParams instance.\n *\n * In some execution environments URLSearchParams is not defined.\n */\nfunction isUrlSearchParams(value) {\n return typeof URLSearchParams !== 'undefined' && value instanceof URLSearchParams;\n}\n/**\n * An outgoing HTTP request with an optional typed body.\n *\n * `HttpRequest` represents an outgoing request, including URL, method,\n * headers, body, and other request configuration options. Instances should be\n * assumed to be immutable. To modify a `HttpRequest`, the `clone`\n * method should be used.\n *\n * @publicApi\n */\nclass HttpRequest {\n constructor(method, url, third, fourth) {\n this.url = url;\n /**\n * The request body, or `null` if one isn't set.\n *\n * Bodies are not enforced to be immutable, as they can include a reference to any\n * user-defined data type. However, interceptors should take care to preserve\n * idempotence by treating them as such.\n */\n this.body = null;\n /**\n * Whether this request should be made in a way that exposes progress events.\n *\n * Progress events are expensive (change detection runs on each event) and so\n * they should only be requested if the consumer intends to monitor them.\n *\n * Note: The `FetchBackend` doesn't support progress report on uploads.\n */\n this.reportProgress = false;\n /**\n * Whether this request should be sent with outgoing credentials (cookies).\n */\n this.withCredentials = false;\n /**\n * The expected response type of the server.\n *\n * This is used to parse the response appropriately before returning it to\n * the requestee.\n */\n this.responseType = 'json';\n this.method = method.toUpperCase();\n // Next, need to figure out which argument holds the HttpRequestInit\n // options, if any.\n let options;\n // Check whether a body argument is expected. The only valid way to omit\n // the body argument is to use a known no-body method like GET.\n if (mightHaveBody(this.method) || !!fourth) {\n // Body is the third argument, options are the fourth.\n this.body = third !== undefined ? third : null;\n options = fourth;\n }\n else {\n // No body required, options are the third argument. The body stays null.\n options = third;\n }\n // If options have been passed, interpret them.\n if (options) {\n // Normalize reportProgress and withCredentials.\n this.reportProgress = !!options.reportProgress;\n this.withCredentials = !!options.withCredentials;\n // Override default response type of 'json' if one is provided.\n if (!!options.responseType) {\n this.responseType = options.responseType;\n }\n // Override headers if they're provided.\n if (!!options.headers) {\n this.headers = options.headers;\n }\n if (!!options.context) {\n this.context = options.context;\n }\n if (!!options.params) {\n this.params = options.params;\n }\n // We do want to assign transferCache even if it's falsy (false is valid value)\n this.transferCache = options.transferCache;\n }\n // If no headers have been passed in, construct a new HttpHeaders instance.\n this.headers ??= new HttpHeaders();\n // If no context have been passed in, construct a new HttpContext instance.\n this.context ??= new HttpContext();\n // If no parameters have been passed in, construct a new HttpUrlEncodedParams instance.\n if (!this.params) {\n this.params = new HttpParams();\n this.urlWithParams = url;\n }\n else {\n // Encode the parameters to a string in preparation for inclusion in the URL.\n const params = this.params.toString();\n if (params.length === 0) {\n // No parameters, the visible URL is just the URL given at creation time.\n this.urlWithParams = url;\n }\n else {\n // Does the URL already have query parameters? Look for '?'.\n const qIdx = url.indexOf('?');\n // There are 3 cases to handle:\n // 1) No existing parameters -> append '?' followed by params.\n // 2) '?' exists and is followed by existing query string ->\n // append '&' followed by params.\n // 3) '?' exists at the end of the url -> append params directly.\n // This basically amounts to determining the character, if any, with\n // which to join the URL and parameters.\n const sep = qIdx === -1 ? '?' : qIdx < url.length - 1 ? '&' : '';\n this.urlWithParams = url + sep + params;\n }\n }\n }\n /**\n * Transform the free-form body into a serialized format suitable for\n * transmission to the server.\n */\n serializeBody() {\n // If no body is present, no need to serialize it.\n if (this.body === null) {\n return null;\n }\n // Check whether the body is already in a serialized form. If so,\n // it can just be returned directly.\n if (typeof this.body === 'string' ||\n isArrayBuffer(this.body) ||\n isBlob(this.body) ||\n isFormData(this.body) ||\n isUrlSearchParams(this.body)) {\n return this.body;\n }\n // Check whether the body is an instance of HttpUrlEncodedParams.\n if (this.body instanceof HttpParams) {\n return this.body.toString();\n }\n // Check whether the body is an object or array, and serialize with JSON if so.\n if (typeof this.body === 'object' ||\n typeof this.body === 'boolean' ||\n Array.isArray(this.body)) {\n return JSON.stringify(this.body);\n }\n // Fall back on toString() for everything else.\n return this.body.toString();\n }\n /**\n * Examine the body and attempt to infer an appropriate MIME type\n * for it.\n *\n * If no such type can be inferred, this method will return `null`.\n */\n detectContentTypeHeader() {\n // An empty body has no content type.\n if (this.body === null) {\n return null;\n }\n // FormData bodies rely on the browser's content type assignment.\n if (isFormData(this.body)) {\n return null;\n }\n // Blobs usually have their own content type. If it doesn't, then\n // no type can be inferred.\n if (isBlob(this.body)) {\n return this.body.type || null;\n }\n // Array buffers have unknown contents and thus no type can be inferred.\n if (isArrayBuffer(this.body)) {\n return null;\n }\n // Technically, strings could be a form of JSON data, but it's safe enough\n // to assume they're plain strings.\n if (typeof this.body === 'string') {\n return 'text/plain';\n }\n // `HttpUrlEncodedParams` has its own content-type.\n if (this.body instanceof HttpParams) {\n return 'application/x-www-form-urlencoded;charset=UTF-8';\n }\n // Arrays, objects, boolean and numbers will be encoded as JSON.\n if (typeof this.body === 'object' ||\n typeof this.body === 'number' ||\n typeof this.body === 'boolean') {\n return 'application/json';\n }\n // No type could be inferred.\n return null;\n }\n clone(update = {}) {\n // For method, url, and responseType, take the current value unless\n // it is overridden in the update hash.\n const method = update.method || this.method;\n const url = update.url || this.url;\n const responseType = update.responseType || this.responseType;\n // Carefully handle the transferCache to differentiate between\n // `false` and `undefined` in the update args.\n const transferCache = update.transferCache ?? this.transferCache;\n // The body is somewhat special - a `null` value in update.body means\n // whatever current body is present is being overridden with an empty\n // body, whereas an `undefined` value in update.body implies no\n // override.\n const body = update.body !== undefined ? update.body : this.body;\n // Carefully handle the boolean options to differentiate between\n // `false` and `undefined` in the update args.\n const withCredentials = update.withCredentials ?? this.withCredentials;\n const reportProgress = update.reportProgress ?? this.reportProgress;\n // Headers and params may be appended to if `setHeaders` or\n // `setParams` are used.\n let headers = update.headers || this.headers;\n let params = update.params || this.params;\n // Pass on context if needed\n const context = update.context ?? this.context;\n // Check whether the caller has asked to add headers.\n if (update.setHeaders !== undefined) {\n // Set every requested header.\n headers = Object.keys(update.setHeaders).reduce((headers, name) => headers.set(name, update.setHeaders[name]), headers);\n }\n // Check whether the caller has asked to set params.\n if (update.setParams) {\n // Set every requested param.\n params = Object.keys(update.setParams).reduce((params, param) => params.set(param, update.setParams[param]), params);\n }\n // Finally, construct the new HttpRequest using the pieces from above.\n return new HttpRequest(method, url, body, {\n params,\n headers,\n context,\n reportProgress,\n responseType,\n withCredentials,\n transferCache,\n });\n }\n}\n\n/**\n * Type enumeration for the different kinds of `HttpEvent`.\n *\n * @publicApi\n */\nvar HttpEventType;\n(function (HttpEventType) {\n /**\n * The request was sent out over the wire.\n */\n HttpEventType[HttpEventType[\"Sent\"] = 0] = \"Sent\";\n /**\n * An upload progress event was received.\n *\n * Note: The `FetchBackend` doesn't support progress report on uploads.\n */\n HttpEventType[HttpEventType[\"UploadProgress\"] = 1] = \"UploadProgress\";\n /**\n * The response status code and headers were received.\n */\n HttpEventType[HttpEventType[\"ResponseHeader\"] = 2] = \"ResponseHeader\";\n /**\n * A download progress event was received.\n */\n HttpEventType[HttpEventType[\"DownloadProgress\"] = 3] = \"DownloadProgress\";\n /**\n * The full response including the body was received.\n */\n HttpEventType[HttpEventType[\"Response\"] = 4] = \"Response\";\n /**\n * A custom event from an interceptor or a backend.\n */\n HttpEventType[HttpEventType[\"User\"] = 5] = \"User\";\n})(HttpEventType || (HttpEventType = {}));\n/**\n * Base class for both `HttpResponse` and `HttpHeaderResponse`.\n *\n * @publicApi\n */\nclass HttpResponseBase {\n /**\n * Super-constructor for all responses.\n *\n * The single parameter accepted is an initialization hash. Any properties\n * of the response passed there will override the default values.\n */\n constructor(init, defaultStatus = 200, defaultStatusText = 'OK') {\n // If the hash has values passed, use them to initialize the response.\n // Otherwise use the default values.\n this.headers = init.headers || new HttpHeaders();\n this.status = init.status !== undefined ? init.status : defaultStatus;\n this.statusText = init.statusText || defaultStatusText;\n this.url = init.url || null;\n // Cache the ok value to avoid defining a getter.\n this.ok = this.status >= 200 && this.status < 300;\n }\n}\n/**\n * A partial HTTP response which only includes the status and header data,\n * but no response body.\n *\n * `HttpHeaderResponse` is a `HttpEvent` available on the response\n * event stream, only when progress events are requested.\n *\n * @publicApi\n */\nclass HttpHeaderResponse extends HttpResponseBase {\n /**\n * Create a new `HttpHeaderResponse` with the given parameters.\n */\n constructor(init = {}) {\n super(init);\n this.type = HttpEventType.ResponseHeader;\n }\n /**\n * Copy this `HttpHeaderResponse`, overriding its contents with the\n * given parameter hash.\n */\n clone(update = {}) {\n // Perform a straightforward initialization of the new HttpHeaderResponse,\n // overriding the current parameters with new ones if given.\n return new HttpHeaderResponse({\n headers: update.headers || this.headers,\n status: update.status !== undefined ? update.status : this.status,\n statusText: update.statusText || this.statusText,\n url: update.url || this.url || undefined,\n });\n }\n}\n/**\n * A full HTTP response, including a typed response body (which may be `null`\n * if one was not returned).\n *\n * `HttpResponse` is a `HttpEvent` available on the response event\n * stream.\n *\n * @publicApi\n */\nclass HttpResponse extends HttpResponseBase {\n /**\n * Construct a new `HttpResponse`.\n */\n constructor(init = {}) {\n super(init);\n this.type = HttpEventType.Response;\n this.body = init.body !== undefined ? init.body : null;\n }\n clone(update = {}) {\n return new HttpResponse({\n body: update.body !== undefined ? update.body : this.body,\n headers: update.headers || this.headers,\n status: update.status !== undefined ? update.status : this.status,\n statusText: update.statusText || this.statusText,\n url: update.url || this.url || undefined,\n });\n }\n}\n/**\n * A response that represents an error or failure, either from a\n * non-successful HTTP status, an error while executing the request,\n * or some other failure which occurred during the parsing of the response.\n *\n * Any error returned on the `Observable` response stream will be\n * wrapped in an `HttpErrorResponse` to provide additional context about\n * the state of the HTTP layer when the error occurred. The error property\n * will contain either a wrapped Error object or the error response returned\n * from the server.\n *\n * @publicApi\n */\nclass HttpErrorResponse extends HttpResponseBase {\n constructor(init) {\n // Initialize with a default status of 0 / Unknown Error.\n super(init, 0, 'Unknown Error');\n this.name = 'HttpErrorResponse';\n /**\n * Errors are never okay, even when the status code is in the 2xx success range.\n */\n this.ok = false;\n // If the response was successful, then this was a parse error. Otherwise, it was\n // a protocol-level failure of some sort. Either the request failed in transit\n // or the server returned an unsuccessful status code.\n if (this.status >= 200 && this.status < 300) {\n this.message = `Http failure during parsing for ${init.url || '(unknown url)'}`;\n }\n else {\n this.message = `Http failure response for ${init.url || '(unknown url)'}: ${init.status} ${init.statusText}`;\n }\n this.error = init.error || null;\n }\n}\n/**\n * We use these constant to prevent pulling the whole HttpStatusCode enum\n * Those are the only ones referenced directly by the framework\n */\nconst HTTP_STATUS_CODE_OK = 200;\nconst HTTP_STATUS_CODE_NO_CONTENT = 204;\n/**\n * Http status codes.\n * As per https://www.iana.org/assignments/http-status-codes/http-status-codes.xhtml\n * @publicApi\n */\nvar HttpStatusCode;\n(function (HttpStatusCode) {\n HttpStatusCode[HttpStatusCode[\"Continue\"] = 100] = \"Continue\";\n HttpStatusCode[HttpStatusCode[\"SwitchingProtocols\"] = 101] = \"SwitchingProtocols\";\n HttpStatusCode[HttpStatusCode[\"Processing\"] = 102] = \"Processing\";\n HttpStatusCode[HttpStatusCode[\"EarlyHints\"] = 103] = \"EarlyHints\";\n HttpStatusCode[HttpStatusCode[\"Ok\"] = 200] = \"Ok\";\n HttpStatusCode[HttpStatusCode[\"Created\"] = 201] = \"Created\";\n HttpStatusCode[HttpStatusCode[\"Accepted\"] = 202] = \"Accepted\";\n HttpStatusCode[HttpStatusCode[\"NonAuthoritativeInformation\"] = 203] = \"NonAuthoritativeInformation\";\n HttpStatusCode[HttpStatusCode[\"NoContent\"] = 204] = \"NoContent\";\n HttpStatusCode[HttpStatusCode[\"ResetContent\"] = 205] = \"ResetContent\";\n HttpStatusCode[HttpStatusCode[\"PartialContent\"] = 206] = \"PartialContent\";\n HttpStatusCode[HttpStatusCode[\"MultiStatus\"] = 207] = \"MultiStatus\";\n HttpStatusCode[HttpStatusCode[\"AlreadyReported\"] = 208] = \"AlreadyReported\";\n HttpStatusCode[HttpStatusCode[\"ImUsed\"] = 226] = \"ImUsed\";\n HttpStatusCode[HttpStatusCode[\"MultipleChoices\"] = 300] = \"MultipleChoices\";\n HttpStatusCode[HttpStatusCode[\"MovedPermanently\"] = 301] = \"MovedPermanently\";\n HttpStatusCode[HttpStatusCode[\"Found\"] = 302] = \"Found\";\n HttpStatusCode[HttpStatusCode[\"SeeOther\"] = 303] = \"SeeOther\";\n HttpStatusCode[HttpStatusCode[\"NotModified\"] = 304] = \"NotModified\";\n HttpStatusCode[HttpStatusCode[\"UseProxy\"] = 305] = \"UseProxy\";\n HttpStatusCode[HttpStatusCode[\"Unused\"] = 306] = \"Unused\";\n HttpStatusCode[HttpStatusCode[\"TemporaryRedirect\"] = 307] = \"TemporaryRedirect\";\n HttpStatusCode[HttpStatusCode[\"PermanentRedirect\"] = 308] = \"PermanentRedirect\";\n HttpStatusCode[HttpStatusCode[\"BadRequest\"] = 400] = \"BadRequest\";\n HttpStatusCode[HttpStatusCode[\"Unauthorized\"] = 401] = \"Unauthorized\";\n HttpStatusCode[HttpStatusCode[\"PaymentRequired\"] = 402] = \"PaymentRequired\";\n HttpStatusCode[HttpStatusCode[\"Forbidden\"] = 403] = \"Forbidden\";\n HttpStatusCode[HttpStatusCode[\"NotFound\"] = 404] = \"NotFound\";\n HttpStatusCode[HttpStatusCode[\"MethodNotAllowed\"] = 405] = \"MethodNotAllowed\";\n HttpStatusCode[HttpStatusCode[\"NotAcceptable\"] = 406] = \"NotAcceptable\";\n HttpStatusCode[HttpStatusCode[\"ProxyAuthenticationRequired\"] = 407] = \"ProxyAuthenticationRequired\";\n HttpStatusCode[HttpStatusCode[\"RequestTimeout\"] = 408] = \"RequestTimeout\";\n HttpStatusCode[HttpStatusCode[\"Conflict\"] = 409] = \"Conflict\";\n HttpStatusCode[HttpStatusCode[\"Gone\"] = 410] = \"Gone\";\n HttpStatusCode[HttpStatusCode[\"LengthRequired\"] = 411] = \"LengthRequired\";\n HttpStatusCode[HttpStatusCode[\"PreconditionFailed\"] = 412] = \"PreconditionFailed\";\n HttpStatusCode[HttpStatusCode[\"PayloadTooLarge\"] = 413] = \"PayloadTooLarge\";\n HttpStatusCode[HttpStatusCode[\"UriTooLong\"] = 414] = \"UriTooLong\";\n HttpStatusCode[HttpStatusCode[\"UnsupportedMediaType\"] = 415] = \"UnsupportedMediaType\";\n HttpStatusCode[HttpStatusCode[\"RangeNotSatisfiable\"] = 416] = \"RangeNotSatisfiable\";\n HttpStatusCode[HttpStatusCode[\"ExpectationFailed\"] = 417] = \"ExpectationFailed\";\n HttpStatusCode[HttpStatusCode[\"ImATeapot\"] = 418] = \"ImATeapot\";\n HttpStatusCode[HttpStatusCode[\"MisdirectedRequest\"] = 421] = \"MisdirectedRequest\";\n HttpStatusCode[HttpStatusCode[\"UnprocessableEntity\"] = 422] = \"UnprocessableEntity\";\n HttpStatusCode[HttpStatusCode[\"Locked\"] = 423] = \"Locked\";\n HttpStatusCode[HttpStatusCode[\"FailedDependency\"] = 424] = \"FailedDependency\";\n HttpStatusCode[HttpStatusCode[\"TooEarly\"] = 425] = \"TooEarly\";\n HttpStatusCode[HttpStatusCode[\"UpgradeRequired\"] = 426] = \"UpgradeRequired\";\n HttpStatusCode[HttpStatusCode[\"PreconditionRequired\"] = 428] = \"PreconditionRequired\";\n HttpStatusCode[HttpStatusCode[\"TooManyRequests\"] = 429] = \"TooManyRequests\";\n HttpStatusCode[HttpStatusCode[\"RequestHeaderFieldsTooLarge\"] = 431] = \"RequestHeaderFieldsTooLarge\";\n HttpStatusCode[HttpStatusCode[\"UnavailableForLegalReasons\"] = 451] = \"UnavailableForLegalReasons\";\n HttpStatusCode[HttpStatusCode[\"InternalServerError\"] = 500] = \"InternalServerError\";\n HttpStatusCode[HttpStatusCode[\"NotImplemented\"] = 501] = \"NotImplemented\";\n HttpStatusCode[HttpStatusCode[\"BadGateway\"] = 502] = \"BadGateway\";\n HttpStatusCode[HttpStatusCode[\"ServiceUnavailable\"] = 503] = \"ServiceUnavailable\";\n HttpStatusCode[HttpStatusCode[\"GatewayTimeout\"] = 504] = \"GatewayTimeout\";\n HttpStatusCode[HttpStatusCode[\"HttpVersionNotSupported\"] = 505] = \"HttpVersionNotSupported\";\n HttpStatusCode[HttpStatusCode[\"VariantAlsoNegotiates\"] = 506] = \"VariantAlsoNegotiates\";\n HttpStatusCode[HttpStatusCode[\"InsufficientStorage\"] = 507] = \"InsufficientStorage\";\n HttpStatusCode[HttpStatusCode[\"LoopDetected\"] = 508] = \"LoopDetected\";\n HttpStatusCode[HttpStatusCode[\"NotExtended\"] = 510] = \"NotExtended\";\n HttpStatusCode[HttpStatusCode[\"NetworkAuthenticationRequired\"] = 511] = \"NetworkAuthenticationRequired\";\n})(HttpStatusCode || (HttpStatusCode = {}));\n\n/**\n * Constructs an instance of `HttpRequestOptions` from a source `HttpMethodOptions` and\n * the given `body`. This function clones the object and adds the body.\n *\n * Note that the `responseType` *options* value is a String that identifies the\n * single data type of the response.\n * A single overload version of the method handles each response type.\n * The value of `responseType` cannot be a union, as the combined signature could imply.\n *\n */\nfunction addBody(options, body) {\n return {\n body,\n headers: options.headers,\n context: options.context,\n observe: options.observe,\n params: options.params,\n reportProgress: options.reportProgress,\n responseType: options.responseType,\n withCredentials: options.withCredentials,\n transferCache: options.transferCache,\n };\n}\n/**\n * Performs HTTP requests.\n * This service is available as an injectable class, with methods to perform HTTP requests.\n * Each request method has multiple signatures, and the return type varies based on\n * the signature that is called (mainly the values of `observe` and `responseType`).\n *\n * Note that the `responseType` *options* value is a String that identifies the\n * single data type of the response.\n * A single overload version of the method handles each response type.\n * The value of `responseType` cannot be a union, as the combined signature could imply.\n\n * TODO(adev): review\n * @usageNotes\n *\n * ### HTTP Request Example\n *\n * ```\n * // GET heroes whose name contains search term\n * searchHeroes(term: string): observable{\n *\n * const params = new HttpParams({fromString: 'name=term'});\n * return this.httpClient.request('GET', this.heroesUrl, {responseType:'json', params});\n * }\n * ```\n *\n * Alternatively, the parameter string can be used without invoking HttpParams\n * by directly joining to the URL.\n * ```\n * this.httpClient.request('GET', this.heroesUrl + '?' + 'name=term', {responseType:'json'});\n * ```\n *\n *\n * ### JSONP Example\n * ```\n * requestJsonp(url, callback = 'callback') {\n * return this.httpClient.jsonp(this.heroesURL, callback);\n * }\n * ```\n *\n * ### PATCH Example\n * ```\n * // PATCH one of the heroes' name\n * patchHero (id: number, heroName: string): Observable<{}> {\n * const url = `${this.heroesUrl}/${id}`; // PATCH api/heroes/42\n * return this.httpClient.patch(url, {name: heroName}, httpOptions)\n * .pipe(catchError(this.handleError('patchHero')));\n * }\n * ```\n *\n * @see [HTTP Guide](guide/http)\n * @see [HTTP Request](api/common/http/HttpRequest)\n *\n * @publicApi\n */\nclass HttpClient {\n constructor(handler) {\n this.handler = handler;\n }\n /**\n * Constructs an observable for a generic HTTP request that, when subscribed,\n * fires the request through the chain of registered interceptors and on to the\n * server.\n *\n * You can pass an `HttpRequest` directly as the only parameter. In this case,\n * the call returns an observable of the raw `HttpEvent` stream.\n *\n * Alternatively you can pass an HTTP method as the first parameter,\n * a URL string as the second, and an options hash containing the request body as the third.\n * See `addBody()`. In this case, the specified `responseType` and `observe` options determine the\n * type of returned observable.\n * * The `responseType` value determines how a successful response body is parsed.\n * * If `responseType` is the default `json`, you can pass a type interface for the resulting\n * object as a type parameter to the call.\n *\n * The `observe` value determines the return type, according to what you are interested in\n * observing.\n * * An `observe` value of events returns an observable of the raw `HttpEvent` stream, including\n * progress events by default.\n * * An `observe` value of response returns an observable of `HttpResponse`,\n * where the `T` parameter depends on the `responseType` and any optionally provided type\n * parameter.\n * * An `observe` value of body returns an observable of `` with the same `T` body type.\n *\n */\n request(first, url, options = {}) {\n let req;\n // First, check whether the primary argument is an instance of `HttpRequest`.\n if (first instanceof HttpRequest) {\n // It is. The other arguments must be undefined (per the signatures) and can be\n // ignored.\n req = first;\n }\n else {\n // It's a string, so it represents a URL. Construct a request based on it,\n // and incorporate the remaining arguments (assuming `GET` unless a method is\n // provided.\n // Figure out the headers.\n let headers = undefined;\n if (options.headers instanceof HttpHeaders) {\n headers = options.headers;\n }\n else {\n headers = new HttpHeaders(options.headers);\n }\n // Sort out parameters.\n let params = undefined;\n if (!!options.params) {\n if (options.params instanceof HttpParams) {\n params = options.params;\n }\n else {\n params = new HttpParams({ fromObject: options.params });\n }\n }\n // Construct the request.\n req = new HttpRequest(first, url, options.body !== undefined ? options.body : null, {\n headers,\n context: options.context,\n params,\n reportProgress: options.reportProgress,\n // By default, JSON is assumed to be returned for all calls.\n responseType: options.responseType || 'json',\n withCredentials: options.withCredentials,\n transferCache: options.transferCache,\n });\n }\n // Start with an Observable.of() the initial request, and run the handler (which\n // includes all interceptors) inside a concatMap(). This way, the handler runs\n // inside an Observable chain, which causes interceptors to be re-run on every\n // subscription (this also makes retries re-run the handler, including interceptors).\n const events$ = of(req).pipe(concatMap((req) => this.handler.handle(req)));\n // If coming via the API signature which accepts a previously constructed HttpRequest,\n // the only option is to get the event stream. Otherwise, return the event stream if\n // that is what was requested.\n if (first instanceof HttpRequest || options.observe === 'events') {\n return events$;\n }\n // The requested stream contains either the full response or the body. In either\n // case, the first step is to filter the event stream to extract a stream of\n // responses(s).\n const res$ = (events$.pipe(filter((event) => event instanceof HttpResponse)));\n // Decide which stream to return.\n switch (options.observe || 'body') {\n case 'body':\n // The requested stream is the body. Map the response stream to the response\n // body. This could be done more simply, but a misbehaving interceptor might\n // transform the response body into a different format and ignore the requested\n // responseType. Guard against this by validating that the response is of the\n // requested type.\n switch (req.responseType) {\n case 'arraybuffer':\n return res$.pipe(map((res) => {\n // Validate that the body is an ArrayBuffer.\n if (res.body !== null && !(res.body instanceof ArrayBuffer)) {\n throw new Error('Response is not an ArrayBuffer.');\n }\n return res.body;\n }));\n case 'blob':\n return res$.pipe(map((res) => {\n // Validate that the body is a Blob.\n if (res.body !== null && !(res.body instanceof Blob)) {\n throw new Error('Response is not a Blob.');\n }\n return res.body;\n }));\n case 'text':\n return res$.pipe(map((res) => {\n // Validate that the body is a string.\n if (res.body !== null && typeof res.body !== 'string') {\n throw new Error('Response is not a string.');\n }\n return res.body;\n }));\n case 'json':\n default:\n // No validation needed for JSON responses, as they can be of any type.\n return res$.pipe(map((res) => res.body));\n }\n case 'response':\n // The response stream was requested directly, so return it.\n return res$;\n default:\n // Guard against new future observe types being added.\n throw new Error(`Unreachable: unhandled observe type ${options.observe}}`);\n }\n }\n /**\n * Constructs an observable that, when subscribed, causes the configured\n * `DELETE` request to execute on the server. See the individual overloads for\n * details on the return type.\n *\n * @param url The endpoint URL.\n * @param options The HTTP options to send with the request.\n *\n */\n delete(url, options = {}) {\n return this.request('DELETE', url, options);\n }\n /**\n * Constructs an observable that, when subscribed, causes the configured\n * `GET` request to execute on the server. See the individual overloads for\n * details on the return type.\n */\n get(url, options = {}) {\n return this.request('GET', url, options);\n }\n /**\n * Constructs an observable that, when subscribed, causes the configured\n * `HEAD` request to execute on the server. The `HEAD` method returns\n * meta information about the resource without transferring the\n * resource itself. See the individual overloads for\n * details on the return type.\n */\n head(url, options = {}) {\n return this.request('HEAD', url, options);\n }\n /**\n * Constructs an `Observable` that, when subscribed, causes a request with the special method\n * `JSONP` to be dispatched via the interceptor pipeline.\n * The [JSONP pattern](https://en.wikipedia.org/wiki/JSONP) works around limitations of certain\n * API endpoints that don't support newer,\n * and preferable [CORS](https://developer.mozilla.org/en-US/docs/Web/HTTP/CORS) protocol.\n * JSONP treats the endpoint API as a JavaScript file and tricks the browser to process the\n * requests even if the API endpoint is not located on the same domain (origin) as the client-side\n * application making the request.\n * The endpoint API must support JSONP callback for JSONP requests to work.\n * The resource API returns the JSON response wrapped in a callback function.\n * You can pass the callback function name as one of the query parameters.\n * Note that JSONP requests can only be used with `GET` requests.\n *\n * @param url The resource URL.\n * @param callbackParam The callback function name.\n *\n */\n jsonp(url, callbackParam) {\n return this.request('JSONP', url, {\n params: new HttpParams().append(callbackParam, 'JSONP_CALLBACK'),\n observe: 'body',\n responseType: 'json',\n });\n }\n /**\n * Constructs an `Observable` that, when subscribed, causes the configured\n * `OPTIONS` request to execute on the server. This method allows the client\n * to determine the supported HTTP methods and other capabilities of an endpoint,\n * without implying a resource action. See the individual overloads for\n * details on the return type.\n */\n options(url, options = {}) {\n return this.request('OPTIONS', url, options);\n }\n /**\n * Constructs an observable that, when subscribed, causes the configured\n * `PATCH` request to execute on the server. See the individual overloads for\n * details on the return type.\n */\n patch(url, body, options = {}) {\n return this.request('PATCH', url, addBody(options, body));\n }\n /**\n * Constructs an observable that, when subscribed, causes the configured\n * `POST` request to execute on the server. The server responds with the location of\n * the replaced resource. See the individual overloads for\n * details on the return type.\n */\n post(url, body, options = {}) {\n return this.request('POST', url, addBody(options, body));\n }\n /**\n * Constructs an observable that, when subscribed, causes the configured\n * `PUT` request to execute on the server. The `PUT` method replaces an existing resource\n * with a new set of values.\n * See the individual overloads for details on the return type.\n */\n put(url, body, options = {}) {\n return this.request('PUT', url, addBody(options, body));\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0\", ngImport: i0, type: HttpClient, deps: [{ token: HttpHandler }], target: i0.ɵɵFactoryTarget.Injectable }); }\n static { this.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"18.2.0\", ngImport: i0, type: HttpClient }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0\", ngImport: i0, type: HttpClient, decorators: [{\n type: Injectable\n }], ctorParameters: () => [{ type: HttpHandler }] });\n\nconst XSSI_PREFIX$1 = /^\\)\\]\\}',?\\n/;\nconst REQUEST_URL_HEADER = `X-Request-URL`;\n/**\n * Determine an appropriate URL for the response, by checking either\n * response url or the X-Request-URL header.\n */\nfunction getResponseUrl$1(response) {\n if (response.url) {\n return response.url;\n }\n // stored as lowercase in the map\n const xRequestUrl = REQUEST_URL_HEADER.toLocaleLowerCase();\n return response.headers.get(xRequestUrl);\n}\n/**\n * Uses `fetch` to send requests to a backend server.\n *\n * This `FetchBackend` requires the support of the\n * [Fetch API](https://developer.mozilla.org/en-US/docs/Web/API/Fetch_API) which is available on all\n * supported browsers and on Node.js v18 or later.\n *\n * @see {@link HttpHandler}\n *\n * @publicApi\n */\nclass FetchBackend {\n constructor() {\n // We need to bind the native fetch to its context or it will throw an \"illegal invocation\"\n this.fetchImpl = inject(FetchFactory, { optional: true })?.fetch ?? fetch.bind(globalThis);\n this.ngZone = inject(NgZone);\n }\n handle(request) {\n return new Observable((observer) => {\n const aborter = new AbortController();\n this.doRequest(request, aborter.signal, observer).then(noop, (error) => observer.error(new HttpErrorResponse({ error })));\n return () => aborter.abort();\n });\n }\n async doRequest(request, signal, observer) {\n const init = this.createRequestInit(request);\n let response;\n try {\n // Run fetch outside of Angular zone.\n // This is due to Node.js fetch implementation (Undici) which uses a number of setTimeouts to check if\n // the response should eventually timeout which causes extra CD cycles every 500ms\n const fetchPromise = this.ngZone.runOutsideAngular(() => this.fetchImpl(request.urlWithParams, { signal, ...init }));\n // Make sure Zone.js doesn't trigger false-positive unhandled promise\n // error in case the Promise is rejected synchronously. See function\n // description for additional information.\n silenceSuperfluousUnhandledPromiseRejection(fetchPromise);\n // Send the `Sent` event before awaiting the response.\n observer.next({ type: HttpEventType.Sent });\n response = await fetchPromise;\n }\n catch (error) {\n observer.error(new HttpErrorResponse({\n error,\n status: error.status ?? 0,\n statusText: error.statusText,\n url: request.urlWithParams,\n headers: error.headers,\n }));\n return;\n }\n const headers = new HttpHeaders(response.headers);\n const statusText = response.statusText;\n const url = getResponseUrl$1(response) ?? request.urlWithParams;\n let status = response.status;\n let body = null;\n if (request.reportProgress) {\n observer.next(new HttpHeaderResponse({ headers, status, statusText, url }));\n }\n if (response.body) {\n // Read Progress\n const contentLength = response.headers.get('content-length');\n const chunks = [];\n const reader = response.body.getReader();\n let receivedLength = 0;\n let decoder;\n let partialText;\n // We have to check whether the Zone is defined in the global scope because this may be called\n // when the zone is nooped.\n const reqZone = typeof Zone !== 'undefined' && Zone.current;\n // Perform response processing outside of Angular zone to\n // ensure no excessive change detection runs are executed\n // Here calling the async ReadableStreamDefaultReader.read() is responsible for triggering CD\n await this.ngZone.runOutsideAngular(async () => {\n while (true) {\n const { done, value } = await reader.read();\n if (done) {\n break;\n }\n chunks.push(value);\n receivedLength += value.length;\n if (request.reportProgress) {\n partialText =\n request.responseType === 'text'\n ? (partialText ?? '') +\n (decoder ??= new TextDecoder()).decode(value, { stream: true })\n : undefined;\n const reportProgress = () => observer.next({\n type: HttpEventType.DownloadProgress,\n total: contentLength ? +contentLength : undefined,\n loaded: receivedLength,\n partialText,\n });\n reqZone ? reqZone.run(reportProgress) : reportProgress();\n }\n }\n });\n // Combine all chunks.\n const chunksAll = this.concatChunks(chunks, receivedLength);\n try {\n const contentType = response.headers.get('Content-Type') ?? '';\n body = this.parseBody(request, chunksAll, contentType);\n }\n catch (error) {\n // Body loading or parsing failed\n observer.error(new HttpErrorResponse({\n error,\n headers: new HttpHeaders(response.headers),\n status: response.status,\n statusText: response.statusText,\n url: getResponseUrl$1(response) ?? request.urlWithParams,\n }));\n return;\n }\n }\n // Same behavior as the XhrBackend\n if (status === 0) {\n status = body ? HTTP_STATUS_CODE_OK : 0;\n }\n // ok determines whether the response will be transmitted on the event or\n // error channel. Unsuccessful status codes (not 2xx) will always be errors,\n // but a successful status code can still result in an error if the user\n // asked for JSON data and the body cannot be parsed as such.\n const ok = status >= 200 && status < 300;\n if (ok) {\n observer.next(new HttpResponse({\n body,\n headers,\n status,\n statusText,\n url,\n }));\n // The full body has been received and delivered, no further events\n // are possible. This request is complete.\n observer.complete();\n }\n else {\n observer.error(new HttpErrorResponse({\n error: body,\n headers,\n status,\n statusText,\n url,\n }));\n }\n }\n parseBody(request, binContent, contentType) {\n switch (request.responseType) {\n case 'json':\n // stripping the XSSI when present\n const text = new TextDecoder().decode(binContent).replace(XSSI_PREFIX$1, '');\n return text === '' ? null : JSON.parse(text);\n case 'text':\n return new TextDecoder().decode(binContent);\n case 'blob':\n return new Blob([binContent], { type: contentType });\n case 'arraybuffer':\n return binContent.buffer;\n }\n }\n createRequestInit(req) {\n // We could share some of this logic with the XhrBackend\n const headers = {};\n const credentials = req.withCredentials ? 'include' : undefined;\n // Setting all the requested headers.\n req.headers.forEach((name, values) => (headers[name] = values.join(',')));\n // Add an Accept header if one isn't present already.\n if (!req.headers.has('Accept')) {\n headers['Accept'] = 'application/json, text/plain, */*';\n }\n // Auto-detect the Content-Type header if one isn't present already.\n if (!req.headers.has('Content-Type')) {\n const detectedType = req.detectContentTypeHeader();\n // Sometimes Content-Type detection fails.\n if (detectedType !== null) {\n headers['Content-Type'] = detectedType;\n }\n }\n return {\n body: req.serializeBody(),\n method: req.method,\n headers,\n credentials,\n };\n }\n concatChunks(chunks, totalLength) {\n const chunksAll = new Uint8Array(totalLength);\n let position = 0;\n for (const chunk of chunks) {\n chunksAll.set(chunk, position);\n position += chunk.length;\n }\n return chunksAll;\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0\", ngImport: i0, type: FetchBackend, deps: [], target: i0.ɵɵFactoryTarget.Injectable }); }\n static { this.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"18.2.0\", ngImport: i0, type: FetchBackend }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0\", ngImport: i0, type: FetchBackend, decorators: [{\n type: Injectable\n }] });\n/**\n * Abstract class to provide a mocked implementation of `fetch()`\n */\nclass FetchFactory {\n}\nfunction noop() { }\n/**\n * Zone.js treats a rejected promise that has not yet been awaited\n * as an unhandled error. This function adds a noop `.then` to make\n * sure that Zone.js doesn't throw an error if the Promise is rejected\n * synchronously.\n */\nfunction silenceSuperfluousUnhandledPromiseRejection(promise) {\n promise.then(noop, noop);\n}\n\nfunction interceptorChainEndFn(req, finalHandlerFn) {\n return finalHandlerFn(req);\n}\n/**\n * Constructs a `ChainedInterceptorFn` which adapts a legacy `HttpInterceptor` to the\n * `ChainedInterceptorFn` interface.\n */\nfunction adaptLegacyInterceptorToChain(chainTailFn, interceptor) {\n return (initialRequest, finalHandlerFn) => interceptor.intercept(initialRequest, {\n handle: (downstreamRequest) => chainTailFn(downstreamRequest, finalHandlerFn),\n });\n}\n/**\n * Constructs a `ChainedInterceptorFn` which wraps and invokes a functional interceptor in the given\n * injector.\n */\nfunction chainedInterceptorFn(chainTailFn, interceptorFn, injector) {\n return (initialRequest, finalHandlerFn) => runInInjectionContext(injector, () => interceptorFn(initialRequest, (downstreamRequest) => chainTailFn(downstreamRequest, finalHandlerFn)));\n}\n/**\n * A multi-provider token that represents the array of registered\n * `HttpInterceptor` objects.\n *\n * @publicApi\n */\nconst HTTP_INTERCEPTORS = new InjectionToken(ngDevMode ? 'HTTP_INTERCEPTORS' : '');\n/**\n * A multi-provided token of `HttpInterceptorFn`s.\n */\nconst HTTP_INTERCEPTOR_FNS = new InjectionToken(ngDevMode ? 'HTTP_INTERCEPTOR_FNS' : '');\n/**\n * A multi-provided token of `HttpInterceptorFn`s that are only set in root.\n */\nconst HTTP_ROOT_INTERCEPTOR_FNS = new InjectionToken(ngDevMode ? 'HTTP_ROOT_INTERCEPTOR_FNS' : '');\n// TODO(atscott): We need a larger discussion about stability and what should contribute to stability.\n// Should the whole interceptor chain contribute to stability or just the backend request #55075?\n// Should HttpClient contribute to stability automatically at all?\nconst REQUESTS_CONTRIBUTE_TO_STABILITY = new InjectionToken(ngDevMode ? 'REQUESTS_CONTRIBUTE_TO_STABILITY' : '', { providedIn: 'root', factory: () => true });\n/**\n * Creates an `HttpInterceptorFn` which lazily initializes an interceptor chain from the legacy\n * class-based interceptors and runs the request through it.\n */\nfunction legacyInterceptorFnFactory() {\n let chain = null;\n return (req, handler) => {\n if (chain === null) {\n const interceptors = inject(HTTP_INTERCEPTORS, { optional: true }) ?? [];\n // Note: interceptors are wrapped right-to-left so that final execution order is\n // left-to-right. That is, if `interceptors` is the array `[a, b, c]`, we want to\n // produce a chain that is conceptually `c(b(a(end)))`, which we build from the inside\n // out.\n chain = interceptors.reduceRight(adaptLegacyInterceptorToChain, interceptorChainEndFn);\n }\n const pendingTasks = inject(ɵPendingTasks);\n const contributeToStability = inject(REQUESTS_CONTRIBUTE_TO_STABILITY);\n if (contributeToStability) {\n const taskId = pendingTasks.add();\n return chain(req, handler).pipe(finalize(() => pendingTasks.remove(taskId)));\n }\n else {\n return chain(req, handler);\n }\n };\n}\nlet fetchBackendWarningDisplayed = false;\n/** Internal function to reset the flag in tests */\nfunction resetFetchBackendWarningFlag() {\n fetchBackendWarningDisplayed = false;\n}\nclass HttpInterceptorHandler extends HttpHandler {\n constructor(backend, injector) {\n super();\n this.backend = backend;\n this.injector = injector;\n this.chain = null;\n this.pendingTasks = inject(ɵPendingTasks);\n this.contributeToStability = inject(REQUESTS_CONTRIBUTE_TO_STABILITY);\n // We strongly recommend using fetch backend for HTTP calls when SSR is used\n // for an application. The logic below checks if that's the case and produces\n // a warning otherwise.\n if ((typeof ngDevMode === 'undefined' || ngDevMode) && !fetchBackendWarningDisplayed) {\n const isServer = isPlatformServer(injector.get(PLATFORM_ID));\n if (isServer && !(this.backend instanceof FetchBackend)) {\n fetchBackendWarningDisplayed = true;\n injector\n .get(ɵConsole)\n .warn(ɵformatRuntimeError(2801 /* RuntimeErrorCode.NOT_USING_FETCH_BACKEND_IN_SSR */, 'Angular detected that `HttpClient` is not configured ' +\n \"to use `fetch` APIs. It's strongly recommended to \" +\n 'enable `fetch` for applications that use Server-Side Rendering ' +\n 'for better performance and compatibility. ' +\n 'To enable `fetch`, add the `withFetch()` to the `provideHttpClient()` ' +\n 'call at the root of the application.'));\n }\n }\n }\n handle(initialRequest) {\n if (this.chain === null) {\n const dedupedInterceptorFns = Array.from(new Set([\n ...this.injector.get(HTTP_INTERCEPTOR_FNS),\n ...this.injector.get(HTTP_ROOT_INTERCEPTOR_FNS, []),\n ]));\n // Note: interceptors are wrapped right-to-left so that final execution order is\n // left-to-right. That is, if `dedupedInterceptorFns` is the array `[a, b, c]`, we want to\n // produce a chain that is conceptually `c(b(a(end)))`, which we build from the inside\n // out.\n this.chain = dedupedInterceptorFns.reduceRight((nextSequencedFn, interceptorFn) => chainedInterceptorFn(nextSequencedFn, interceptorFn, this.injector), interceptorChainEndFn);\n }\n if (this.contributeToStability) {\n const taskId = this.pendingTasks.add();\n return this.chain(initialRequest, (downstreamRequest) => this.backend.handle(downstreamRequest)).pipe(finalize(() => this.pendingTasks.remove(taskId)));\n }\n else {\n return this.chain(initialRequest, (downstreamRequest) => this.backend.handle(downstreamRequest));\n }\n }\n static { this.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"18.2.0\", ngImport: i0, type: HttpInterceptorHandler, deps: [{ token: HttpBackend }, { token: i0.EnvironmentInjector }], target: i0.ɵɵFactoryTarget.Injectable }); }\n static { this.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"18.2.0\", ngImport: i0, type: HttpInterceptorHandler }); }\n}\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"18.2.0\", ngImport: i0, type: HttpInterceptorHandler, decorators: [{\n type: Injectable\n }], ctorParameters: () => [{ type: HttpBackend }, { type: i0.EnvironmentInjector }] });\n\n// Every request made through JSONP needs a callback name that's unique across the\n// whole page. Each request is assigned an id and the callback name is constructed\n// from that. The next id to be assigned is tracked in a global variable here that\n// is shared among all applications on the page.\nlet nextRequestId = 0;\n/**\n * When a pending
![\"ID-porten](\"../../../assets/images/idporten.svg\")
\n ![\"Svensk](\"../../../assets/images/logo-bank-id.svg\"){kind=logo}
\n ![\"MitID](\"../../../assets/images/mitid.svg\")
\n